PandaLib/pandalib-chat/src/main/java/fr/pandacube/lib/chat/Chat.java

950 lines
37 KiB
Java
Raw Blame History

This file contains ambiguous Unicode characters

This file contains Unicode characters that might be confused with other characters. If you think that this is intentional, you can safely ignore this warning. Use the Escape button to reveal them.

package fr.pandacube.lib.chat;
import net.kyori.adventure.key.Key;
import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentBuilder;
import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.TextComponent;
import net.kyori.adventure.text.TranslationArgument;
import net.kyori.adventure.text.TranslationArgumentLike;
import net.kyori.adventure.text.event.ClickEvent;
import net.kyori.adventure.text.event.HoverEvent;
import net.kyori.adventure.text.event.HoverEventSource;
import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.Style;
import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.format.TextDecoration;
import net.kyori.adventure.text.format.TextDecoration.State;
import net.kyori.adventure.text.minimessage.MiniMessage;
import net.kyori.adventure.text.serializer.gson.GsonComponentSerializer;
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
import net.kyori.adventure.text.serializer.plain.PlainTextComponentSerializer;
import org.jetbrains.annotations.NotNull;
import java.awt.*;
import java.util.Locale;
import java.util.Objects;
import java.util.function.Consumer;
import java.util.function.UnaryOperator;
/**
* A builder for chat components.
* <p>
* Use one of the provided static methods to create a new instance.
* <p>
* This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
* Adventure API and its implementation without using the final methods of this builder.
* <p>
* The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the
* built component. The rationale for this design is explained in the documentation of {@link FormatableChat}.
*/
public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
/* package */ final ComponentBuilder<?, ?> builder;
/* package */ boolean console = false;
/* package */ Integer maxWidth = null;
/* package */ Chat(ComponentBuilder<?, ?> b) {
builder = Objects.requireNonNull(b, "Provided component builder must not be null");
}
/*
* Builder terminal operation and serialization
*/
/**
* Builds the component into Adventure Component instance.
* @return the {@link Component} built from this {@link Chat} component.
*/
public Component get() {
return builder.build();
}
private static final LegacyComponentSerializer LEGACY_SERIALIZER_BUNGEE_FRIENDLY = LegacyComponentSerializer.builder()
.hexColors()
.useUnusualXRepeatedCharacterHexFormat()
.build();
/**
* Converts the built component into legacy text.
* @return the legacy text. RGB colors are in BungeeCord format.
*/
public String getLegacyText() {
return LEGACY_SERIALIZER_BUNGEE_FRIENDLY.serialize(get());
}
/**
* Converts the built component into plain text.
* @return the plain text of this component.
*/
public String getPlainText() {
return PlainTextComponentSerializer.plainText().serializeOr(get(), "");
}
@Override
public @NotNull HoverEvent<Component> asHoverEvent(@NotNull UnaryOperator<Component> op) {
return HoverEvent.showText(op.apply(get()));
}
/**
* Builds the component into Adventure Component instance.
* @return the {@link Component} built from this {@link Chat} component.
*/
@Override
public @NotNull Component asComponent() {
return get();
}
/**
* Builds the component into Adventure Component instance, also down sampling the RGB colors to named colors.
* @return the {@link Component} built from this {@link Chat} component, with down-sampled colors.
*/
public Component getAsDownSampledColorsComponent() {
String json = GsonComponentSerializer.colorDownsamplingGson().serialize(get());
return GsonComponentSerializer.gson().deserialize(json);
}
/**
* Returns a new {@link Chat} consisting of this {@link Chat} instance, with the RGB colors down-sampled to named colors.
* @return a new {@link Chat} instance, with down-sampled colors.
*/
public Chat getAsDownSampledColors() {
return chatComponent(getAsDownSampledColorsComponent());
}
/**
* Returns a MiniMessage representation of this {@link Chat} component.
* @return the MiniMessage representation if this {@link Chat} component.
*/
public String getMiniMessage() {
return MiniMessage.miniMessage().serialize(get());
}
/*
* Sub-component appending
*/
/**
* Appends a component to this component.
* @param comp the component to append.
* @return this.
*/
public Chat then(Component comp) {
if (comp instanceof TextComponent txtComp) {
if (!txtComp.hasStyling() && (txtComp.content().isEmpty())) {
// no need to add the provided component to the current component.
// but eventual child component must be added
if (!txtComp.children().isEmpty()) {
for (Component child : txtComp.children())
then(child);
}
return this;
}
}
builder.append(comp);
return this;
}
/**
* Appends a component to this component.
* @param comp the component to append.
* @return this.
*/
public Chat then(ComponentLike comp) {
if (comp instanceof ChatFilledLine ac) {
ac.console(console);
if (maxWidth != null)
ac.maxWidth(maxWidth);
}
return then(comp.asComponent());
}
/*
* Special sub-components appending
*/
/**
* Appends a plain text to this component.
* @param plainText the plain text.
* @return this.
*/
public Chat thenText(Object plainText) { return then(text(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#infoColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenInfo(Object plainText) { return then(infoText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#warningColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenWarning(Object plainText) { return then(warningText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#successColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenSuccess(Object plainText) { return then(successText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#failureColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenFailure(Object plainText) { return then(failureText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#dataColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenData(Object plainText) { return then(dataText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#decorationColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenDecoration(Object plainText) { return then(decorationText(plainText)); }
/**
* Appends a component with the provided legacy text as its main text content, and colored in white in case there is
* no color on the generated parent component.
* @param legacyText the legacy text.
* @return this.
*/
public Chat thenPlayerName(String legacyText) { return then(playerNameText(legacyText)); }
/**
* Appends the provided Component, coloring it in white in case there is no color defined. If the provided component
* is an instance of Chat, its content will be duplicated, and the provided one will be untouched.
* @param comp the component.
* @return this.
*/
public Chat thenPlayerName(ComponentLike comp) { return then(playerNameComponent(comp)); }
/**
* Appends a component consisting of a new line.
* @return this.
*/
public Chat thenNewLine() { return then(Component.newline()); }
/**
* Appends a component with the provided legacy text as its content, using the section {@code "§"} character.
* @param legacyText the legacy text that uses the {@code "§"} character.
* @return this.
*/
public Chat thenLegacyText(Object legacyText) { return then(legacyText(legacyText)); }
/**
* Appends a component with the provided legacy text as its content, using the ampersand {@code "&"} character.
* @param legacyText the legacy text that uses the {@code "&"} character.
* @return this.
*/
public Chat thenLegacyAmpersandText(Object legacyText) { return then(legacyAmpersandText(legacyText)); }
/**
* Appends a component with the provided MiniMessage text as its content.
* @param miniMessageText the MiniMessage text.
* @return this.
*/
public Chat thenMiniMessage(String miniMessageText) { return then(miniMessageText(miniMessageText)); }
/**
* Appends a component with the provided translation key and parameters.
* @param key the translation key.
* @param with the translation parameters.
* @return this.
*/
public Chat thenTranslation(String key, Object... with) { return then(translation(key, with)); }
/**
* Appends a component with the provided keybinding.
* @param key the keybinding to display.
* @return this.
*/
public Chat thenKeyBind(String key) { return then(keybind(key)); }
/**
* Appends a component with the provided score name and objective.
* @param name the score name.
* @param objective the score objective.
* @return this.
*/
public Chat thenScore(String name, String objective) { return then(score(name, objective)); }
/**
* Appends a component that leads to a URL when clicked.
* @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component.
* @return this.
*/
public Chat thenClickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) { return then(clickableURL(inner, url, hover)); }
/**
* Appends a component that leads to a URL when clicked.
* <p>
* When hovered, the component will display the url. To customize the hover content, use
* {@link #thenClickableURL(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return this.
*/
public Chat thenClickableURL(ComponentLike inner, String url) { return then(clickableURL(inner, url)); }
/**
* Appends a component that leads to a URL when clicked.
* <p>
* The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #thenClickableURL(ComponentLike, String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component.
* @return this.
*/
public Chat thenClickableURL(String url, HoverEventSource<?> hover) { return then(clickableURL(url, hover)); }
/**
* Appends a component that leads to a URL when clicked.
* <p>
* The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #thenClickableURL(ComponentLike, String)}.
* <p>
* When hovered, the component will display the url. To customize the hover content, use
* {@link #thenClickableURL(String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return this.
*/
public Chat thenClickableURL(String url) { return then(clickableURL(url)); }
/**
* Appends a component that runs a command when clicked.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(ComponentLike inner, String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableCommand(inner, cmdWithSlash, hover)); }
/**
* Appends a component that runs a command when clicked.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenClickableCommand(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(ComponentLike inner, String cmdWithSlash) { return then(clickableCommand(inner, cmdWithSlash)); }
/**
* Appends a component that runs a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenClickableCommand(ComponentLike, String, HoverEventSource)}.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableCommand(cmdWithSlash, hover)); }
/**
* Appends a component that runs a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenClickableCommand(ComponentLike, String)}.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenClickableCommand(String, HoverEventSource)}.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(String cmdWithSlash) { return then(clickableCommand(cmdWithSlash)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(ComponentLike inner, String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableSuggest(inner, cmdWithSlash, hover)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenCommandSuggest(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(ComponentLike inner, String cmdWithSlash) { return then(clickableSuggest(inner, cmdWithSlash)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenCommandSuggest(ComponentLike, String, HoverEventSource)}.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableSuggest(cmdWithSlash, hover)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenCommandSuggest(ComponentLike, String)}.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenCommandSuggest(String, HoverEventSource)}.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(String cmdWithSlash) { return then(clickableSuggest(cmdWithSlash)); }
/**
* Appends a component filling a chat line with the configured decoration character and
* color and a left-aligned text.
* @param leftText the text aligned to the left.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
* and color and a left-aligned text.
*/
public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
/**
* Appends a component filling a chat line with the configured decoration character and
* color and a right-aligned text.
* @param rightText the text aligned to the right.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
* and color and a right-aligned text.
*/
public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
/**
* Appends a component filling a chat line with the configured decoration character and
* color and a centered text.
* @param centerText the text aligned to the center.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
* and color and a centered text.
*/
public Chat thenCenterText(ComponentLike centerText) {
return then(centerText(centerText, console));
}
/**
* Appends a component filling a chat line with the configured decoration character and color.
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
*/
public Chat thenFilledLine() { return then(filledLine(console)); }
/**
* A {@link Chat} that can be formatted.
* <p>
* The purpose of subclassing {@link Chat} is to avoid ambiguity with the way the Bungee chat component builder works.
* Here is an example of to use their builder (from
* <a href="https://www.spigotmc.org/wiki/the-chat-component-api/#the-component-builder-api">the Spigot wiki</a>):
* <pre>{@code
* BaseComponent[] component = new ComponentBuilder("Hello ").color(ChatColor.RED)
* .append("world").color(ChatColor.DARK_RED).bold(true)
* .append("!").color(ChatColor.RED)
* .create();
* }</pre>
* Here, when you call a formatting method (like {@code bold(boolean)} or {@code color(ChatColor)}) after the
* {@code append(String)} method, the formatting apply to the last subcomponent appended.
* <p>
* In our design, we want the formatting to apply to the currently built component, not the last appended one.
* The purpose is to make the component structure clearer and have better control of the formatting over the
* component hierarchy.
* Here is the equivalent of the above code, with the {@link Chat} API:
* <pre>{@code
* Chat component = Chat.text("Hello ").red()
* .then(Chat.text("world").darkRed().bold())
* .thenText("!"); // short for .then(Chat.text("!"))
* // the red color for "!" is not needed because the parent component is already red.
* }</pre>
* When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast
* to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
* subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
* class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again.
* <pre>{@code
* Chat component = Chat.text("Hello ").red()
* .then(Chat.text("world").darkRed().bold())
* .thenText("!");
* // ok now I want to underline everything:
* ((FormatableChat)component).underlined(); // this will not format only the last appended text.
* }</pre>
*/
public static final class FormatableChat extends Chat {
/* package */ FormatableChat(ComponentBuilder<?, ?> c) {
super(c);
}
/**
* Configure if this component will be rendered on console or not.
* @param c true for console, false for game UI.
* @return this.
*/
public FormatableChat console(boolean c) { console = c; return this; }
/**
* Configure the width of the line.
* @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
* console rendering.
* @return this.
*/
public FormatableChat maxWidth(int w) { maxWidth = w; return this; }
/**
* Sets the color of this component.
* @param c the color.
* @return this.
*/
public FormatableChat color(TextColor c) { builder.color(c); return this; }
/**
* Sets the color of this component.
* @param c the color.
* @return this.
*/
public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
/**
* Sets the color of this component.
* @param c the color.
* @return this.
*/
public FormatableChat color(String c) {
if (c == null)
return color((TextColor) null);
TextColor tc = c.startsWith("#")
? TextColor.fromCSSHexString(c)
: NamedTextColor.NAMES.value(c.toLowerCase(Locale.ROOT));
if (tc == null)
throw new IllegalArgumentException("Invalid color string '" + c + "'.");
return color(tc);
}
/**
* Sets the color of this component to {@link NamedTextColor#BLACK}.
* @return this.
*/
public FormatableChat black() { return color(NamedTextColor.BLACK); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
* @return this.
*/
public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
* @return this.
*/
public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
* @return this.
*/
public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_RED}.
* @return this.
*/
public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
* @return this.
*/
public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
/**
* Sets the color of this component to {@link NamedTextColor#GOLD}.
* @return this.
*/
public FormatableChat gold() { return color(NamedTextColor.GOLD); }
/**
* Sets the color of this component to {@link NamedTextColor#GRAY}.
* @return this.
*/
public FormatableChat gray() { return color(NamedTextColor.GRAY); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
* @return this.
*/
public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
/**
* Sets the color of this component to {@link NamedTextColor#BLUE}.
* @return this.
*/
public FormatableChat blue() { return color(NamedTextColor.BLUE); }
/**
* Sets the color of this component to {@link NamedTextColor#GREEN}.
* @return this.
*/
public FormatableChat green() { return color(NamedTextColor.GREEN); }
/**
* Sets the color of this component to {@link NamedTextColor#AQUA}.
* @return this.
*/
public FormatableChat aqua() { return color(NamedTextColor.AQUA); }
/**
* Sets the color of this component to {@link NamedTextColor#RED}.
* @return this.
*/
public FormatableChat red() { return color(NamedTextColor.RED); }
/**
* Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
* @return this.
*/
public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
/**
* Sets the color of this component to {@link NamedTextColor#YELLOW}.
* @return this.
*/
public FormatableChat yellow() { return color(NamedTextColor.YELLOW); }
/**
* Sets the color of this component to {@link NamedTextColor#WHITE}.
* @return this.
*/
public FormatableChat white() { return color(NamedTextColor.WHITE); }
/**
* Sets the color of this component to {@link ChatConfig#successColor}.
* @return this.
*/
public FormatableChat successColor() { return color(ChatConfig.successColor); }
/**
* Sets the color of this component to {@link ChatConfig#failureColor}.
* @return this.
*/
public FormatableChat failureColor() { return color(ChatConfig.failureColor); }
/**
* Sets the color of this component to {@link ChatConfig#infoColor}.
* @return this.
*/
public FormatableChat infoColor() { return color(ChatConfig.infoColor); }
/**
* Sets the color of this component to {@link ChatConfig#warningColor}.
* @return this.
*/
public FormatableChat warningColor() { return color(ChatConfig.warningColor); }
/**
* Sets the color of this component to {@link ChatConfig#dataColor}.
* @return this.
*/
public FormatableChat dataColor() { return color(ChatConfig.dataColor); }
/**
* Sets the color of this component to {@link ChatConfig#decorationColor}.
* @return this.
*/
public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); }
/**
* Sets the color of this component to {@link ChatConfig#urlColor}.
* @return this.
*/
public FormatableChat urlColor() { return color(ChatConfig.urlColor); }
/**
* Sets the color of this component to {@link ChatConfig#commandColor}.
* @return this.
*/
public FormatableChat commandColor() { return color(ChatConfig.commandColor); }
/**
* Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
* @return this.
*/
public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
/**
* Sets the color of this component to {@link ChatConfig#broadcastColor}.
* @return this.
*/
public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
private FormatableChat setDecoration(TextDecoration deco, Boolean state) {
return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
}
/**
* Sets the bold status of this component.
* @param b true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
/**
* Enables the bold status of this component.
* @return this.
*/
public FormatableChat bold() { return bold(true); }
/**
* Sets the italic status of this component.
* @param i true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
/**
* Enables the italic status of this component.
* @return this.
*/
public FormatableChat italic() { return italic(true); }
/**
* Sets the underlined status of this component.
* @param u true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
/**
* Enables the underlined status of this component.
* @return this.
*/
public FormatableChat underlined() { return underlined(true); }
/**
* Sets the strikethrough status of this component.
* @param s true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
/**
* Enables the strikethrough status of this component.
* @return this.
*/
public FormatableChat strikethrough() { return strikethrough(true); }
/**
* Sets the obfuscated status of this component.
* @param o true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
/**
* Enables the obfuscated status of this component.
* @return this.
*/
public FormatableChat obfuscated() { return obfuscated(true); }
/**
* Sets the font of this component.
* @param f the font namespaced key.
* @return this.
*/
public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); }
/**
* Configure this component to insert the specified text at the cursor position when clicked.
* @param i the text to insert.
* @return this.
*/
public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
/**
* Configure this components click event.
* @param e the {@link ClickEvent}.
* @return this.
*/
private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
/**
* Configure this component to execute the specified command when clicked.
* @param cmdWithSlash the command to execute.
* @return this.
*/
public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
/**
* Configure this component to insert in the chat-box the specified command when clicked.
* @param cmdWithSlash the command to suggest.
* @return this.
*/
public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
/**
* Configure this component to copy into clipboard the specified text when clicked.
* @param value the text to copy.
* @return this.
*/
public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
/**
* Configure this component to open the specified URL when clicked.
* @param url the URL to open.
* @return this.
*/
public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
/**
* Configure this component to change the page of the opened book when clicked.
* @param page the page to go to.
* @return this.
*/
public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
/**
* Configure this components hover event.
* @param e the {@link HoverEventSource}.
* @return this.
*/
public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); }
/**
* Configure this component to show the provided legacy text when hovered.
* @param legacyText the legacy text to show.
* @return this.
*/
public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
}
@Override
public boolean equals(Object obj) {
return obj instanceof Chat c
&& builder.equals(c.builder);
}
@Override
public int hashCode() {
return get().hashCode();
}
@Override
public String toString() {
return getPlainText();
}
/* package */ static ComponentLike filterObjToComponentLike(Object v) {
return switch (v) {
case ComponentLike componentLike -> componentLike;
case null, default -> Component.text(Objects.toString(v));
};
}
/* package */ static ComponentLike[] filterObjToComponentLike(Object[] values) {
if (values == null)
return null;
ComponentLike[] ret = new ComponentLike[values.length];
for (int i = 0; i < values.length; i++) {
ret[i] = filterObjToComponentLike(values[i]);
}
return ret;
}
/* package */ static TranslationArgumentLike[] filterObjToTranslationArgumentLike(Object[] values) {
if (values == null)
return null;
TranslationArgumentLike[] ret = new TranslationArgumentLike[values.length];
for (int i = 0; i < values.length; i++) {
Object v = values[i];
if (v instanceof Number n)
ret[i] = TranslationArgument.numeric(n);
else if (v instanceof Boolean b)
ret[i] = TranslationArgument.bool(b);
else
ret[i] = TranslationArgument.component(filterObjToComponentLike(values[i]));
}
return ret;
}
/**
* Force the italic formatting to be set to false if it is not explicitly set in the component.
* This is useful for item lores that defaults to italic in the game UI.
* @param c the {@link Chat} in which to set the italic property if needed.
* @return the provided {@link Chat} instance.
*/
public static Chat italicFalseIfNotSet(Chat c) {
c.builder.style(b -> {
if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
((FormatableChat) c).italic(false);
}
});
return c;
}
}