PandaLib/pandalib-chat/src/main/java/fr/pandacube/lib/chat/Chat.java

1066 lines
41 KiB
Java
Raw Normal View History

package fr.pandacube.lib.chat;
import net.kyori.adventure.key.Key;
import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentBuilder;
import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.TextComponent;
import net.kyori.adventure.text.TranslationArgument;
import net.kyori.adventure.text.TranslationArgumentLike;
import net.kyori.adventure.text.event.ClickEvent;
import net.kyori.adventure.text.event.HoverEvent;
import net.kyori.adventure.text.event.HoverEventSource;
2021-07-24 19:37:04 +02:00
import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.Style;
import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.format.TextDecoration;
import net.kyori.adventure.text.format.TextDecoration.State;
import net.kyori.adventure.text.minimessage.MiniMessage;
import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
import net.kyori.adventure.text.serializer.gson.GsonComponentSerializer;
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
2021-07-24 19:37:04 +02:00
import net.kyori.adventure.text.serializer.plain.PlainTextComponentSerializer;
import net.md_5.bungee.api.ChatColor;
import net.md_5.bungee.api.chat.BaseComponent;
import org.jetbrains.annotations.NotNull;
import java.awt.*;
import java.util.Objects;
import java.util.function.Consumer;
import java.util.function.UnaryOperator;
2022-07-30 13:58:16 +02:00
/**
* A builder for chat components.
* <p>
* Use one of the provided static methods to create a new instance.
* <p>
* This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
* Adventure API and its implementation without using the final methods of this builder.
2022-07-30 13:58:16 +02:00
* <p>
* The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the
* built component. The rationale for this design is explained in the documentation of {@link FormatableChat}.
2022-07-30 13:58:16 +02:00
*/
public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
2022-07-30 13:58:16 +02:00
/* package */ final ComponentBuilder<?, ?> builder;
/* package */ boolean console = false;
/* package */ Integer maxWidth = null;
/* package */ Chat(ComponentBuilder<?, ?> b) {
builder = Objects.requireNonNull(b, "Provided component builder must not be null");
}
/*
* Builder terminal operation and serialization
*/
/**
* Builds the component into Adventure Component instance.
* @return the {@link Component} built from this {@link Chat} component.
2022-07-30 13:58:16 +02:00
*/
public Component getAdv() {
return builder.build();
}
/**
* Builds the component into BungeeCord {@link BaseComponent} instance.
* @return the {@link BaseComponent} built from this {@link Chat} component.
2022-07-30 13:58:16 +02:00
*/
public BaseComponent get() {
return toBungee(getAdv());
}
/**
* Builds the component into BungeeCord {@link BaseComponent} array.
* @return the {@link BaseComponent} array built from this {@link Chat} component.
2022-07-30 13:58:16 +02:00
*/
public BaseComponent[] getAsArray() {
return toBungeeArray(getAdv());
}
private static final LegacyComponentSerializer LEGACY_SERIALIZER_BUNGEE_FRIENDLY = LegacyComponentSerializer.builder()
2022-07-30 13:58:16 +02:00
.hexColors()
.useUnusualXRepeatedCharacterHexFormat()
.build();
/**
* Converts the built component into legacy text.
2022-07-30 13:58:16 +02:00
* @return the legacy text. RGB colors are in BungeeCord format.
*/
public String getLegacyText() {
return LEGACY_SERIALIZER_BUNGEE_FRIENDLY.serialize(getAdv());
2022-07-30 13:58:16 +02:00
}
/**
* Converts the built component into plain text.
2022-07-30 13:58:16 +02:00
* @return the plain text of this component.
*/
public String getPlainText() {
return PlainTextComponentSerializer.plainText().serializeOr(getAdv(), "");
}
@Override
public @NotNull HoverEvent<Component> asHoverEvent(@NotNull UnaryOperator<Component> op) {
2022-07-30 13:58:16 +02:00
return HoverEvent.showText(op.apply(getAdv()));
}
/**
* Builds the component into Adventure Component instance.
* @return the {@link Component} built from this {@link Chat} component.
2022-07-30 13:58:16 +02:00
*/
@Override
public @NotNull Component asComponent() {
2022-07-30 13:58:16 +02:00
return getAdv();
}
2023-10-28 23:46:47 +02:00
/**
* Builds the component into Adventure Component instance, also down sampling the RGB colors to named colors.
* @return the {@link Component} built from this {@link Chat} component, with down-sampled colors.
*/
public Component getAsDownSampledColorsComponent() {
String json = GsonComponentSerializer.colorDownsamplingGson().serialize(getAdv());
return GsonComponentSerializer.gson().deserialize(json);
}
2023-10-28 23:46:47 +02:00
/**
* Returns a new {@link Chat} consisting of this {@link Chat} instance, with the RGB colors down-sampled to named colors.
* @return a new {@link Chat} instance, with down-sampled colors.
*/
public Chat getAsDownSampledColors() {
return chatComponent(getAsDownSampledColorsComponent());
}
2023-10-28 23:46:47 +02:00
/**
* Returns a MiniMessage representation of this {@link Chat} component.
* @return the MiniMessage representation if this {@link Chat} component.
*/
public String getMiniMessage() {
return MiniMessage.miniMessage().serialize(getAdv());
}
2022-07-30 13:58:16 +02:00
/*
* Sub-component appending
*/
/**
* Appends a component to this component.
* @param comp the component to append.
* @return this.
*/
public Chat then(Component comp) {
if (comp instanceof TextComponent txtComp) {
if (!txtComp.hasStyling() && (txtComp.content().isEmpty())) {
// no need to add the provided component to the current component.
// but eventual child component must be added
if (!txtComp.children().isEmpty()) {
for (Component child : txtComp.children())
then(child);
}
return this;
}
}
builder.append(comp);
return this;
}
/**
* Appends a BungeeCord {@link BaseComponent} to this component.
* @param comp the component to append.
* @return this.
*/
public Chat then(BaseComponent comp) {
return then(toAdventure(comp));
}
/**
* Appends a component to this component.
* @param comp the component to append.
* @return this.
*/
public Chat then(ComponentLike comp) {
if (comp instanceof ChatFilledLine ac) {
ac.console(console);
if (maxWidth != null)
ac.maxWidth(maxWidth);
}
return then(comp.asComponent());
}
/**
* Appends a BungeeCord {@link BaseComponent} array to this component.
* @param comp the components to append.
* @return this.
*/
public Chat then(BaseComponent[] comp) {
return then(toAdventure(comp));
}
/*
* Special sub-components appending
*/
/**
* Appends a plain text to this component.
* @param plainText the plain text.
* @return this.
*/
public Chat thenText(Object plainText) { return then(text(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#infoColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenInfo(Object plainText) { return then(infoText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#warningColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenWarning(Object plainText) { return then(warningText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#successColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenSuccess(Object plainText) { return then(successText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#failureColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenFailure(Object plainText) { return then(failureText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#dataColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenData(Object plainText) { return then(dataText(plainText)); }
/**
* Appends a plain text to this component, colored using {@link ChatConfig#decorationColor}.
* @param plainText the plain text.
* @return this.
*/
public Chat thenDecoration(Object plainText) { return then(decorationText(plainText)); }
/**
* Appends a component with the provided legacy text as its main text content, and colored in white in case there is
* no color on the generated parent component.
* @param legacyText the legacy text.
* @return this.
*/
public Chat thenPlayerName(String legacyText) { return then(playerNameText(legacyText)); }
/**
* Appends the provided Component, coloring it in white in case there is no color defined. If the provided component
* is an instance of Chat, its content will be duplicated, and the provided one will be untouched.
* @param comp the component.
* @return this.
*/
public Chat thenPlayerName(ComponentLike comp) { return then(playerNameComponent(comp)); }
2022-07-30 13:58:16 +02:00
/**
* Appends a component consisting of a new line.
* @return this.
*/
public Chat thenNewLine() { return then(Component.newline()); }
/**
* Appends a component with the provided legacy text as its content, using the section {@code "§"} character.
* @param legacyText the legacy text that uses the {@code "§"} character.
2022-07-30 13:58:16 +02:00
* @return this.
*/
public Chat thenLegacyText(Object legacyText) { return then(legacyText(legacyText)); }
/**
* Appends a component with the provided legacy text as its content, using the ampersand {@code "&"} character.
* @param legacyText the legacy text that uses the {@code "&"} character.
* @return this.
*/
public Chat thenLegacyAmpersandText(Object legacyText) { return then(legacyAmpersandText(legacyText)); }
/**
* Appends a component with the provided MiniMessage text as its content.
* @param miniMessageText the MiniMessage text.
* @return this.
*/
public Chat thenMiniMessage(String miniMessageText) { return then(miniMessageText(miniMessageText)); }
2022-07-30 13:58:16 +02:00
/**
* Appends a component with the provided translation key and parameters.
* @param key the translation key.
* @param with the translation parameters.
* @return this.
*/
public Chat thenTranslation(String key, Object... with) { return then(translation(key, with)); }
/**
* Appends a component with the provided keybinding.
* @param key the keybinding to display.
2022-07-30 13:58:16 +02:00
* @return this.
*/
public Chat thenKeyBind(String key) { return then(keybind(key)); }
/**
* Appends a component with the provided score name and objective.
* @param name the score name.
* @param objective the score objective.
* @return this.
*/
public Chat thenScore(String name, String objective) { return then(score(name, objective)); }
/**
* Appends a component that leads to a URL when clicked.
* @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component.
* @return this.
*/
public Chat thenClickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) { return then(clickableURL(inner, url, hover)); }
/**
* Appends a component that leads to a URL when clicked.
* <p>
* When hovered, the component will display the url. To customize the hover content, use
* {@link #thenClickableURL(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return this.
*/
public Chat thenClickableURL(ComponentLike inner, String url) { return then(clickableURL(inner, url)); }
/**
* Appends a component that leads to a URL when clicked.
* <p>
* The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #thenClickableURL(ComponentLike, String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component.
* @return this.
*/
public Chat thenClickableURL(String url, HoverEventSource<?> hover) { return then(clickableURL(url, hover)); }
/**
* Appends a component that leads to a URL when clicked.
* <p>
* The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #thenClickableURL(ComponentLike, String)}.
* <p>
* When hovered, the component will display the url. To customize the hover content, use
* {@link #thenClickableURL(String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return this.
*/
public Chat thenClickableURL(String url) { return then(clickableURL(url)); }
/**
* Appends a component that runs a command when clicked.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(ComponentLike inner, String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableCommand(inner, cmdWithSlash, hover)); }
/**
* Appends a component that runs a command when clicked.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenClickableCommand(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(ComponentLike inner, String cmdWithSlash) { return then(clickableCommand(inner, cmdWithSlash)); }
/**
* Appends a component that runs a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenClickableCommand(ComponentLike, String, HoverEventSource)}.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableCommand(cmdWithSlash, hover)); }
/**
* Appends a component that runs a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenClickableCommand(ComponentLike, String)}.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenClickableCommand(String, HoverEventSource)}.
* @param cmdWithSlash the command to run. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenClickableCommand(String cmdWithSlash) { return then(clickableCommand(cmdWithSlash)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(ComponentLike inner, String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableSuggest(inner, cmdWithSlash, hover)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenCommandSuggest(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(ComponentLike inner, String cmdWithSlash) { return then(clickableSuggest(inner, cmdWithSlash)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenCommandSuggest(ComponentLike, String, HoverEventSource)}.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(String cmdWithSlash, HoverEventSource<?> hover) { return then(clickableSuggest(cmdWithSlash, hover)); }
/**
* Appends a component that pre-fill the chat box with a command when clicked.
* <p>
* The text on which to click will be the command itself. To configure the clicked text, use
* {@link #thenCommandSuggest(ComponentLike, String)}.
* <p>
* When hovered, the component will display the command itself. To customize the hover content, use
* {@link #thenCommandSuggest(String, HoverEventSource)}.
* @param cmdWithSlash the command to suggest. Must start with {@code "/"}.
* @return this.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/
public Chat thenCommandSuggest(String cmdWithSlash) { return then(clickableSuggest(cmdWithSlash)); }
/**
* Appends a component filling a chat line with the configured decoration character and
2022-07-30 13:58:16 +02:00
* color and a left-aligned text.
* @param leftText the text aligned to the left.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
2022-07-30 13:58:16 +02:00
* and color and a left-aligned text.
*/
public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
/**
* Appends a component filling a chat line with the configured decoration character and
2022-07-30 13:58:16 +02:00
* color and a left-aligned text.
* @param leftText the text aligned to the left.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
2022-07-30 13:58:16 +02:00
* and color and a left-aligned text.
* @deprecated uses Bungeecord chat API.
*/
@Deprecated
public Chat thenLeftText(BaseComponent leftText) { return thenLeftText(chatComponent(leftText)); }
/**
* Appends a component filling a chat line with the configured decoration character and
2022-07-30 13:58:16 +02:00
* color and a right-aligned text.
* @param rightText the text aligned to the right.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
2022-07-30 13:58:16 +02:00
* and color and a right-aligned text.
*/
public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
/**
* Appends a component filling a chat line with the configured decoration character and
2022-07-30 13:58:16 +02:00
* color and a right-aligned text.
* @param rightText the text aligned to the right.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
2022-07-30 13:58:16 +02:00
* and color and a right-aligned text.
* @deprecated uses Bungeecord chat API.
*/
@Deprecated
public Chat thenRightText(BaseComponent rightText) { return thenRightText(chatComponent(rightText)); }
/**
* Appends a component filling a chat line with the configured decoration character and
2022-07-30 13:58:16 +02:00
* color and a centered text.
* @param centerText the text aligned to the center.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
2022-07-30 13:58:16 +02:00
* and color and a centered text.
*/
public Chat thenCenterText(ComponentLike centerText) {
return then(centerText(centerText, console));
}
/**
* Appends a component filling a chat line with the configured decoration character and
2022-07-30 13:58:16 +02:00
* color and a centered text.
* @param centerText the text aligned to the center.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
2022-07-30 13:58:16 +02:00
* and color and a centered text.
* @deprecated uses Bungeecord chat API.
*/
@Deprecated
public Chat thenCenterText(BaseComponent centerText) {
return thenCenterText(chatComponent(centerText));
}
/**
* Appends a component filling a chat line with the configured decoration character and color.
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
2022-07-30 13:58:16 +02:00
*/
public Chat thenFilledLine() { return then(filledLine(console)); }
/**
* A {@link Chat} that can be formatted.
* <p>
* The purpose of subclassing {@link Chat} is to avoid ambiguity with the way the Bungee chat component builder works.
* Here is an example of to use their builder (from
* <a href="https://www.spigotmc.org/wiki/the-chat-component-api/#the-component-builder-api">the Spigot wiki</a>):
* <pre>{@code
* BaseComponent[] component = new ComponentBuilder("Hello ").color(ChatColor.RED)
* .append("world").color(ChatColor.DARK_RED).bold(true)
* .append("!").color(ChatColor.RED)
* .create();
* }</pre>
* Here, when you call a formatting method (like {@code bold(boolean)} or {@code color(ChatColor)}) after the
* {@code append(String)} method, the formatting apply to the last subcomponent appended.
2022-07-30 13:58:16 +02:00
* <p>
* In our design, we want the formatting to apply to the currently built component, not the last appended one.
* The purpose is to make the component structure clearer and have better control of the formatting over the
2022-07-30 13:58:16 +02:00
* component hierarchy.
* Here is the equivalent of the above code, with the {@link Chat} API:
* <pre>{@code
* Chat component = Chat.text("Hello ").red()
* .then(Chat.text("world").darkRed().bold())
* .thenText("!"); // short for .then(Chat.text("!"))
* // the red color for "!" is not needed because the parent component is already red.
* }</pre>
* When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast
* to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
* subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
2022-07-30 13:58:16 +02:00
* class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again.
* <pre>{@code
* Chat component = Chat.text("Hello ").red()
* .then(Chat.text("world").darkRed().bold())
* .thenText("!");
* // ok now I want to underline everything:
* ((FormatableChat)component).underlined(); // this will not format only the last appended text.
* }</pre>
*/
public static final class FormatableChat extends Chat {
/* package */ FormatableChat(ComponentBuilder<?, ?> c) {
super(c);
}
/**
* Configure if this component will be rendered on console or not.
* @param c true for console, false for game UI.
* @return this.
*/
public FormatableChat console(boolean c) { console = c; return this; }
/**
* Configure the width of the line.
* @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
* console rendering.
* @return this.
*/
public FormatableChat maxWidth(int w) { maxWidth = w; return this; }
/**
* Sets the color of this component.
* @param c the color.
* @return this.
*/
public FormatableChat color(TextColor c) { builder.color(c); return this; }
/**
* Sets the color of this component.
* @param c the color.
* @return this.
*/
public FormatableChat color(ChatColor c) { return color(c == null ? null : TextColor.color(c.getColor().getRGB())); }
/**
* Sets the color of this component.
* @param c the color.
* @return this.
*/
public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
/**
* Sets the color of this component.
* @param c the color.
* @return this.
*/
public FormatableChat color(String c) { return color(c == null ? null : ChatColor.of(c)); }
/**
* Sets the color of this component to {@link NamedTextColor#BLACK}.
* @return this.
*/
public FormatableChat black() { return color(NamedTextColor.BLACK); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
* @return this.
*/
public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
* @return this.
*/
public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
* @return this.
*/
public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_RED}.
* @return this.
*/
public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
* @return this.
*/
public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
/**
* Sets the color of this component to {@link NamedTextColor#GOLD}.
* @return this.
*/
public FormatableChat gold() { return color(NamedTextColor.GOLD); }
/**
* Sets the color of this component to {@link NamedTextColor#GRAY}.
* @return this.
*/
public FormatableChat gray() { return color(NamedTextColor.GRAY); }
/**
* Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
* @return this.
*/
public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
/**
* Sets the color of this component to {@link NamedTextColor#BLUE}.
* @return this.
*/
public FormatableChat blue() { return color(NamedTextColor.BLUE); }
/**
* Sets the color of this component to {@link NamedTextColor#GREEN}.
* @return this.
*/
public FormatableChat green() { return color(NamedTextColor.GREEN); }
/**
* Sets the color of this component to {@link NamedTextColor#AQUA}.
* @return this.
*/
public FormatableChat aqua() { return color(NamedTextColor.AQUA); }
/**
* Sets the color of this component to {@link NamedTextColor#RED}.
* @return this.
*/
public FormatableChat red() { return color(NamedTextColor.RED); }
/**
* Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
* @return this.
*/
public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
/**
* Sets the color of this component to {@link NamedTextColor#YELLOW}.
* @return this.
*/
public FormatableChat yellow() { return color(NamedTextColor.YELLOW); }
/**
* Sets the color of this component to {@link NamedTextColor#WHITE}.
* @return this.
*/
public FormatableChat white() { return color(NamedTextColor.WHITE); }
/**
* Sets the color of this component to {@link ChatConfig#successColor}.
* @return this.
*/
public FormatableChat successColor() { return color(ChatConfig.successColor); }
/**
* Sets the color of this component to {@link ChatConfig#failureColor}.
* @return this.
*/
public FormatableChat failureColor() { return color(ChatConfig.failureColor); }
/**
* Sets the color of this component to {@link ChatConfig#infoColor}.
* @return this.
*/
public FormatableChat infoColor() { return color(ChatConfig.infoColor); }
/**
* Sets the color of this component to {@link ChatConfig#warningColor}.
* @return this.
*/
public FormatableChat warningColor() { return color(ChatConfig.warningColor); }
/**
* Sets the color of this component to {@link ChatConfig#dataColor}.
* @return this.
*/
public FormatableChat dataColor() { return color(ChatConfig.dataColor); }
/**
* Sets the color of this component to {@link ChatConfig#decorationColor}.
* @return this.
*/
public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); }
/**
* Sets the color of this component to {@link ChatConfig#urlColor}.
* @return this.
*/
public FormatableChat urlColor() { return color(ChatConfig.urlColor); }
/**
* Sets the color of this component to {@link ChatConfig#commandColor}.
* @return this.
*/
public FormatableChat commandColor() { return color(ChatConfig.commandColor); }
/**
* Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
* @return this.
*/
public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
/**
* Sets the color of this component to {@link ChatConfig#broadcastColor}.
* @return this.
*/
public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
private FormatableChat setDecoration(TextDecoration deco, Boolean state) {
return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
}
/**
* Sets the bold status of this component.
* @param b true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
/**
* Enables the bold status of this component.
* @return this.
*/
public FormatableChat bold() { return bold(true); }
/**
* Sets the italic status of this component.
* @param i true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
/**
* Enables the italic status of this component.
* @return this.
*/
public FormatableChat italic() { return italic(true); }
/**
* Sets the underlined status of this component.
* @param u true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
/**
* Enables the underlined status of this component.
* @return this.
*/
public FormatableChat underlined() { return underlined(true); }
/**
* Sets the strikethrough status of this component.
* @param s true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
/**
* Enables the strikethrough status of this component.
* @return this.
*/
public FormatableChat strikethrough() { return strikethrough(true); }
/**
* Sets the obfuscated status of this component.
* @param o true to enable, false to disable, or null to inherit from parent.
* @return this.
*/
public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
/**
* Enables the obfuscated status of this component.
* @return this.
*/
public FormatableChat obfuscated() { return obfuscated(true); }
/**
* Sets the font of this component.
* @param f the font namespaced key.
* @return this.
*/
public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); }
/**
* Configure this component to insert the specified text at the cursor position when clicked.
* @param i the text to insert.
* @return this.
*/
public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
/**
* Configure this components click event.
* @param e the {@link ClickEvent}.
* @return this.
*/
private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
/**
* Configure this component to execute the specified command when clicked.
* @param cmdWithSlash the command to execute.
* @return this.
*/
public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
/**
* Configure this component to insert in the chat-box the specified command when clicked.
* @param cmdWithSlash the command to suggest.
* @return this.
*/
public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
/**
* Configure this component to copy into clipboard the specified text when clicked.
* @param value the text to copy.
* @return this.
*/
public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
/**
* Configure this component to open the specified URL when clicked.
* @param url the URL to open.
* @return this.
*/
public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
/**
* Configure this component to change the page of the opened book when clicked.
* @param page the page to go to.
* @return this.
*/
public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
/**
* Configure this components hover event.
* @param e the {@link HoverEventSource}.
* @return this.
*/
public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(BaseComponent v) { return hover(toAdventure(v)); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(BaseComponent[] v) { return hover(toAdventure(v)); }
/**
* Configure this component to show the provided legacy text when hovered.
* @param legacyText the legacy text to show.
* @return this.
*/
public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
}
@Override
public boolean equals(Object obj) {
return obj instanceof Chat c
&& builder.equals(c.builder);
}
@Override
public int hashCode() {
return getAdv().hashCode();
}
@Override
public String toString() {
return getPlainText();
}
/* package */ static ComponentLike filterObjToComponentLike(Object v) {
return switch (v) {
case BaseComponent[] baseComponents -> toAdventure(baseComponents);
case BaseComponent baseComponent -> toAdventure(baseComponent);
case ComponentLike componentLike -> componentLike;
case null, default -> Component.text(Objects.toString(v));
};
}
2022-07-30 13:58:16 +02:00
/* package */ static ComponentLike[] filterObjToComponentLike(Object[] values) {
if (values == null)
return null;
ComponentLike[] ret = new ComponentLike[values.length];
for (int i = 0; i < values.length; i++) {
ret[i] = filterObjToComponentLike(values[i]);
}
return ret;
}
/* package */ static TranslationArgumentLike[] filterObjToTranslationArgumentLike(Object[] values) {
if (values == null)
return null;
TranslationArgumentLike[] ret = new TranslationArgumentLike[values.length];
2022-07-30 13:58:16 +02:00
for (int i = 0; i < values.length; i++) {
Object v = values[i];
if (v instanceof Number n)
ret[i] = TranslationArgument.numeric(n);
else if (v instanceof Boolean b)
ret[i] = TranslationArgument.bool(b);
2022-07-30 13:58:16 +02:00
else
ret[i] = TranslationArgument.component(filterObjToComponentLike(values[i]));
2022-07-30 13:58:16 +02:00
}
return ret;
}
/**
* Converts the Bungee {@link BaseComponent} array into Adventure {@link Component}.
* @param components the Bungee {@link BaseComponent} array.
* @return a {@link Component}.
*/
public static Component toAdventure(BaseComponent[] components) {
return BungeeComponentSerializer.get().deserialize(components);
}
/**
* Converts the Bungee {@link BaseComponent} into Adventure {@link Component}.
* @param component the Bungee {@link BaseComponent}.
* @return a {@link Component}.
*/
public static Component toAdventure(BaseComponent component) {
return toAdventure(new BaseComponent[] { component });
}
/**
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent} array.
* @param component the Adventure {@link Component}.
* @return a {@link BaseComponent} array.
*/
public static BaseComponent[] toBungeeArray(Component component) {
return BungeeComponentSerializer.get().serialize(component);
}
/**
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent}.
* @param component the Adventure {@link Component}.
* @return a {@link BaseComponent}.
*/
public static BaseComponent toBungee(Component component) {
BaseComponent[] arr = toBungeeArray(component);
return arr.length == 1 ? arr[0] : new net.md_5.bungee.api.chat.TextComponent(arr);
}
/**
* Force the italic formatting to be set to false if it is not explicitly set in the component.
2022-07-30 13:58:16 +02:00
* This is useful for item lores that defaults to italic in the game UI.
* @param c the {@link Chat} in which to set the italic property if needed.
* @return the provided {@link Chat} instance.
*/
public static Chat italicFalseIfNotSet(Chat c) {
c.builder.style(b -> {
if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
((FormatableChat) c).italic(false);
}
});
return c;
}
}