Compare commits

..

39 Commits

Author SHA1 Message Date
b42bbb4887 ItemStackAdapter for Json: removed backward compatibility of serialized data (was temporary during the server upgrade) 2025-07-20 00:22:41 +02:00
34809d4618 ItemStackAdapter for Json: fix again deserialization 2025-07-18 17:17:08 +02:00
843d9c3509 ItemStackAdapter for Json: deserialized json cannot contains both old and new data. When both are present (because old server needs the old one), keeping only the new data. 2025-07-18 17:09:30 +02:00
1716e0b5a8 ItemStackAdapter for Json: make the generated json compatible with pre 1.21.5 deserializer
-> temporary fix so the older servers does not throw an error when trying to deserialize (e.g. when using the lobby compass menu)
2025-07-18 16:53:22 +02:00
254b885648 Fix reflection for 1.21.7/8 (round 6) 2025-07-18 15:12:38 +02:00
e2c0098eb9 Fix reflection for 1.21.7/8 (round 5) 2025-07-18 14:37:12 +02:00
2fc3eb50f5 Added missing javadoc 2025-07-18 01:56:28 +02:00
fc44151f2b Fix reflection for 1.21.7/8 (round 4) 2025-07-18 01:52:17 +02:00
f8a7c5f1e7 Small dependency upgrade 2025-07-18 01:39:58 +02:00
a9ea8c3038 Fix reflection for 1.21.7/8 (round 3) 2025-07-18 01:37:57 +02:00
e611d06987 MC 1.21.8 2025-07-17 19:12:03 +02:00
638e57bb7f Fix reflection wrappers for 1.21.7 (round 2) 2025-07-17 14:41:44 +02:00
0009dd22cd Fix reflection wrappers for 1.21.7 2025-07-17 13:22:05 +02:00
79474b14d2 Make pandalib compile against Paper API 1.21.7 (prepare to full 1.21.7 update) 2025-07-14 22:31:55 +02:00
ee4812bdbb Adjust debugging message for command registration 2025-07-14 00:29:32 +02:00
7d2a5e7862 Fix another reflection wrapper inheritance 2025-07-14 00:26:04 +02:00
c09362c75e Fix reflection wrapper inheritance 2025-07-14 00:20:00 +02:00
457262049d Fix some reflection wrapping issues 2025-07-14 00:16:38 +02:00
ebbbc3a1f0 Fixes to support last Paper 1.21.4 build 2025-07-14 00:02:07 +02:00
8c0db895da Added MC 1.21.7 2025-07-01 21:39:39 +02:00
5943b10d16 Added MC 1.21.6 2025-06-21 18:14:18 +02:00
cda7ebadcc Updated Bungeecord version 2025-06-21 18:13:51 +02:00
dbdf1eeb7c Fix ItemStackBuilder#canBreak 2025-05-24 17:26:42 +02:00
500163d8f4 Spaces around hyphen of versions range in MinecraftVersionUtil#toString() 2025-04-05 00:14:06 +02:00
9374f8d280 Updated MC version json file 2025-04-04 00:29:52 +02:00
f5194334de Fix PerformanceAnalysisManager 2025-02-20 21:54:00 +01:00
21777d4b9e Fully use chat components in PerformanceAnalysisManager lag bar 2025-02-20 21:31:13 +01:00
3b4cf63c48 Updated Skull class handling custom heads. No more relying on MHF_* accounts 2025-02-17 00:30:38 +01:00
e2b2ab466d New RandomUtil method shuffleMap 2025-02-12 23:10:48 +01:00
50e21896ba Override VaultAPI Permission extra methods #playerAdd and @playerRemove to ignore the current player world when another plugin changes permissions 2025-02-06 23:19:06 +01:00
07af67b33f Less verbose client websocket when reconnecting 2025-01-20 00:00:14 +01:00
f4d0ccca51 Do not put the HttpClient of a persistent websocket into a try-with-resources 2025-01-19 23:30:56 +01:00
51bc0bd6e8 Removed unused reflected method. 2025-01-19 17:53:53 +01:00
c229b14779 ItemStackBuilder: make canPlaceOn and canBreak actually working (must use old deprecated API because the new API is not yet working) 2025-01-18 19:17:33 +01:00
49942b35da Add support for item data components in ItemStackBuilder 2025-01-17 00:50:15 +01:00
0ffe3198e6 Fixed hundreds of small issues, code improvements, typos, ... 2025-01-16 00:25:23 +01:00
ace34fc0e8 MC 1.21.4 + small fixes 2025-01-13 23:57:48 +01:00
27c444f3b4 test: adjusted BadCommandUsage javadoc 2025-01-11 23:52:18 +01:00
c589da2a14 mvn: updated papermc repo url 2025-01-11 23:27:38 +01:00
91 changed files with 1179 additions and 969 deletions

View File

@@ -9,11 +9,11 @@ that are detailed in their respective Readme file (if any).
- `pandalib-util` General purpose utility and helper classes; - `pandalib-util` General purpose utility and helper classes;
- `pandalib-chat` A chat API working on top of the Adventure API; - `pandalib-chat` A chat API working on top of the Adventure API;
- `pandalib-db` An ORM working with a MySQL server through JDBC; - `pandalib-db` An ORM working with a MySQL server through JDBC;
- `pandalib-bungee` Utility and helper classes to use in Bungeecord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`; - `pandalib-bungee` Utility and helper classes to use in BungeeCord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
- `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`; - `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
- `pandalib-reflect` A reflection wrapper to make reflective operation easier; - `pandalib-reflect` A reflection wrapper to make reflective operation easier;
- `pandalib-permissions` A general purpose permission system; - `pandalib-permissions` A general purpose permission system;
- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into Bungeecord; - `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into BungeeCord;
- `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems; - `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems;
- `pandalib-players` A library to handle classes representing online or offline players; - `pandalib-players` A library to handle classes representing online or offline players;
- `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`; - `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`;

View File

@@ -21,11 +21,6 @@
</repositories> </repositories>
<dependencies> <dependencies>
<dependency>
<groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-util</artifactId>
<version>${project.version}</version>
</dependency>
<dependency> <dependency>
<groupId>fr.pandacube.lib</groupId> <groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-chat</artifactId> <artifactId>pandalib-chat</artifactId>

View File

@@ -1,7 +1,7 @@
package fr.pandacube.lib.bungee.chat; package fr.pandacube.lib.bungee.chat;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.chat.Chat;
import fr.pandacube.lib.chat.Chat.FormatableChat; import fr.pandacube.lib.chat.Chat.FormattableChat;
import net.kyori.adventure.text.Component; import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentLike; import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer; import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
@@ -15,22 +15,22 @@ public class ChatBungee {
/** /**
* Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent}. * Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent}.
* @param c the {@link BaseComponent}. * @param c the {@link BaseComponent}.
* @return a new {@link FormatableChat}. * @return a new {@link FormattableChat}.
*/ */
public static FormatableChat chatComponent(BaseComponent c) { public static FormattableChat chatComponent(BaseComponent c) {
return Chat.chatComponent(toAdventure(c)); return Chat.chatComponent(toAdventure(c));
} }
/** /**
* Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}. * Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
* @param c the array of {@link BaseComponent}. * @param c the array of {@link BaseComponent}.
* @return a new {@link FormatableChat}. * @return a new {@link FormattableChat}.
*/ */
public static FormatableChat chatComponent(BaseComponent[] c) { public static FormattableChat chatComponent(BaseComponent[] c) {
return Chat.chatComponent(toAdventure(c)); return Chat.chatComponent(toAdventure(c));
} }

View File

@@ -1,7 +1,7 @@
package fr.pandacube.lib.bungee; package fr.pandacube.lib.bungee;
import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler; import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler;
import fr.pandacube.lib.bungee.util.PluginMessagePassthrough; import fr.pandacube.lib.bungee.util.PluginMessagePassThrough;
import net.md_5.bungee.api.plugin.Plugin; import net.md_5.bungee.api.plugin.Plugin;
/** /**
@@ -24,7 +24,7 @@ public class PandaLibBungee {
* Method to be called in {@link Plugin#onEnable()} method. * Method to be called in {@link Plugin#onEnable()} method.
*/ */
public static void onEnable() { public static void onEnable() {
PluginMessagePassthrough.init(plugin); PluginMessagePassThrough.init(plugin);
BungeeDailyLogRotateFileHandler.init(true); BungeeDailyLogRotateFileHandler.init(true);
} }

View File

@@ -7,7 +7,7 @@ import java.util.ArrayList;
import java.util.List; import java.util.List;
/** /**
* Class that holds the configuration varables for {@link BungeeBackupManager}. * Class that holds the configuration variables for {@link BungeeBackupManager}.
*/ */
@SuppressWarnings("CanBeFinal") @SuppressWarnings("CanBeFinal")
public class BungeeBackupConfig { public class BungeeBackupConfig {

View File

@@ -7,14 +7,14 @@ import fr.pandacube.lib.core.backup.RotatedLogsBackupProcess;
import java.io.File; import java.io.File;
/** /**
* Handles the backup processes for a Bungeecord instance. * Handles the backup processes for a BungeeCord instance.
*/ */
public class BungeeBackupManager extends BackupManager { public class BungeeBackupManager extends BackupManager {
BungeeBackupConfig config; BungeeBackupConfig config;
/** /**
* Instanciate a new {@link BungeeBackupManager}. * Creates a new {@link BungeeBackupManager}.
* @param config the configuration. * @param config the configuration.
*/ */
public BungeeBackupManager(BungeeBackupConfig config) { public BungeeBackupManager(BungeeBackupConfig config) {

View File

@@ -6,7 +6,7 @@ import java.io.File;
import java.util.function.BiPredicate; import java.util.function.BiPredicate;
/** /**
* The backup process responsible for the working directory of the current Bungeecord instance. * The backup process responsible for the working directory of the current BungeeCord instance.
*/ */
public class BungeeWorkdirProcess extends BackupProcess { public class BungeeWorkdirProcess extends BackupProcess {

View File

@@ -6,7 +6,7 @@ import net.md_5.bungee.api.connection.ProxiedPlayer;
import fr.pandacube.lib.players.standalone.AbstractOffPlayer; import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
/** /**
* Represents any player on a Bungeecord proxy, either offline or online. * Represents any player on a BungeeCord proxy, either offline or online.
*/ */
public interface BungeeOffPlayer extends AbstractOffPlayer { public interface BungeeOffPlayer extends AbstractOffPlayer {

View File

@@ -20,7 +20,7 @@ import net.md_5.bungee.protocol.packet.PluginMessage;
import java.util.Locale; import java.util.Locale;
/** /**
* Represents any online player on a Bungeecord proxy. * Represents any online player on a BungeeCord proxy.
*/ */
public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer { public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer {

View File

@@ -19,16 +19,16 @@ import net.md_5.bungee.event.EventHandler;
* <p> * <p>
* Usage example, in your plugin init code: * Usage example, in your plugin init code:
* <pre>{@code * <pre>{@code
* PluginMessagePassthrough.init(yourPluginInstance); * PluginMessagePassThrough.init(yourPluginInstance);
* PluginMessagePassthrough.register("worldedit:cui"); // plugin message used by WorldEdit * PluginMessagePassThrough.register("worldedit:cui"); // plugin message used by WorldEdit
* }</pre> * }</pre>
*/ */
public class PluginMessagePassthrough implements Listener { public class PluginMessagePassThrough implements Listener {
private static final List<String> channels = Collections.synchronizedList(new ArrayList<>()); private static final List<String> channels = Collections.synchronizedList(new ArrayList<>());
private static final PluginMessagePassthrough instance = new PluginMessagePassthrough(); private static final PluginMessagePassThrough instance = new PluginMessagePassThrough();
/** /**
* Initialize the {@link PluginMessagePassthrough}. * Initialize the {@link PluginMessagePassThrough}.
* It registers the required event listener. * It registers the required event listener.
* @param plugin the plugin instance. * @param plugin the plugin instance.
*/ */
@@ -92,7 +92,7 @@ public class PluginMessagePassthrough implements Listener {
} }
private PluginMessagePassthrough() { } private PluginMessagePassThrough() { }
/** /**

View File

@@ -54,7 +54,7 @@
<dependency> <dependency>
<groupId>com.google.code.gson</groupId> <groupId>com.google.code.gson</groupId>
<artifactId>gson</artifactId> <artifactId>gson</artifactId>
<version>2.10.1</version> <version>${gson.version}</version>
</dependency> </dependency>
</dependencies> </dependencies>

View File

@@ -35,8 +35,8 @@ import java.util.function.UnaryOperator;
* This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in * This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
* Adventure API and its implementation without using the final methods of this builder. * Adventure API and its implementation without using the final methods of this builder.
* <p> * <p>
* The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the * The unique possible concrete subclass of this class, {@link FormattableChat}, takes care of the formatting of the
* built component. The rationale for this design is explained in the documentation of {@link FormatableChat}. * built component. The rationale for this design is explained in the documentation of {@link FormattableChat}.
*/ */
public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike { public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
@@ -296,7 +296,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param key the keybinding to display. * @param key the keybinding to display.
* @return this. * @return this.
*/ */
public Chat thenKeyBind(String key) { return then(keybind(key)); } public Chat thenKeyBind(String key) { return then(keyBind(key)); }
/** /**
* Appends a component with the provided score name and objective. * Appends a component with the provided score name and objective.
@@ -454,7 +454,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* Appends a component filling a chat line with the configured decoration character and * Appends a component filling a chat line with the configured decoration character and
* color and a left-aligned text. * color and a left-aligned text.
* @param leftText the text aligned to the left. * @param leftText the text aligned to the left.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a left-aligned text. * and color and a left-aligned text.
*/ */
public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); } public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
@@ -463,7 +463,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* Appends a component filling a chat line with the configured decoration character and * Appends a component filling a chat line with the configured decoration character and
* color and a right-aligned text. * color and a right-aligned text.
* @param rightText the text aligned to the right. * @param rightText the text aligned to the right.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a right-aligned text. * and color and a right-aligned text.
*/ */
public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); } public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
@@ -472,7 +472,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* Appends a component filling a chat line with the configured decoration character and * Appends a component filling a chat line with the configured decoration character and
* color and a centered text. * color and a centered text.
* @param centerText the text aligned to the center. * @param centerText the text aligned to the center.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a centered text. * and color and a centered text.
*/ */
public Chat thenCenterText(ComponentLike centerText) { public Chat thenCenterText(ComponentLike centerText) {
@@ -481,7 +481,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
/** /**
* Appends a component filling a chat line with the configured decoration character and color. * Appends a component filling a chat line with the configured decoration character and color.
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color. * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
*/ */
public Chat thenFilledLine() { return then(filledLine(console)); } public Chat thenFilledLine() { return then(filledLine(console)); }
@@ -520,10 +520,10 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* .thenText("!"); // short for .then(Chat.text("!")) * .thenText("!"); // short for .then(Chat.text("!"))
* // the red color for "!" is not needed because the parent component is already red. * // the red color for "!" is not needed because the parent component is already red.
* }</pre> * }</pre>
* When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast * When calling {@link #then(Component) #then(...)} on a {@link FormattableChat}, the method returns itself, cast
* to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended * to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
* subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed * subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
* class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again. * class which only subclass is {@link FormattableChat}, you can cast the builder, and use the format methods again.
* <pre>{@code * <pre>{@code
* Chat component = Chat.text("Hello ").red() * Chat component = Chat.text("Hello ").red()
* .then(Chat.text("world").darkRed().bold()) * .then(Chat.text("world").darkRed().bold())
@@ -532,8 +532,8 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* ((FormatableChat)component).underlined(); // this will not format only the last appended text. * ((FormatableChat)component).underlined(); // this will not format only the last appended text.
* }</pre> * }</pre>
*/ */
public static final class FormatableChat extends Chat { public static final class FormattableChat extends Chat {
/* package */ FormatableChat(ComponentBuilder<?, ?> c) { /* package */ FormattableChat(ComponentBuilder<?, ?> c) {
super(c); super(c);
} }
@@ -543,33 +543,33 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param c true for console, false for game UI. * @param c true for console, false for game UI.
* @return this. * @return this.
*/ */
public FormatableChat console(boolean c) { console = c; return this; } public FormattableChat console(boolean c) { console = c; return this; }
/** /**
* Configure the width of the line. * Configure the width of the line.
* @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for * @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
* console rendering. * console rendering.
* @return this. * @return this.
*/ */
public FormatableChat maxWidth(int w) { maxWidth = w; return this; } public FormattableChat maxWidth(int w) { maxWidth = w; return this; }
/** /**
* Sets the color of this component. * Sets the color of this component.
* @param c the color. * @param c the color.
* @return this. * @return this.
*/ */
public FormatableChat color(TextColor c) { builder.color(c); return this; } public FormattableChat color(TextColor c) { builder.color(c); return this; }
/** /**
* Sets the color of this component. * Sets the color of this component.
* @param c the color. * @param c the color.
* @return this. * @return this.
*/ */
public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); } public FormattableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
/** /**
* Sets the color of this component. * Sets the color of this component.
* @param c the color. * @param c the color.
* @return this. * @return this.
*/ */
public FormatableChat color(String c) { public FormattableChat color(String c) {
if (c == null) if (c == null)
return color((TextColor) null); return color((TextColor) null);
TextColor tc = c.startsWith("#") TextColor tc = c.startsWith("#")
@@ -585,138 +585,138 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* Sets the color of this component to {@link NamedTextColor#BLACK}. * Sets the color of this component to {@link NamedTextColor#BLACK}.
* @return this. * @return this.
*/ */
public FormatableChat black() { return color(NamedTextColor.BLACK); } public FormattableChat black() { return color(NamedTextColor.BLACK); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_BLUE}. * Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
* @return this. * @return this.
*/ */
public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); } public FormattableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_GREEN}. * Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
* @return this. * @return this.
*/ */
public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); } public FormattableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_AQUA}. * Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
* @return this. * @return this.
*/ */
public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); } public FormattableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_RED}. * Sets the color of this component to {@link NamedTextColor#DARK_RED}.
* @return this. * @return this.
*/ */
public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); } public FormattableChat darkRed() { return color(NamedTextColor.DARK_RED); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}. * Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
* @return this. * @return this.
*/ */
public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); } public FormattableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#GOLD}. * Sets the color of this component to {@link NamedTextColor#GOLD}.
* @return this. * @return this.
*/ */
public FormatableChat gold() { return color(NamedTextColor.GOLD); } public FormattableChat gold() { return color(NamedTextColor.GOLD); }
/** /**
* Sets the color of this component to {@link NamedTextColor#GRAY}. * Sets the color of this component to {@link NamedTextColor#GRAY}.
* @return this. * @return this.
*/ */
public FormatableChat gray() { return color(NamedTextColor.GRAY); } public FormattableChat gray() { return color(NamedTextColor.GRAY); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_GRAY}. * Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
* @return this. * @return this.
*/ */
public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); } public FormattableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
/** /**
* Sets the color of this component to {@link NamedTextColor#BLUE}. * Sets the color of this component to {@link NamedTextColor#BLUE}.
* @return this. * @return this.
*/ */
public FormatableChat blue() { return color(NamedTextColor.BLUE); } public FormattableChat blue() { return color(NamedTextColor.BLUE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#GREEN}. * Sets the color of this component to {@link NamedTextColor#GREEN}.
* @return this. * @return this.
*/ */
public FormatableChat green() { return color(NamedTextColor.GREEN); } public FormattableChat green() { return color(NamedTextColor.GREEN); }
/** /**
* Sets the color of this component to {@link NamedTextColor#AQUA}. * Sets the color of this component to {@link NamedTextColor#AQUA}.
* @return this. * @return this.
*/ */
public FormatableChat aqua() { return color(NamedTextColor.AQUA); } public FormattableChat aqua() { return color(NamedTextColor.AQUA); }
/** /**
* Sets the color of this component to {@link NamedTextColor#RED}. * Sets the color of this component to {@link NamedTextColor#RED}.
* @return this. * @return this.
*/ */
public FormatableChat red() { return color(NamedTextColor.RED); } public FormattableChat red() { return color(NamedTextColor.RED); }
/** /**
* Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}. * Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
* @return this. * @return this.
*/ */
public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); } public FormattableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#YELLOW}. * Sets the color of this component to {@link NamedTextColor#YELLOW}.
* @return this. * @return this.
*/ */
public FormatableChat yellow() { return color(NamedTextColor.YELLOW); } public FormattableChat yellow() { return color(NamedTextColor.YELLOW); }
/** /**
* Sets the color of this component to {@link NamedTextColor#WHITE}. * Sets the color of this component to {@link NamedTextColor#WHITE}.
* @return this. * @return this.
*/ */
public FormatableChat white() { return color(NamedTextColor.WHITE); } public FormattableChat white() { return color(NamedTextColor.WHITE); }
/** /**
* Sets the color of this component to {@link ChatConfig#successColor}. * Sets the color of this component to {@link ChatConfig#successColor}.
* @return this. * @return this.
*/ */
public FormatableChat successColor() { return color(ChatConfig.successColor); } public FormattableChat successColor() { return color(ChatConfig.successColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#failureColor}. * Sets the color of this component to {@link ChatConfig#failureColor}.
* @return this. * @return this.
*/ */
public FormatableChat failureColor() { return color(ChatConfig.failureColor); } public FormattableChat failureColor() { return color(ChatConfig.failureColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#infoColor}. * Sets the color of this component to {@link ChatConfig#infoColor}.
* @return this. * @return this.
*/ */
public FormatableChat infoColor() { return color(ChatConfig.infoColor); } public FormattableChat infoColor() { return color(ChatConfig.infoColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#warningColor}. * Sets the color of this component to {@link ChatConfig#warningColor}.
* @return this. * @return this.
*/ */
public FormatableChat warningColor() { return color(ChatConfig.warningColor); } public FormattableChat warningColor() { return color(ChatConfig.warningColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#dataColor}. * Sets the color of this component to {@link ChatConfig#dataColor}.
* @return this. * @return this.
*/ */
public FormatableChat dataColor() { return color(ChatConfig.dataColor); } public FormattableChat dataColor() { return color(ChatConfig.dataColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#decorationColor}. * Sets the color of this component to {@link ChatConfig#decorationColor}.
* @return this. * @return this.
*/ */
public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); } public FormattableChat decorationColor() { return color(ChatConfig.decorationColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#urlColor}. * Sets the color of this component to {@link ChatConfig#urlColor}.
* @return this. * @return this.
*/ */
public FormatableChat urlColor() { return color(ChatConfig.urlColor); } public FormattableChat urlColor() { return color(ChatConfig.urlColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#commandColor}. * Sets the color of this component to {@link ChatConfig#commandColor}.
* @return this. * @return this.
*/ */
public FormatableChat commandColor() { return color(ChatConfig.commandColor); } public FormattableChat commandColor() { return color(ChatConfig.commandColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#highlightedCommandColor}. * Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
* @return this. * @return this.
*/ */
public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); } public FormattableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#broadcastColor}. * Sets the color of this component to {@link ChatConfig#broadcastColor}.
* @return this. * @return this.
*/ */
public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); } public FormattableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; } private FormattableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
private FormatableChat setDecoration(TextDecoration deco, Boolean state) { private FormattableChat setDecoration(TextDecoration deco, Boolean state) {
return setStyle(b -> b.decoration(deco, State.byBoolean(state))); return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
} }
@@ -726,56 +726,56 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param b true to enable, false to disable, or null to inherit from parent. * @param b true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); } public FormattableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
/** /**
* Enables the bold status of this component. * Enables the bold status of this component.
* @return this. * @return this.
*/ */
public FormatableChat bold() { return bold(true); } public FormattableChat bold() { return bold(true); }
/** /**
* Sets the italic status of this component. * Sets the italic status of this component.
* @param i true to enable, false to disable, or null to inherit from parent. * @param i true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); } public FormattableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
/** /**
* Enables the italic status of this component. * Enables the italic status of this component.
* @return this. * @return this.
*/ */
public FormatableChat italic() { return italic(true); } public FormattableChat italic() { return italic(true); }
/** /**
* Sets the underlined status of this component. * Sets the underlined status of this component.
* @param u true to enable, false to disable, or null to inherit from parent. * @param u true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); } public FormattableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
/** /**
* Enables the underlined status of this component. * Enables the underlined status of this component.
* @return this. * @return this.
*/ */
public FormatableChat underlined() { return underlined(true); } public FormattableChat underlined() { return underlined(true); }
/** /**
* Sets the strikethrough status of this component. * Sets the strikethrough status of this component.
* @param s true to enable, false to disable, or null to inherit from parent. * @param s true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); } public FormattableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
/** /**
* Enables the strikethrough status of this component. * Enables the strikethrough status of this component.
* @return this. * @return this.
*/ */
public FormatableChat strikethrough() { return strikethrough(true); } public FormattableChat strikethrough() { return strikethrough(true); }
/** /**
* Sets the obfuscated status of this component. * Sets the obfuscated status of this component.
* @param o true to enable, false to disable, or null to inherit from parent. * @param o true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); } public FormattableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
/** /**
* Enables the obfuscated status of this component. * Enables the obfuscated status of this component.
* @return this. * @return this.
*/ */
public FormatableChat obfuscated() { return obfuscated(true); } public FormattableChat obfuscated() { return obfuscated(true); }
/** /**
@@ -783,7 +783,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param f the font namespaced key. * @param f the font namespaced key.
* @return this. * @return this.
*/ */
public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); } public FormattableChat font(Key f) { return setStyle(s -> s.font(f)); }
/** /**
@@ -791,7 +791,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param i the text to insert. * @param i the text to insert.
* @return this. * @return this.
*/ */
public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; } public FormattableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
/** /**
@@ -799,37 +799,37 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param e the {@link ClickEvent}. * @param e the {@link ClickEvent}.
* @return this. * @return this.
*/ */
private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; } private FormattableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
/** /**
* Configure this component to execute the specified command when clicked. * Configure this component to execute the specified command when clicked.
* @param cmdWithSlash the command to execute. * @param cmdWithSlash the command to execute.
* @return this. * @return this.
*/ */
public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); } public FormattableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
/** /**
* Configure this component to insert in the chat-box the specified command when clicked. * Configure this component to insert in the chat-box the specified command when clicked.
* @param cmdWithSlash the command to suggest. * @param cmdWithSlash the command to suggest.
* @return this. * @return this.
*/ */
public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); } public FormattableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
/** /**
* Configure this component to copy into clipboard the specified text when clicked. * Configure this component to copy into clipboard the specified text when clicked.
* @param value the text to copy. * @param value the text to copy.
* @return this. * @return this.
*/ */
public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); } public FormattableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
/** /**
* Configure this component to open the specified URL when clicked. * Configure this component to open the specified URL when clicked.
* @param url the URL to open. * @param url the URL to open.
* @return this. * @return this.
*/ */
public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); } public FormattableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
/** /**
* Configure this component to change the page of the opened book when clicked. * Configure this component to change the page of the opened book when clicked.
* @param page the page to go to. * @param page the page to go to.
* @return this. * @return this.
*/ */
public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); } public FormattableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
/** /**
@@ -837,31 +837,31 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param e the {@link HoverEventSource}. * @param e the {@link HoverEventSource}.
* @return this. * @return this.
*/ */
public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; } public FormattableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
/** /**
* Configure this component to show the provided component when hovered. * Configure this component to show the provided component when hovered.
* @param v the component to show. * @param v the component to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); } public FormattableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
/** /**
* Configure this component to show the provided component when hovered. * Configure this component to show the provided component when hovered.
* @param v the component to show. * @param v the component to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); } public FormattableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
/** /**
* Configure this component to show the provided component when hovered. * Configure this component to show the provided component when hovered.
* @param v the component to show. * @param v the component to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); } public FormattableChat hover(ComponentLike v) { return hover(v.asComponent()); }
/** /**
* Configure this component to show the provided legacy text when hovered. * Configure this component to show the provided legacy text when hovered.
* @param legacyText the legacy text to show. * @param legacyText the legacy text to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); } public FormattableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
} }
@@ -932,14 +932,14 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
/** /**
* Force the italic formatting to be set to false if it is not explicitly set in the component. * Force the italic formatting to be set to false if it is not explicitly set in the component.
* This is useful for item lores that defaults to italic in the game UI. * This is useful for item lore that defaults to italic in the game UI.
* @param c the {@link Chat} in which to set the italic property if needed. * @param c the {@link Chat} in which to set the italic property if needed.
* @return the provided {@link Chat} instance. * @return the provided {@link Chat} instance.
*/ */
public static Chat italicFalseIfNotSet(Chat c) { public static Chat italicFalseIfNotSet(Chat c) {
c.builder.style(b -> { c.builder.style(b -> {
if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) { if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
((FormatableChat) c).italic(false); ((FormattableChat) c).italic(false);
} }
}); });
return c; return c;

View File

@@ -5,7 +5,7 @@ import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.format.TextColor; import net.kyori.adventure.text.format.TextColor;
import org.jetbrains.annotations.NotNull; import org.jetbrains.annotations.NotNull;
import fr.pandacube.lib.chat.Chat.FormatableChat; import fr.pandacube.lib.chat.Chat.FormattableChat;
/** /**
* Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text. * Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text.
@@ -150,10 +150,10 @@ public class ChatFilledLine implements ComponentLike {
/** /**
* Renders this line to a {@link FormatableChat}. * Renders this line to a {@link FormattableChat}.
* @return a new {@link FormatableChat} built by this {@link ChatFilledLine}. * @return a new {@link FormattableChat} built by this {@link ChatFilledLine}.
*/ */
public FormatableChat toChat() { public FormattableChat toChat() {
int maxWidth = (this.maxWidth != null) int maxWidth = (this.maxWidth != null)
? this.maxWidth ? this.maxWidth
: console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH; : console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH;
@@ -170,7 +170,7 @@ public class ChatFilledLine implements ComponentLike {
int textWidth = ChatUtil.componentWidth(text.asComponent(), console); int textWidth = ChatUtil.componentWidth(text.asComponent(), console);
if (textWidth > maxWidth) if (textWidth > maxWidth)
return (FormatableChat) text; return (FormattableChat) text;
int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold); int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold);
int nbCharLeft = 0, nbCharRight = 0; int nbCharLeft = 0, nbCharRight = 0;
@@ -179,12 +179,12 @@ public class ChatFilledLine implements ComponentLike {
case CENTER -> { case CENTER -> {
nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth; nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth;
if (nbCharLeft == 0) if (nbCharLeft == 0)
return (FormatableChat) text; return (FormattableChat) text;
} }
case LEFT, RIGHT -> { case LEFT, RIGHT -> {
int remWidth = textWidth + nbSide * repeatedCharWidth; int remWidth = textWidth + nbSide * repeatedCharWidth;
if (remWidth > maxWidth) if (remWidth > maxWidth)
return (FormatableChat) text; return (FormattableChat) text;
boolean left = alignment == Alignment.LEFT; boolean left = alignment == Alignment.LEFT;
int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth; int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth;
nbCharLeft = left ? nbSide : nbOtherSide; nbCharLeft = left ? nbSide : nbOtherSide;
@@ -197,7 +197,7 @@ public class ChatFilledLine implements ComponentLike {
.then(text); .then(text);
if (decorationChar != ' ' || spacesDecorationRightSide) if (decorationChar != ' ' || spacesDecorationRightSide)
d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold)); d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold));
return (FormatableChat) d; return (FormattableChat) d;
} }

View File

@@ -1,6 +1,6 @@
package fr.pandacube.lib.chat; package fr.pandacube.lib.chat;
import fr.pandacube.lib.chat.Chat.FormatableChat; import fr.pandacube.lib.chat.Chat.FormattableChat;
import net.kyori.adventure.text.BlockNBTComponent; import net.kyori.adventure.text.BlockNBTComponent;
import net.kyori.adventure.text.Component; import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentBuilder; import net.kyori.adventure.text.ComponentBuilder;
@@ -27,27 +27,27 @@ public abstract class ChatStatic {
private static FormatableChat chatComponent(Component c) { private static FormattableChat chatComponent(Component c) {
return new FormatableChat(componentToBuilder(c)); return new FormattableChat(componentToBuilder(c));
} }
/** /**
* Creates a {@link FormatableChat} from the provided {@link ComponentLike}. * Creates a {@link FormattableChat} from the provided {@link ComponentLike}.
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
* will be untouched. * will be untouched.
* @param c the {@link ComponentLike}. * @param c the {@link ComponentLike}.
* @return a new {@link FormatableChat}. * @return a new {@link FormattableChat}.
*/ */
public static FormatableChat chatComponent(ComponentLike c) { public static FormattableChat chatComponent(ComponentLike c) {
return chatComponent(c.asComponent()); return chatComponent(c.asComponent());
} }
/** /**
* Creates a {@link FormatableChat} with an empty main text content. * Creates a {@link FormattableChat} with an empty main text content.
* @return a new empty {@link FormatableChat}. * @return a new empty {@link FormattableChat}.
*/ */
public static FormatableChat chat() { public static FormattableChat chat() {
return new FormatableChat(Component.text()); return new FormattableChat(Component.text());
} }
@@ -56,60 +56,60 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content. * Creates a {@link FormattableChat} with the provided plain text as its main text content.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content. * @return a new {@link FormattableChat} with the provided text as its main text content.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
public static FormatableChat text(Object plainText) { public static FormattableChat text(Object plainText) {
if (plainText instanceof ComponentLike) { if (plainText instanceof ComponentLike) {
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead."); throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
} }
return new FormatableChat(Component.text().content(Objects.toString(plainText))); return new FormattableChat(Component.text().content(Objects.toString(plainText)));
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the section {@code "§"} * Creates a {@link FormattableChat} with the provided legacy text as its content, using the section {@code "§"}
* character. * character.
* @param legacyText the legacy text to use as the content, that uses the {@code "§"} character. * @param legacyText the legacy text to use as the content, that uses the {@code "§"} character.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
public static FormatableChat legacyText(Object legacyText) { public static FormattableChat legacyText(Object legacyText) {
return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR); return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR);
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the ampersand {@code "&"} * Creates a {@link FormattableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
* character. * character.
* @param legacyText the legacy text to use as the content, that uses the {@code "&"} character. * @param legacyText the legacy text to use as the content, that uses the {@code "&"} character.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
public static FormatableChat legacyAmpersandText(Object legacyText) { public static FormattableChat legacyAmpersandText(Object legacyText) {
return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR); return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR);
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the specified * Creates a {@link FormattableChat} with the provided legacy text as its content, using the specified
* legacyCharacter. * legacyCharacter.
* @param legacyText the legacy text to use as the content. * @param legacyText the legacy text to use as the content.
* @param legacyCharacter the character used in the provided text to prefix color and format code. * @param legacyCharacter the character used in the provided text to prefix color and format code.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
private static FormatableChat legacyText(Object legacyText, char legacyCharacter) { private static FormattableChat legacyText(Object legacyText, char legacyCharacter) {
if (legacyText instanceof ComponentLike) { if (legacyText instanceof ComponentLike) {
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead."); throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
} }
@@ -118,118 +118,118 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} with the provided MiniMessage text as its content. * Creates a {@link FormattableChat} with the provided MiniMessage text as its content.
* @param miniMessageText the MiniMessage text to use as the content. * @param miniMessageText the MiniMessage text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
*/ */
public static FormatableChat miniMessageText(String miniMessageText) { public static FormattableChat miniMessageText(String miniMessageText) {
return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText)); return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText));
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#infoColor configured info color}. * {@link ChatConfig#infoColor configured info color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#infoColor()} instead. * {@link FormattableChat#infoColor()} instead.
*/ */
public static FormatableChat infoText(Object plainText) { public static FormattableChat infoText(Object plainText) {
return text(plainText).infoColor(); return text(plainText).infoColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#warningColor configured warning color}. * {@link ChatConfig#warningColor configured warning color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#warningColor()} instead. * {@link FormattableChat#warningColor()} instead.
*/ */
public static FormatableChat warningText(Object plainText) { public static FormattableChat warningText(Object plainText) {
return text(plainText).warningColor(); return text(plainText).warningColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#dataColor configured data color}. * {@link ChatConfig#dataColor configured data color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#dataColor()} instead. * {@link FormattableChat#dataColor()} instead.
*/ */
public static FormatableChat dataText(Object plainText) { public static FormattableChat dataText(Object plainText) {
return text(plainText).dataColor(); return text(plainText).dataColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#decorationColor configured decorationColor color}. * {@link ChatConfig#decorationColor configured decorationColor color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#decorationColor()} instead. * {@link FormattableChat#decorationColor()} instead.
*/ */
public static FormatableChat decorationText(Object plainText) { public static FormattableChat decorationText(Object plainText) {
return text(plainText).decorationColor(); return text(plainText).decorationColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#successColor configured success color}. * {@link ChatConfig#successColor configured success color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#successColor()} instead. * {@link FormattableChat#successColor()} instead.
*/ */
public static FormatableChat successText(Object plainText) { public static FormattableChat successText(Object plainText) {
return text(plainText).successColor(); return text(plainText).successColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#failureColor configured failure color}. * {@link ChatConfig#failureColor configured failure color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#failureColor()} instead. * {@link FormattableChat#failureColor()} instead.
*/ */
public static FormatableChat failureText(Object plainText) { public static FormattableChat failureText(Object plainText) {
return text(plainText).failureColor(); return text(plainText).failureColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its main text content, and colored in white in * Creates a {@link FormattableChat} with the provided legacy text as its main text content, and colored in white in
* case there is no color on the generated parent component. * case there is no color on the generated parent component.
* @param legacyText the legacy text to use as the content. * @param legacyText the legacy text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#failureColor()} instead. * {@link FormattableChat#failureColor()} instead.
*/ */
public static FormatableChat playerNameText(String legacyText) { public static FormattableChat playerNameText(String legacyText) {
FormatableChat fc = legacyText(legacyText); FormattableChat fc = legacyText(legacyText);
fc.builder.colorIfAbsent(NamedTextColor.WHITE); fc.builder.colorIfAbsent(NamedTextColor.WHITE);
return fc; return fc;
} }
/** /**
* Creates a {@link FormatableChat} from the provided {@link Component}, coloring in white the generated parent * Creates a {@link FormattableChat} from the provided {@link Component}, coloring in white the generated parent
* component in case there is no color defined. * component in case there is no color defined.
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
* will be untouched. * will be untouched.
* @param c the {@link Component}. * @param c the {@link Component}.
* @return a new {@link FormatableChat}. * @return a new {@link FormattableChat}.
*/ */
public static FormatableChat playerNameComponent(ComponentLike c) { public static FormattableChat playerNameComponent(ComponentLike c) {
FormatableChat fc = chatComponent(c); FormattableChat fc = chatComponent(c);
fc.builder.colorIfAbsent(NamedTextColor.WHITE); fc.builder.colorIfAbsent(NamedTextColor.WHITE);
return fc; return fc;
} }
@@ -238,32 +238,32 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} with the provided translation key and parameters. * Creates a {@link FormattableChat} with the provided translation key and parameters.
* @param key the translation key. * @param key the translation key.
* @param with the translation parameters. * @param with the translation parameters.
* @return a new {@link FormatableChat} with the provided translation key and parameters. * @return a new {@link FormattableChat} with the provided translation key and parameters.
*/ */
public static FormatableChat translation(String key, Object... with) { public static FormattableChat translation(String key, Object... with) {
return new FormatableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with))); return new FormattableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
} }
/** /**
* Creates a {@link FormatableChat} with the provided keybinding. * Creates a {@link FormattableChat} with the provided keybinding.
* @param key the keybinding to display. * @param key the keybinding to display.
* @return a new {@link FormatableChat} with the provided keybinding. * @return a new {@link FormattableChat} with the provided keybinding.
*/ */
public static FormatableChat keybind(String key) { public static FormattableChat keyBind(String key) {
return new FormatableChat(Component.keybind().keybind(key)); return new FormattableChat(Component.keybind().keybind(key));
} }
/** /**
* Creates a {@link FormatableChat} with the provided score name and objective. * Creates a {@link FormattableChat} with the provided score name and objective.
* @param name the score name. * @param name the score name.
* @param objective the score objective. * @param objective the score objective.
* @return a new {@link FormatableChat} with the provided score name and objective. * @return a new {@link FormattableChat} with the provided score name and objective.
*/ */
public static FormatableChat score(String name, String objective) { public static FormattableChat score(String name, String objective) {
return new FormatableChat(Component.score().name(name).objective(objective)); return new FormattableChat(Component.score().name(name).objective(objective));
} }
@@ -272,49 +272,49 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) { public static FormattableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
Objects.requireNonNull(url, "url"); Objects.requireNonNull(url, "url");
if (inner == null) if (inner == null)
inner = text(url); inner = text(url);
if (hover == null) if (hover == null)
hover = text(ChatUtil.wrapInLimitedPixels(url, 240)); hover = text(ChatUtil.wrapInLimitedPixels(url, 240));
return (FormatableChat) chat().clickURL(url).urlColor().hover(hover).then(inner); return (FormattableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
} }
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* <p> * <p>
* When hovered, the component will display the url. To customize the hover content, use * When hovered, the component will display the url. To customize the hover content, use
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}. * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(ComponentLike inner, String url) { public static FormattableChat clickableURL(ComponentLike inner, String url) {
return clickableURL(inner, url, null); return clickableURL(inner, url, null);
} }
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* <p> * <p>
* The text on which to click will be the URL itself. To configure the clicked text, use * The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}. * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(String url, HoverEventSource<?> hover) { public static FormattableChat clickableURL(String url, HoverEventSource<?> hover) {
return clickableURL(null, url, hover); return clickableURL(null, url, hover);
} }
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* <p> * <p>
* The text on which to click will be the URL itself. To configure the clicked text, use * The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #clickableURL(ComponentLike, String)}. * {@link #clickableURL(ComponentLike, String)}.
@@ -322,9 +322,9 @@ public abstract class ChatStatic {
* When hovered, the component will display the url. To customize the hover content, use * When hovered, the component will display the url. To customize the hover content, use
* {@link #clickableURL(String, HoverEventSource)}. * {@link #clickableURL(String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(String url) { public static FormattableChat clickableURL(String url) {
return clickableURL(null, url, null); return clickableURL(null, url, null);
} }
@@ -334,14 +334,14 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
Objects.requireNonNull(commandWithSlash, "commandWithSlash"); Objects.requireNonNull(commandWithSlash, "commandWithSlash");
if (!commandWithSlash.startsWith("/")) if (!commandWithSlash.startsWith("/"))
throw new IllegalArgumentException("commandWithSlash must start with a '/' character."); throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -349,39 +349,39 @@ public abstract class ChatStatic {
inner = text(commandWithSlash); inner = text(commandWithSlash);
if (hover == null) if (hover == null)
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240)); hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
return (FormatableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner); return (FormattableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
} }
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* <p> * <p>
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}. * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash) { public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
return clickableCommand(inner, commandWithSlash, null); return clickableCommand(inner, commandWithSlash, null);
} }
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}. * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
return clickableCommand(null, commandWithSlash, hover); return clickableCommand(null, commandWithSlash, hover);
} }
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableCommand(ComponentLike, String)}. * {@link #clickableCommand(ComponentLike, String)}.
@@ -389,10 +389,10 @@ public abstract class ChatStatic {
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableCommand(String, HoverEventSource)}. * {@link #clickableCommand(String, HoverEventSource)}.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(String commandWithSlash) { public static FormattableChat clickableCommand(String commandWithSlash) {
return clickableCommand(null, commandWithSlash, null); return clickableCommand(null, commandWithSlash, null);
} }
@@ -402,14 +402,14 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
Objects.requireNonNull(commandWithSlash, "commandWithSlash"); Objects.requireNonNull(commandWithSlash, "commandWithSlash");
if (!commandWithSlash.startsWith("/")) if (!commandWithSlash.startsWith("/"))
throw new IllegalArgumentException("commandWithSlash must start with a '/' character."); throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -417,39 +417,39 @@ public abstract class ChatStatic {
inner = text(commandWithSlash); inner = text(commandWithSlash);
if (hover == null) if (hover == null)
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240)); hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
return (FormatableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner); return (FormattableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
} }
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* <p> * <p>
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}. * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash) { public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
return clickableSuggest(inner, commandWithSlash, null); return clickableSuggest(inner, commandWithSlash, null);
} }
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}. * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
return clickableSuggest(null, commandWithSlash, hover); return clickableSuggest(null, commandWithSlash, hover);
} }
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableSuggest(ComponentLike, String)}. * {@link #clickableSuggest(ComponentLike, String)}.
@@ -457,10 +457,10 @@ public abstract class ChatStatic {
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableSuggest(String, HoverEventSource)}. * {@link #clickableSuggest(String, HoverEventSource)}.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(String commandWithSlash) { public static FormattableChat clickableSuggest(String commandWithSlash) {
return clickableSuggest(null, commandWithSlash, null); return clickableSuggest(null, commandWithSlash, null);
} }
@@ -472,112 +472,112 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} filling a chat line with decoration and a left-aligned text. * Creates a {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
* @param text the text aligned to the left. * @param text the text aligned to the left.
* @param decorationChar the character used for decoration around the text. * @param decorationChar the character used for decoration around the text.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with decoration and a left-aligned text. * @return a new {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
* @see ChatFilledLine#leftText(ComponentLike) * @see ChatFilledLine#leftText(ComponentLike)
*/ */
public static FormatableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat(); return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color and a left-aligned text. * color and a left-aligned text.
* @param text the text aligned to the left. * @param text the text aligned to the left.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a left-aligned text. * and color and a left-aligned text.
* @see ChatFilledLine#leftText(ComponentLike) * @see ChatFilledLine#leftText(ComponentLike)
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat leftText(ComponentLike text, boolean console) { public static FormattableChat leftText(ComponentLike text, boolean console) {
return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat(); return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with decoration and a right-aligned text. * Creates a {@link FormattableChat} filling a chat line with decoration and a right-aligned text.
* @param text the text aligned to the right. * @param text the text aligned to the right.
* @param decorationChar the character used for decoration around the text. * @param decorationChar the character used for decoration around the text.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with decoration and a right-aligned * @return a new {@link FormattableChat} filling a chat line with decoration and a right-aligned
* text. * text.
* @see ChatFilledLine#rightText(ComponentLike) * @see ChatFilledLine#rightText(ComponentLike)
*/ */
public static FormatableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat(); return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color and a right-aligned text. * color and a right-aligned text.
* @param text the text aligned to the right. * @param text the text aligned to the right.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a right-aligned text. * and color and a right-aligned text.
* @see ChatFilledLine#rightText(ComponentLike) * @see ChatFilledLine#rightText(ComponentLike)
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat rightText(ComponentLike text, boolean console) { public static FormattableChat rightText(ComponentLike text, boolean console) {
return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat(); return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with decoration and a centered text. * Creates a {@link FormattableChat} filling a chat line with decoration and a centered text.
* @param text the text aligned to the center. * @param text the text aligned to the center.
* @param decorationChar the character used for decoration around the text. * @param decorationChar the character used for decoration around the text.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with decoration and a centered text. * @return a new {@link FormattableChat} filling a chat line with decoration and a centered text.
* @see ChatFilledLine#centerText(ComponentLike) * @see ChatFilledLine#centerText(ComponentLike)
*/ */
public static FormatableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat(); return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color and a centered text. * color and a centered text.
* @param text the text aligned to the center. * @param text the text aligned to the center.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a centered text. * and color and a centered text.
* @see ChatFilledLine#centerText(ComponentLike) * @see ChatFilledLine#centerText(ComponentLike)
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat centerText(ComponentLike text, boolean console) { public static FormattableChat centerText(ComponentLike text, boolean console) {
return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat(); return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with a decoration character and color. * Creates a {@link FormattableChat} filling a chat line with a decoration character and color.
* @param decorationChar the character used for decoration. * @param decorationChar the character used for decoration.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color. * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
* @see ChatFilledLine#filled() * @see ChatFilledLine#filled()
*/ */
public static FormatableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat(); return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color. * color.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color. * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
* @see ChatFilledLine#filled() * @see ChatFilledLine#filled()
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat filledLine(boolean console) { public static FormattableChat filledLine(boolean console) {
return ChatFilledLine.filled().console(console).toChat(); return ChatFilledLine.filled().console(console).toChat();
} }

View File

@@ -1,6 +1,6 @@
package fr.pandacube.lib.chat; package fr.pandacube.lib.chat;
import fr.pandacube.lib.chat.Chat.FormatableChat; import fr.pandacube.lib.chat.Chat.FormattableChat;
import net.kyori.adventure.text.Component; import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentLike; import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.TextComponent; import net.kyori.adventure.text.TextComponent;
@@ -152,7 +152,7 @@ public class ChatUtil {
else else
first = false; first = false;
FormatableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page)); FormattableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
if (page == currentPage) { if (page == currentPage) {
pDisplay.highlightedCommandColor(); pDisplay.highlightedCommandColor();
} }
@@ -180,12 +180,12 @@ public class ChatUtil {
* @param elements the components to join. * @param elements the components to join.
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators. * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
*/ */
public static FormatableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) { public static FormattableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
int size = elements == null ? 0 : elements.size(); int size = elements == null ? 0 : elements.size();
int last = size - 1; int last = size - 1;
return switch (size) { return switch (size) {
case 0, 1, 2 -> join(finalSeparator, elements); case 0, 1, 2 -> join(finalSeparator, elements);
default -> (FormatableChat) join(regularSeparator, elements.subList(0, last)) default -> (FormattableChat) join(regularSeparator, elements.subList(0, last))
.then(finalSeparator) .then(finalSeparator)
.then(elements.get(last)); .then(elements.get(last));
}; };
@@ -202,8 +202,8 @@ public class ChatUtil {
* @param elements the components to join. * @param elements the components to join.
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators. * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
*/ */
public static FormatableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) { public static FormattableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
FormatableChat c = chat(); FormattableChat c = chat();
if (elements == null) if (elements == null)
return c; return c;
boolean first = true; boolean first = true;
@@ -596,7 +596,7 @@ public class ChatUtil {
for (int i = 0; i < sizes.length; i++) { for (int i = 0; i < sizes.length; i++) {
sumSizes += sizes[i]; sumSizes += sizes[i];
FormatableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i])); FormattableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
if (colors != null && i < colors.length && colors[i] != null) if (colors != null && i < colors.length && colors[i] != null)
subC.color(colors[i]); subC.color(colors[i]);

View File

@@ -27,21 +27,11 @@
<artifactId>pandalib-core</artifactId> <artifactId>pandalib-core</artifactId>
<version>${project.version}</version> <version>${project.version}</version>
</dependency> </dependency>
<dependency>
<groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-reflect</artifactId>
<version>${project.version}</version>
</dependency>
<dependency> <dependency>
<groupId>fr.pandacube.lib</groupId> <groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-commands</artifactId> <artifactId>pandalib-commands</artifactId>
<version>${project.version}</version> <version>${project.version}</version>
</dependency> </dependency>
<dependency>
<groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-config</artifactId>
<version>${project.version}</version>
</dependency>
<dependency> <dependency>
<groupId>net.md-5</groupId> <groupId>net.md-5</groupId>
<artifactId>bungeecord-log</artifactId> <artifactId>bungeecord-log</artifactId>

View File

@@ -1,22 +1,25 @@
package fr.pandacube.lib.cli; package fr.pandacube.lib.cli;
import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
import fr.pandacube.lib.cli.log.CLILogger;
import fr.pandacube.lib.util.log.Log;
import org.jline.reader.EndOfFileException;
import org.jline.reader.LineReader;
import org.jline.reader.LineReaderBuilder;
import org.jline.reader.UserInterruptException;
import org.jline.terminal.Terminal;
import org.jline.terminal.TerminalBuilder;
import java.io.IOException; import java.io.IOException;
import java.util.logging.Logger; import java.util.logging.Logger;
import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
import fr.pandacube.lib.cli.log.CLILogger;
import jline.console.ConsoleReader;
import org.fusesource.jansi.AnsiConsole;
import fr.pandacube.lib.util.log.Log;
/** /**
* Class to handle general standard IO operation for a CLI application. It uses Jlines {@link ConsoleReader} for the * Class to handle general standard IO operation for a CLI application. It uses Jlines {@link LineReader} for the
* console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands. * console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands.
*/ */
public class CLI extends Thread { public class CLI extends Thread {
private final ConsoleReader reader; private final LineReader reader;
private final Logger logger; private final Logger logger;
@@ -28,10 +31,11 @@ public class CLI extends Thread {
super("Console Thread"); super("Console Thread");
setDaemon(true); setDaemon(true);
AnsiConsole.systemInstall(); Terminal terminal = TerminalBuilder.builder().build();
reader = new ConsoleReader(); reader = LineReaderBuilder.builder().terminal(terminal)
reader.setPrompt(">"); .completer(CLIBrigadierDispatcher.instance)
reader.addCompleter(CLIBrigadierDispatcher.instance); .build()
;
// configure logger's formatter // configure logger's formatter
System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss"); System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss");
@@ -40,10 +44,10 @@ public class CLI extends Thread {
/** /**
* Gets the Jline {@link ConsoleReader} of this CLI instance. * Gets the Jline {@link LineReader} of this CLI instance.
* @return the Jline {@link ConsoleReader} of this CLI instance. * @return the Jline {@link LineReader} of this CLI instance.
*/ */
public ConsoleReader getConsoleReader() { public LineReader getConsoleReader() {
return reader; return reader;
} }
@@ -65,15 +69,14 @@ public class CLI extends Thread {
int i = 0; int i = 0;
String line; String line;
try { try {
while((line = reader.readLine()) != null) { while((line = reader.readLine(">")) != null) {
if (line.trim().equals("")) if (line.trim().isEmpty())
continue; continue;
String cmdLine = line; String cmdLine = line;
new Thread(() -> CLIBrigadierDispatcher.instance.execute(cmdLine), "CLICmdThread #"+(i++)).start(); Thread.ofVirtual().name("CLICmdThread #"+(i++))
} .start(() -> CLIBrigadierDispatcher.instance.execute(cmdLine));
} catch (IOException e) {
Log.severe(e);
} }
} catch (UserInterruptException | EndOfFileException ignore) { }
} }

View File

@@ -32,6 +32,7 @@ public abstract class CLIApplication {
/** /**
* Creates a new application instance. * Creates a new application instance.
*/ */
@SuppressWarnings("CallToPrintStackTrace")
protected CLIApplication() { protected CLIApplication() {
instance = this; instance = this;
CLI tmpCLI = null; CLI tmpCLI = null;

View File

@@ -39,13 +39,6 @@ public abstract class CLIBrigadierCommand extends BrigadierCommand<CLICommandSen
protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand(); protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand();
protected String[] getAliases() {
return new String[0];
}
public boolean isPlayer(CLICommandSender sender) { public boolean isPlayer(CLICommandSender sender) {
return sender.isPlayer(); return sender.isPlayer();

View File

@@ -3,8 +3,11 @@ package fr.pandacube.lib.cli.commands;
import com.mojang.brigadier.suggestion.Suggestion; import com.mojang.brigadier.suggestion.Suggestion;
import com.mojang.brigadier.suggestion.Suggestions; import com.mojang.brigadier.suggestion.Suggestions;
import fr.pandacube.lib.commands.BrigadierDispatcher; import fr.pandacube.lib.commands.BrigadierDispatcher;
import jline.console.completer.Completer;
import net.kyori.adventure.text.ComponentLike; import net.kyori.adventure.text.ComponentLike;
import org.jline.reader.Candidate;
import org.jline.reader.Completer;
import org.jline.reader.LineReader;
import org.jline.reader.ParsedLine;
import java.util.List; import java.util.List;
@@ -39,17 +42,15 @@ public class CLIBrigadierDispatcher extends BrigadierDispatcher<CLICommandSender
@Override @Override
public int complete(String buffer, int cursor, List<CharSequence> candidates) { public void complete(LineReader lineReader, ParsedLine parsedLine, List<Candidate> candidates) {
String bufferBeforeCursor = parsedLine.line().substring(0, parsedLine.cursor());
String bufferBeforeCursor = buffer.substring(0, cursor);
Suggestions completeResult = getSuggestions(bufferBeforeCursor); Suggestions completeResult = getSuggestions(bufferBeforeCursor);
completeResult.getList().stream() completeResult.getList().stream()
.map(Suggestion::getText) .map(Suggestion::getText)
.map(Candidate::new)
.forEach(candidates::add); .forEach(candidates::add);
return completeResult.getRange().getStart();
} }
/** /**

View File

@@ -41,6 +41,9 @@ public interface CLICommandSender extends Audience {
*/ */
void sendMessage(String message); void sendMessage(String message);
@SuppressWarnings({"UnstableApiUsage", "deprecation"})
@Override // force implementation of super-interface default method @Override // force implementation of super-interface default method
void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type); void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type);
} }

View File

@@ -38,7 +38,7 @@ public class CLIConsoleCommandSender implements CLICommandSender {
} }
@Override @Override
public void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type) { public void sendMessage(@NotNull Identity source, @NotNull Component message, @SuppressWarnings({"UnstableApiUsage", "deprecation"}) @NotNull MessageType type) {
sendMessage(Chat.chatComponent(message).getLegacyText()); sendMessage(Chat.chatComponent(message).getLegacyText());
} }
} }

View File

@@ -14,7 +14,7 @@ import com.mojang.brigadier.tree.CommandNode;
import com.mojang.brigadier.tree.LiteralCommandNode; import com.mojang.brigadier.tree.LiteralCommandNode;
import com.mojang.brigadier.tree.RootCommandNode; import com.mojang.brigadier.tree.RootCommandNode;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.chat.Chat;
import fr.pandacube.lib.chat.Chat.FormatableChat; import fr.pandacube.lib.chat.Chat.FormattableChat;
import fr.pandacube.lib.chat.ChatTreeNode; import fr.pandacube.lib.chat.ChatTreeNode;
import fr.pandacube.lib.cli.CLIApplication; import fr.pandacube.lib.cli.CLIApplication;
import fr.pandacube.lib.util.log.Log; import fr.pandacube.lib.util.log.Log;
@@ -195,13 +195,13 @@ public class CommandAdmin extends CLIBrigadierCommand {
private Component displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) { private Component displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) {
if (node == null) if (node == null)
throw new IllegalArgumentException("node must not be null"); throw new IllegalArgumentException("node must not be null");
FormatableChat d; FormattableChat d;
if (node instanceof RootCommandNode) { if (node instanceof RootCommandNode) {
d = text("(root)").italic() d = text("(root)").italic()
.hover("Root command node"); .hover("Root command node");
} }
else if (node instanceof ArgumentCommandNode) { else if (node instanceof ArgumentCommandNode<?, ?> argNode) {
ArgumentType<?> type = ((ArgumentCommandNode<?, ?>) node).getType(); ArgumentType<?> type = argNode.getType();
String typeStr = type.getClass().getSimpleName(); String typeStr = type.getClass().getSimpleName();
if (type instanceof IntegerArgumentType if (type instanceof IntegerArgumentType
|| type instanceof LongArgumentType || type instanceof LongArgumentType

View File

@@ -45,7 +45,7 @@
<dependency> <dependency>
<groupId>com.mojang</groupId> <groupId>com.mojang</groupId>
<artifactId>brigadier</artifactId> <artifactId>brigadier</artifactId>
<version>1.0.18</version> <version>${brigadier.version}</version>
</dependency> </dependency>
</dependencies> </dependencies>

View File

@@ -3,35 +3,39 @@ package fr.pandacube.lib.commands;
import java.util.logging.Logger; import java.util.logging.Logger;
/** /**
* Throw an instance of this exception to indicate to the plugin command handler that the user has missused the command. * Throw an instance of this exception to indicate to the plugin command handler that the user has badly used the command.
* The message, if provided, must indicate the reason of the mussusage of the command. It will be displayed on the * The message, if provided, must indicate the reason of the bad usage of the command. It will be displayed on the
* screen with eventual indications of how to use the command (help command for example). * screen with eventual indications of how to use the command (help command for example).
* If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}. * If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}.
* *
*/ */
public class BadCommandUsage extends RuntimeException { public class BadCommandUsage extends RuntimeException {
/** Constructs a new runtime exception with no message or cause. /**
* Constructs a new runtime exception with no message or cause.
*/ */
public BadCommandUsage() { public BadCommandUsage() {
super(); super();
} }
/** Constructs a new runtime exception with the specified cause. /**
* Constructs a new runtime exception with the specified cause.
* @param cause the cause. * @param cause the cause.
*/ */
public BadCommandUsage(Throwable cause) { public BadCommandUsage(Throwable cause) {
super(cause); super(cause);
} }
/** Constructs a new runtime exception with the specified message. /**
* Constructs a new runtime exception with the specified message.
* @param message the message. * @param message the message.
*/ */
public BadCommandUsage(String message) { public BadCommandUsage(String message) {
super(message); super(message);
} }
/** Constructs a new runtime exception with the specified message and cause. /**
* Constructs a new runtime exception with the specified message and cause.
* @param message the message. * @param message the message.
* @param cause the cause. * @param cause the cause.
*/ */

View File

@@ -223,14 +223,14 @@ public abstract class BrigadierCommand<S> {
/** /**
* Wraps the provided {@link SuggestionsSupplier} into a Brigadiers {@link SuggestionProvider}. * Wraps the provided {@link SuggestionsSupplier} into a Brigadiers {@link SuggestionProvider}.
* @param suggestions the suggestions to wrap. * @param suggestions the suggestions to wrap.
* @param senderUnwrapper function to convert the command sender provided by brigadier into the command sender * @param senderUnWrapper function to convert the command sender provided by brigadier into the command sender
* supported by {@link SuggestionsSupplier}. * supported by {@link SuggestionsSupplier}.
* @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}. * @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}.
* @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}. * @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}.
*/ */
protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnwrapper) { protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnWrapper) {
return (context, builder) -> { return (context, builder) -> {
AS sender = senderUnwrapper.apply(context.getSource()); AS sender = senderUnWrapper.apply(context.getSource());
String message = builder.getInput(); String message = builder.getInput();
try { try {
int tokenStartPos = builder.getStart(); int tokenStartPos = builder.getStart();

View File

@@ -241,7 +241,7 @@ public interface SuggestionsSupplier<S> {
return (s, ti, token, a) -> { return (s, ti, token, a) -> {
try { try {
List<Long> proposedValues = new ArrayList<>(); List<Long> proposedValues = new ArrayList<>();
if (token.length() == 0) { if (token.isEmpty()) {
long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9); long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9);
long end = Math.min(Math.min(start + 9, max), 9); long end = Math.min(Math.min(start + 9, max), 9);
ListUtil.addLongRangeToList(proposedValues, start, end); ListUtil.addLongRangeToList(proposedValues, start, end);
@@ -399,7 +399,7 @@ public interface SuggestionsSupplier<S> {
*/ */
default SuggestionsSupplier<S> quotableString() { default SuggestionsSupplier<S> quotableString() {
return (s, ti, token, a) -> { return (s, ti, token, a) -> {
boolean startWithQuote = token.length() > 0 && (token.charAt(0) == '"' || token.charAt(0) == '\''); boolean startWithQuote = !token.isEmpty() && (token.charAt(0) == '"' || token.charAt(0) == '\'');
String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token; String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token;
String[] argsCopy = Arrays.copyOf(a, a.length); String[] argsCopy = Arrays.copyOf(a, a.length);
argsCopy[a.length - 1] = realToken; argsCopy[a.length - 1] = realToken;

View File

@@ -3,6 +3,7 @@ package fr.pandacube.lib.core.json;
import com.google.gson.Gson; import com.google.gson.Gson;
import com.google.gson.GsonBuilder; import com.google.gson.GsonBuilder;
import com.google.gson.JsonParseException; import com.google.gson.JsonParseException;
import com.google.gson.Strictness;
import com.google.gson.ToNumberStrategy; import com.google.gson.ToNumberStrategy;
import com.google.gson.TypeAdapter; import com.google.gson.TypeAdapter;
import com.google.gson.TypeAdapterFactory; import com.google.gson.TypeAdapterFactory;
@@ -32,7 +33,7 @@ public class Json {
boolean isFloat = value.contains("."); boolean isFloat = value.contains(".");
if (isFloat) { if (isFloat) {
// if float, will only parse to Double // if is float, will only parse to Double
// (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat) // (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat)
try { try {
Double d = Double.valueOf(value); Double d = Double.valueOf(value);
@@ -74,21 +75,21 @@ public class Json {
public static final Gson gson = build(Function.identity()); public static final Gson gson = build(Function.identity());
/** /**
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#setPrettyPrinting()} and support * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#setPrettyPrinting()} and support
* for Java records and additional {@link TypeAdapterFactory} provided with * for Java records and additional {@link TypeAdapterFactory} provided with
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}. * {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
*/ */
public static final Gson gsonPrettyPrinting = build(GsonBuilder::setPrettyPrinting); public static final Gson gsonPrettyPrinting = build(GsonBuilder::setPrettyPrinting);
/** /**
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()} and support for * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()} and support for
* Java records and additional {@link TypeAdapterFactory} provided with * Java records and additional {@link TypeAdapterFactory} provided with
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}. * {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
*/ */
public static final Gson gsonSerializeNulls = build(GsonBuilder::serializeNulls); public static final Gson gsonSerializeNulls = build(GsonBuilder::serializeNulls);
/** /**
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()}, * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()},
* {@link GsonBuilder#setPrettyPrinting()} and support for Java records and additional {@link TypeAdapterFactory} * {@link GsonBuilder#setPrettyPrinting()} and support for Java records and additional {@link TypeAdapterFactory}
* provided with {@link #registerTypeAdapterFactory(TypeAdapterFactory)}. * provided with {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
*/ */
@@ -105,7 +106,7 @@ public class Json {
.registerTypeAdapterFactory(new CustomAdapterFactory()) .registerTypeAdapterFactory(new CustomAdapterFactory())
.disableHtmlEscaping() .disableHtmlEscaping()
.setObjectToNumberStrategy(YAML_EQUIVALENT_NUMBER_STRATEGY) .setObjectToNumberStrategy(YAML_EQUIVALENT_NUMBER_STRATEGY)
.setLenient(); .setStrictness(Strictness.LENIENT);
return builderModifier.apply(base).create(); return builderModifier.apply(base).create();
} }

View File

@@ -134,30 +134,30 @@ public class ThrowableAdapter implements JsonSerializer<Throwable>, JsonDeserial
} }
private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) { private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) {
BiFunction<String, Throwable, T> constructor = null; BiFunction<String, Throwable, T> constructionFunction = null;
// try (String, Throwable) constructor // try (String, Throwable) constructor
try { try {
Constructor<T> constr = clazz.getConstructor(String.class, Throwable.class); Constructor<T> constructor = clazz.getConstructor(String.class, Throwable.class);
if (constr.canAccess(null)) { if (constructor.canAccess(null)) {
constructor = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m, t)); constructionFunction = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m, t));
} }
} catch (ReflectiveOperationException ignore) { } } catch (ReflectiveOperationException ignore) { }
// try (String) constructor // try (String) constructor
try { try {
Constructor<T> constr = clazz.getConstructor(String.class); Constructor<T> constructor = clazz.getConstructor(String.class);
if (constr.canAccess(null)) { if (constructor.canAccess(null)) {
constructor = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m))); constructionFunction = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m)));
} }
} catch (ReflectiveOperationException ignore) { } } catch (ReflectiveOperationException ignore) { }
if (constructor == null) { if (constructionFunction == null) {
Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String)."); Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String).");
return null; return null;
} }
return new ThrowableSubAdapter<>(constructor); return new ThrowableSubAdapter<>(constructionFunction);
} }

View File

@@ -37,8 +37,8 @@ public class MinecraftVersionUtil {
/** /**
* Decompose a version string into a series of integers. * Decompose a version string into a series of integers.
* @param v a string representation of a version (eg. 1.19.1). * @param v a string representation of a version (e.g. 1.19.1).
* @return an array of int representing the provided version (eg. [1, 19, 1]). * @return an array of int representing the provided version (e.g. [1, 19, 1]).
*/ */
public static int[] decomposedVersion(String v) { public static int[] decomposedVersion(String v) {
try { try {

View File

@@ -68,11 +68,11 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
private static void init() { private static void init() {
// try online source first // try online source first
try { try (HttpClient cl = HttpClient.newBuilder()
HttpResponse<String> response = HttpClient.newBuilder()
.connectTimeout(Duration.ofSeconds(5)) .connectTimeout(Duration.ofSeconds(5))
.build() .build()) {
.send(HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(), HttpResponse<String> response = cl.send(
HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
BodyHandlers.ofString() BodyHandlers.ofString()
); );
if (response.statusCode() == 200) { if (response.statusCode() == 200) {
@@ -123,7 +123,7 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
/** /**
* Gets the {@link ProtocolVersion} associated with the provided Minecraft version. * Gets the {@link ProtocolVersion} associated with the provided Minecraft version.
* @param version The Minecraft version, in the format "X.X[.X]" (eg. "1.17" or "1.8.8"). * @param version The Minecraft version, in the format "X.X[.X]" (e.g. "1.17" or "1.8.8").
* @return an instance of {@link ProtocolVersion}. * @return an instance of {@link ProtocolVersion}.
*/ */
public static ProtocolVersion ofVersion(String version) { public static ProtocolVersion ofVersion(String version) {

View File

@@ -71,7 +71,11 @@
"1.21.1": 767, "1.21.1": 767,
"1.21.2": 768, "1.21.2": 768,
"1.21.3": 768, "1.21.3": 768,
"1.21.4": 769 "1.21.4": 769,
"1.21.5": 770,
"1.21.6": 771,
"1.21.7": 772,
"1.21.8": 772
}, },
"versionsOfProtocol": { "versionsOfProtocol": {
"4": [ "4": [
@@ -233,6 +237,16 @@
], ],
"769": [ "769": [
"1.21.4" "1.21.4"
],
"770": [
"1.21.5"
],
"771": [
"1.21.6"
],
"772": [
"1.21.7",
"1.21.8"
] ]
} }
} }

View File

@@ -227,7 +227,7 @@ public final class DB {
*/ */
public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException { public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException {
SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset); SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset);
return (elements.size() == 0) ? null : elements.get(0); return (elements.isEmpty()) ? null : elements.get(0);
} }
/** /**

View File

@@ -42,7 +42,7 @@ public class SQLType<T> {
@Override @Override
public boolean equals(Object obj) { public boolean equals(Object obj) {
return obj instanceof SQLType o return obj instanceof SQLType<?> o
&& toString().equals(o.toString()); && toString().equals(o.toString());
} }

View File

@@ -16,7 +16,7 @@
<repositories> <repositories>
<repository> <repository>
<id>papermc</id> <id>papermc</id>
<url>https://papermc.io/repo/repository/maven-public/</url> <url>https://repo.papermc.io/repository/maven-public/</url>
</repository> </repository>
<!-- WorldEdit --> <!-- WorldEdit -->

View File

@@ -7,6 +7,7 @@ import net.milkbowl.vault.chat.Chat;
import net.milkbowl.vault.permission.Permission; import net.milkbowl.vault.permission.Permission;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.OfflinePlayer; import org.bukkit.OfflinePlayer;
import org.bukkit.entity.Player;
import org.bukkit.plugin.ServicePriority; import org.bukkit.plugin.ServicePriority;
import java.util.List; import java.util.List;
@@ -120,6 +121,13 @@ import java.util.List;
return true; return true;
} }
@Override
public boolean playerAdd(Player player, String permission) {
// override because the super class sets the permission on the current world of the player, that is probably
// not intended by the calling plugin
return playerAdd(null, player, permission);
}
@Deprecated @Deprecated
@Override @Override
public boolean playerRemove(String world, String player, String permission) { public boolean playerRemove(String world, String player, String permission) {
@@ -136,6 +144,14 @@ import java.util.List;
return true; return true;
} }
@Override
public boolean playerRemove(Player player, String permission) {
// to stay coherent with the override of #playerAdd(Player, String), we also override this method.
// Will try first to remove the permission on the world itself (like super-method), then if it doesn't exist,
// removes on the server level.
return super.playerRemove(player, permission) || playerRemove(null, player, permission);
}
@Override @Override
public boolean groupHas(String world, String group, String permission) { public boolean groupHas(String world, String group, String permission) {
checkEnabled(); checkEnabled();

View File

@@ -16,12 +16,17 @@
<repositories> <repositories>
<repository> <repository>
<id>papermc</id> <id>papermc</id>
<url>https://papermc.io/repo/repository/maven-public/</url> <url>https://repo.papermc.io/repository/maven-public/</url>
</repository> </repository>
<repository> <repository>
<id>fabricmc</id> <id>fabricmc</id>
<url>https://maven.fabricmc.net/</url> <url>https://maven.fabricmc.net/</url>
</repository> </repository>
<repository>
<id>minecraft-libraries</id>
<name>Minecraft Libraries</name>
<url>https://libraries.minecraft.net</url>
</repository>
</repositories> </repositories>
<dependencies> <dependencies>
@@ -84,6 +89,12 @@
<scope>provided</scope> <scope>provided</scope>
</dependency> </dependency>
<dependency>
<groupId>com.mojang</groupId>
<artifactId>datafixerupper</artifactId>
<version>${datafixerupper.version}</version>
</dependency>
<!-- Paper --> <!-- Paper -->
<dependency> <dependency>
<groupId>io.papermc.paper</groupId> <groupId>io.papermc.paper</groupId>

View File

@@ -18,8 +18,8 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftVector;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper; import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode; import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
import fr.pandacube.lib.players.standalone.AbstractOffPlayer; import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer; import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
import fr.pandacube.lib.players.standalone.AbstractPlayerManager; import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
@@ -46,7 +46,6 @@ import java.util.Set;
import java.util.function.Predicate; import java.util.function.Predicate;
import java.util.stream.Stream; import java.util.stream.Stream;
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.unwrap;
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap; import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
/** /**
@@ -199,6 +198,10 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
registeredAliases = new HashSet<>(event.registrar().register(commandNode, description, List.of(aliases))); registeredAliases = new HashSet<>(event.registrar().register(commandNode, description, List.of(aliases)));
doPostRegistrationFixes(); doPostRegistrationFixes();
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> registeredNode = wrap(vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()), fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
if (registrationPolicy == RegistrationPolicy.ALL) { if (registrationPolicy == RegistrationPolicy.ALL) {
// enforce registration of aliases // enforce registration of aliases
for (String alias : aliases) { for (String alias : aliases) {
@@ -221,11 +224,12 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
for (String aliasToForce : forceRegistrationAgain) { for (String aliasToForce : forceRegistrationAgain) {
CommandNode<CommandSourceStack> actualNode = vanillaPaperDispatcher.getRoot().getChild(aliasToForce); CommandNode<CommandSourceStack> actualNode = vanillaPaperDispatcher.getRoot().getChild(aliasToForce);
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(actualNode, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
if (actualNode != null) { if (actualNode != null) {
//Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode) + "?"); if (wrappedCommandNode.apiCommandMeta() != null) {
if (PluginCommandNode.REFLECT.get().isInstance(actualNode)) { APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
PluginCommandNode pcn = wrap(actualNode, PluginCommandNode.class); if (meta.plugin().equals(plugin))
if (pcn.getPlugin().equals(plugin))
return; return;
} }
else if (BukkitCommandNode.REFLECT.get().isInstance(actualNode)) { else if (BukkitCommandNode.REFLECT.get().isInstance(actualNode)) {
@@ -233,12 +237,16 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
if (bcn.getBukkitCommand() instanceof PluginCommand pc && pc.getPlugin().equals(plugin)) if (bcn.getBukkitCommand() instanceof PluginCommand pc && pc.getPlugin().equals(plugin))
return; return;
} }
Log.warning("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode));
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(aliasToForce)); vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(aliasToForce));
} }
/*else { /*else {
Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias."); Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
}*/ }*/
LiteralCommandNode<CommandSourceStack> newPCN = unwrap(new PluginCommandNode(aliasToForce, plugin.getPluginMeta(), commandNode, description)); LiteralCommandNode<CommandSourceStack> newPCN = getAliasNode(commandNode, aliasToForce);
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedNewPCN = wrap(newPCN, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
wrappedNewPCN.apiCommandMeta(registeredNode.apiCommandMeta());
vanillaPaperDispatcher.getRoot().addChild(newPCN); vanillaPaperDispatcher.getRoot().addChild(newPCN);
} }
}); });
@@ -296,11 +304,8 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
} }
private static String getCommandIdentity(CommandNode<CommandSourceStack> command) { private static String getCommandIdentity(CommandNode<CommandSourceStack> command) {
if (PluginCommandNode.REFLECT.get().isInstance(command)) {
PluginCommandNode wrappedPCN = wrap(command, PluginCommandNode.class); if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
return "Node /" + command.getName() + " from plugin " + wrappedPCN.getPlugin().getName();
}
else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class); BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
Command bukkitCmd = wrappedBCN.getBukkitCommand(); Command bukkitCmd = wrappedBCN.getBukkitCommand();
if (bukkitCmd instanceof PluginCommand cmd) { if (bukkitCmd instanceof PluginCommand cmd) {
@@ -317,17 +322,23 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
else else
return "Node /" + command.getName() + " wrapping " + bukkitCmd.getClass().getName() + " /" + bukkitCmd.getName(); return "Node /" + command.getName() + " wrapping " + bukkitCmd.getClass().getName() + " /" + bukkitCmd.getName();
} }
else {
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
if (wrappedCommandNode.apiCommandMeta() != null) {
APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
return "Node /" + command.getName() + " from plugin " + meta.plugin().getName();
}
else { else {
return "Node /" + command.getName() + " (unspecific)"; return "Node /" + command.getName() + " (unspecific)";
} }
} }
}
private static Boolean isPluginCommand(CommandNode<CommandSourceStack> command) { private static Boolean isPluginCommand(CommandNode<CommandSourceStack> command) {
if (PluginCommandNode.REFLECT.get().isInstance(command)) { if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
return true;
}
else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class); BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
Command bukkitCmd = wrappedBCN.getBukkitCommand(); Command bukkitCmd = wrappedBCN.getBukkitCommand();
if (bukkitCmd instanceof PluginCommand) { if (bukkitCmd instanceof PluginCommand) {
@@ -345,7 +356,9 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
return null; return null;
} }
else { else {
return false; @SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
return wrappedCommandNode.apiCommandMeta() != null;
} }
} }

View File

@@ -18,6 +18,11 @@ import java.util.Objects;
*/ */
public class DummyPlayerInventory extends InventoryWrapper implements PlayerInventory { public class DummyPlayerInventory extends InventoryWrapper implements PlayerInventory {
/**
* Total number of item slots in the player inventory.
*/
public static final int PLAYER_INVENTORY_SIZE = 43; // 36 base inventory + 4 armor slots + 1 off hand + 2 hidden slots (body and saddle)
private int heldItemSlot; private int heldItemSlot;
/** /**
@@ -27,8 +32,8 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
*/ */
public DummyPlayerInventory(Inventory base, int heldItemSlot) { public DummyPlayerInventory(Inventory base, int heldItemSlot) {
super(base); super(base);
if (base.getSize() < 41) if (base.getSize() < PLAYER_INVENTORY_SIZE)
throw new IllegalArgumentException("base inventory should have a size of 41 (" + base.getSize() + " given)."); throw new IllegalArgumentException("base inventory should have a size of " + PLAYER_INVENTORY_SIZE + " (" + base.getSize() + " given).");
if (heldItemSlot < 0 || heldItemSlot > 8) if (heldItemSlot < 0 || heldItemSlot > 8)
throw new IllegalArgumentException("heldItemSlot should be between 0 and 8 inclusive."); throw new IllegalArgumentException("heldItemSlot should be between 0 and 8 inclusive.");
this.heldItemSlot = heldItemSlot; this.heldItemSlot = heldItemSlot;
@@ -114,6 +119,40 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
setItem(36, boots); setItem(36, boots);
} }
/**
* Gets the item stack in the SADDLE {@link EquipmentSlot}.
* @return the SADDLE item stack.
*/
public ItemStack getSaddle() {
return getItem(42);
}
/**
* Puts the provided item stack in the SADDLE {@link EquipmentSlot}.
* @param saddle the item.
*/
public void setSaddle(@Nullable ItemStack saddle) {
setItem(42, saddle);
}
/**
* Gets the item stack in the BODY {@link EquipmentSlot}.
* @return the BODY item stack.
*/
public ItemStack getBody() {
return getItem(41);
}
/**
* Puts the provided item stack in the BODY {@link EquipmentSlot}.
* @param body the item.
*/
public void setBody(@Nullable ItemStack body) {
setItem(41, body);
}
@Override @Override
public void setItem(EquipmentSlot slot, ItemStack item) { public void setItem(EquipmentSlot slot, ItemStack item) {
Preconditions.checkArgument(slot != null, "slot must not be null"); Preconditions.checkArgument(slot != null, "slot must not be null");
@@ -125,7 +164,8 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
case LEGS -> this.setLeggings(item); case LEGS -> this.setLeggings(item);
case CHEST -> this.setChestplate(item); case CHEST -> this.setChestplate(item);
case HEAD -> this.setHelmet(item); case HEAD -> this.setHelmet(item);
default -> throw new IllegalArgumentException("Not implemented. This is a bug"); case BODY -> this.setBody(item);
case SADDLE -> this.setSaddle(item);
} }
} }
@@ -138,7 +178,8 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
case LEGS -> Objects.requireNonNullElseGet(this.getLeggings(), () -> new ItemStack(Material.AIR)); case LEGS -> Objects.requireNonNullElseGet(this.getLeggings(), () -> new ItemStack(Material.AIR));
case CHEST -> Objects.requireNonNullElseGet(this.getChestplate(), () -> new ItemStack(Material.AIR)); case CHEST -> Objects.requireNonNullElseGet(this.getChestplate(), () -> new ItemStack(Material.AIR));
case HEAD -> Objects.requireNonNullElseGet(this.getHelmet(), () -> new ItemStack(Material.AIR)); case HEAD -> Objects.requireNonNullElseGet(this.getHelmet(), () -> new ItemStack(Material.AIR));
case BODY -> new ItemStack(Material.AIR); // for horses/wolves armor case BODY -> Objects.requireNonNullElseGet(this.getBody(), () -> new ItemStack(Material.AIR)); // for horses/wolves armor
case SADDLE -> Objects.requireNonNullElseGet(this.getSaddle(), () -> new ItemStack(Material.AIR));
}; };
} }

View File

@@ -2,9 +2,14 @@ package fr.pandacube.lib.paper.inventory;
import com.google.common.collect.Streams; import com.google.common.collect.Streams;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.chat.Chat;
import io.papermc.paper.datacomponent.DataComponentType;
import io.papermc.paper.datacomponent.DataComponentType.Valued;
import io.papermc.paper.datacomponent.DataComponentTypes;
import io.papermc.paper.datacomponent.item.ResolvableProfile;
import net.kyori.adventure.text.Component; import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentLike; import net.kyori.adventure.text.ComponentLike;
import org.bukkit.Material; import org.bukkit.Material;
import org.bukkit.NamespacedKey;
import org.bukkit.enchantments.Enchantment; import org.bukkit.enchantments.Enchantment;
import org.bukkit.inventory.ItemFlag; import org.bukkit.inventory.ItemFlag;
import org.bukkit.inventory.ItemStack; import org.bukkit.inventory.ItemStack;
@@ -12,6 +17,7 @@ import org.bukkit.inventory.meta.Damageable;
import org.bukkit.inventory.meta.ItemMeta; import org.bukkit.inventory.meta.ItemMeta;
import java.util.Arrays; import java.util.Arrays;
import java.util.Collection;
import java.util.Collections; import java.util.Collections;
import java.util.List; import java.util.List;
import java.util.function.Consumer; import java.util.function.Consumer;
@@ -70,16 +76,11 @@ public class ItemStackBuilder {
private final ItemStack stack; private final ItemStack stack;
private ItemMeta cachedMeta;
private ItemStackBuilder(ItemStack base) { private ItemStackBuilder(ItemStack base) {
stack = base; stack = base;
} }
private ItemMeta getOrInitMeta() {
return (cachedMeta != null) ? cachedMeta : (cachedMeta = stack.getItemMeta());
}
/** /**
* Runs the provided updater on the {@link ItemMeta} instance of the built stack. * Runs the provided updater on the {@link ItemMeta} instance of the built stack.
* @param metaUpdater the updater that will modify the meta. * @param metaUpdater the updater that will modify the meta.
@@ -97,10 +98,7 @@ public class ItemStackBuilder {
* @return itself. * @return itself.
*/ */
public <T extends ItemMeta> ItemStackBuilder meta(Consumer<T> metaUpdater, Class<T> metaType) { public <T extends ItemMeta> ItemStackBuilder meta(Consumer<T> metaUpdater, Class<T> metaType) {
stack.editMeta(metaType, m -> { stack.editMeta(metaType, metaUpdater);
metaUpdater.accept(m);
cachedMeta = m;
});
return this; return this;
} }
@@ -166,7 +164,7 @@ public class ItemStackBuilder {
*/ */
public ItemStackBuilder addLoreAfter(List<? extends ComponentLike> lores) { public ItemStackBuilder addLoreAfter(List<? extends ComponentLike> lores) {
if (lores != null) { if (lores != null) {
List<Component> baseLore = getOrInitMeta().lore(); List<Component> baseLore = stack.getItemMeta().lore();
if (baseLore == null) baseLore = Collections.emptyList(); if (baseLore == null) baseLore = Collections.emptyList();
return rawLore( return rawLore(
Streams.concat( Streams.concat(
@@ -302,6 +300,107 @@ public class ItemStackBuilder {
} }
/**
* Sets a value for a data component of this item.
* @param dataType the data component type.
* @param dataValue the data component value.
* @return itself.
* @param <T> the data component API type.
*/
public <T> ItemStackBuilder data(Valued<T> dataType, T dataValue) {
stack.setData(dataType, dataValue);
return this;
}
/**
* Unset (set to empty) a value for a data component of this item.
* @param dataType the data component type.
* @return itself.
*/
public ItemStackBuilder unsetData(DataComponentType dataType) {
stack.unsetData(dataType);
return this;
}
/**
* Reset (act as default) a value for a data component of this item.
* @param dataType the data component type.
* @return itself.
*/
public ItemStackBuilder resetData(DataComponentType dataType) {
stack.resetData(dataType);
return this;
}
/**
* Sets the {@code can_break} data component to the provided list of {@link Material}.
* @param canBreak a list of {@link Material}.
* @return itself.
*/
public ItemStackBuilder canBreakMaterials(Collection<Material> canBreak) {
return canBreak(canBreak.stream().map(Material::getKey).toList());
}
/**
* Sets the {@code can_break} data component to the provided list of {@link NamespacedKey}.
* @param canBreak a list of block predicate. If empty, unsets the data component. If null, reset to default.
* @return itself.
*/
@SuppressWarnings("removal")
public ItemStackBuilder canBreak(Collection<NamespacedKey> canBreak) {
@SuppressWarnings("unchecked")
Collection<com.destroystokyo.paper.Namespaced> nsCanBreak = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canBreak;
return meta(m -> m.setDestroyableKeys(nsCanBreak));
/*
if (canBreak == null)
return resetData(DataComponentTypes.CAN_BREAK);
else if (canBreak.isEmpty())
return unsetData(DataComponentTypes.CAN_BREAK);
else
return data(DataComponentTypes.CAN_BREAK, ItemAdventurePredicate.itemAdventurePredicate(canBreak));*/
}
/**
* Sets the {@code can_place_on} data component to the provided list of {@link Material}.
* @param canPlaceOn a list of {@link Material}.
* @return itself.
*/
public ItemStackBuilder canPlaceOnMaterials(Collection<Material> canPlaceOn) {
return canPlaceOn(canPlaceOn.stream().map(Material::getKey).toList());
}
/**
* Sets the {@code can_place_on} data component to the provided list of {@link NamespacedKey}.
* @param canPlaceOn a list of block predicate. If empty, unsets the data component. If null, reset to default.
* @return itself.
*/
@SuppressWarnings("removal")
public ItemStackBuilder canPlaceOn(Collection<NamespacedKey> canPlaceOn) {
@SuppressWarnings("unchecked")
Collection<com.destroystokyo.paper.Namespaced> nsCanPlaceOn = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canPlaceOn;
return meta(m -> m.setPlaceableKeys(nsCanPlaceOn));
/* if (canPlaceOn == null)
return resetData(DataComponentTypes.CAN_PLACE_ON);
else if (canPlaceOn.isEmpty())
return unsetData(DataComponentTypes.CAN_PLACE_ON);
else
return data(DataComponentTypes.CAN_PLACE_ON, ItemAdventurePredicate.itemAdventurePredicate(canPlaceOn)); */
}
/**
* Sets the {@code profile} data component to the provided profile.
* @param profile the profile to use as the component value.
* @return itself.
*/
public ItemStackBuilder profile(ResolvableProfile profile) {
return data(DataComponentTypes.PROFILE, profile);
}
/** /**
* Build the {@link ItemStack}. * Build the {@link ItemStack}.
* @return the build item stack. * @return the build item stack.

View File

@@ -0,0 +1,126 @@
package fr.pandacube.lib.paper.inventory;
import com.destroystokyo.paper.profile.ProfileProperty;
import io.papermc.paper.datacomponent.item.ResolvableProfile;
import org.bukkit.Material;
import org.bukkit.inventory.ItemStack;
import java.util.Base64;
import java.util.regex.Pattern;
/**
* Represents some special mob heads, also support creating player skulls and custom skulls.
*/
public enum Skull {
/** Jungle wood arrow left. */
ARROW_LEFT("http://textures.minecraft.net/texture/3625902b389ed6c147574e422da8f8f361c8eb57e7631676a72777e7b1d"),
/** Jungle wood arrow right. */
ARROW_RIGHT("http://textures.minecraft.net/texture/d4be8aeec11849697adc6fd1f189b16642dff19f2955c05deaba68c9dff1be"),
/** Jungle wood arrow up. */
ARROW_UP("http://textures.minecraft.net/texture/88c0f37dec764d6e26b57aa8212572fbace5ee8f27f7b61c1fdaa47dd4c893"),
/** Jungle wood arrow down. */
ARROW_DOWN("http://textures.minecraft.net/texture/751ced2e647366f8f3ad2dfe415cca85651bfaf9739a95cd57b6f21cba053"),
/** Jungle wood question mark. */
QUESTION("http://textures.minecraft.net/texture/b4d7cc4dca986a53f1d6b52aaf376dc6acc73b8b287f42dc8fef5808bb5d76"),
/** Jungle wood exclamation mark. */
EXCLAMATION("http://textures.minecraft.net/texture/e869dc405a3155f281c16a3e8d9ff54afc1599153b4d9385c9b7bab88680f0");
private final String skinUrl;
Skull(String skinUrl) {
this.skinUrl = skinUrl;
}
/**
* Return the item based on this Skull enum.
* @return the item stack.
*/
public ItemStack get() {
return getFromSkinURL(skinUrl);
}
/**
* Return an item stack builder already containing the skull.
* @return an item stack builder already containing the skull.
*/
public ItemStackBuilder builder() {
return ItemStackBuilder.wrap(get());
}
/**
* Return a skull of a player based on their name.
*
* @param name player's name
* @return item stack
*/
public static ItemStack getFromPlayerName(String name) {
return getFromProfile(ResolvableProfile.resolvableProfile().name(name).build());
}
/**
* Return a skull that has a custom texture specified by url.
* @param url skin url.
* @return item stack
*/
public static ItemStack getFromSkinURL(String url) {
return getFromProfile(ResolvableProfile.resolvableProfile().addProperty(getTexturesProperty(url)).build());
}
private static ItemStack getFromProfile(ResolvableProfile profile) {
return ItemStackBuilder.of(Material.PLAYER_HEAD).profile(profile).build();
}
/**
* The URL prefix for all the player related textures (skin, cape)
*/
public static final String TEXTURE_URL_PREFIX = "http://textures.minecraft.net/texture/";
private static final Pattern textureIdMatcher = Pattern.compile("^[0-9a-fA-F]+$");
/**
* Generate the base64 value of the "textures" profile property, based on the provided skin url!
* @param skinURL the URL of the skin. The "https" will be replaced by "http" because this is the protocol used in
* the profile property url. If only the texture id part is provided, {@link #TEXTURE_URL_PREFIX} is
* prepended.
* @return the base64 encoded texture data.
*/
private static String encodeTextureBase64String(String skinURL) {
if (skinURL.startsWith("https://")) // secure url is not the url found in texture data (even if it actually works in the browser)
skinURL = "http://" + skinURL.substring("https://".length());
if (!skinURL.startsWith(TEXTURE_URL_PREFIX)) { // accept taking only the texture id part ()
if (textureIdMatcher.matcher(skinURL).matches())
skinURL = TEXTURE_URL_PREFIX + skinURL;
else
throw new IllegalArgumentException("Invalid skin URL. Must be from " + TEXTURE_URL_PREFIX + ".");
}
return Base64.getEncoder().encodeToString(String.format("{\"textures\":{\"SKIN\":{\"url\":\"%s\"}}}", skinURL).getBytes());
}
private static ProfileProperty getTexturesProperty(String skinURL) {
return new ProfileProperty("textures", encodeTextureBase64String(skinURL));
}
}

View File

@@ -23,7 +23,7 @@ import java.util.Map;
/** /**
* Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease * Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease
* serialization to YAML. * serialization to YAML.
* * <p>
* To not reinvent the wheel, this class uses the Bukkits Yaml API to convert the objects from/to json. * To not reinvent the wheel, this class uses the Bukkits Yaml API to convert the objects from/to json.
*/ */
/* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> { /* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> {

View File

@@ -9,10 +9,13 @@ import com.google.gson.JsonObject;
import com.google.gson.JsonParseException; import com.google.gson.JsonParseException;
import com.google.gson.JsonSerializationContext; import com.google.gson.JsonSerializationContext;
import com.google.gson.JsonSerializer; import com.google.gson.JsonSerializer;
import com.google.gson.Strictness;
import com.google.gson.TypeAdapterFactory; import com.google.gson.TypeAdapterFactory;
import com.google.gson.internal.bind.TreeTypeAdapter; import com.google.gson.internal.bind.TreeTypeAdapter;
import com.google.gson.reflect.TypeToken; import com.google.gson.reflect.TypeToken;
import net.kyori.adventure.key.Key;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.Registry;
import org.bukkit.configuration.serialization.ConfigurationSerializable; import org.bukkit.configuration.serialization.ConfigurationSerializable;
import org.bukkit.configuration.serialization.ConfigurationSerialization; import org.bukkit.configuration.serialization.ConfigurationSerialization;
import org.bukkit.inventory.ItemStack; import org.bukkit.inventory.ItemStack;
@@ -28,16 +31,25 @@ import java.util.Map;
private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { }; private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { };
/** Gson instance with no custom type adapter */ /** Gson instance with no custom type adapter */
private static final Gson vanillaGson = new GsonBuilder().setLenient().create(); private static final Gson vanillaGson = new GsonBuilder().setStrictness(Strictness.LENIENT).create();
@Override @Override
public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException { public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
if (!(json instanceof JsonObject jsonObj)) if (!(json instanceof JsonObject jsonObj))
throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure."); throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure.");
// if it contains both old and new data, delete the old one introduced for compatibility
if (jsonObj.has("DataVersion") || jsonObj.has("id")) {
jsonObj.remove("v");
jsonObj.remove("type");
}
// format used when using ConfigurationSerialization
if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY))
return context.deserialize(jsonObj, ConfigurationSerializable.class); return context.deserialize(jsonObj, ConfigurationSerializable.class);
if (jsonObj.has("meta") if (jsonObj.has("meta")
&& jsonObj.get("meta") instanceof JsonObject metaJson && jsonObj.get("meta") instanceof JsonObject metaJson
&& !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) { && !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) {
@@ -47,6 +59,8 @@ import java.util.Map;
Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType()); Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType());
fixDeserializationVersion(map); fixDeserializationVersion(map);
map.remove("meta"); map.remove("meta");
ItemStack is = ItemStack.deserialize(map); ItemStack is = ItemStack.deserialize(map);
Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass(); Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass();

View File

@@ -21,6 +21,7 @@ import net.kyori.adventure.bossbar.BossBar.Color;
import net.kyori.adventure.bossbar.BossBar.Overlay; import net.kyori.adventure.bossbar.BossBar.Overlay;
import net.kyori.adventure.text.format.NamedTextColor; import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.TextColor; import net.kyori.adventure.text.format.TextColor;
import org.apache.commons.lang3.tuple.Pair;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.command.CommandSender; import org.bukkit.command.CommandSender;
import org.bukkit.command.ConsoleCommandSender; import org.bukkit.command.ConsoleCommandSender;
@@ -36,6 +37,7 @@ import java.lang.management.ThreadMXBean;
import java.util.ArrayList; import java.util.ArrayList;
import java.util.LinkedList; import java.util.LinkedList;
import java.util.List; import java.util.List;
import java.util.concurrent.atomic.AtomicInteger;
import static fr.pandacube.lib.chat.ChatStatic.chat; import static fr.pandacube.lib.chat.ChatStatic.chat;
import static fr.pandacube.lib.chat.ChatStatic.failureText; import static fr.pandacube.lib.chat.ChatStatic.failureText;
@@ -318,20 +320,23 @@ public class PerformanceAnalysisManager implements Listener {
int[] tpsHistory = getTPSHistory(); int[] tpsHistory = getTPSHistory();
// keep the legacy text when generating the bar to save space when converting to component List<Pair<TextColor, AtomicInteger>> barComponents = new ArrayList<>(60);
StringBuilder s = new StringBuilder();
TextColor prevC = null;
for (int i = 58; i >= 0; i--) { for (int i = 58; i >= 0; i--) {
int t = tpsHistory[i]; int t = tpsHistory[i];
TextColor newC = tps1sGradient.pickColorAt(t); TextColor newC = tps1sGradient.pickColorAt(t);
if (!newC.equals(prevC)) { if (barComponents.isEmpty() || !newC.equals(barComponents.get(barComponents.size() - 1).getKey())) {
s.append(text("|").color(newC).getLegacyText()); barComponents.add(Pair.of(newC, new AtomicInteger(1)));
prevC = newC;
} }
else { else {
s.append("|"); barComponents.get(barComponents.size() - 1).getValue().incrementAndGet();
} }
} }
Chat history = chat();
barComponents.forEach(p -> {
history.then(text("|".repeat(p.getValue().get()))
.color(p.getKey())
);
});
@@ -355,7 +360,7 @@ public class PerformanceAnalysisManager implements Listener {
: (avgTickCPUTime1s < 50) ? NamedTextColor.RED : (avgTickCPUTime1s < 50) ? NamedTextColor.RED
: NamedTextColor.DARK_RED; : NamedTextColor.DARK_RED;
float avgTickWaitingTime1s = avgTickDuration1s - avgTickCPUTime1s; float avgTickWaitingTime1s = Math.max(0, avgTickDuration1s - avgTickCPUTime1s);
TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL
: (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW : (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW
: (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD : (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD
@@ -371,16 +376,16 @@ public class PerformanceAnalysisManager implements Listener {
: NamedTextColor.RED; : NamedTextColor.RED;
timings = text("(R/W/S:") timings = text("(R/W/S:")
.then(text(Math.round(avgTickCPUTime1s)).color(avgTickCPUTime1sColor)) .then(text("%02d".formatted(Math.round(avgTickCPUTime1s))).color(avgTickCPUTime1sColor))
.thenText("/") .thenText("/")
.then(text(Math.round(avgTickWaitingTime1s)).color(avgTickWaitingTime1sColor)) .then(text("%02d".formatted(Math.round(avgTickWaitingTime1s))).color(avgTickWaitingTime1sColor))
.thenText("/") .thenText("/")
.then(text(Math.round(avgInterTickDuration1s)).color(avgInterTickDuration1sColor)) .then(text("%02d".formatted(Math.round(avgInterTickDuration1s))).color(avgInterTickDuration1sColor))
.thenText("ms)"); .thenText("ms)");
} }
title = infoText("TPS [") title = infoText("TPS [")
.thenLegacyText(s.toString()) .then(history)
.thenText("] ") .thenText("] ")
.then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s))) .then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s)))
.then(timings); .then(timings);
@@ -493,7 +498,7 @@ public class PerformanceAnalysisManager implements Listener {
/** /**
* Runs the garbage collector on the server. * Runs the garbage collector on the server.
* Depending on the server load and the used memory, this can freeze the server for a second. * Depending on the server load and the used memory, this can freeze the server for a second.
* @param sender the command sender that triggers the garbase collector. Can be null (the report will be sent to the * @param sender the command sender that triggers the garbage collector. Can be null (the report will be sent to the
* console) * console)
*/ */
public static void gc(CommandSender sender) { public static void gc(CommandSender sender) {

View File

@@ -1,5 +1,6 @@
package fr.pandacube.lib.paper.players; package fr.pandacube.lib.paper.players;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.paper.world.PrimaryWorlds; import fr.pandacube.lib.paper.world.PrimaryWorlds;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer; import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
@@ -166,7 +167,7 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
.getServer() .getServer()
.getPlayerList() .getPlayerList()
.playerIo() .playerIo()
.load(getName(), getUniqueId().toString()).orElse(null); .load(getName(), getUniqueId().toString(), ProblemReporter.DISCARDING()).orElse(null);
} catch (Exception|LinkageError e) { } catch (Exception|LinkageError e) {
throw new PlayerDataLoadException(getName(), getUniqueId(), e); throw new PlayerDataLoadException(getName(), getUniqueId(), e);
} }

View File

@@ -3,9 +3,14 @@ package fr.pandacube.lib.paper.players;
import fr.pandacube.lib.paper.inventory.DummyPlayerInventory; import fr.pandacube.lib.paper.inventory.DummyPlayerInventory;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftItemStack; import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftItemStack;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.ListTag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.Tag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
import fr.pandacube.lib.paper.util.ExperienceUtil; import fr.pandacube.lib.paper.util.ExperienceUtil;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.event.inventory.InventoryType; import org.bukkit.event.inventory.InventoryType;
import org.bukkit.inventory.Inventory; import org.bukkit.inventory.Inventory;
@@ -14,6 +19,7 @@ import org.bukkit.inventory.PlayerInventory;
import java.util.Map; import java.util.Map;
import java.util.Map.Entry; import java.util.Map.Entry;
import java.util.Optional;
import java.util.TreeMap; import java.util.TreeMap;
import java.util.UUID; import java.util.UUID;
import java.util.function.IntUnaryOperator; import java.util.function.IntUnaryOperator;
@@ -118,17 +124,17 @@ public record PlayerDataWrapper(CompoundTag data) {
} }
private Map<Integer, ItemStack> getRawInventoryContent(String key) { private Map<Integer, ItemStack> getRawInventoryContent(String key) {
if (!data.contains(key, Tag.TAG_LIST()))
return Map.of(); ValueInput vi = TagValueInput.createGlobal(ProblemReporter.DISCARDING(), data);
ListTag list = data.getList(key, Tag.TAG_COMPOUND()); Iterable<?> listNMSItemStackWithSlot = ReflectWrapper.unwrap(vi.listOrEmpty(key, ItemStackWithSlot.CODEC()));
if (list == null)
return Map.of();
Map<Integer, ItemStack> stacks = new TreeMap<>(); Map<Integer, ItemStack> stacks = new TreeMap<>();
for (int i = 0; i < list.size(); i++) {
CompoundTag itemTag = list.getCompound(i); for (Object nmsISWS : listNMSItemStackWithSlot) {
int nbtSlot = itemTag.getByte("Slot") & 255; ItemStackWithSlot isws = ReflectWrapper.wrap(nmsISWS, ItemStackWithSlot.class);
fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack.parse(itemTag)
int nbtSlot = isws.slot() & 255;
Optional.of(isws.stack())
.map(nms -> filterStack(CraftItemStack.asCraftMirror(nms))) .map(nms -> filterStack(CraftItemStack.asCraftMirror(nms)))
.ifPresent(is -> stacks.put(nbtSlot, is)); .ifPresent(is -> stacks.put(nbtSlot, is));
} }
@@ -153,28 +159,27 @@ public record PlayerDataWrapper(CompoundTag data) {
} }
private void setRawInventoryContent(String key, Map<Integer, ItemStack> stacks) { private void setRawInventoryContent(String key, Map<Integer, ItemStack> stacks) {
ListTag list = new ListTag();
TagValueOutput vo = TagValueOutput.createWrappingGlobal(ProblemReporter.DISCARDING(), data);
ValueOutputTypedOutputList listNMSItemStackWithSlot = vo.list(key, ItemStackWithSlot.CODEC());
for (Entry<Integer, ItemStack> is : stacks.entrySet()) { for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
ItemStack stack = filterStack(is.getValue()); ItemStack stack = filterStack(is.getValue());
if (stack == null) if (stack == null)
continue; continue;
CompoundTag itemTag = new CompoundTag();
itemTag.putByte("Slot", is.getKey().byteValue()); listNMSItemStackWithSlot.add(ReflectWrapper.unwrap(new ItemStackWithSlot(is.getKey(), CraftItemStack.asNMSCopy(is.getValue()))));
list.add(list.size(), CraftItemStack.asNMSCopy(is.getValue()).save(itemTag));
} }
data.put(key, list);
} }
private ItemStack filterStack(ItemStack is) { private ItemStack filterStack(ItemStack is) {
return is == null || is.getType().isEmpty() || is.getAmount() == 0 ? null : is; return is == null || is.isEmpty() || is.getAmount() <= 0 ? null : is;
} }
private int getHeldItemSlot() { private int getHeldItemSlot() {
if (!data.contains("SelectedItemSlot")) return data.getInt("SelectedItemSlot").orElse(0);
return 0;
return data.getInt("SelectedItemSlot");
} }
private void setHeldItemSlot(int slot) { private void setHeldItemSlot(int slot) {
@@ -187,9 +192,7 @@ public record PlayerDataWrapper(CompoundTag data) {
* @return the value of Score. * @return the value of Score.
*/ */
public int getScore() { public int getScore() {
if (!data.contains("Score")) return data.getInt("Score").orElse(0);
return 0;
return data.getInt("Score");
} }
@@ -207,9 +210,7 @@ public record PlayerDataWrapper(CompoundTag data) {
* @return the value of XpTotal. * @return the value of XpTotal.
*/ */
public int getTotalExperience() { public int getTotalExperience() {
if (!data.contains("XpTotal")) return data.getInt("XpTotal").orElse(0);
return 0;
return data.getInt("XpTotal");
} }
/** /**

View File

@@ -14,9 +14,7 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter; import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType; import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry; import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.DetectedVersion;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.WorldVersion;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
@@ -54,18 +52,25 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerGamePacketL
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.RegionFileStorage; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.RegionFileStorage;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInputTypedInputList;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock;
@@ -73,9 +78,9 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.Block;
import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf; import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf;
import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled; import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled;
import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure; import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode; import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PaperBrigadier; import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PaperBrigadier;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.ShadowBrigNode; import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.ShadowBrigNode;
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int; import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int;
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration; import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration;
@@ -180,6 +185,7 @@ public class PandalibPaperReflect {
thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.REFLECT.get()));
// minecraft.util // minecraft.util
thAcc.catchThrowable(() -> initWrapper(ProblemReporter.class, ProblemReporter.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.REFLECT.get()));
// minecraft.world.block // minecraft.world.block
thAcc.catchThrowable(() -> initWrapper(Block.class, Block.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(Block.class, Block.REFLECT.get()));
@@ -188,29 +194,33 @@ public class PandalibPaperReflect {
thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(DataVersion.class, DataVersion.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ItemStackWithSlot.class, ItemStackWithSlot.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Level.class, Level.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(Level.class, Level.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(RegionFileStorage.class, RegionFileStorage.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(RegionFileStorage.class, RegionFileStorage.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(TagValueInput.class, TagValueInput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(TagValueOutput.class, TagValueOutput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueInput.class, ValueInput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueInputTypedInputList.class, ValueInputTypedInputList.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueOutput.class, ValueOutput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueOutputTypedOutputList.class, ValueOutputTypedOutputList.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.REFLECT.get()));
// minecraft // minecraft
thAcc.catchThrowable(() -> initWrapper(DetectedVersion.class, DetectedVersion.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(WorldVersion.class, WorldVersion.REFLECT.get()));
// netty // netty
thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get()));
// paper.commands // paper.commands
thAcc.catchThrowable(() -> initWrapper(APICommandMeta.class, APICommandMeta.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(BukkitCommandNode.class, BukkitCommandNode.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(BukkitCommandNode.class, BukkitCommandNode.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(PaperBrigadier.class, PaperBrigadier.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(PaperBrigadier.class, PaperBrigadier.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(PluginCommandNode.class, PluginCommandNode.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ShadowBrigNode.class, ShadowBrigNode.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ShadowBrigNode.class, ShadowBrigNode.REFLECT.get()));
// paper.configuration // paper.configuration
thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get()));

View File

@@ -34,7 +34,7 @@ public final class BedrockBambooCollisionFixer implements Listener {
public BedrockBambooCollisionFixer() { public BedrockBambooCollisionFixer() {
// Make the bamboo block have zero collision. // Make the bamboo block have zero collision.
try { try {
BambooStalkBlock.COLLISION_SHAPE(Block.box(8, 0, 8, 8, 0, 8)); BambooStalkBlock.SHAPE_COLLISION(Block.box(8, 0, 8, 8, 0, 8));
Log.info("Bamboo block collision box removed successfully."); Log.info("Bamboo block collision box removed successfully.");
} catch (Exception e) { } catch (Exception e) {
Log.severe("Unable to remove the collision box of the Bamboo block.", e); Log.severe("Unable to remove the collision box of the Bamboo block.", e);

View File

@@ -1,6 +1,8 @@
package fr.pandacube.lib.paper.reflect.wrapper.brigadier; package fr.pandacube.lib.paper.reflect.wrapper.brigadier;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectField;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped; import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod; import fr.pandacube.lib.reflect.ReflectMethod;
@@ -11,11 +13,20 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class CommandNode<S> extends ReflectWrapperTyped<com.mojang.brigadier.tree.CommandNode<S>> { public class CommandNode<S> extends ReflectWrapperTyped<com.mojang.brigadier.tree.CommandNode<S>> {
public static final ReflectClass<?> REFLECT = Reflect.ofClass(com.mojang.brigadier.tree.CommandNode.class); public static final ReflectClass<?> REFLECT = Reflect.ofClass(com.mojang.brigadier.tree.CommandNode.class);
private static final ReflectMethod<?> removeCommand = wrapEx(() -> REFLECT.method("removeCommand", String.class)); private static final ReflectMethod<?> removeCommand = wrapEx(() -> REFLECT.method("removeCommand", String.class));
private static final ReflectField<?> apiCommandMeta = wrapEx(() -> REFLECT.field("apiCommandMeta"));
public void removeCommand(String cmd) { public void removeCommand(String cmd) {
wrapReflectEx(() -> removeCommand.invoke(__getRuntimeInstance(), cmd)); wrapReflectEx(() -> removeCommand.invoke(__getRuntimeInstance(), cmd));
} }
public APICommandMeta apiCommandMeta() {
return wrap(wrapReflectEx(() -> apiCommandMeta.getValue(__getRuntimeInstance())), APICommandMeta.class);
}
public void apiCommandMeta(APICommandMeta meta) {
wrapReflectEx(() -> apiCommandMeta.setValue(__getRuntimeInstance(), unwrap(meta)));
}
protected CommandNode(Object obj) { protected CommandNode(Object obj) {
super(obj); super(obj);
} }

View File

@@ -1,12 +1,10 @@
package fr.pandacube.lib.paper.reflect.wrapper.craftbukkit; package fr.pandacube.lib.paper.reflect.wrapper.craftbukkit;
import fr.pandacube.lib.paper.reflect.OBCReflect; import fr.pandacube.lib.paper.reflect.OBCReflect;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.BlockPos;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod; import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import fr.pandacube.lib.util.ThrowableUtil; import fr.pandacube.lib.util.ThrowableUtil;
import org.bukkit.util.Vector; import org.bukkit.util.Vector;
@@ -16,26 +14,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class CraftVector extends ReflectWrapper { public class CraftVector extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("util.CraftVector")); public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("util.CraftVector"));
public static final ReflectMethod<?> toBukkit_Vec3 = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", Vec3.REFLECT.get())); public static final ReflectMethod<?> toBukkit_Vec3 = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", Vec3.REFLECT.get()));
public static final ReflectMethod<?> toBukkit_BlockPos = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", BlockPos.REFLECT.get()));
public static final ReflectMethod<?> toNMS = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
public static final ReflectMethod<?> toBlockPos = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
public static Vector toBukkit(Vec3 nms) { public static Vector toBukkit(Vec3 nms) {
return (Vector) wrapReflectEx(() -> toBukkit_Vec3.invokeStatic(unwrap(nms))); return (Vector) wrapReflectEx(() -> toBukkit_Vec3.invokeStatic(unwrap(nms)));
} }
public static Vector toBukkit(BlockPos blockPos) {
return (Vector) wrapReflectEx(() -> toBukkit_BlockPos.invokeStatic(unwrap(blockPos)));
}
public static Vec3 toNMS(Vector bukkit) {
return wrap(wrapReflectEx(() -> toNMS.invokeStatic(bukkit)), Vec3.class);
}
public static BlockPos toBlockPos(Vector bukkit) {
return wrap(wrapReflectEx(() -> toBlockPos.invokeStatic(bukkit)), BlockPos.class);
}
protected CraftVector(Object obj) { protected CraftVector(Object obj) {
super(obj); super(obj);

View File

@@ -17,13 +17,9 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class VanillaCommandWrapper extends ReflectWrapperTyped<BukkitCommand> { public class VanillaCommandWrapper extends ReflectWrapperTyped<BukkitCommand> {
public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("command.VanillaCommandWrapper")); public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("command.VanillaCommandWrapper"));
public static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(Commands.REFLECT.get(), CommandNode.class));
public static final ReflectField<?> vanillaCommand = wrapEx(() -> REFLECT.field("vanillaCommand")); public static final ReflectField<?> vanillaCommand = wrapEx(() -> REFLECT.field("vanillaCommand"));
public static final ReflectMethod<?> getListener = wrapEx(() -> REFLECT.method("getListener", CommandSender.class)); public static final ReflectMethod<?> getListener = wrapEx(() -> REFLECT.method("getListener", CommandSender.class));
public VanillaCommandWrapper(Commands dispatcher, CommandNode<CommandSourceStack> vanillaCommand) {
this(wrapReflectEx(() -> CONSTRUCTOR.instantiate(unwrap(dispatcher), vanillaCommand)));
}
@SuppressWarnings("unchecked") @SuppressWarnings("unchecked")
public CommandNode<CommandSourceStack> vanillaCommand() { public CommandNode<CommandSourceStack> vanillaCommand() {

View File

@@ -1,15 +0,0 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
public class DetectedVersion extends ReflectWrapper implements WorldVersion {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.DetectedVersion"));
protected DetectedVersion(Object obj) {
super(obj);
}
}

View File

@@ -10,15 +10,10 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class SharedConstants extends ReflectWrapper { public class SharedConstants extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.SharedConstants")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.SharedConstants"));
private static final ReflectMethod<?> getCurrentVersion = wrapEx(() -> REFLECT.method("getCurrentVersion"));
private static final ReflectMethod<?> getProtocolVersion = wrapEx(() -> REFLECT.method("getProtocolVersion")); private static final ReflectMethod<?> getProtocolVersion = wrapEx(() -> REFLECT.method("getProtocolVersion"));
public static WorldVersion getCurrentVersion() {
return wrap(wrapReflectEx(() -> getCurrentVersion.invokeStatic()), WorldVersion.class);
}
public static int getProtocolVersion() { public static int getProtocolVersion() {
return (int) wrapReflectEx(() -> getProtocolVersion.invokeStatic()); return (int) wrapReflectEx(() -> getProtocolVersion.invokeStatic());
} }

View File

@@ -14,7 +14,7 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@ConcreteWrapper(Coordinates.__concrete.class) @ConcreteWrapper(Coordinates.__concrete.class)
public interface Coordinates extends ReflectWrapperI { public interface Coordinates extends ReflectWrapperI {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates")); ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates"));
ReflectMethod<?> getPosition = wrapEx(() -> REFLECT.method("getPosition", CommandSourceStack.REFLECT.get())); ReflectMethod<?> getPosition = wrapEx(() -> REFLECT.method("getPosition", CommandSourceStack.REFLECT.get()));
default Vec3 getPosition(io.papermc.paper.command.brigadier.CommandSourceStack source) { default Vec3 getPosition(io.papermc.paper.command.brigadier.CommandSourceStack source) {

View File

@@ -6,10 +6,9 @@ import fr.pandacube.lib.reflect.ReflectConstructor;
import fr.pandacube.lib.reflect.ReflectMethod; import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper; import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import java.util.List;
import java.util.Map; import java.util.Map;
import java.util.Optional;
import java.util.Set; import java.util.Set;
import java.util.UUID;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@@ -20,21 +19,16 @@ public class CompoundTag extends ReflectWrapper implements Tag {
private static final ReflectMethod<?> putBoolean = wrapEx(() -> REFLECT.method("putBoolean", String.class, boolean.class)); private static final ReflectMethod<?> putBoolean = wrapEx(() -> REFLECT.method("putBoolean", String.class, boolean.class));
private static final ReflectMethod<?> putByte = wrapEx(() -> REFLECT.method("putByte", String.class, byte.class)); private static final ReflectMethod<?> putByte = wrapEx(() -> REFLECT.method("putByte", String.class, byte.class));
private static final ReflectMethod<?> putByteArray = wrapEx(() -> REFLECT.method("putByteArray", String.class, byte[].class)); private static final ReflectMethod<?> putByteArray = wrapEx(() -> REFLECT.method("putByteArray", String.class, byte[].class));
private static final ReflectMethod<?> putByteArray_List = wrapEx(() -> REFLECT.method("putByteArray", String.class, List.class));
private static final ReflectMethod<?> putDouble = wrapEx(() -> REFLECT.method("putDouble", String.class, double.class)); private static final ReflectMethod<?> putDouble = wrapEx(() -> REFLECT.method("putDouble", String.class, double.class));
private static final ReflectMethod<?> putFloat = wrapEx(() -> REFLECT.method("putFloat", String.class, float.class)); private static final ReflectMethod<?> putFloat = wrapEx(() -> REFLECT.method("putFloat", String.class, float.class));
private static final ReflectMethod<?> putInt = wrapEx(() -> REFLECT.method("putInt", String.class, int.class)); private static final ReflectMethod<?> putInt = wrapEx(() -> REFLECT.method("putInt", String.class, int.class));
private static final ReflectMethod<?> putIntArray = wrapEx(() -> REFLECT.method("putIntArray", String.class, int[].class)); private static final ReflectMethod<?> putIntArray = wrapEx(() -> REFLECT.method("putIntArray", String.class, int[].class));
private static final ReflectMethod<?> putIntArray_List = wrapEx(() -> REFLECT.method("putIntArray", String.class, List.class));
private static final ReflectMethod<?> putString = wrapEx(() -> REFLECT.method("putString", String.class, String.class)); private static final ReflectMethod<?> putString = wrapEx(() -> REFLECT.method("putString", String.class, String.class));
private static final ReflectMethod<?> putUUID = wrapEx(() -> REFLECT.method("putUUID", String.class, UUID.class));
private static final ReflectMethod<?> putLong = wrapEx(() -> REFLECT.method("putLong", String.class, long.class)); private static final ReflectMethod<?> putLong = wrapEx(() -> REFLECT.method("putLong", String.class, long.class));
private static final ReflectMethod<?> putLongArray = wrapEx(() -> REFLECT.method("putLongArray", String.class, long[].class)); private static final ReflectMethod<?> putLongArray = wrapEx(() -> REFLECT.method("putLongArray", String.class, long[].class));
private static final ReflectMethod<?> putLongArray_List = wrapEx(() -> REFLECT.method("putLongArray", String.class, List.class));
private static final ReflectMethod<?> putShort = wrapEx(() -> REFLECT.method("putShort", String.class, short.class)); private static final ReflectMethod<?> putShort = wrapEx(() -> REFLECT.method("putShort", String.class, short.class));
private static final ReflectMethod<?> put = wrapEx(() -> REFLECT.method("put", String.class, Tag.REFLECT.get())); private static final ReflectMethod<?> put = wrapEx(() -> REFLECT.method("put", String.class, Tag.REFLECT.get()));
private static final ReflectMethod<?> getTagType = wrapEx(() -> REFLECT.method("getTagType", String.class));
private static final ReflectMethod<?> getByte = wrapEx(() -> REFLECT.method("getByte", String.class)); private static final ReflectMethod<?> getByte = wrapEx(() -> REFLECT.method("getByte", String.class));
private static final ReflectMethod<?> getShort = wrapEx(() -> REFLECT.method("getShort", String.class)); private static final ReflectMethod<?> getShort = wrapEx(() -> REFLECT.method("getShort", String.class));
private static final ReflectMethod<?> getInt = wrapEx(() -> REFLECT.method("getInt", String.class)); private static final ReflectMethod<?> getInt = wrapEx(() -> REFLECT.method("getInt", String.class));
@@ -47,14 +41,13 @@ public class CompoundTag extends ReflectWrapper implements Tag {
private static final ReflectMethod<?> getLongArray = wrapEx(() -> REFLECT.method("getLongArray", String.class)); private static final ReflectMethod<?> getLongArray = wrapEx(() -> REFLECT.method("getLongArray", String.class));
private static final ReflectMethod<?> getCompound = wrapEx(() -> REFLECT.method("getCompound", String.class)); private static final ReflectMethod<?> getCompound = wrapEx(() -> REFLECT.method("getCompound", String.class));
private static final ReflectMethod<?> getBoolean = wrapEx(() -> REFLECT.method("getBoolean", String.class)); private static final ReflectMethod<?> getBoolean = wrapEx(() -> REFLECT.method("getBoolean", String.class));
private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class, int.class)); private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class));
private static final ReflectMethod<?> get = wrapEx(() -> REFLECT.method("get", String.class)); private static final ReflectMethod<?> get = wrapEx(() -> REFLECT.method("get", String.class));
private static final ReflectMethod<?> getAllKeys = wrapEx(() -> REFLECT.method("getAllKeys")); private static final ReflectMethod<?> keySet = wrapEx(() -> REFLECT.method("keySet"));
private static final ReflectMethod<?> entrySet = wrapEx(() -> REFLECT.method("entrySet")); private static final ReflectMethod<?> entrySet = wrapEx(() -> REFLECT.method("entrySet"));
private static final ReflectMethod<?> size = wrapEx(() -> REFLECT.method("size")); private static final ReflectMethod<?> size = wrapEx(() -> REFLECT.method("size"));
private static final ReflectMethod<?> contains = wrapEx(() -> REFLECT.method("contains", String.class)); private static final ReflectMethod<?> contains = wrapEx(() -> REFLECT.method("contains", String.class));
private static final ReflectMethod<?> containsStringInt = wrapEx(() -> REFLECT.method("contains", String.class, int.class));
public CompoundTag() { public CompoundTag() {
this(wrapReflectEx(() -> CONSTRUCTOR.instantiate())); this(wrapReflectEx(() -> CONSTRUCTOR.instantiate()));
@@ -73,9 +66,6 @@ public class CompoundTag extends ReflectWrapper implements Tag {
public void putByteArray(String key, byte[] value) { public void putByteArray(String key, byte[] value) {
wrapReflectEx(() -> putByteArray.invoke(__getRuntimeInstance(), key, value)); wrapReflectEx(() -> putByteArray.invoke(__getRuntimeInstance(), key, value));
} }
public void putByteArray(String key, List<Byte> value) {
wrapReflectEx(() -> putByteArray_List.invoke(__getRuntimeInstance(), key, value));
}
public void putDouble(String key, double value) { public void putDouble(String key, double value) {
wrapReflectEx(() -> putDouble.invoke(__getRuntimeInstance(), key, value)); wrapReflectEx(() -> putDouble.invoke(__getRuntimeInstance(), key, value));
} }
@@ -88,78 +78,79 @@ public class CompoundTag extends ReflectWrapper implements Tag {
public void putIntArray(String key, int[] value) { public void putIntArray(String key, int[] value) {
wrapReflectEx(() -> putIntArray.invoke(__getRuntimeInstance(), key, value)); wrapReflectEx(() -> putIntArray.invoke(__getRuntimeInstance(), key, value));
} }
public void putIntArray(String key, List<Integer> value) {
wrapReflectEx(() -> putIntArray_List.invoke(__getRuntimeInstance(), key, value));
}
public void putString(String key, String value) { public void putString(String key, String value) {
wrapReflectEx(() -> putString.invoke(__getRuntimeInstance(), key, value)); wrapReflectEx(() -> putString.invoke(__getRuntimeInstance(), key, value));
} }
public void putUUID(String key, UUID value) {
wrapReflectEx(() -> putUUID.invoke(__getRuntimeInstance(), key, value));
}
public void putLong(String key, long value) { public void putLong(String key, long value) {
wrapReflectEx(() -> putLong.invoke(__getRuntimeInstance(), key, value)); wrapReflectEx(() -> putLong.invoke(__getRuntimeInstance(), key, value));
} }
public void putLongArray(String key, long[] value) { public void putLongArray(String key, long[] value) {
wrapReflectEx(() -> putLongArray.invoke(__getRuntimeInstance(), key, value)); wrapReflectEx(() -> putLongArray.invoke(__getRuntimeInstance(), key, value));
} }
public void putLongArray(String key, List<Long> value) {
wrapReflectEx(() -> putLongArray_List.invoke(__getRuntimeInstance(), key, value));
}
public void putShort(String key, short value) { public void putShort(String key, short value) {
wrapReflectEx(() -> putShort.invoke(__getRuntimeInstance(), key, value)); wrapReflectEx(() -> putShort.invoke(__getRuntimeInstance(), key, value));
} }
public void put(String key, Tag value) { public void put(String key, Tag value) {
wrapReflectEx(() -> put.invoke(__getRuntimeInstance(), key, unwrap(value))); wrapReflectEx(() -> put.invoke(__getRuntimeInstance(), key, unwrap(value)));
} }
public byte getTagType(String key) { @SuppressWarnings("unchecked")
return (byte) wrapReflectEx(() -> getTagType.invoke(__getRuntimeInstance(), key)); public Optional<Byte> getByte(String key) {
return (Optional<Byte>) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key));
} }
public byte getByte(String key) { @SuppressWarnings("unchecked")
return (byte) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key)); public Optional<Short> getShort(String key) {
return (Optional<Short>) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key));
} }
public short getShort(String key) { @SuppressWarnings("unchecked")
return (short) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key)); public Optional<Integer> getInt(String key) {
return (Optional<Integer>) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key));
} }
public int getInt(String key) { @SuppressWarnings("unchecked")
return (int) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key)); public Optional<Long> getLong(String key) {
return (Optional<Long>) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key));
} }
public long getLong(String key) { @SuppressWarnings("unchecked")
return (long) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key)); public Optional<Float> getFloat(String key) {
return (Optional<Float>) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key));
} }
public float getFloat(String key) { @SuppressWarnings("unchecked")
return (float) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key)); public Optional<Double> getDouble(String key) {
return (Optional<Double>) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key));
} }
public double getDouble(String key) { @SuppressWarnings("unchecked")
return (double) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key)); public Optional<String> getString(String key) {
return (Optional<String>) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key));
} }
public String getString(String key) { @SuppressWarnings("unchecked")
return (String) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key)); public Optional<byte[]> getByteArray(String key) {
return (Optional<byte[]>) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key));
} }
public byte[] getByteArray(String key) { @SuppressWarnings("unchecked")
return (byte[]) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key)); public Optional<int[]> getIntArray(String key) {
return (Optional<int[]>) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key));
} }
public int[] getIntArray(String key) { @SuppressWarnings("unchecked")
return (int[]) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key)); public Optional<long[]> getLongArray(String key) {
return (Optional<long[]>) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key));
} }
public long[] getLongArray(String key) { public Optional<CompoundTag> getCompound(String key) {
return (long[]) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key)); return ((Optional<?>) wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)))
.map(u -> wrap(u, CompoundTag.class));
} }
public CompoundTag getCompound(String key) { @SuppressWarnings("unchecked")
return wrap(wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)), CompoundTag.class); public Optional<Boolean> getBoolean(String key) {
return (Optional<Boolean>) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key));
} }
public boolean getBoolean(String key) { public Optional<ListTag> getList(String key) {
return (boolean) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key)); return ((Optional<?>) wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key)))
} .map(u -> wrap(u, ListTag.class));
public ListTag getList(String key, int type) {
return wrap(wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key, type)), ListTag.class);
} }
public Tag get(String key) { public Tag get(String key) {
return wrap(wrapReflectEx(() -> get.invoke(__getRuntimeInstance(), key)), Tag.class); return wrap(wrapReflectEx(() -> get.invoke(__getRuntimeInstance(), key)), Tag.class);
} }
@SuppressWarnings("unchecked") @SuppressWarnings("unchecked")
public Set<String> getAllKeys() { public Set<String> keySet() {
return (Set<String>) wrapReflectEx(() -> getAllKeys.invoke(__getRuntimeInstance())); return (Set<String>) wrapReflectEx(() -> keySet.invoke(__getRuntimeInstance()));
} }
/** /**
@@ -176,8 +167,5 @@ public class CompoundTag extends ReflectWrapper implements Tag {
public boolean contains(String key) { public boolean contains(String key) {
return (boolean) wrapReflectEx(() -> contains.invoke(__getRuntimeInstance(), key)); return (boolean) wrapReflectEx(() -> contains.invoke(__getRuntimeInstance(), key));
} }
public boolean contains(String key, int type) {
return (boolean) wrapReflectEx(() -> containsStringInt.invoke(__getRuntimeInstance(), key, type));
}
} }

View File

@@ -8,20 +8,22 @@ import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper; import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI; import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
import java.util.Optional;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@ConcreteWrapper(Tag.__concrete.class) @ConcreteWrapper(Tag.__concrete.class)
public interface Tag extends ReflectWrapperI { public interface Tag extends ReflectWrapperI {
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.nbt.Tag")); ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.nbt.Tag"));
ReflectMethod<?> getAsString = wrapEx(() -> REFLECT.method("getAsString")); ReflectMethod<?> asString = wrapEx(() -> REFLECT.method("asString"));
ReflectField<?> TAG_LIST = wrapEx(() -> REFLECT.field("TAG_LIST")); ReflectField<?> TAG_LIST = wrapEx(() -> REFLECT.field("TAG_LIST"));
ReflectField<?> TAG_COMPOUND = wrapEx(() -> REFLECT.field("TAG_COMPOUND")); ReflectField<?> TAG_COMPOUND = wrapEx(() -> REFLECT.field("TAG_COMPOUND"));
ReflectField<?> TAG_ANY_NUMERIC = wrapEx(() -> REFLECT.field("TAG_ANY_NUMERIC"));
default String getAsString() { @SuppressWarnings("unchecked")
return wrapReflectEx(() -> (String) getAsString.invoke(__getRuntimeInstance())); default Optional<String> asString() {
return wrapReflectEx(() -> (Optional<String>) asString.invoke(__getRuntimeInstance()));
} }
static byte TAG_LIST() { static byte TAG_LIST() {
@@ -32,10 +34,6 @@ public interface Tag extends ReflectWrapperI {
return wrapReflectEx(() -> (byte) TAG_COMPOUND.getStaticValue()); return wrapReflectEx(() -> (byte) TAG_COMPOUND.getStaticValue());
} }
static byte TAG_ANY_NUMERIC() {
return wrapReflectEx(() -> (byte) TAG_ANY_NUMERIC.getStaticValue());
}
class __concrete extends ReflectWrapper implements Tag { class __concrete extends ReflectWrapper implements Tag {
private __concrete(Object obj) { private __concrete(Object obj) {

View File

@@ -0,0 +1,31 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.util;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectField;
import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@ConcreteWrapper(ProblemReporter.__concrete.class)
public interface ProblemReporter extends ReflectWrapperI {
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.util.ProblemReporter"));
ReflectField<?> DISCARDING = wrapEx(() -> REFLECT.field("DISCARDING"));
static ProblemReporter DISCARDING() {
return wrap(wrapReflectEx(DISCARDING::getStaticValue), ProblemReporter.class);
}
class __concrete extends ReflectWrapper implements ProblemReporter {
protected __concrete(Object obj) {
super(obj);
}
}
}

View File

@@ -1,32 +0,0 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class DataVersion extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.DataVersion"));
private static final ReflectMethod<?> getVersion = wrapEx(() -> REFLECT.method("getVersion"));
private static final ReflectMethod<?> getSeries = wrapEx(() -> REFLECT.method("getSeries"));
public int getVersion() {
return (int) wrapReflectEx(() -> getVersion.invoke(__getRuntimeInstance()));
}
public String getSeries() {
return (String) wrapReflectEx(() -> getSeries.invoke(__getRuntimeInstance()));
}
protected DataVersion(Object obj) {
super(obj);
}
}

View File

@@ -1,6 +1,5 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world; package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod; import fr.pandacube.lib.reflect.ReflectMethod;
@@ -12,16 +11,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class Entity extends ReflectWrapper { public class Entity extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.entity.Entity")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.entity.Entity"));
public static final ReflectMethod<?> getBukkitEntity = wrapEx(() -> REFLECT.method("getBukkitEntity")); // spigot method public static final ReflectMethod<?> getBukkitEntity = wrapEx(() -> REFLECT.method("getBukkitEntity")); // spigot method
public static final ReflectMethod<?> serializeEntity = wrapEx(() -> REFLECT.method("serializeEntity", CompoundTag.REFLECT.get())); // paper method
public org.bukkit.entity.Entity getBukkitEntity() { public org.bukkit.entity.Entity getBukkitEntity() {
return (org.bukkit.entity.Entity) wrapReflectEx(() -> getBukkitEntity.invoke(__getRuntimeInstance())); return (org.bukkit.entity.Entity) wrapReflectEx(() -> getBukkitEntity.invoke(__getRuntimeInstance()));
} }
public boolean serializeEntity(CompoundTag nbt) {
return wrapReflectEx(() -> (Boolean) serializeEntity.invoke(__getRuntimeInstance(), unwrap(nbt)));
}
protected Entity(Object obj) { protected Entity(Object obj) {
super(obj); super(obj);
} }

View File

@@ -1,63 +1,15 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world; package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.HolderLookupProvider;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.RegistryAccess;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.Tag;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper; import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import org.bukkit.Bukkit;
import java.util.Optional;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class ItemStack extends ReflectWrapper { public class ItemStack extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.item.ItemStack")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.item.ItemStack"));
private static final ReflectMethod<?> parse = wrapEx(() -> REFLECT.method("parse", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
private static final ReflectMethod<?> saveWithPrefix = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
private static final ReflectMethod<?> save = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get()));
@SuppressWarnings("unchecked")
public static Optional<ItemStack> parse(HolderLookupProvider registries, Tag nbt) {
return ((Optional<Object>) wrapReflectEx(() -> parse.invokeStatic(unwrap(registries), unwrap(nbt))))
.map(o -> wrap(o, ItemStack.class));
}
public static Optional<ItemStack> parse(Tag nbt) {
return parse(getRegistries(), nbt);
}
protected ItemStack(Object obj) { protected ItemStack(Object obj) {
super(obj); super(obj);
} }
public Tag save(HolderLookupProvider registries, Tag prefix) {
return wrap(wrapReflectEx(() -> saveWithPrefix.invoke(__getRuntimeInstance(), unwrap(registries), unwrap(prefix))), Tag.class);
}
public Tag save(HolderLookupProvider registries) {
return wrap(wrapReflectEx(() -> save.invoke(__getRuntimeInstance(), unwrap(registries))), Tag.class);
}
public Tag save(Tag prefix) {
return save(getRegistries(), prefix);
}
public Tag save() {
return save(getRegistries());
}
private static RegistryAccess getRegistries() {
return wrap(Bukkit.getServer(), CraftServer.class).getServer().registryAccess();
}
} }

View File

@@ -0,0 +1,44 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import com.mojang.serialization.Codec;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectConstructor;
import fr.pandacube.lib.reflect.ReflectField;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class ItemStackWithSlot extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.ItemStackWithSlot"));
private static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(int.class, ItemStack.REFLECT.get()));
private static final ReflectField<?> CODEC = wrapEx(() -> REFLECT.field("CODEC"));
private static final ReflectMethod<?> slot = wrapEx(() -> REFLECT.method("slot"));
private static final ReflectMethod<?> stack = wrapEx(() -> REFLECT.method("stack"));
public static Codec<?> CODEC() {
return (Codec<?>) wrapReflectEx(CODEC::getStaticValue);
}
protected ItemStackWithSlot(Object obj) {
super(obj);
}
public ItemStackWithSlot(int slot, ItemStack stack) {
super(wrapReflectEx(() -> CONSTRUCTOR.instantiate(slot, unwrap(stack))));
}
public int slot() {
return (int) wrapReflectEx(() -> slot.invoke(__getRuntimeInstance()));
}
public ItemStack stack() {
return wrap(wrapReflectEx(() -> stack.invoke(__getRuntimeInstance())), ItemStack.class);
}
}

View File

@@ -12,17 +12,12 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class Level extends ReflectWrapper { public class Level extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.Level")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.Level"));
public static final ReflectMethod<?> getGameTime = wrapEx(() -> REFLECT.method("getGameTime")); public static final ReflectMethod<?> getGameTime = wrapEx(() -> REFLECT.method("getGameTime"));
public static final ReflectMethod<?> getFreeMapId = wrapEx(() -> REFLECT.method("getFreeMapId"));
public static final ReflectMethod<?> paperConfig = wrapEx(() -> REFLECT.method("paperConfig")); // paper method public static final ReflectMethod<?> paperConfig = wrapEx(() -> REFLECT.method("paperConfig")); // paper method
public long getGameTime() { public long getGameTime() {
return (long) wrapReflectEx(() -> getGameTime.invoke(__getRuntimeInstance())); return (long) wrapReflectEx(() -> getGameTime.invoke(__getRuntimeInstance()));
} }
public int getFreeMapId() {
return (int) wrapReflectEx(() -> getFreeMapId.invoke(__getRuntimeInstance()));
}
public WorldConfiguration paperConfig() { public WorldConfiguration paperConfig() {
return wrap(wrapReflectEx(() -> paperConfig.invoke(__getRuntimeInstance())), WorldConfiguration.class); return wrap(wrapReflectEx(() -> paperConfig.invoke(__getRuntimeInstance())), WorldConfiguration.class);
} }

View File

@@ -1,6 +1,7 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world; package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod; import fr.pandacube.lib.reflect.ReflectMethod;
@@ -13,15 +14,15 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class PlayerDataStorage extends ReflectWrapper { public class PlayerDataStorage extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.PlayerDataStorage")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.PlayerDataStorage"));
public static final ReflectMethod<?> load = wrapEx(() -> REFLECT.method("load", String.class, String.class)); public static final ReflectMethod<?> load = wrapEx(() -> REFLECT.method("load", String.class, String.class, ProblemReporter.REFLECT.get()));
/** /**
* @param playerName the name of the player: used for loading error message and for offline UUID generation. * @param playerName the name of the player: used for loading error message and for offline UUID generation.
* @param playerId UUID of a player as it is used to name the player data file (UUID.toString()). * @param playerId UUID of a player as it is used to name the player data file (UUID.toString()).
*/ */
@SuppressWarnings("unchecked") @SuppressWarnings("unchecked")
public Optional<CompoundTag> load(String playerName, String playerId) { public Optional<CompoundTag> load(String playerName, String playerId, ProblemReporter problemReporter) {
return wrapOptional((Optional<Object>) wrapReflectEx(() -> load.invoke(__getRuntimeInstance(), playerName, playerId)), CompoundTag.class); return wrapOptional((Optional<Object>) wrapReflectEx(() -> load.invoke(__getRuntimeInstance(), playerName, playerId, unwrap(problemReporter))), CompoundTag.class);
} }

View File

@@ -0,0 +1,25 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class TagValueInput extends ReflectWrapper implements ValueInput {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.TagValueInput"));
private static final ReflectMethod<?> createGlobal = wrapEx(() -> REFLECT.method("createGlobal", ProblemReporter.REFLECT.get(), CompoundTag.REFLECT.get()));
public static ValueInput createGlobal(ProblemReporter problemReporter, CompoundTag nbt) {
return wrap(wrapReflectEx(() -> createGlobal.invokeStatic(unwrap(problemReporter), unwrap(nbt))), ValueInput.class);
}
protected TagValueInput(Object obj) {
super(obj);
}
}

View File

@@ -0,0 +1,25 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class TagValueOutput extends ReflectWrapper implements ValueOutput {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.TagValueOutput"));
private static final ReflectMethod<?> createWrappingGlobal = wrapEx(() -> REFLECT.method("createWrappingGlobal", ProblemReporter.REFLECT.get(), CompoundTag.REFLECT.get()));
public static TagValueOutput createWrappingGlobal(ProblemReporter problemReporter, CompoundTag nbt) {
return wrap(wrapReflectEx(() -> createWrappingGlobal.invokeStatic(unwrap(problemReporter), unwrap(nbt))), TagValueOutput.class);
}
protected TagValueOutput(Object obj) {
super(obj);
}
}

View File

@@ -0,0 +1,31 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import com.mojang.serialization.Codec;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@ConcreteWrapper(ValueInput.__concrete.class)
public interface ValueInput extends ReflectWrapperI {
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueInput"));
ReflectMethod<?> listOrEmpty = wrapEx(() -> REFLECT.method("listOrEmpty", String.class, Codec.class));
default ValueInputTypedInputList listOrEmpty(String key, Codec<?> elementCodec) {
return wrap(wrapReflectEx(() -> listOrEmpty.invoke(__getRuntimeInstance(), key, elementCodec)), ValueInputTypedInputList.class);
}
class __concrete extends ReflectWrapper implements ValueInput {
private __concrete(Object obj) {
super(obj);
}
}
}

View File

@@ -0,0 +1,21 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTypedI;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
@ConcreteWrapper(ValueInputTypedInputList.__concrete.class)
public interface ValueInputTypedInputList extends ReflectWrapperTypedI<Iterable<?>> {
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueInput$TypedInputList"));
class __concrete extends ReflectWrapperTyped<Iterable<?>> implements ValueInputTypedInputList {
private __concrete(Object obj) {
super(obj);
}
}
}

View File

@@ -1,6 +1,6 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft; package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion; import com.mojang.serialization.Codec;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod; import fr.pandacube.lib.reflect.ReflectMethod;
@@ -12,18 +12,18 @@ import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@ConcreteWrapper(WorldVersion.__concrete.class) @ConcreteWrapper(ValueOutput.__concrete.class)
public interface WorldVersion extends ReflectWrapperI { public interface ValueOutput extends ReflectWrapperI {
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.WorldVersion")); ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueOutput"));
ReflectMethod<?> getDataVersion = wrapEx(() -> REFLECT.method("getDataVersion")); ReflectMethod<?> list = wrapEx(() -> REFLECT.method("list", String.class, Codec.class));
default DataVersion getDataVersion() {
return wrap(wrapReflectEx(() -> getDataVersion.invoke(__getRuntimeInstance())), DataVersion.class);
default ValueOutputTypedOutputList list(String key, Codec<?> elementCodec) {
return wrap(wrapReflectEx(() -> list.invoke(__getRuntimeInstance(), key, elementCodec)), ValueOutputTypedOutputList.class);
} }
class __concrete extends ReflectWrapper implements ValueOutput {
class __concrete extends ReflectWrapper implements WorldVersion {
private __concrete(Object obj) { private __concrete(Object obj) {
super(obj); super(obj);
} }

View File

@@ -0,0 +1,28 @@
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@ConcreteWrapper(ValueOutputTypedOutputList.__concrete.class)
public interface ValueOutputTypedOutputList extends ReflectWrapperI {
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueOutput$TypedOutputList"));
ReflectMethod<?> add = wrapEx(() -> REFLECT.method("add", Object.class));
default void add(Object rawElement) {
wrapReflectEx(() -> add.invoke(__getRuntimeInstance(), rawElement));
}
class __concrete extends ReflectWrapper implements ValueOutputTypedOutputList {
private __concrete(Object obj) {
super(obj);
}
}
}

View File

@@ -10,14 +10,14 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class BambooStalkBlock extends Block { public class BambooStalkBlock extends Block {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.block.BambooStalkBlock")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.block.BambooStalkBlock"));
public static final ReflectField<?> COLLISION_SHAPE = wrapEx(() -> REFLECT.field("COLLISION_SHAPE")); public static final ReflectField<?> SHAPE_COLLISION = wrapEx(() -> REFLECT.field("SHAPE_COLLISION"));
public static VoxelShape COLLISION_SHAPE() { public static VoxelShape SHAPE_COLLISION() {
return wrap(wrapReflectEx(COLLISION_SHAPE::getStaticValue), VoxelShape.class); return wrap(wrapReflectEx(SHAPE_COLLISION::getStaticValue), VoxelShape.class);
} }
public static void COLLISION_SHAPE(VoxelShape shape) { public static void SHAPE_COLLISION(VoxelShape shape) {
wrapReflectEx(() -> COLLISION_SHAPE.setStaticValue(unwrap(shape))); wrapReflectEx(() -> SHAPE_COLLISION.setStaticValue(unwrap(shape)));
} }
protected BambooStalkBlock(Object obj) { protected BambooStalkBlock(Object obj) {

View File

@@ -0,0 +1,39 @@
package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import org.bukkit.plugin.Plugin;
import java.util.List;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class APICommandMeta extends ReflectWrapper {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.APICommandMeta"));
private static final ReflectMethod<?> plugin = wrapEx(() -> REFLECT.method("plugin"));
private static final ReflectMethod<?> description = wrapEx(() -> REFLECT.method("description"));
private static final ReflectMethod<?> aliases = wrapEx(() -> REFLECT.method("aliases"));
public Plugin plugin() {
return (Plugin) wrapReflectEx(() -> plugin.invoke(__getRuntimeInstance()));
}
public String description() {
return (String) wrapReflectEx(() -> description.invoke(__getRuntimeInstance()));
}
@SuppressWarnings("unchecked")
public List<String> aliases() {
return (List<String>) wrapReflectEx(() -> aliases.invoke(__getRuntimeInstance()));
}
protected APICommandMeta(Object obj) {
super(obj);
}
}

View File

@@ -1,18 +1,15 @@
package fr.pandacube.lib.paper.reflect.wrapper.paper.commands; package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
import com.mojang.brigadier.tree.LiteralCommandNode; import fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectMethod; import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
import io.papermc.paper.command.brigadier.CommandSourceStack;
import org.bukkit.command.Command; import org.bukkit.command.Command;
import org.bukkit.plugin.Plugin;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class BukkitCommandNode extends ReflectWrapperTyped<LiteralCommandNode<CommandSourceStack>> { public class BukkitCommandNode<S> extends CommandNode<S> {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.bukkit.BukkitCommandNode")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.bukkit.BukkitCommandNode"));
private static final ReflectMethod<?> getBukkitCommand = wrapEx(() -> REFLECT.method("getBukkitCommand")); private static final ReflectMethod<?> getBukkitCommand = wrapEx(() -> REFLECT.method("getBukkitCommand"));

View File

@@ -1,43 +0,0 @@
package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
import com.mojang.brigadier.tree.LiteralCommandNode;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectConstructor;
import fr.pandacube.lib.reflect.ReflectMethod;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
import io.papermc.paper.command.brigadier.CommandSourceStack;
import io.papermc.paper.plugin.configuration.PluginMeta;
import org.bukkit.plugin.Plugin;
import org.jetbrains.annotations.NotNull;
import org.jetbrains.annotations.Nullable;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
public class PluginCommandNode extends ReflectWrapperTyped<LiteralCommandNode<CommandSourceStack>> {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.PluginCommandNode"));
private static final ReflectMethod<?> getPlugin = wrapEx(() -> REFLECT.method("getPlugin"));
private static final ReflectMethod<?> getDescription = wrapEx(() -> REFLECT.method("getDescription"));
private static final ReflectConstructor CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(String.class, PluginMeta.class, LiteralCommandNode.class, String.class));
public PluginCommandNode(@NotNull String literal, @NotNull PluginMeta plugin, @NotNull LiteralCommandNode<CommandSourceStack> rootLiteral, @Nullable String description) {
this(wrapReflectEx(() -> CONSTRUCTOR.instantiate(literal, plugin, rootLiteral, description)));
}
public Plugin getPlugin() {
return (Plugin) wrapReflectEx(() -> getPlugin.invoke(__getRuntimeInstance()));
}
public String getDescription() {
return (String) wrapReflectEx(() -> getDescription.invoke(__getRuntimeInstance()));
}
protected PluginCommandNode(Object obj) {
super(obj);
}
}

View File

@@ -1,14 +1,12 @@
package fr.pandacube.lib.paper.reflect.wrapper.paper.commands; package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
import com.mojang.brigadier.tree.LiteralCommandNode; import fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass; import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
import io.papermc.paper.command.brigadier.CommandSourceStack;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx; import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
public class ShadowBrigNode extends ReflectWrapperTyped<LiteralCommandNode<CommandSourceStack>> { public class ShadowBrigNode<S> extends CommandNode<S> {
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.ShadowBrigNode")); public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.ShadowBrigNode"));

View File

@@ -57,8 +57,8 @@ public class AutoUpdatedBossBar implements Listener {
* Schedule the update of this boss bar with synchronisation with the system clock. * Schedule the update of this boss bar with synchronisation with the system clock.
* The underlying method called is {@link Timer#schedule(TimerTask, long, long)}. * The underlying method called is {@link Timer#schedule(TimerTask, long, long)}.
* The updater is executed in a separate Thread. * The updater is executed in a separate Thread.
* @param msDelay ms before running the first update of this bossbar * @param msDelay ms before running the first update of this boss bar.
* @param msPeriod ms between each call of the updater * @param msPeriod ms between each call of the updater.
*/ */
public synchronized void scheduleUpdateTimeSyncThreadAsync(long msDelay, long msPeriod) { public synchronized void scheduleUpdateTimeSyncThreadAsync(long msDelay, long msPeriod) {
if (scheduled) if (scheduled)
@@ -82,8 +82,8 @@ public class AutoUpdatedBossBar implements Listener {
* Schedule the update of this boss bar with synchronisation with the ticking of this Minecraft server. * Schedule the update of this boss bar with synchronisation with the ticking of this Minecraft server.
* The underlying method called is {@link BukkitScheduler#runTaskTimer(org.bukkit.plugin.Plugin, Runnable, long, long)}. * The underlying method called is {@link BukkitScheduler#runTaskTimer(org.bukkit.plugin.Plugin, Runnable, long, long)}.
* The updater is executed by the main Server Thread. * The updater is executed by the main Server Thread.
* @param tickDelay number of server tick before running the first update of this boss bar * @param tickDelay number of server tick before running the first update of this boss bar.
* @param tickPeriod number of server tick between each call of the updater * @param tickPeriod number of server tick between each call of the updater.
*/ */
public synchronized void scheduleUpdateTickSyncThreadSync(long tickDelay, long tickPeriod) { public synchronized void scheduleUpdateTickSyncThreadSync(long tickDelay, long tickPeriod) {
if (scheduled) if (scheduled)

View File

@@ -141,7 +141,7 @@ public class BukkitEvent {
/** /**
* An single executor event listener. Used for the {@link #register(Class, EventListener)} static method and the other variants. * A single executor event listener. Used for the {@link #register(Class, EventListener)} static method and the other variants.
* @param <E> the event type. * @param <E> the event type.
*/ */
public interface EventListener<E extends Event> extends Listener, EventExecutor { public interface EventListener<E extends Event> extends Listener, EventExecutor {

View File

@@ -1,230 +0,0 @@
package fr.pandacube.lib.paper.util;
import java.util.Base64;
import java.util.List;
import java.util.UUID;
import java.util.stream.Collectors;
import org.bukkit.Bukkit;
import org.bukkit.Material;
import org.bukkit.inventory.ItemStack;
import org.bukkit.inventory.meta.SkullMeta;
import com.destroystokyo.paper.profile.PlayerProfile;
import com.destroystokyo.paper.profile.ProfileProperty;
import fr.pandacube.lib.chat.Chat;
/**
* Represents some special mob heads, also support creating player skulls and custom skulls.
*
* @author xigsag, SBPrime
*
* @see <a href="https://github.com/TigerHix/Hex-Utils/blob/9954159a323d12733b29c287a56980991cee2948/hex/util/Skull.java">github.com/TigerHix/Hex-Utils/hex/util/Skull.java</a>
*/
public enum Skull {
/** Standard skull of player MHF_ArrowLeft. */
ARROW_LEFT("MHF_ArrowLeft"),
/** Standard skull of player MHF_ArrowRight. */
ARROW_RIGHT("MHF_ArrowRight"),
/** Standard skull of player MHF_ArrowUp. */
ARROW_UP("MHF_ArrowUp"),
/** Standard skull of player MHF_ArrowDown. */
ARROW_DOWN("MHF_ArrowDown"),
/** Standard skull of player MHF_Question. */
QUESTION("MHF_Question"),
/** Standard skull of player MHF_Exclamation. */
EXCLAMATION("MHF_Exclamation"),
/** Standard skull of player FHG_Cam. */
CAMERA("FHG_Cam"),
/** Standard skull of player MHF_PigZombie. */
ZOMBIE_PIGMAN("MHF_PigZombie"),
/** Standard skull of player MHF_Pig. */
PIG("MHF_Pig"),
/** Standard skull of player MHF_Sheep. */
SHEEP("MHF_Sheep"),
/** Standard skull of player MHF_Blaze. */
BLAZE("MHF_Blaze"),
/** Standard skull of player MHF_Chicken. */
CHICKEN("MHF_Chicken"),
/** Standard skull of player MHF_Cow. */
COW("MHF_Cow"),
/** Standard skull of player MHF_Slime. */
SLIME("MHF_Slime"),
/** Standard skull of player MHF_Spider. */
SPIDER("MHF_Spider"),
/** Standard skull of player MHF_Squid. */
SQUID("MHF_Squid"),
/** Standard skull of player MHF_Villager. */
VILLAGER("MHF_Villager"),
/** Standard skull of player MHF_Ocelot. */
OCELOT("MHF_Ocelot"),
/** Standard skull of player MHF_Herobrine. */
HEROBRINE("MHF_Herobrine"),
/** Standard skull of player MHF_LavaSlime. */
LAVA_SLIME("MHF_LavaSlime"),
/** Standard skull of player MHF_MushroomCow. */
MOOSHROOM("MHF_MushroomCow"),
/** Standard skull of player MHF_Golem. */
GOLEM("MHF_Golem"),
/** Standard skull of player MHF_Ghast. */
GHAST("MHF_Ghast"),
/** Standard skull of player MHF_Enderman. */
ENDERMAN("MHF_Enderman"),
/** Standard skull of player MHF_CaveSpider. */
CAVE_SPIDER("MHF_CaveSpider"),
/** Standard skull of player MHF_Cactus. */
CACTUS("MHF_Cactus"),
/** Standard skull of player MHF_Cake. */
CAKE("MHF_Cake"),
/** Standard skull of player MHF_Chest. */
CHEST("MHF_Chest"),
/** Standard skull of player MHF_Melon. */
MELON("MHF_Melon"),
/** Standard skull of player MHF_OakLog. */
LOG("MHF_OakLog"),
/** Standard skull of player MHF_Pumpkin. */
PUMPKIN("MHF_Pumpkin"),
/** Standard skull of player MHF_TNT. */
TNT("MHF_TNT"),
/** Standard skull of player MHF_TNT2. */
DYNAMITE("MHF_TNT2");
private final String name;
Skull(String mcName) {
name = mcName;
}
/**
* Return the item based on this Skull enum.
*
* @return item stack
*/
public ItemStack get() {
return get(null, null);
}
/**
* Return the item based on this Skull enum, with the provided display name and lore.
* @param displayName the display name to add to the returned skull.
* @param lore the lore to add to the returned skull.
* @return item stack
*/
public ItemStack get(Chat displayName, List<Chat> lore) {
return getFromPlayerName(name, displayName, lore);
}
/**
* Return a skull of a player based on their name.
*
* @param name player's name
* @param displayName the display name to add to the returned skull.
* @param lore the lore to add to the returned skull.
* @return item stack
*/
public static ItemStack getFromPlayerName(String name, Chat displayName, List<Chat> lore) {
ItemStack itemStack = new ItemStack(Material.PLAYER_HEAD, 1);
SkullMeta meta = (SkullMeta) itemStack.getItemMeta();
@SuppressWarnings({ "deprecation", "unused" })
boolean b = meta.setOwner(name);
if (displayName != null)
meta.displayName(displayName.get());
if (lore != null)
meta.lore(lore.stream().map(Chat::get).collect(Collectors.toList()));
itemStack.setItemMeta(meta);
return itemStack;
}
/**
* Return a skull that has a custom texture specified by url.
* @param url skin url.
* @return item stack
*/
public static ItemStack getFromSkinURL(String url) {
return getFromSkinURL(url, null, null);
}
/**
* Return a skull that has a custom texture specified by url.
*
* @param url the skin full url.
* @param displayName the display name to add to the returned skull.
* @param lore the lore to add to the returned skull.
* @return item stack
*/
public static ItemStack getFromSkinURL(String url, Chat displayName, List<Chat> lore) {
return getFromBase64String(Base64.getEncoder().encodeToString(String.format("{\"textures\":{\"SKIN\":{\"url\":\"%s\"}}}", url).getBytes()), displayName, lore);
}
/**
* Return a skull that has a custom texture specified by a base64 String.
*
* @param str the base64 string from game profile information.
* @return item stack
*/
public static ItemStack getFromBase64String(String str) {
return getFromBase64String(str, null, null);
}
/**
* Return a skull that has a custom texture specified by a base64 String.
*
* @param str the base64 string from game profile information.
* @param displayName the display name to add to the returned skull.
* @param lore the lore to add to the returned skull.
* @return item stack
*/
public static ItemStack getFromBase64String(String str, Chat displayName, List<Chat> lore) {
ItemStack head = new ItemStack(Material.PLAYER_HEAD, 1);
SkullMeta headMeta = (SkullMeta) head.getItemMeta();
PlayerProfile profile = Bukkit.createProfile(UUID.nameUUIDFromBytes(str.getBytes()));
profile.setProperty(new ProfileProperty("textures", str));
headMeta.setPlayerProfile(profile);
if (displayName != null)
headMeta.displayName(displayName.get());
if (lore != null)
headMeta.lore(lore.stream().map(Chat::get).collect(Collectors.toList()));
head.setItemMeta(headMeta);
return head;
}
}

View File

@@ -71,9 +71,7 @@ import fr.pandacube.lib.util.log.Log;
try { try {
DB.getAll(SQLPermissions.class, SQLPermissions.type.eq(EntityType.User.getCode())) DB.getAll(SQLPermissions.class, SQLPermissions.type.eq(EntityType.User.getCode()))
.stream() .stream()
.collect(Collectors.groupingBy(el -> el.get(SQLPermissions.name), .collect(Collectors.groupingBy(el -> el.get(SQLPermissions.name))
Collectors.toCollection(() -> new SQLElementList<SQLPermissions>())
)
) )
.forEach((idStr, pData) -> { .forEach((idStr, pData) -> {
try { try {
@@ -100,7 +98,7 @@ import fr.pandacube.lib.util.log.Log;
return initPlayer(playerId, playerData); return initPlayer(playerId, playerData);
} }
private CachedPlayer initPlayer(UUID playerId, SQLElementList<SQLPermissions> playerData) { private CachedPlayer initPlayer(UUID playerId, List<SQLPermissions> playerData) {
Map<String, List<SQLPermissions>> playerRawData = playerData.stream() Map<String, List<SQLPermissions>> playerRawData = playerData.stream()
.collect( .collect(

View File

@@ -122,9 +122,11 @@ public final class ReflectField<T> extends ReflectMember<T, String, Field, NoSuc
// if the field is final, we have to do some unsafe stuff :/ // if the field is final, we have to do some unsafe stuff :/
if (sunMiscUnsafeInstance != null) { // Java >= 16 if (sunMiscUnsafeInstance != null) { // Java >= 16
// set the value of the field, directly in the memory // set the value of the field, directly in the memory
@SuppressWarnings("deprecation") // no other options yet. VarHandle blocks edition of final fields
Object unsafeObjInstance = Modifier.isStatic(realModifiers) Object unsafeObjInstance = Modifier.isStatic(realModifiers)
? sunMiscUnsafeInstance.staticFieldBase(f) ? sunMiscUnsafeInstance.staticFieldBase(f)
: instance; : instance;
@SuppressWarnings("deprecation") // no other options yet. VarHandle blocks edition of final fields
long offset = Modifier.isStatic(realModifiers) long offset = Modifier.isStatic(realModifiers)
? sunMiscUnsafeInstance.staticFieldOffset(f) ? sunMiscUnsafeInstance.staticFieldOffset(f)
: sunMiscUnsafeInstance.objectFieldOffset(f); : sunMiscUnsafeInstance.objectFieldOffset(f);

View File

@@ -39,7 +39,7 @@ public class ReflectListWrapper<W extends ReflectWrapperI> extends MappedListVie
*/ */
@Override @Override
public boolean equals(Object o) { public boolean equals(Object o) {
return o instanceof List l && backend.equals(l instanceof ReflectListWrapper<?> rw ? rw.backend : l); return o instanceof List<?> l && backend.equals(l instanceof ReflectListWrapper<?> rw ? rw.backend : l);
} }
@Override @Override

View File

@@ -198,16 +198,20 @@ public abstract class ReflectWrapper implements ReflectWrapperI {
@Override @Override
public boolean equals(Object obj) { public boolean equals(Object obj) {
if (obj instanceof ReflectWrapper wr) { if (obj instanceof ReflectWrapper wr) {
return Objects.equals(reflectObject, wr.reflectObject); return reflectObject.equals(wr.reflectObject);
} }
return false; return false;
} }
@Override @Override
public int hashCode() { public int hashCode() {
return Objects.hashCode(reflectObject); return reflectObject.hashCode();
}
@Override
public String toString() {
return reflectObject.toString();
} }
} }

View File

@@ -16,11 +16,6 @@ public abstract class ReflectWrapperTyped<T> extends ReflectWrapper implements R
super(obj); super(obj);
} }
@Override
public Class<? extends T> __getRuntimeClass() {
return ReflectWrapperTypedI.super.__getRuntimeClass();
}
@SuppressWarnings("unchecked") @SuppressWarnings("unchecked")
@Override @Override
public T __getRuntimeInstance() { public T __getRuntimeInstance() {

View File

@@ -6,10 +6,10 @@ import java.util.stream.Collectors;
/** /**
* Utility class to track and limit the amount of a specific value for a specified amount of duration. * Utility class to track and limit the amount of a specific value for a specified amount of duration.
* * <p>
* An exemple of application is for rolling expense limit of a debit card: you cannot expense more that {@code $X} * An exemple of application is for rolling expense limit of a debit card: you cannot expense more that {@code $X}
* during a rolling period of {@code $Y} time. * during a rolling period of {@code $Y} time.
* * <p>
* Here is an example usage of this class: * Here is an example usage of this class:
* <pre> * <pre>
* AmountPerTimeLimiter instance = new AmountPerTimeLimiter(X, Y); * AmountPerTimeLimiter instance = new AmountPerTimeLimiter(X, Y);

View File

@@ -55,7 +55,7 @@ public class EnumUtil {
* Search for a specific enum entry in the provided enum type, using the case-insensitive search string. * Search for a specific enum entry in the provided enum type, using the case-insensitive search string.
* unlike {@link #searchEnum(Class, String)}, this method does not statically check the enum type, in case it is not * unlike {@link #searchEnum(Class, String)}, this method does not statically check the enum type, in case it is not
* known at compilation time. * known at compilation time.
* * <p>
* For a statically checked enum type, uses {@link #searchEnum(Class, String)} instead. * For a statically checked enum type, uses {@link #searchEnum(Class, String)} instead.
* *
* @param enumType the class of the enum in which to search * @param enumType the class of the enum in which to search

View File

@@ -15,7 +15,7 @@ public class IteratorIterator<T> implements Iterator<T> {
/** /**
* Create an {@link IteratorIterator} with the provided {@link Collection} of {@link Iterable}. * Create an {@link IteratorIterator} with the provided {@link Collection} of {@link Iterable}.
* The iterables iterators will be concatenated in the order of the collections iterator. * The iterable's iterators will be concatenated in the order of the collections iterator.
* @param coll the collection of iterables. * @param coll the collection of iterables.
* @return a new instance of {@link IteratorIterator} iterating over the elements of the provided iterables. * @return a new instance of {@link IteratorIterator} iterating over the elements of the provided iterables.
* @param <T> the type of the values in the iterables. * @param <T> the type of the values in the iterables.
@@ -37,7 +37,7 @@ public class IteratorIterator<T> implements Iterator<T> {
/** /**
* Create an {@link IteratorIterator} with the provided array of {@link Iterable}. * Create an {@link IteratorIterator} with the provided array of {@link Iterable}.
* The iterables iterators will be concatenated in the order of the array. * The iterable's iterators will be concatenated in the order of the array.
* @param arr the array of iterables. * @param arr the array of iterables.
* @return a new instance of {@link IteratorIterator} iterating over the elements of the provided iterables. * @return a new instance of {@link IteratorIterator} iterating over the elements of the provided iterables.
* @param <T> the type of the values in the iterables. * @param <T> the type of the values in the iterables.

View File

@@ -1,6 +1,11 @@
package fr.pandacube.lib.util; package fr.pandacube.lib.util;
import java.util.ArrayList;
import java.util.Collections;
import java.util.Iterator;
import java.util.LinkedHashMap;
import java.util.List; import java.util.List;
import java.util.Map;
import java.util.Random; import java.util.Random;
import java.util.Set; import java.util.Set;
@@ -101,7 +106,7 @@ public class RandomUtil {
* The probability of each value to be returned depends on the frequencies provided. * The probability of each value to be returned depends on the frequencies provided.
* @param frequencies the frequencies of each entry * @param frequencies the frequencies of each entry
* @return the index of an entry, or -1 if it is unable to pick anything (all the frequencies are 0 or there is no provided frequency) * @return the index of an entry, or -1 if it is unable to pick anything (all the frequencies are 0 or there is no provided frequency)
* @throws IllegalArgumentException if frequencies is null. * @throws IllegalArgumentException if frequencies is null or one of the values is negative.
*/ */
public static int randomIndexOfFrequencies(double... frequencies) { public static int randomIndexOfFrequencies(double... frequencies) {
if (frequencies == null) if (frequencies == null)
@@ -123,6 +128,30 @@ public class RandomUtil {
} }
/**
* Creates a new map with the values shuffled, and the key in the same iteration order as the provided map.
* @param input the source map, untouched.
* @return a new map with shuffled values.
* @param <K> the key type.
* @param <V> the value type.
*/
public static <K, V> Map<K, V> shuffleMap(Map<K, V> input) {
Map<K, V> ret = new LinkedHashMap<>();
List<V> values = new ArrayList<>(input.values());
Collections.shuffle(values, rand);
Iterator<K> iK = input.keySet().iterator();
Iterator<V> iV = values.iterator();
while (iK.hasNext() && iV.hasNext()) {
ret.put(iK.next(), iV.next());
}
return ret;
}
/** /**
* A set of characters representing all the lowercase letters of the latin alphabet (only in the ASCII table). * A set of characters representing all the lowercase letters of the latin alphabet (only in the ASCII table).
*/ */

View File

@@ -7,7 +7,7 @@ import java.util.logging.Logger;
/** /**
* Utility class to easily log info into a provided logger. This class avoid the needs to fetch the logger everytime it * Utility class to easily log info into a provided logger. This class avoid the needs to fetch the logger everytime it
* is needed. * is needed.
* * <p>
* For instance, this piece of code: * For instance, this piece of code:
* <pre> * <pre>
* getTheLoggerFromSomewhere().info(message); * getTheLoggerFromSomewhere().info(message);
@@ -22,7 +22,7 @@ import java.util.logging.Logger;
* Log.info(message); * Log.info(message);
* </pre> * </pre>
* *
* This the {@link #setLogger(Logger)} method is not called, thi class will use the logger returned by * If the {@link #setLogger(Logger)} method is not called, this class will use the logger returned by
* {@link Logger#getGlobal()}. * {@link Logger#getGlobal()}.
*/ */
public final class Log { public final class Log {

View File

@@ -23,6 +23,7 @@ public abstract class AbstractClientWS implements AbstractWS {
private final URI uri; private final URI uri;
private boolean autoReconnect; private boolean autoReconnect;
private boolean isConnecting; private boolean isConnecting;
private HttpClient httpClient = HttpClient.newHttpClient();
private final AtomicReference<WebSocket> socket = new AtomicReference<>(); private final AtomicReference<WebSocket> socket = new AtomicReference<>();
@@ -114,7 +115,7 @@ public abstract class AbstractClientWS implements AbstractWS {
synchronized (socket) { synchronized (socket) {
if (autoReconnect && !isConnecting && socket.get() == null) { if (autoReconnect && !isConnecting && socket.get() == null) {
try { try {
Thread.sleep(1000); Thread.sleep(2000);
} catch (InterruptedException ignored) { } catch (InterruptedException ignored) {
Thread.currentThread().interrupt(); Thread.currentThread().interrupt();
} }
@@ -127,8 +128,10 @@ public abstract class AbstractClientWS implements AbstractWS {
private void connect() { private void connect() {
synchronized (socket) { synchronized (socket) {
isConnecting = true; isConnecting = true;
HttpClient.newHttpClient() if (httpClient == null)
.newWebSocketBuilder() httpClient = HttpClient.newHttpClient();
httpClient.newWebSocketBuilder()
.connectTimeout(Duration.ofSeconds(5)) .connectTimeout(Duration.ofSeconds(5))
.buildAsync(uri, receiveListener) .buildAsync(uri, receiveListener)
.whenCompleteAsync((ws, ex) -> { .whenCompleteAsync((ws, ex) -> {
@@ -145,13 +148,15 @@ public abstract class AbstractClientWS implements AbstractWS {
ex = ex.getCause(); ex = ex.getCause();
if (ex instanceof IOException) { if (ex instanceof IOException) {
reconnectIfNecessary(); reconnectIfNecessary();
log("Unable to connect. Trying again...: " + ex); log("Can't connect. Trying again. " + ex);
} }
else { else {
autoReconnect = false; autoReconnect = false;
logError("Error connecting (not trying to reconnect even if asked)", ex); logError("Error connecting (not trying to reconnect even if asked)", ex);
} }
}); });
} }
} }

View File

@@ -61,7 +61,7 @@ public abstract class AbstractServerWS extends WebSocketAdapter implements Abstr
} }
@Override @Override
public final void sendClose(int code, String reason) throws IOException { public final void sendClose(int code, String reason) {
getSession().close(code, reason); getSession().close(code, reason);
isClosed = true; isClosed = true;
} }

11
pom.xml
View File

@@ -55,11 +55,14 @@
<maven.compiler.target>21</maven.compiler.target> <maven.compiler.target>21</maven.compiler.target>
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding> <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
<bungeecord.version>1.21-R0.1-SNAPSHOT</bungeecord.version> <bungeecord.version>1.21-R0.4-SNAPSHOT</bungeecord.version>
<paper.version>1.21.3-R0.1</paper.version> <paper.version>1.21.8-R0.1</paper.version>
<mc.version>1.21.3</mc.version> <mc.version>1.21.8</mc.version>
<guava.version>32.1.2-jre</guava.version> <!-- Match the version imported by Paper API/BungeeCord API if possible --> <guava.version>33.3.1-jre</guava.version> <!-- Match the version imported by Paper API/BungeeCord API if possible -->
<gson.version>2.11.0</gson.version> <!-- Match the version imported by Paper API/BungeeCord API if possible -->
<brigadier.version>1.3.10</brigadier.version> <!-- Match the version imported by Paper API if possible -->
<datafixerupper.version>8.0.16</datafixerupper.version> <!-- Match the version used internally in Paper Server -->
</properties> </properties>
<modules> <modules>