2022-07-20 13:18:57 +02:00
|
|
|
|
package fr.pandacube.lib.chat;
|
2020-11-02 23:23:41 +01:00
|
|
|
|
|
|
|
|
|
import java.awt.Color;
|
2021-07-09 00:27:59 +02:00
|
|
|
|
import java.util.Objects;
|
2021-07-19 01:27:50 +02:00
|
|
|
|
import java.util.function.Consumer;
|
2021-07-09 00:27:59 +02:00
|
|
|
|
import java.util.function.UnaryOperator;
|
2020-11-02 23:23:41 +01:00
|
|
|
|
|
2021-07-09 00:27:59 +02:00
|
|
|
|
import net.kyori.adventure.key.Key;
|
|
|
|
|
import net.kyori.adventure.text.Component;
|
2021-07-19 01:27:50 +02:00
|
|
|
|
import net.kyori.adventure.text.ComponentBuilder;
|
2021-07-09 00:27:59 +02:00
|
|
|
|
import net.kyori.adventure.text.ComponentLike;
|
|
|
|
|
import net.kyori.adventure.text.TextComponent;
|
|
|
|
|
import net.kyori.adventure.text.event.ClickEvent;
|
|
|
|
|
import net.kyori.adventure.text.event.HoverEvent;
|
|
|
|
|
import net.kyori.adventure.text.event.HoverEventSource;
|
2021-07-24 19:37:04 +02:00
|
|
|
|
import net.kyori.adventure.text.format.NamedTextColor;
|
2021-07-09 00:27:59 +02:00
|
|
|
|
import net.kyori.adventure.text.format.Style;
|
|
|
|
|
import net.kyori.adventure.text.format.TextColor;
|
|
|
|
|
import net.kyori.adventure.text.format.TextDecoration;
|
|
|
|
|
import net.kyori.adventure.text.format.TextDecoration.State;
|
|
|
|
|
import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
|
|
|
|
|
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
|
2021-07-24 19:37:04 +02:00
|
|
|
|
import net.kyori.adventure.text.serializer.plain.PlainTextComponentSerializer;
|
2020-11-02 23:23:41 +01:00
|
|
|
|
import net.md_5.bungee.api.ChatColor;
|
|
|
|
|
import net.md_5.bungee.api.chat.BaseComponent;
|
2023-06-20 00:15:46 +02:00
|
|
|
|
import org.jetbrains.annotations.NotNull;
|
2020-11-02 23:23:41 +01:00
|
|
|
|
|
2022-07-30 13:58:16 +02:00
|
|
|
|
/**
|
|
|
|
|
* A builder for chat components.
|
|
|
|
|
* <p>
|
|
|
|
|
* Use one of the provided static methods to create a new instance.
|
|
|
|
|
* <p>
|
|
|
|
|
* This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Adventure API and its implementation without using the final methods of this builder.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* <p>
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the
|
|
|
|
|
* built component. The rationale for this design is explained in the documentation of {@link FormatableChat}.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
*/
|
2022-01-21 18:56:21 +01:00
|
|
|
|
public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
|
2022-07-30 13:58:16 +02:00
|
|
|
|
|
|
|
|
|
/* package */ final ComponentBuilder<?, ?> builder;
|
|
|
|
|
/* package */ boolean console = false;
|
|
|
|
|
/* package */ Integer maxWidth = null;
|
|
|
|
|
|
|
|
|
|
/* package */ Chat(ComponentBuilder<?, ?> b) {
|
|
|
|
|
builder = Objects.requireNonNull(b, "Provided component builder must not be null");
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
|
* Builder terminal operation and serialization
|
|
|
|
|
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Builds the component into Adventure Component instance.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return the {@link Component} built from this {@link Chat} component.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
*/
|
|
|
|
|
public Component getAdv() {
|
|
|
|
|
return builder.build();
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Builds the component into BungeeCord {@link BaseComponent} instance.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return the {@link BaseComponent} built from this {@link Chat} component.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
*/
|
|
|
|
|
public BaseComponent get() {
|
|
|
|
|
return toBungee(getAdv());
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Builds the component into BungeeCord {@link BaseComponent} array.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return the {@link BaseComponent} array built from this {@link Chat} component.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
*/
|
|
|
|
|
public BaseComponent[] getAsArray() {
|
|
|
|
|
return toBungeeArray(getAdv());
|
|
|
|
|
}
|
|
|
|
|
|
2023-06-20 00:15:46 +02:00
|
|
|
|
private static final LegacyComponentSerializer LEGACY_SERIALIZER_BUNGEE_FRIENDLY = LegacyComponentSerializer.builder()
|
2022-07-30 13:58:16 +02:00
|
|
|
|
.hexColors()
|
|
|
|
|
.useUnusualXRepeatedCharacterHexFormat()
|
|
|
|
|
.build();
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Converts the built component into legacy text.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* @return the legacy text. RGB colors are in BungeeCord format.
|
|
|
|
|
*/
|
|
|
|
|
public String getLegacyText() {
|
2023-06-20 00:15:46 +02:00
|
|
|
|
return LEGACY_SERIALIZER_BUNGEE_FRIENDLY.serialize(getAdv());
|
2022-07-30 13:58:16 +02:00
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Converts the built component into plain text.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* @return the plain text of this component.
|
|
|
|
|
*/
|
|
|
|
|
public String getPlainText() {
|
|
|
|
|
return PlainTextComponentSerializer.plainText().serializeOr(getAdv(), "");
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
@Override
|
2023-06-20 00:15:46 +02:00
|
|
|
|
public @NotNull HoverEvent<Component> asHoverEvent(@NotNull UnaryOperator<Component> op) {
|
2022-07-30 13:58:16 +02:00
|
|
|
|
return HoverEvent.showText(op.apply(getAdv()));
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Builds the component into Adventure Component instance.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return the {@link Component} built from this {@link Chat} component.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
*/
|
|
|
|
|
@Override
|
2023-06-20 00:15:46 +02:00
|
|
|
|
public @NotNull Component asComponent() {
|
2022-07-30 13:58:16 +02:00
|
|
|
|
return getAdv();
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
|
* Sub-component appending
|
|
|
|
|
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component to this component.
|
|
|
|
|
* @param comp the component to append.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat then(Component comp) {
|
|
|
|
|
if (comp instanceof TextComponent txtComp) {
|
|
|
|
|
if (!txtComp.hasStyling() && (txtComp.content().isEmpty())) {
|
|
|
|
|
// no need to add the provided component to the current component.
|
|
|
|
|
// but eventual child component must be added
|
|
|
|
|
if (!txtComp.children().isEmpty()) {
|
|
|
|
|
for (Component child : txtComp.children())
|
|
|
|
|
then(child);
|
|
|
|
|
}
|
|
|
|
|
return this;
|
|
|
|
|
}
|
|
|
|
|
}
|
|
|
|
|
builder.append(comp);
|
|
|
|
|
return this;
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a BungeeCord {@link BaseComponent} to this component.
|
|
|
|
|
* @param comp the component to append.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat then(BaseComponent comp) {
|
|
|
|
|
return then(toAdventure(comp));
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component to this component.
|
|
|
|
|
* @param comp the component to append.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat then(ComponentLike comp) {
|
|
|
|
|
if (comp instanceof ChatFilledLine ac) {
|
|
|
|
|
ac.console(console);
|
|
|
|
|
if (maxWidth != null)
|
|
|
|
|
ac.maxWidth(maxWidth);
|
|
|
|
|
}
|
|
|
|
|
return then(comp.asComponent());
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a BungeeCord {@link BaseComponent} array to this component.
|
|
|
|
|
* @param comp the components to append.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat then(BaseComponent[] comp) {
|
|
|
|
|
return then(toAdventure(comp));
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
|
* Special sub-components appending
|
|
|
|
|
*/
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a plain text to this component.
|
|
|
|
|
* @param plainText the plain text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenText(Object plainText) { return then(text(plainText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a plain text to this component, colored using {@link ChatConfig#infoColor}.
|
|
|
|
|
* @param plainText the plain text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenInfo(Object plainText) { return then(infoText(plainText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a plain text to this component, colored using {@link ChatConfig#warningColor}.
|
|
|
|
|
* @param plainText the plain text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenWarning(Object plainText) { return then(warningText(plainText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a plain text to this component, colored using {@link ChatConfig#successColor}.
|
|
|
|
|
* @param plainText the plain text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenSuccess(Object plainText) { return then(successText(plainText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a plain text to this component, colored using {@link ChatConfig#failureColor}.
|
|
|
|
|
* @param plainText the plain text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenFailure(Object plainText) { return then(failureText(plainText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a plain text to this component, colored using {@link ChatConfig#dataColor}.
|
|
|
|
|
* @param plainText the plain text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenData(Object plainText) { return then(dataText(plainText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a plain text to this component, colored using {@link ChatConfig#decorationColor}.
|
|
|
|
|
* @param plainText the plain text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenDecoration(Object plainText) { return then(decorationText(plainText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component with the provided legacy text as its main text content, and colored in white in case there is
|
|
|
|
|
* no color on the generated parent component.
|
|
|
|
|
* @param legacyText the legacy text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenPlayerName(String legacyText) { return then(playerNameText(legacyText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends the provided Component, coloring it in white in case there is no color defined. If the provided component
|
|
|
|
|
* is an instance of Chat, its content will be duplicated, and the provided one will be untouched.
|
|
|
|
|
* @param comp the component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenPlayerName(Component comp) { return then(playerNameComponent(comp)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component consisting of a new line.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenNewLine() { return then(Component.newline()); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component with the provided legacy text as its content.
|
|
|
|
|
* @param legacyText the legacy text.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenLegacyText(Object legacyText) { return then(legacyText(legacyText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component with the provided translation key and parameters.
|
|
|
|
|
* @param key the translation key.
|
|
|
|
|
* @param with the translation parameters.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenTranslation(String key, Object... with) { return then(translation(key, with)); }
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component with the provided keybinding.
|
|
|
|
|
* @param key the keybinding to display.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenKeyBind(String key) { return then(keybind(key)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component with the provided score name and objective.
|
|
|
|
|
* @param name the score name.
|
|
|
|
|
* @param objective the score objective.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenScore(String name, String objective) { return then(score(name, objective)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that leads to a URL when clicked.
|
|
|
|
|
* @param inner the component to make clickable.
|
|
|
|
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
|
|
|
|
* @param hover the content to display when hovering the component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) { return then(clickableURL(inner, url, hover)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that leads to a URL when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* When hovered, the component will display the url. To customize the hover content, use
|
|
|
|
|
* {@link #thenClickableURL(ComponentLike, String, HoverEventSource)}.
|
|
|
|
|
* @param inner the component to make clickable.
|
|
|
|
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableURL(ComponentLike inner, String url) { return then(clickableURL(inner, url)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that leads to a URL when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* The text on which to click will be the URL itself. To configure the clicked text, use
|
|
|
|
|
* {@link #thenClickableURL(ComponentLike, String, HoverEventSource)}.
|
|
|
|
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
|
|
|
|
* @param hover the content to display when hovering the component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableURL(String url, HoverEventSource<?> hover) { return then(clickableURL(url, hover)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that leads to a URL when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* The text on which to click will be the URL itself. To configure the clicked text, use
|
|
|
|
|
* {@link #thenClickableURL(ComponentLike, String)}.
|
|
|
|
|
* <p>
|
|
|
|
|
* When hovered, the component will display the url. To customize the hover content, use
|
|
|
|
|
* {@link #thenClickableURL(String, HoverEventSource)}.
|
|
|
|
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableURL(String url) { return then(clickableURL(url)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that runs a command when clicked.
|
|
|
|
|
* @param inner the component to make clickable.
|
|
|
|
|
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
|
|
|
|
|
* @param hover the content to display when hovering the component.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableCommand(ComponentLike inner, String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableCommand(inner, cmdWithSlash, hover)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that runs a command when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
|
|
|
|
* {@link #thenClickableCommand(ComponentLike, String, HoverEventSource)}.
|
|
|
|
|
* @param inner the component to make clickable.
|
|
|
|
|
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableCommand(ComponentLike inner, String cmdWithSlash) { return then(clickableCommand(inner, cmdWithSlash)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that runs a command when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
|
|
|
|
* {@link #thenClickableCommand(ComponentLike, String, HoverEventSource)}.
|
|
|
|
|
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
|
|
|
|
|
* @param hover the content to display when hovering the component.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableCommand(String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableCommand(cmdWithSlash, hover)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that runs a command when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
|
|
|
|
* {@link #thenClickableCommand(ComponentLike, String)}.
|
|
|
|
|
* <p>
|
|
|
|
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
|
|
|
|
* {@link #thenClickableCommand(String, HoverEventSource)}.
|
|
|
|
|
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenClickableCommand(String cmdWithSlash) { return then(clickableCommand(cmdWithSlash)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that pre-fill the chat box with a command when clicked.
|
|
|
|
|
* @param inner the component to make clickable.
|
|
|
|
|
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
|
|
|
|
|
* @param hover the content to display when hovering the component.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenCommandSuggest(ComponentLike inner, String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableSuggest(inner, cmdWithSlash, hover)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that pre-fill the chat box with a command when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
|
|
|
|
* {@link #thenCommandSuggest(ComponentLike, String, HoverEventSource)}.
|
|
|
|
|
* @param inner the component to make clickable.
|
|
|
|
|
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenCommandSuggest(ComponentLike inner, String cmdWithSlash) { return then(clickableSuggest(inner, cmdWithSlash)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that pre-fill the chat box with a command when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
|
|
|
|
* {@link #thenCommandSuggest(ComponentLike, String, HoverEventSource)}.
|
|
|
|
|
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
|
|
|
|
|
* @param hover the content to display when hovering the component.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenCommandSuggest(String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableSuggest(cmdWithSlash, hover)); }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Appends a component that pre-fill the chat box with a command when clicked.
|
|
|
|
|
* <p>
|
|
|
|
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
|
|
|
|
* {@link #thenCommandSuggest(ComponentLike, String)}.
|
|
|
|
|
* <p>
|
|
|
|
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
|
|
|
|
* {@link #thenCommandSuggest(String, HoverEventSource)}.
|
|
|
|
|
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
|
|
|
|
|
* @return this.
|
|
|
|
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenCommandSuggest(String cmdWithSlash) { return then(clickableSuggest(cmdWithSlash)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component filling a chat line with the configured decoration character and
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* color and a left-aligned text.
|
|
|
|
|
* @param leftText the text aligned to the left.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* and color and a left-aligned text.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component filling a chat line with the configured decoration character and
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* color and a left-aligned text.
|
|
|
|
|
* @param leftText the text aligned to the left.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* and color and a left-aligned text.
|
|
|
|
|
* @deprecated uses Bungeecord chat API.
|
|
|
|
|
*/
|
|
|
|
|
@Deprecated
|
|
|
|
|
public Chat thenLeftText(BaseComponent leftText) { return thenLeftText(chatComponent(leftText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component filling a chat line with the configured decoration character and
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* color and a right-aligned text.
|
|
|
|
|
* @param rightText the text aligned to the right.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* and color and a right-aligned text.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component filling a chat line with the configured decoration character and
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* color and a right-aligned text.
|
|
|
|
|
* @param rightText the text aligned to the right.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* and color and a right-aligned text.
|
|
|
|
|
* @deprecated uses Bungeecord chat API.
|
|
|
|
|
*/
|
|
|
|
|
@Deprecated
|
|
|
|
|
public Chat thenRightText(BaseComponent rightText) { return thenRightText(chatComponent(rightText)); }
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component filling a chat line with the configured decoration character and
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* color and a centered text.
|
|
|
|
|
* @param centerText the text aligned to the center.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* and color and a centered text.
|
|
|
|
|
*/
|
|
|
|
|
public Chat thenCenterText(ComponentLike centerText) {
|
|
|
|
|
return then(centerText(centerText, console));
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component filling a chat line with the configured decoration character and
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* color and a centered text.
|
|
|
|
|
* @param centerText the text aligned to the center.
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* and color and a centered text.
|
|
|
|
|
* @deprecated uses Bungeecord chat API.
|
|
|
|
|
*/
|
|
|
|
|
@Deprecated
|
|
|
|
|
public Chat thenCenterText(BaseComponent centerText) {
|
|
|
|
|
return thenCenterText(chatComponent(centerText));
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Appends a component filling a chat line with the configured decoration character and color.
|
|
|
|
|
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
*/
|
|
|
|
|
public Chat thenFilledLine() { return then(filledLine(console)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* A {@link Chat} that can be formatted.
|
|
|
|
|
* <p>
|
|
|
|
|
* The purpose of subclassing {@link Chat} is to avoid ambiguity with the way the Bungee chat component builder works.
|
|
|
|
|
* Here is an example of to use their builder (from
|
|
|
|
|
* <a href="https://www.spigotmc.org/wiki/the-chat-component-api/#the-component-builder-api">the Spigot wiki</a>):
|
|
|
|
|
* <pre>{@code
|
|
|
|
|
* BaseComponent[] component = new ComponentBuilder("Hello ").color(ChatColor.RED)
|
|
|
|
|
* .append("world").color(ChatColor.DARK_RED).bold(true)
|
|
|
|
|
* .append("!").color(ChatColor.RED)
|
|
|
|
|
* .create();
|
|
|
|
|
* }</pre>
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Here, when you call a formatting method (like {@code bold(boolean)} or {@code color(ChatColor)}) after the
|
|
|
|
|
* {@code append(String)} method, the formatting apply to the last subcomponent appended.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* <p>
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* In our design, we want the formatting to apply to the currently built component, not the last appended one.
|
|
|
|
|
* The purpose is to make the component structure clearer and have better control of the formatting over the
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* component hierarchy.
|
|
|
|
|
* Here is the equivalent of the above code, with the {@link Chat} API:
|
|
|
|
|
* <pre>{@code
|
|
|
|
|
* Chat component = Chat.text("Hello ").red()
|
|
|
|
|
* .then(Chat.text("world").darkRed().bold())
|
|
|
|
|
* .thenText("!"); // short for .then(Chat.text("!"))
|
|
|
|
|
* // the red color for "!" is not needed because the parent component is already red.
|
|
|
|
|
* }</pre>
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast
|
|
|
|
|
* to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
|
|
|
|
|
* subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again.
|
|
|
|
|
* <pre>{@code
|
|
|
|
|
* Chat component = Chat.text("Hello ").red()
|
|
|
|
|
* .then(Chat.text("world").darkRed().bold())
|
|
|
|
|
* .thenText("!");
|
|
|
|
|
* // ok now I want to underline everything:
|
|
|
|
|
* ((FormatableChat)component).underlined(); // this will not format only the last appended text.
|
|
|
|
|
* }</pre>
|
|
|
|
|
*/
|
|
|
|
|
public static final class FormatableChat extends Chat {
|
|
|
|
|
/* package */ FormatableChat(ComponentBuilder<?, ?> c) {
|
|
|
|
|
super(c);
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Configure if this component will be rendered on console or not.
|
|
|
|
|
* @param c true for console, false for game UI.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat console(boolean c) { console = c; return this; }
|
|
|
|
|
/**
|
|
|
|
|
* Configure the width of the line.
|
|
|
|
|
* @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
|
|
|
|
|
* console rendering.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat maxWidth(int w) { maxWidth = w; return this; }
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component.
|
|
|
|
|
* @param c the color.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat color(TextColor c) { builder.color(c); return this; }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component.
|
|
|
|
|
* @param c the color.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat color(ChatColor c) { return color(c == null ? null : TextColor.color(c.getColor().getRGB())); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component.
|
|
|
|
|
* @param c the color.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component.
|
|
|
|
|
* @param c the color.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat color(String c) { return color(c == null ? null : ChatColor.of(c)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#BLACK}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat black() { return color(NamedTextColor.BLACK); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#DARK_RED}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#GOLD}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat gold() { return color(NamedTextColor.GOLD); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#GRAY}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat gray() { return color(NamedTextColor.GRAY); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#BLUE}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat blue() { return color(NamedTextColor.BLUE); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#GREEN}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat green() { return color(NamedTextColor.GREEN); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#AQUA}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat aqua() { return color(NamedTextColor.AQUA); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#RED}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat red() { return color(NamedTextColor.RED); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#YELLOW}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat yellow() { return color(NamedTextColor.YELLOW); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link NamedTextColor#WHITE}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat white() { return color(NamedTextColor.WHITE); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#successColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat successColor() { return color(ChatConfig.successColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#failureColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat failureColor() { return color(ChatConfig.failureColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#infoColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat infoColor() { return color(ChatConfig.infoColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#warningColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat warningColor() { return color(ChatConfig.warningColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#dataColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat dataColor() { return color(ChatConfig.dataColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#decorationColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#urlColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat urlColor() { return color(ChatConfig.urlColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#commandColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat commandColor() { return color(ChatConfig.commandColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the color of this component to {@link ChatConfig#broadcastColor}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
|
|
|
|
|
private FormatableChat setDecoration(TextDecoration deco, Boolean state) {
|
|
|
|
|
return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Sets the bold status of this component.
|
|
|
|
|
* @param b true to enable, false to disable, or null to inherit from parent.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
|
|
|
|
|
/**
|
|
|
|
|
* Enables the bold status of this component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat bold() { return bold(true); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the italic status of this component.
|
|
|
|
|
* @param i true to enable, false to disable, or null to inherit from parent.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
|
|
|
|
|
/**
|
|
|
|
|
* Enables the italic status of this component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat italic() { return italic(true); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the underlined status of this component.
|
|
|
|
|
* @param u true to enable, false to disable, or null to inherit from parent.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
|
|
|
|
|
/**
|
|
|
|
|
* Enables the underlined status of this component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat underlined() { return underlined(true); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the strikethrough status of this component.
|
|
|
|
|
* @param s true to enable, false to disable, or null to inherit from parent.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
|
|
|
|
|
/**
|
|
|
|
|
* Enables the strikethrough status of this component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat strikethrough() { return strikethrough(true); }
|
|
|
|
|
/**
|
|
|
|
|
* Sets the obfuscated status of this component.
|
|
|
|
|
* @param o true to enable, false to disable, or null to inherit from parent.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
|
|
|
|
|
/**
|
|
|
|
|
* Enables the obfuscated status of this component.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat obfuscated() { return obfuscated(true); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Sets the font of this component.
|
|
|
|
|
* @param f the font namespaced key.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to insert the specified text at the cursor position when clicked.
|
|
|
|
|
* @param i the text to insert.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component’s click event.
|
|
|
|
|
* @param e the {@link ClickEvent}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to execute the specified command when clicked.
|
|
|
|
|
* @param cmdWithSlash the command to execute.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to insert in the chat-box the specified command when clicked.
|
|
|
|
|
* @param cmdWithSlash the command to suggest.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to copy into clipboard the specified text when clicked.
|
|
|
|
|
* @param value the text to copy.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to open the specified URL when clicked.
|
|
|
|
|
* @param url the URL to open.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to change the page of the opened book when clicked.
|
|
|
|
|
* @param page the page to go to.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component’s hover event.
|
|
|
|
|
* @param e the {@link HoverEventSource}.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to show the provided component when hovered.
|
|
|
|
|
* @param v the component to show.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to show the provided component when hovered.
|
|
|
|
|
* @param v the component to show.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to show the provided component when hovered.
|
|
|
|
|
* @param v the component to show.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to show the provided component when hovered.
|
|
|
|
|
* @param v the component to show.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat hover(BaseComponent v) { return hover(toAdventure(v)); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to show the provided component when hovered.
|
|
|
|
|
* @param v the component to show.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat hover(BaseComponent[] v) { return hover(toAdventure(v)); }
|
|
|
|
|
/**
|
|
|
|
|
* Configure this component to show the provided legacy text when hovered.
|
|
|
|
|
* @param legacyText the legacy text to show.
|
|
|
|
|
* @return this.
|
|
|
|
|
*/
|
|
|
|
|
public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
|
|
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
@Override
|
|
|
|
|
public boolean equals(Object obj) {
|
|
|
|
|
return obj instanceof Chat c
|
|
|
|
|
&& builder.equals(c.builder);
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
@Override
|
|
|
|
|
public int hashCode() {
|
|
|
|
|
return getAdv().hashCode();
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
@Override
|
|
|
|
|
public String toString() {
|
|
|
|
|
return getPlainText();
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* package */ static ComponentLike[] filterObjToComponentLike(Object[] values) {
|
|
|
|
|
if (values == null)
|
|
|
|
|
return null;
|
|
|
|
|
ComponentLike[] ret = new ComponentLike[values.length];
|
|
|
|
|
for (int i = 0; i < values.length; i++) {
|
|
|
|
|
Object v = values[i];
|
|
|
|
|
if (v instanceof BaseComponent[])
|
|
|
|
|
ret[i] = toAdventure((BaseComponent[]) v);
|
|
|
|
|
else if (v instanceof BaseComponent)
|
|
|
|
|
ret[i] = toAdventure((BaseComponent) v);
|
|
|
|
|
else if (v instanceof ComponentLike)
|
|
|
|
|
ret[i] = (ComponentLike) v;
|
|
|
|
|
else
|
|
|
|
|
ret[i] = Component.text(Objects.toString(v));
|
|
|
|
|
}
|
|
|
|
|
return ret;
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Converts the Bungee {@link BaseComponent} array into Adventure {@link Component}.
|
|
|
|
|
* @param components the Bungee {@link BaseComponent} array.
|
|
|
|
|
* @return a {@link Component}.
|
|
|
|
|
*/
|
|
|
|
|
public static Component toAdventure(BaseComponent[] components) {
|
|
|
|
|
return BungeeComponentSerializer.get().deserialize(components);
|
|
|
|
|
}
|
|
|
|
|
/**
|
|
|
|
|
* Converts the Bungee {@link BaseComponent} into Adventure {@link Component}.
|
|
|
|
|
* @param component the Bungee {@link BaseComponent}.
|
|
|
|
|
* @return a {@link Component}.
|
|
|
|
|
*/
|
|
|
|
|
public static Component toAdventure(BaseComponent component) {
|
|
|
|
|
return toAdventure(new BaseComponent[] { component });
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
|
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent} array.
|
|
|
|
|
* @param component the Adventure {@link Component}.
|
|
|
|
|
* @return a {@link BaseComponent} array.
|
|
|
|
|
*/
|
|
|
|
|
public static BaseComponent[] toBungeeArray(Component component) {
|
|
|
|
|
return BungeeComponentSerializer.get().serialize(component);
|
|
|
|
|
}
|
|
|
|
|
/**
|
|
|
|
|
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent}.
|
|
|
|
|
* @param component the Adventure {@link Component}.
|
|
|
|
|
* @return a {@link BaseComponent}.
|
|
|
|
|
*/
|
|
|
|
|
public static BaseComponent toBungee(Component component) {
|
|
|
|
|
BaseComponent[] arr = toBungeeArray(component);
|
|
|
|
|
return arr.length == 1 ? arr[0] : new net.md_5.bungee.api.chat.TextComponent(arr);
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
/**
|
2023-06-20 00:15:46 +02:00
|
|
|
|
* Force the italic formatting to be set to false if it is not explicitly set in the component.
|
2022-07-30 13:58:16 +02:00
|
|
|
|
* This is useful for item lores that defaults to italic in the game UI.
|
|
|
|
|
* @param c the {@link Chat} in which to set the italic property if needed.
|
|
|
|
|
* @return the provided {@link Chat} instance.
|
|
|
|
|
*/
|
|
|
|
|
public static Chat italicFalseIfNotSet(Chat c) {
|
|
|
|
|
c.builder.style(b -> {
|
|
|
|
|
if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
|
|
|
|
|
((FormatableChat) c).italic(false);
|
|
|
|
|
}
|
|
|
|
|
});
|
|
|
|
|
return c;
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
2020-11-02 23:23:41 +01:00
|
|
|
|
}
|