ItemStackAdapter for Json: fix again deserialization

-> temporary fix so the older servers does not throw an error when trying to deserialize (e.g. when using the lobby compass menu)

Readme.md

@@ -9,11 +9,11 @@ that are detailed in their respective Readme file (if any).
 - `pandalib-util` General purpose utility and helper classes;
 - `pandalib-chat` A chat API working on top of the Adventure API;
 - `pandalib-db` An ORM working with a MySQL server through JDBC;
-- `pandalib-bungee` Utility and helper classes to use in Bungeecord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
+- `pandalib-bungee` Utility and helper classes to use in BungeeCord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
 - `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
 - `pandalib-reflect` A reflection wrapper to make reflective operation easier;
 - `pandalib-permissions` A general purpose permission system;
-- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into Bungeecord;
+- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into BungeeCord;
 - `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems;
 - `pandalib-players` A library to handle classes representing online or offline players;
 - `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`;

pandalib-bungee-chat/pom.xml

@@ -21,11 +21,6 @@
     </repositories>
 
     <dependencies>
-        <dependency>
-            <groupId>fr.pandacube.lib</groupId>
-            <artifactId>pandalib-util</artifactId>
-            <version>${project.version}</version>
-        </dependency>
         <dependency>
             <groupId>fr.pandacube.lib</groupId>
             <artifactId>pandalib-chat</artifactId>

pandalib-bungee-chat/src/main/java/fr/pandacube/lib/bungee/chat/ChatBungee.java

@@ -1,7 +1,7 @@
 package fr.pandacube.lib.bungee.chat;
 
 import fr.pandacube.lib.chat.Chat;
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import net.kyori.adventure.text.Component;
 import net.kyori.adventure.text.ComponentLike;
 import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
@@ -15,22 +15,22 @@ public class ChatBungee {
 
 
     /**
-     * Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent}.
+     * Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent}.
      * @param c the {@link BaseComponent}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat chatComponent(BaseComponent c) {
+    public static FormattableChat chatComponent(BaseComponent c) {
         return Chat.chatComponent(toAdventure(c));
     }
 
 
 
     /**
-     * Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
+     * Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
      * @param c the array of {@link BaseComponent}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat chatComponent(BaseComponent[] c) {
+    public static FormattableChat chatComponent(BaseComponent[] c) {
         return Chat.chatComponent(toAdventure(c));
     }
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/PandaLibBungee.java

@@ -1,7 +1,7 @@
 package fr.pandacube.lib.bungee;
 
 import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler;
-import fr.pandacube.lib.bungee.util.PluginMessagePassthrough;
+import fr.pandacube.lib.bungee.util.PluginMessagePassThrough;
 import net.md_5.bungee.api.plugin.Plugin;
 
 /**
@@ -24,7 +24,7 @@ public class PandaLibBungee {
      * Method to be called in {@link Plugin#onEnable()} method.
      */
     public static void onEnable() {
-        PluginMessagePassthrough.init(plugin);
+        PluginMessagePassThrough.init(plugin);
         BungeeDailyLogRotateFileHandler.init(true);
     }
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/backup/BungeeBackupConfig.java

@@ -7,7 +7,7 @@ import java.util.ArrayList;
 import java.util.List;
 
 /**
- * Class that holds the configuration varables for {@link BungeeBackupManager}.
+ * Class that holds the configuration variables for {@link BungeeBackupManager}.
  */
 @SuppressWarnings("CanBeFinal")
 public class BungeeBackupConfig {

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/backup/BungeeBackupManager.java

@@ -7,14 +7,14 @@ import fr.pandacube.lib.core.backup.RotatedLogsBackupProcess;
 import java.io.File;
 
 /**
- * Handles the backup processes for a Bungeecord instance.
+ * Handles the backup processes for a BungeeCord instance.
  */
 public class BungeeBackupManager extends BackupManager {
 
 	BungeeBackupConfig config;
 
 	/**
-	 * Instanciate a new {@link BungeeBackupManager}.
+	 * Creates a new {@link BungeeBackupManager}.
 	 * @param config the configuration.
 	 */
 	public BungeeBackupManager(BungeeBackupConfig config) {

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/backup/BungeeWorkdirProcess.java

@@ -6,7 +6,7 @@ import java.io.File;
 import java.util.function.BiPredicate;
 
 /**
- * The backup process responsible for the working directory of the current Bungeecord instance.
+ * The backup process responsible for the working directory of the current BungeeCord instance.
  */
 public class BungeeWorkdirProcess extends BackupProcess {
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/players/BungeeOffPlayer.java

@@ -6,7 +6,7 @@ import net.md_5.bungee.api.connection.ProxiedPlayer;
 import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
 
 /**
- * Represents any player on a Bungeecord proxy, either offline or online.
+ * Represents any player on a BungeeCord proxy, either offline or online.
  */
 public interface BungeeOffPlayer extends AbstractOffPlayer {
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/players/BungeeOnlinePlayer.java

@@ -20,7 +20,7 @@ import net.md_5.bungee.protocol.packet.PluginMessage;
 import java.util.Locale;
 
 /**
- * Represents any online player on a Bungeecord proxy.
+ * Represents any online player on a BungeeCord proxy.
  */
 public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer {
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/util/PluginMessagePassThrough.java

@@ -19,16 +19,16 @@ import net.md_5.bungee.event.EventHandler;
  * <p>
  * Usage example, in your plugin init code:
  * <pre>{@code
- * PluginMessagePassthrough.init(yourPluginInstance);
- * PluginMessagePassthrough.register("worldedit:cui"); // plugin message used by WorldEdit
+ * PluginMessagePassThrough.init(yourPluginInstance);
+ * PluginMessagePassThrough.register("worldedit:cui"); // plugin message used by WorldEdit
  * }</pre>
  */
-public class PluginMessagePassthrough implements Listener {
+public class PluginMessagePassThrough implements Listener {
     private static final List<String> channels = Collections.synchronizedList(new ArrayList<>());
-    private static final PluginMessagePassthrough instance = new PluginMessagePassthrough();
+    private static final PluginMessagePassThrough instance = new PluginMessagePassThrough();
 
     /**
-     * Initialize the {@link PluginMessagePassthrough}.
+     * Initialize the {@link PluginMessagePassThrough}.
      * It registers the required event listener.
      * @param plugin the plugin instance.
      */
@@ -92,7 +92,7 @@ public class PluginMessagePassthrough implements Listener {
     }
 
 
-    private PluginMessagePassthrough() { }
+    private PluginMessagePassThrough() { }
 
 
     /**

pandalib-chat/pom.xml

@@ -54,7 +54,7 @@
         <dependency>
             <groupId>com.google.code.gson</groupId>
             <artifactId>gson</artifactId>
-            <version>2.10.1</version>
+            <version>${gson.version}</version>
         </dependency>
     </dependencies>
 

pandalib-chat/src/main/java/fr/pandacube/lib/chat/Chat.java

@@ -35,8 +35,8 @@ import java.util.function.UnaryOperator;
  * This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
  * Adventure API and its implementation without using the final methods of this builder.
  * <p>
- * The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the
- * built component. The rationale for this design is explained in the documentation of {@link FormatableChat}.
+ * The unique possible concrete subclass of this class, {@link FormattableChat}, takes care of the formatting of the
+ * built component. The rationale for this design is explained in the documentation of {@link FormattableChat}.
  */
 public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
 
@@ -296,7 +296,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * @param key the keybinding to display.
      * @return this.
      */
-    public Chat thenKeyBind(String key) { return then(keybind(key)); }
+    public Chat thenKeyBind(String key) { return then(keyBind(key)); }
 
     /**
      * Appends a component with the provided score name and objective.
@@ -454,7 +454,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * Appends a component filling a chat line with the configured decoration character and
      * color and a left-aligned text.
      * @param leftText the text aligned to the left.
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a left-aligned text.
      */
     public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
@@ -463,7 +463,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * Appends a component filling a chat line with the configured decoration character and
      * color and a right-aligned text.
      * @param rightText the text aligned to the right.
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a right-aligned text.
      */
     public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
@@ -472,7 +472,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * Appends a component filling a chat line with the configured decoration character and
      * color and a centered text.
      * @param centerText the text aligned to the center.
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a centered text.
      */
     public Chat thenCenterText(ComponentLike centerText) {
@@ -481,7 +481,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
 
     /**
      * Appends a component filling a chat line with the configured decoration character and color.
-     * @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
+     * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
      */
     public Chat thenFilledLine() { return then(filledLine(console)); }
 
@@ -520,10 +520,10 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      *         .thenText("!"); // short for .then(Chat.text("!"))
      *         // the red color for "!" is not needed because the parent component is already red.
      * }</pre>
-     * When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast
+     * When calling {@link #then(Component) #then(...)} on a {@link FormattableChat}, the method returns itself, cast
      * to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
      * subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
-     * class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again.
+     * class which only subclass is {@link FormattableChat}, you can cast the builder, and use the format methods again.
      * <pre>{@code
      * Chat component = Chat.text("Hello ").red()
      *         .then(Chat.text("world").darkRed().bold())
@@ -532,8 +532,8 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * ((FormatableChat)component).underlined(); // this will not format only the last appended text.
      * }</pre>
      */
-    public static final class FormatableChat extends Chat {
-        /* package */ FormatableChat(ComponentBuilder<?, ?> c) {
+    public static final class FormattableChat extends Chat {
+        /* package */ FormattableChat(ComponentBuilder<?, ?> c) {
             super(c);
         }
 
@@ -543,33 +543,33 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param c true for console, false for game UI.
          * @return this.
          */
-        public FormatableChat console(boolean c) { console = c; return this; }
+        public FormattableChat console(boolean c) { console = c; return this; }
         /**
          * Configure the width of the line.
          * @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
          *                 console rendering.
          * @return this.
          */
-        public FormatableChat maxWidth(int w) { maxWidth = w; return this; }
+        public FormattableChat maxWidth(int w) { maxWidth = w; return this; }
 
         /**
          * Sets the color of this component.
          * @param c the color.
          * @return this.
          */
-        public FormatableChat color(TextColor c) { builder.color(c); return this; }
+        public FormattableChat color(TextColor c) { builder.color(c); return this; }
         /**
          * Sets the color of this component.
          * @param c the color.
          * @return this.
          */
-        public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
+        public FormattableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
         /**
          * Sets the color of this component.
          * @param c the color.
          * @return this.
          */
-        public FormatableChat color(String c) {
+        public FormattableChat color(String c) {
             if (c == null)
                 return color((TextColor) null);
             TextColor tc = c.startsWith("#")
@@ -585,138 +585,138 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * Sets the color of this component to {@link NamedTextColor#BLACK}.
          * @return this.
          */
-        public FormatableChat black() { return color(NamedTextColor.BLACK); }
+        public FormattableChat black() { return color(NamedTextColor.BLACK); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
          * @return this.
          */
-        public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
+        public FormattableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
          * @return this.
          */
-        public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
+        public FormattableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
          * @return this.
          */
-        public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
+        public FormattableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_RED}.
          * @return this.
          */
-        public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); }
+        public FormattableChat darkRed() { return color(NamedTextColor.DARK_RED); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
          * @return this.
          */
-        public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
+        public FormattableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#GOLD}.
          * @return this.
          */
-        public FormatableChat gold() { return color(NamedTextColor.GOLD); }
+        public FormattableChat gold() { return color(NamedTextColor.GOLD); }
         /**
          * Sets the color of this component to {@link NamedTextColor#GRAY}.
          * @return this.
          */
-        public FormatableChat gray() { return color(NamedTextColor.GRAY); }
+        public FormattableChat gray() { return color(NamedTextColor.GRAY); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
          * @return this.
          */
-        public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
+        public FormattableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
         /**
          * Sets the color of this component to {@link NamedTextColor#BLUE}.
          * @return this.
          */
-        public FormatableChat blue() { return color(NamedTextColor.BLUE); }
+        public FormattableChat blue() { return color(NamedTextColor.BLUE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#GREEN}.
          * @return this.
          */
-        public FormatableChat green() { return color(NamedTextColor.GREEN); }
+        public FormattableChat green() { return color(NamedTextColor.GREEN); }
         /**
          * Sets the color of this component to {@link NamedTextColor#AQUA}.
          * @return this.
          */
-        public FormatableChat aqua() { return color(NamedTextColor.AQUA); }
+        public FormattableChat aqua() { return color(NamedTextColor.AQUA); }
         /**
          * Sets the color of this component to {@link NamedTextColor#RED}.
          * @return this.
          */
-        public FormatableChat red() { return color(NamedTextColor.RED); }
+        public FormattableChat red() { return color(NamedTextColor.RED); }
         /**
          * Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
          * @return this.
          */
-        public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
+        public FormattableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#YELLOW}.
          * @return this.
          */
-        public FormatableChat yellow() { return color(NamedTextColor.YELLOW); }
+        public FormattableChat yellow() { return color(NamedTextColor.YELLOW); }
         /**
          * Sets the color of this component to {@link NamedTextColor#WHITE}.
          * @return this.
          */
-        public FormatableChat white() { return color(NamedTextColor.WHITE); }
+        public FormattableChat white() { return color(NamedTextColor.WHITE); }
 
 
         /**
          * Sets the color of this component to {@link ChatConfig#successColor}.
          * @return this.
          */
-        public FormatableChat successColor() { return color(ChatConfig.successColor); }
+        public FormattableChat successColor() { return color(ChatConfig.successColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#failureColor}.
          * @return this.
          */
-        public FormatableChat failureColor() { return color(ChatConfig.failureColor); }
+        public FormattableChat failureColor() { return color(ChatConfig.failureColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#infoColor}.
          * @return this.
          */
-        public FormatableChat infoColor() { return color(ChatConfig.infoColor); }
+        public FormattableChat infoColor() { return color(ChatConfig.infoColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#warningColor}.
          * @return this.
          */
-        public FormatableChat warningColor() { return color(ChatConfig.warningColor); }
+        public FormattableChat warningColor() { return color(ChatConfig.warningColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#dataColor}.
          * @return this.
          */
-        public FormatableChat dataColor() { return color(ChatConfig.dataColor); }
+        public FormattableChat dataColor() { return color(ChatConfig.dataColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#decorationColor}.
          * @return this.
          */
-        public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); }
+        public FormattableChat decorationColor() { return color(ChatConfig.decorationColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#urlColor}.
          * @return this.
          */
-        public FormatableChat urlColor() { return color(ChatConfig.urlColor); }
+        public FormattableChat urlColor() { return color(ChatConfig.urlColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#commandColor}.
          * @return this.
          */
-        public FormatableChat commandColor() { return color(ChatConfig.commandColor); }
+        public FormattableChat commandColor() { return color(ChatConfig.commandColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
          * @return this.
          */
-        public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
+        public FormattableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#broadcastColor}.
          * @return this.
          */
-        public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
+        public FormattableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
 
 
-        private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
-        private FormatableChat setDecoration(TextDecoration deco, Boolean state) {
+        private FormattableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
+        private FormattableChat setDecoration(TextDecoration deco, Boolean state) {
             return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
         }
 
@@ -726,56 +726,56 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param b true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
+        public FormattableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
         /**
          * Enables the bold status of this component.
          * @return this.
          */
-        public FormatableChat bold() { return bold(true); }
+        public FormattableChat bold() { return bold(true); }
         /**
          * Sets the italic status of this component.
          * @param i true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
+        public FormattableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
         /**
          * Enables the italic status of this component.
          * @return this.
          */
-        public FormatableChat italic() { return italic(true); }
+        public FormattableChat italic() { return italic(true); }
         /**
          * Sets the underlined status of this component.
          * @param u true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
+        public FormattableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
         /**
          * Enables the underlined status of this component.
          * @return this.
          */
-        public FormatableChat underlined() { return underlined(true); }
+        public FormattableChat underlined() { return underlined(true); }
         /**
          * Sets the strikethrough status of this component.
          * @param s true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
+        public FormattableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
         /**
          * Enables the strikethrough status of this component.
          * @return this.
          */
-        public FormatableChat strikethrough() { return strikethrough(true); }
+        public FormattableChat strikethrough() { return strikethrough(true); }
         /**
          * Sets the obfuscated status of this component.
          * @param o true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
+        public FormattableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
         /**
          * Enables the obfuscated status of this component.
          * @return this.
          */
-        public FormatableChat obfuscated() { return obfuscated(true); }
+        public FormattableChat obfuscated() { return obfuscated(true); }
 
 
         /**
@@ -783,7 +783,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param f the font namespaced key.
          * @return this.
          */
-        public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); }
+        public FormattableChat font(Key f) { return setStyle(s -> s.font(f)); }
 
 
         /**
@@ -791,7 +791,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param i the text to insert.
          * @return this.
          */
-        public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
+        public FormattableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
 
 
         /**
@@ -799,37 +799,37 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param e the {@link ClickEvent}.
          * @return this.
          */
-        private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
+        private FormattableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
         /**
          * Configure this component to execute the specified command when clicked.
          * @param cmdWithSlash the command to execute.
          * @return this.
          */
-        public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
+        public FormattableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
         /**
          * Configure this component to insert in the chat-box the specified command when clicked.
          * @param cmdWithSlash the command to suggest.
          * @return this.
          */
-        public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
+        public FormattableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
         /**
          * Configure this component to copy into clipboard the specified text when clicked.
          * @param value the text to copy.
          * @return this.
          */
-        public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
+        public FormattableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
         /**
          * Configure this component to open the specified URL when clicked.
          * @param url the URL to open.
          * @return this.
          */
-        public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
+        public FormattableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
         /**
          * Configure this component to change the page of the opened book when clicked.
          * @param page the page to go to.
          * @return this.
          */
-        public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
+        public FormattableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
 
 
         /**
@@ -837,31 +837,31 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param e the {@link HoverEventSource}.
          * @return this.
          */
-        public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
+        public FormattableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
         /**
          * Configure this component to show the provided component when hovered.
          * @param v the component to show.
          * @return this.
          */
-        public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
+        public FormattableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
         /**
          * Configure this component to show the provided component when hovered.
          * @param v the component to show.
          * @return this.
          */
-        public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
+        public FormattableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
         /**
          * Configure this component to show the provided component when hovered.
          * @param v the component to show.
          * @return this.
          */
-        public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); }
+        public FormattableChat hover(ComponentLike v) { return hover(v.asComponent()); }
         /**
          * Configure this component to show the provided legacy text when hovered.
          * @param legacyText the legacy text to show.
          * @return this.
          */
-        public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
+        public FormattableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
 
     }
 
@@ -932,14 +932,14 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
 
     /**
      * Force the italic formatting to be set to false if it is not explicitly set in the component.
-     * This is useful for item lores that defaults to italic in the game UI.
+     * This is useful for item lore that defaults to italic in the game UI.
      * @param c the {@link Chat} in which to set the italic property if needed.
      * @return the provided {@link Chat} instance.
      */
     public static Chat italicFalseIfNotSet(Chat c) {
         c.builder.style(b -> {
             if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
-                ((FormatableChat) c).italic(false);
+                ((FormattableChat) c).italic(false);
             }
         });
         return c;

pandalib-chat/src/main/java/fr/pandacube/lib/chat/ChatFilledLine.java

@@ -5,7 +5,7 @@ import net.kyori.adventure.text.ComponentLike;
 import net.kyori.adventure.text.format.TextColor;
 import org.jetbrains.annotations.NotNull;
 
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 
 /**
  * Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text.
@@ -150,10 +150,10 @@ public class ChatFilledLine implements ComponentLike {
 
 
     /**
-     * Renders this line to a {@link FormatableChat}.
-     * @return a new {@link FormatableChat} built by this {@link ChatFilledLine}.
+     * Renders this line to a {@link FormattableChat}.
+     * @return a new {@link FormattableChat} built by this {@link ChatFilledLine}.
      */
-    public FormatableChat toChat() {
+    public FormattableChat toChat() {
         int maxWidth = (this.maxWidth != null)
                 ? this.maxWidth
                 : console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH;
@@ -170,7 +170,7 @@ public class ChatFilledLine implements ComponentLike {
         int textWidth = ChatUtil.componentWidth(text.asComponent(), console);
 
         if (textWidth > maxWidth)
-            return (FormatableChat) text;
+            return (FormattableChat) text;
 
         int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold);
         int nbCharLeft = 0, nbCharRight = 0;
@@ -179,12 +179,12 @@ public class ChatFilledLine implements ComponentLike {
             case CENTER -> {
                 nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth;
                 if (nbCharLeft == 0)
-                    return (FormatableChat) text;
+                    return (FormattableChat) text;
             }
             case LEFT, RIGHT -> {
                 int remWidth = textWidth + nbSide * repeatedCharWidth;
                 if (remWidth > maxWidth)
-                    return (FormatableChat) text;
+                    return (FormattableChat) text;
                 boolean left = alignment == Alignment.LEFT;
                 int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth;
                 nbCharLeft  = left ? nbSide : nbOtherSide;
@@ -197,7 +197,7 @@ public class ChatFilledLine implements ComponentLike {
                 .then(text);
         if (decorationChar != ' ' || spacesDecorationRightSide)
             d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold));
-        return (FormatableChat) d;
+        return (FormattableChat) d;
     }
 
 

pandalib-chat/src/main/java/fr/pandacube/lib/chat/ChatStatic.java

@@ -1,6 +1,6 @@
 package fr.pandacube.lib.chat;
 
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import net.kyori.adventure.text.BlockNBTComponent;
 import net.kyori.adventure.text.Component;
 import net.kyori.adventure.text.ComponentBuilder;
@@ -27,27 +27,27 @@ public abstract class ChatStatic {
 
 
 
-    private static FormatableChat chatComponent(Component c) {
-        return new FormatableChat(componentToBuilder(c));
+    private static FormattableChat chatComponent(Component c) {
+        return new FormattableChat(componentToBuilder(c));
     }
 
     /**
-     * Creates a {@link FormatableChat} from the provided {@link ComponentLike}.
+     * Creates a {@link FormattableChat} from the provided {@link ComponentLike}.
      * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
      * will be untouched.
      * @param c the {@link ComponentLike}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat chatComponent(ComponentLike c) {
+    public static FormattableChat chatComponent(ComponentLike c) {
         return chatComponent(c.asComponent());
     }
 
     /**
-     * Creates a {@link FormatableChat} with an empty main text content.
-     * @return a new empty {@link FormatableChat}.
+     * Creates a {@link FormattableChat} with an empty main text content.
+     * @return a new empty {@link FormattableChat}.
      */
-    public static FormatableChat chat() {
-        return new FormatableChat(Component.text());
+    public static FormattableChat chat() {
+        return new FormattableChat(Component.text());
     }
 
 
@@ -56,60 +56,60 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content.
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content.
+     * @return a new {@link FormattableChat} with the provided text as its main text content.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    public static FormatableChat text(Object plainText) {
+    public static FormattableChat text(Object plainText) {
         if (plainText instanceof ComponentLike) {
             throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
         }
-        return new FormatableChat(Component.text().content(Objects.toString(plainText)));
+        return new FormattableChat(Component.text().content(Objects.toString(plainText)));
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its content, using the section {@code "§"}
+     * Creates a {@link FormattableChat} with the provided legacy text as its content, using the section {@code "§"}
      * character.
      * @param legacyText the legacy text to use as the content, that uses the {@code "§"} character.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    public static FormatableChat legacyText(Object legacyText) {
+    public static FormattableChat legacyText(Object legacyText) {
         return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR);
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
+     * Creates a {@link FormattableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
      * character.
      * @param legacyText the legacy text to use as the content, that uses the {@code "&"} character.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    public static FormatableChat legacyAmpersandText(Object legacyText) {
+    public static FormattableChat legacyAmpersandText(Object legacyText) {
         return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR);
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its content, using the specified
+     * Creates a {@link FormattableChat} with the provided legacy text as its content, using the specified
      * legacyCharacter.
      * @param legacyText the legacy text to use as the content.
      * @param legacyCharacter the character used in the provided text to prefix color and format code.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    private static FormatableChat legacyText(Object legacyText, char legacyCharacter) {
+    private static FormattableChat legacyText(Object legacyText, char legacyCharacter) {
         if (legacyText instanceof ComponentLike) {
             throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
         }
@@ -118,118 +118,118 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided MiniMessage text as its content.
+     * Creates a {@link FormattableChat} with the provided MiniMessage text as its content.
      * @param miniMessageText the MiniMessage text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      */
-    public static FormatableChat miniMessageText(String miniMessageText) {
+    public static FormattableChat miniMessageText(String miniMessageText) {
         return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText));
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#infoColor configured info color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#infoColor()} instead.
+     *         {@link FormattableChat#infoColor()} instead.
      */
-    public static FormatableChat infoText(Object plainText) {
+    public static FormattableChat infoText(Object plainText) {
         return text(plainText).infoColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#warningColor configured warning color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#warningColor()} instead.
+     *         {@link FormattableChat#warningColor()} instead.
      */
-    public static FormatableChat warningText(Object plainText) {
+    public static FormattableChat warningText(Object plainText) {
         return text(plainText).warningColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#dataColor configured data color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#dataColor()} instead.
+     *         {@link FormattableChat#dataColor()} instead.
      */
-    public static FormatableChat dataText(Object plainText) {
+    public static FormattableChat dataText(Object plainText) {
         return text(plainText).dataColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#decorationColor configured decorationColor color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#decorationColor()} instead.
+     *         {@link FormattableChat#decorationColor()} instead.
      */
-    public static FormatableChat decorationText(Object plainText) {
+    public static FormattableChat decorationText(Object plainText) {
         return text(plainText).decorationColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#successColor configured success color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#successColor()} instead.
+     *         {@link FormattableChat#successColor()} instead.
      */
-    public static FormatableChat successText(Object plainText) {
+    public static FormattableChat successText(Object plainText) {
         return text(plainText).successColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#failureColor configured failure color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#failureColor()} instead.
+     *         {@link FormattableChat#failureColor()} instead.
      */
-    public static FormatableChat failureText(Object plainText) {
+    public static FormattableChat failureText(Object plainText) {
         return text(plainText).failureColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its main text content, and colored in white in
+     * Creates a {@link FormattableChat} with the provided legacy text as its main text content, and colored in white in
      * case there is no color on the generated parent component.
      * @param legacyText the legacy text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#failureColor()} instead.
+     *         {@link FormattableChat#failureColor()} instead.
      */
-    public static FormatableChat playerNameText(String legacyText) {
-        FormatableChat fc = legacyText(legacyText);
+    public static FormattableChat playerNameText(String legacyText) {
+        FormattableChat fc = legacyText(legacyText);
         fc.builder.colorIfAbsent(NamedTextColor.WHITE);
         return fc;
     }
 
     /**
-     * Creates a {@link FormatableChat} from the provided {@link Component}, coloring in white the generated parent
+     * Creates a {@link FormattableChat} from the provided {@link Component}, coloring in white the generated parent
      * component in case there is no color defined.
      * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
      * will be untouched.
      * @param c the {@link Component}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat playerNameComponent(ComponentLike c) {
-        FormatableChat fc = chatComponent(c);
+    public static FormattableChat playerNameComponent(ComponentLike c) {
+        FormattableChat fc = chatComponent(c);
         fc.builder.colorIfAbsent(NamedTextColor.WHITE);
         return fc;
     }
@@ -238,32 +238,32 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided translation key and parameters.
+     * Creates a {@link FormattableChat} with the provided translation key and parameters.
      * @param key the translation key.
      * @param with the translation parameters.
-     * @return a new {@link FormatableChat} with the provided translation key and parameters.
+     * @return a new {@link FormattableChat} with the provided translation key and parameters.
      */
-    public static FormatableChat translation(String key, Object... with) {
-        return new FormatableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
+    public static FormattableChat translation(String key, Object... with) {
+        return new FormattableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided keybinding.
+     * Creates a {@link FormattableChat} with the provided keybinding.
      * @param key the keybinding to display.
-     * @return a new {@link FormatableChat} with the provided keybinding.
+     * @return a new {@link FormattableChat} with the provided keybinding.
      */
-    public static FormatableChat keybind(String key) {
-        return new FormatableChat(Component.keybind().keybind(key));
+    public static FormattableChat keyBind(String key) {
+        return new FormattableChat(Component.keybind().keybind(key));
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided score name and objective.
+     * Creates a {@link FormattableChat} with the provided score name and objective.
      * @param name the score name.
      * @param objective the score objective.
-     * @return a new {@link FormatableChat} with the provided score name and objective.
+     * @return a new {@link FormattableChat} with the provided score name and objective.
      */
-    public static FormatableChat score(String name, String objective) {
-        return new FormatableChat(Component.score().name(name).objective(objective));
+    public static FormattableChat score(String name, String objective) {
+        return new FormattableChat(Component.score().name(name).objective(objective));
     }
 
 
@@ -272,49 +272,49 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * @param inner the component to make clickable.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
+    public static FormattableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
         Objects.requireNonNull(url, "url");
         if (inner == null)
             inner = text(url);
         if (hover == null)
             hover = text(ChatUtil.wrapInLimitedPixels(url, 240));
-        return (FormatableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
+        return (FormattableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
     }
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * <p>
      * When hovered, the component will display the url. To customize the hover content, use
      * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
      * @param inner the component to make clickable.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(ComponentLike inner, String url) {
+    public static FormattableChat clickableURL(ComponentLike inner, String url) {
         return clickableURL(inner, url, null);
     }
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * <p>
      * The text on which to click will be the URL itself. To configure the clicked text, use
      * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(String url, HoverEventSource<?> hover) {
+    public static FormattableChat clickableURL(String url, HoverEventSource<?> hover) {
         return clickableURL(null, url, hover);
     }
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * <p>
      * The text on which to click will be the URL itself. To configure the clicked text, use
      * {@link #clickableURL(ComponentLike, String)}.
@@ -322,9 +322,9 @@ public abstract class ChatStatic {
      * When hovered, the component will display the url. To customize the hover content, use
      * {@link #clickableURL(String, HoverEventSource)}.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(String url) {
+    public static FormattableChat clickableURL(String url) {
         return clickableURL(null, url, null);
     }
 
@@ -334,14 +334,14 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
         Objects.requireNonNull(commandWithSlash, "commandWithSlash");
         if (!commandWithSlash.startsWith("/"))
             throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -349,39 +349,39 @@ public abstract class ChatStatic {
             inner = text(commandWithSlash);
         if (hover == null)
             hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
-        return (FormatableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
+        return (FormattableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
     }
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * <p>
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
+    public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
         return clickableCommand(inner, commandWithSlash, null);
     }
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
         return clickableCommand(null, commandWithSlash, hover);
     }
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableCommand(ComponentLike, String)}.
@@ -389,10 +389,10 @@ public abstract class ChatStatic {
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableCommand(String, HoverEventSource)}.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(String commandWithSlash) {
+    public static FormattableChat clickableCommand(String commandWithSlash) {
         return clickableCommand(null, commandWithSlash, null);
     }
 
@@ -402,14 +402,14 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
         Objects.requireNonNull(commandWithSlash, "commandWithSlash");
         if (!commandWithSlash.startsWith("/"))
             throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -417,39 +417,39 @@ public abstract class ChatStatic {
             inner = text(commandWithSlash);
         if (hover == null)
             hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
-        return (FormatableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
+        return (FormattableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
     }
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * <p>
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
+    public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
         return clickableSuggest(inner, commandWithSlash, null);
     }
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
         return clickableSuggest(null, commandWithSlash, hover);
     }
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableSuggest(ComponentLike, String)}.
@@ -457,10 +457,10 @@ public abstract class ChatStatic {
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableSuggest(String, HoverEventSource)}.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(String commandWithSlash) {
+    public static FormattableChat clickableSuggest(String commandWithSlash) {
         return clickableSuggest(null, commandWithSlash, null);
     }
 
@@ -472,112 +472,112 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with decoration and a left-aligned text.
+     * Creates a {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
      * @param text the text aligned to the left.
      * @param decorationChar the character used for decoration around the text.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with decoration and a left-aligned text.
+     * @return a new {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
      * @see ChatFilledLine#leftText(ComponentLike)
      */
-    public static FormatableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color and a left-aligned text.
      * @param text the text aligned to the left.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a left-aligned text.
      * @see ChatFilledLine#leftText(ComponentLike)
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat leftText(ComponentLike text, boolean console) {
+    public static FormattableChat leftText(ComponentLike text, boolean console) {
         return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with decoration and a right-aligned text.
+     * Creates a {@link FormattableChat} filling a chat line with decoration and a right-aligned text.
      * @param text the text aligned to the right.
      * @param decorationChar the character used for decoration around the text.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with decoration and a right-aligned
+     * @return a new {@link FormattableChat} filling a chat line with decoration and a right-aligned
      *         text.
      * @see ChatFilledLine#rightText(ComponentLike)
      */
-    public static FormatableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color and a right-aligned text.
      * @param text the text aligned to the right.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a right-aligned text.
      * @see ChatFilledLine#rightText(ComponentLike)
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat rightText(ComponentLike text, boolean console) {
+    public static FormattableChat rightText(ComponentLike text, boolean console) {
         return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with decoration and a centered text.
+     * Creates a {@link FormattableChat} filling a chat line with decoration and a centered text.
      * @param text the text aligned to the center.
      * @param decorationChar the character used for decoration around the text.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with decoration and a centered text.
+     * @return a new {@link FormattableChat} filling a chat line with decoration and a centered text.
      * @see ChatFilledLine#centerText(ComponentLike)
      */
-    public static FormatableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color and a centered text.
      * @param text the text aligned to the center.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a centered text.
      * @see ChatFilledLine#centerText(ComponentLike)
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat centerText(ComponentLike text, boolean console) {
+    public static FormattableChat centerText(ComponentLike text, boolean console) {
         return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with a decoration character and color.
+     * Creates a {@link FormattableChat} filling a chat line with a decoration character and color.
      * @param decorationChar the character used for decoration.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
+     * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
      * @see ChatFilledLine#filled()
      */
-    public static FormatableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
+     * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
      * @see ChatFilledLine#filled()
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat filledLine(boolean console) {
+    public static FormattableChat filledLine(boolean console) {
         return ChatFilledLine.filled().console(console).toChat();
     }
 

pandalib-chat/src/main/java/fr/pandacube/lib/chat/ChatUtil.java

@@ -1,6 +1,6 @@
 package fr.pandacube.lib.chat;
 
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import net.kyori.adventure.text.Component;
 import net.kyori.adventure.text.ComponentLike;
 import net.kyori.adventure.text.TextComponent;
@@ -152,7 +152,7 @@ public class ChatUtil {
             else
                 first = false;
 
-            FormatableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
+            FormattableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
             if (page == currentPage) {
                 pDisplay.highlightedCommandColor();
             }
@@ -180,12 +180,12 @@ public class ChatUtil {
      * @param elements the components to join.
      * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
      */
-    public static FormatableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
+    public static FormattableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
         int size = elements == null ? 0 : elements.size();
         int last = size - 1;
         return switch (size) {
             case 0, 1, 2 -> join(finalSeparator, elements);
-            default -> (FormatableChat) join(regularSeparator, elements.subList(0, last))
+            default -> (FormattableChat) join(regularSeparator, elements.subList(0, last))
                     .then(finalSeparator)
                     .then(elements.get(last));
         };
@@ -202,8 +202,8 @@ public class ChatUtil {
      * @param elements the components to join.
      * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
      */
-    public static FormatableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
-        FormatableChat c = chat();
+    public static FormattableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
+        FormattableChat c = chat();
         if (elements == null)
             return c;
         boolean first = true;
@@ -596,7 +596,7 @@ public class ChatUtil {
         for (int i = 0; i < sizes.length; i++) {
             sumSizes += sizes[i];
 
-            FormatableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
+            FormattableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
 
             if (colors != null && i < colors.length && colors[i] != null)
                 subC.color(colors[i]);

pandalib-cli/pom.xml

@@ -27,21 +27,11 @@
             <artifactId>pandalib-core</artifactId>
             <version>${project.version}</version>
         </dependency>
-        <dependency>
-            <groupId>fr.pandacube.lib</groupId>
-            <artifactId>pandalib-reflect</artifactId>
-            <version>${project.version}</version>
-        </dependency>
         <dependency>
             <groupId>fr.pandacube.lib</groupId>
             <artifactId>pandalib-commands</artifactId>
             <version>${project.version}</version>
         </dependency>
-        <dependency>
-            <groupId>fr.pandacube.lib</groupId>
-            <artifactId>pandalib-config</artifactId>
-            <version>${project.version}</version>
-        </dependency>
         <dependency>
             <groupId>net.md-5</groupId>
             <artifactId>bungeecord-log</artifactId>

pandalib-cli/src/main/java/fr/pandacube/lib/cli/CLI.java

@@ -1,22 +1,25 @@
 package fr.pandacube.lib.cli;
 
+import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
+import fr.pandacube.lib.cli.log.CLILogger;
+import fr.pandacube.lib.util.log.Log;
+import org.jline.reader.EndOfFileException;
+import org.jline.reader.LineReader;
+import org.jline.reader.LineReaderBuilder;
+import org.jline.reader.UserInterruptException;
+import org.jline.terminal.Terminal;
+import org.jline.terminal.TerminalBuilder;
+
 import java.io.IOException;
 import java.util.logging.Logger;
 
-import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
-import fr.pandacube.lib.cli.log.CLILogger;
-import jline.console.ConsoleReader;
-import org.fusesource.jansi.AnsiConsole;
-
-import fr.pandacube.lib.util.log.Log;
-
 /**
- * Class to handle general standard IO operation for a CLI application. It uses Jline’s {@link ConsoleReader} for the
+ * Class to handle general standard IO operation for a CLI application. It uses Jline’s {@link LineReader} for the
  * console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands.
  */
 public class CLI extends Thread {
 	
-	private final ConsoleReader reader;
+	private final LineReader reader;
 	private final Logger logger;
 
 
@@ -28,10 +31,11 @@ public class CLI extends Thread {
 		super("Console Thread");
 		setDaemon(true);
 
-        AnsiConsole.systemInstall();
-		reader = new ConsoleReader();
-		reader.setPrompt(">");
-		reader.addCompleter(CLIBrigadierDispatcher.instance);
+		Terminal terminal = TerminalBuilder.builder().build();
+		reader = LineReaderBuilder.builder().terminal(terminal)
+				.completer(CLIBrigadierDispatcher.instance)
+				.build()
+		;
 
 		// configure logger's formatter
 		System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss");
@@ -40,10 +44,10 @@ public class CLI extends Thread {
 
 
 	/**
-	 * Gets the Jline {@link ConsoleReader} of this CLI instance.
-	 * @return the Jline {@link ConsoleReader} of this CLI instance.
+	 * Gets the Jline {@link LineReader} of this CLI instance.
+	 * @return the Jline {@link LineReader} of this CLI instance.
 	 */
-	public ConsoleReader getConsoleReader() {
+	public LineReader getConsoleReader() {
 		return reader;
 	}
 
@@ -65,15 +69,14 @@ public class CLI extends Thread {
 		int i = 0;
 		String line;
 		try {
-			while((line = reader.readLine()) != null) {
-				if (line.trim().equals(""))
+			while((line = reader.readLine(">")) != null) {
+				if (line.trim().isEmpty())
 					continue;
 				String cmdLine = line;
-				new Thread(() -> CLIBrigadierDispatcher.instance.execute(cmdLine), "CLICmdThread #"+(i++)).start();
+				Thread.ofVirtual().name("CLICmdThread #"+(i++))
+						.start(() -> CLIBrigadierDispatcher.instance.execute(cmdLine));
 			}
-		} catch (IOException e) {
-			Log.severe(e);
-		}
+		} catch (UserInterruptException | EndOfFileException ignore) { }
 		
 	}
 	

pandalib-cli/src/main/java/fr/pandacube/lib/cli/CLIApplication.java

@@ -32,6 +32,7 @@ public abstract class CLIApplication {
     /**
      * Creates a new application instance.
      */
+    @SuppressWarnings("CallToPrintStackTrace")
     protected CLIApplication() {
         instance = this;
         CLI tmpCLI = null;

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLIBrigadierCommand.java

@@ -38,16 +38,9 @@ public abstract class CLIBrigadierCommand extends BrigadierCommand<CLICommandSen
 	}
 	
 	protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand();
-	
-	protected String[] getAliases() {
-		return new String[0];
-	}
 
 
-
-
-
-	public boolean isPlayer(CLICommandSender sender) {
+    public boolean isPlayer(CLICommandSender sender) {
 		return sender.isPlayer();
 	}
 

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLIBrigadierDispatcher.java

@@ -3,8 +3,11 @@ package fr.pandacube.lib.cli.commands;
 import com.mojang.brigadier.suggestion.Suggestion;
 import com.mojang.brigadier.suggestion.Suggestions;
 import fr.pandacube.lib.commands.BrigadierDispatcher;
-import jline.console.completer.Completer;
 import net.kyori.adventure.text.ComponentLike;
+import org.jline.reader.Candidate;
+import org.jline.reader.Completer;
+import org.jline.reader.LineReader;
+import org.jline.reader.ParsedLine;
 
 import java.util.List;
 
@@ -39,17 +42,15 @@ public class CLIBrigadierDispatcher extends BrigadierDispatcher<CLICommandSender
 	
 	
 	@Override
-	public int complete(String buffer, int cursor, List<CharSequence> candidates) {
-		
-		String bufferBeforeCursor = buffer.substring(0, cursor);
-		
+	public void complete(LineReader lineReader, ParsedLine parsedLine, List<Candidate> candidates) {
+		String bufferBeforeCursor = parsedLine.line().substring(0, parsedLine.cursor());
+
 		Suggestions completeResult = getSuggestions(bufferBeforeCursor);
-		
+
 		completeResult.getList().stream()
 				.map(Suggestion::getText)
+				.map(Candidate::new)
 				.forEach(candidates::add);
-		
-		return completeResult.getRange().getStart();
 	}
 
 	/**

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLICommandSender.java

@@ -41,6 +41,9 @@ public interface CLICommandSender extends Audience {
      */
     void sendMessage(String message);
 
+    @SuppressWarnings({"UnstableApiUsage", "deprecation"})
     @Override // force implementation of super-interface default method
     void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type);
+
+
 }

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLIConsoleCommandSender.java

@@ -38,7 +38,7 @@ public class CLIConsoleCommandSender implements CLICommandSender {
     }
 
     @Override
-    public void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type) {
+    public void sendMessage(@NotNull Identity source, @NotNull Component message, @SuppressWarnings({"UnstableApiUsage", "deprecation"}) @NotNull MessageType type) {
         sendMessage(Chat.chatComponent(message).getLegacyText());
     }
 }

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CommandAdmin.java

@@ -14,7 +14,7 @@ import com.mojang.brigadier.tree.CommandNode;
 import com.mojang.brigadier.tree.LiteralCommandNode;
 import com.mojang.brigadier.tree.RootCommandNode;
 import fr.pandacube.lib.chat.Chat;
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import fr.pandacube.lib.chat.ChatTreeNode;
 import fr.pandacube.lib.cli.CLIApplication;
 import fr.pandacube.lib.util.log.Log;
@@ -195,13 +195,13 @@ public class CommandAdmin extends CLIBrigadierCommand {
 	private Component displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) {
 		if (node == null)
 			throw new IllegalArgumentException("node must not be null");
-		FormatableChat d;
+		FormattableChat d;
 		if (node instanceof RootCommandNode) {
 			d = text("(root)").italic()
 				.hover("Root command node");
 		}
-		else if (node instanceof ArgumentCommandNode) {
-			ArgumentType<?> type = ((ArgumentCommandNode<?, ?>) node).getType();
+		else if (node instanceof ArgumentCommandNode<?, ?> argNode) {
+			ArgumentType<?> type = argNode.getType();
 			String typeStr = type.getClass().getSimpleName();
 			if (type instanceof IntegerArgumentType
 					|| type instanceof LongArgumentType
@@ -260,10 +260,10 @@ public class CommandAdmin extends CLIBrigadierCommand {
 		return d.get();
 		
 	}
-	
-	
-	
-	
+
+
+
+
 	private static class DisplayCommandNode {
 		final List<CommandNode<CLICommandSender>> nodes = new ArrayList<>();
 		final List<DisplayCommandNode> children = new ArrayList<>();

pandalib-commands/pom.xml

@@ -45,7 +45,7 @@
         <dependency>
             <groupId>com.mojang</groupId>
             <artifactId>brigadier</artifactId>
-            <version>1.0.18</version>
+            <version>${brigadier.version}</version>
         </dependency>
 
     </dependencies>

pandalib-commands/src/main/java/fr/pandacube/lib/commands/BadCommandUsage.java

@@ -3,8 +3,8 @@ package fr.pandacube.lib.commands;
 import java.util.logging.Logger;
 
 /**
- * Throw an instance of this exception to indicate to the plugin command handler that the user has missused the command.
- * The message, if provided, must indicate the reason of the mussusage of the command. It will be displayed on the
+ * Throw an instance of this exception to indicate to the plugin command handler that the user has badly used the command.
+ * The message, if provided, must indicate the reason of the bad usage of the command. It will be displayed on the
  * screen with eventual indications of how to use the command (help command for example).
  * If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}.
  * 

pandalib-commands/src/main/java/fr/pandacube/lib/commands/BrigadierCommand.java

@@ -223,14 +223,14 @@ public abstract class BrigadierCommand<S> {
     /**
      * Wraps the provided {@link SuggestionsSupplier} into a Brigadier’s {@link SuggestionProvider}.
      * @param suggestions the suggestions to wrap.
-     * @param senderUnwrapper function to convert the command sender provided by brigadier into the command sender
+     * @param senderUnWrapper function to convert the command sender provided by brigadier into the command sender
      *                        supported by {@link SuggestionsSupplier}.
      * @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}.
      * @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}.
      */
-    protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnwrapper) {
+    protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnWrapper) {
         return (context, builder) -> {
-            AS sender = senderUnwrapper.apply(context.getSource());
+            AS sender = senderUnWrapper.apply(context.getSource());
             String message = builder.getInput();
             try {
                 int tokenStartPos = builder.getStart();

pandalib-commands/src/main/java/fr/pandacube/lib/commands/SuggestionsSupplier.java

@@ -241,7 +241,7 @@ public interface SuggestionsSupplier<S> {
 			return (s, ti, token, a) -> {
 				try {
 					List<Long> proposedValues = new ArrayList<>();
-					if (token.length() == 0) {
+					if (token.isEmpty()) {
 						long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9);
 						long end = Math.min(Math.min(start + 9, max), 9);
 						ListUtil.addLongRangeToList(proposedValues, start, end);
@@ -399,7 +399,7 @@ public interface SuggestionsSupplier<S> {
 	 */
 	default SuggestionsSupplier<S> quotableString() {
 		return (s, ti, token, a) -> {
-			boolean startWithQuote = token.length() > 0 && (token.charAt(0) == '"' || token.charAt(0) == '\'');
+			boolean startWithQuote = !token.isEmpty() && (token.charAt(0) == '"' || token.charAt(0) == '\'');
 			String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token;
 			String[] argsCopy = Arrays.copyOf(a, a.length);
 			argsCopy[a.length - 1] = realToken;

pandalib-core/src/main/java/fr/pandacube/lib/core/json/Json.java

@@ -32,7 +32,7 @@ public class Json {
 		boolean isFloat = value.contains(".");
 
 		if (isFloat) {
-			// if float, will only parse to Double
+			// if is float, will only parse to Double
 			//   (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat)
 			try {
 				Double d = Double.valueOf(value);

pandalib-core/src/main/java/fr/pandacube/lib/core/json/ThrowableAdapter.java

@@ -134,30 +134,30 @@ public class ThrowableAdapter implements JsonSerializer<Throwable>, JsonDeserial
     }
 
     private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) {
-        BiFunction<String, Throwable, T> constructor = null;
+        BiFunction<String, Throwable, T> constructionFunction = null;
 
         // try (String, Throwable) constructor
         try {
-            Constructor<T> constr = clazz.getConstructor(String.class, Throwable.class);
-            if (constr.canAccess(null)) {
-                constructor = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m, t));
+            Constructor<T> constructor = clazz.getConstructor(String.class, Throwable.class);
+            if (constructor.canAccess(null)) {
+                constructionFunction = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m, t));
             }
         } catch (ReflectiveOperationException ignore) { }
 
         // try (String) constructor
         try {
-            Constructor<T> constr = clazz.getConstructor(String.class);
-            if (constr.canAccess(null)) {
-                constructor = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m)));
+            Constructor<T> constructor = clazz.getConstructor(String.class);
+            if (constructor.canAccess(null)) {
+                constructionFunction = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m)));
             }
         } catch (ReflectiveOperationException ignore) { }
 
-        if (constructor == null) {
+        if (constructionFunction == null) {
             Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String).");
             return null;
         }
 
-        return new ThrowableSubAdapter<>(constructor);
+        return new ThrowableSubAdapter<>(constructionFunction);
     }
 
 

pandalib-core/src/main/java/fr/pandacube/lib/core/mc_version/MinecraftVersionUtil.java

@@ -37,8 +37,8 @@ public class MinecraftVersionUtil {
 
     /**
      * Decompose a version string into a series of integers.
-     * @param v a string representation of a version (eg. 1.19.1).
-     * @return an array of int representing the provided version (eg. [1, 19, 1]).
+     * @param v a string representation of a version (e.g. 1.19.1).
+     * @return an array of int representing the provided version (e.g. [1, 19, 1]).
      */
     public static int[] decomposedVersion(String v) {
         try {
@@ -114,7 +114,7 @@ public class MinecraftVersionUtil {
                 else {
                     // merge
                     if (i - firstConsecutive > 1)
-                        keptVersions.add(versions.get(firstConsecutive) + "-" + versions.get(i));
+                        keptVersions.add(versions.get(firstConsecutive) + " - " + versions.get(i));
                     else {
                         keptVersions.add(versions.get(firstConsecutive));
                         keptVersions.add(versions.get(i));

pandalib-core/src/main/java/fr/pandacube/lib/core/mc_version/ProtocolVersion.java

@@ -68,12 +68,12 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
 
     private static void init() {
         // try online source first
-        try {
-            HttpResponse<String> response = HttpClient.newBuilder()
-                    .connectTimeout(Duration.ofSeconds(5))
-                    .build()
-                    .send(HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
-                            BodyHandlers.ofString()
+        try (HttpClient cl = HttpClient.newBuilder()
+                .connectTimeout(Duration.ofSeconds(5))
+                .build()) {
+            HttpResponse<String> response = cl.send(
+                    HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
+                    BodyHandlers.ofString()
                     );
             if (response.statusCode() == 200) {
                 MinecraftVersionList data = Json.gson.fromJson(response.body(), MinecraftVersionList.class);
@@ -123,7 +123,7 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
 
     /**
      * Gets the {@link ProtocolVersion} associated with the provided Minecraft version.
-     * @param version The Minecraft version, in the format "X.X[.X]" (eg. "1.17" or "1.8.8").
+     * @param version The Minecraft version, in the format "X.X[.X]" (e.g. "1.17" or "1.8.8").
      * @return an instance of {@link ProtocolVersion}.
      */
     public static ProtocolVersion ofVersion(String version) {

pandalib-core/src/main/resources/fr/pandacube/lib/core/mc_version/mcversion.json

@@ -71,7 +71,11 @@
     "1.21.1": 767,
     "1.21.2": 768,
     "1.21.3": 768,
-    "1.21.4": 769
+    "1.21.4": 769,
+    "1.21.5": 770,
+    "1.21.6": 771,
+    "1.21.7": 772,
+    "1.21.8": 772
   },
   "versionsOfProtocol": {
     "4": [
@@ -233,6 +237,16 @@
     ],
     "769": [
       "1.21.4"
+    ],
+    "770": [
+      "1.21.5"
+    ],
+    "771": [
+      "1.21.6"
+    ],
+    "772": [
+      "1.21.7",
+      "1.21.8"
     ]
   }
 }

pandalib-db/src/main/java/fr/pandacube/lib/db/DB.java

@@ -227,7 +227,7 @@ public final class DB {
      */
     public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException {
         SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset);
-        return (elements.size() == 0) ? null : elements.get(0);
+        return (elements.isEmpty()) ? null : elements.get(0);
     }
 
     /**

pandalib-db/src/main/java/fr/pandacube/lib/db/SQLType.java

@@ -42,7 +42,7 @@ public class SQLType<T> {
 
     @Override
     public boolean equals(Object obj) {
-        return obj instanceof SQLType o
+        return obj instanceof SQLType<?> o
                 && toString().equals(o.toString());
     }
 

pandalib-paper-permissions/src/main/java/fr/pandacube/lib/paper/permissions/PermissionsInjectorVault.java

@@ -7,6 +7,7 @@ import net.milkbowl.vault.chat.Chat;
 import net.milkbowl.vault.permission.Permission;
 import org.bukkit.Bukkit;
 import org.bukkit.OfflinePlayer;
+import org.bukkit.entity.Player;
 import org.bukkit.plugin.ServicePriority;
 
 import java.util.List;
@@ -120,6 +121,13 @@ import java.util.List;
 			return true;
 		}
 
+		@Override
+		public boolean playerAdd(Player player, String permission) {
+			// override because the super class sets the permission on the current world of the player, that is probably
+			// not intended by the calling plugin
+			return playerAdd(null, player, permission);
+		}
+
 		@Deprecated
 		@Override
 		public boolean playerRemove(String world, String player, String permission) {
@@ -136,6 +144,14 @@ import java.util.List;
 			return true;
 		}
 
+		@Override
+		public boolean playerRemove(Player player, String permission) {
+			// to stay coherent with the override of #playerAdd(Player, String), we also override this method.
+			// Will try first to remove the permission on the world itself (like super-method), then if it doesn't exist,
+			// removes on the server level.
+			return super.playerRemove(player, permission) || playerRemove(null, player, permission);
+		}
+
 		@Override
 		public boolean groupHas(String world, String group, String permission) {
 			checkEnabled();

pandalib-paper/pom.xml

@@ -22,6 +22,11 @@
             <id>fabricmc</id>
             <url>https://maven.fabricmc.net/</url>
         </repository>
+        <repository>
+            <id>minecraft-libraries</id>
+            <name>Minecraft Libraries</name>
+            <url>https://libraries.minecraft.net</url>
+        </repository>
     </repositories>
 
     <dependencies>
@@ -84,6 +89,12 @@
             <scope>provided</scope>
         </dependency>
 
+        <dependency>
+            <groupId>com.mojang</groupId>
+            <artifactId>datafixerupper</artifactId>
+            <version>${datafixerupper.version}</version>
+        </dependency>
+
         <!-- Paper -->
         <dependency>
             <groupId>io.papermc.paper</groupId>

pandalib-paper/src/main/java/fr/pandacube/lib/paper/commands/PaperBrigadierCommand.java

@@ -18,8 +18,8 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftVector;
 import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument;
+import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
-import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
 import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
 import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
 import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
@@ -46,7 +46,6 @@ import java.util.Set;
 import java.util.function.Predicate;
 import java.util.stream.Stream;
 
-import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.unwrap;
 import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
 
 /**
@@ -199,6 +198,10 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
             registeredAliases = new HashSet<>(event.registrar().register(commandNode, description, List.of(aliases)));
             doPostRegistrationFixes();
 
+            @SuppressWarnings("unchecked")
+            fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> registeredNode = wrap(vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()), fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+
+
             if (registrationPolicy == RegistrationPolicy.ALL) {
                 // enforce registration of aliases
                 for (String alias : aliases) {
@@ -221,11 +224,12 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
 
                 for (String aliasToForce : forceRegistrationAgain) {
                     CommandNode<CommandSourceStack> actualNode = vanillaPaperDispatcher.getRoot().getChild(aliasToForce);
+                    @SuppressWarnings("unchecked")
+                    fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(actualNode, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
                     if (actualNode != null) {
-                        //Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode) + "?");
-                        if (PluginCommandNode.REFLECT.get().isInstance(actualNode)) {
-                            PluginCommandNode pcn = wrap(actualNode, PluginCommandNode.class);
-                            if (pcn.getPlugin().equals(plugin))
+                        if (wrappedCommandNode.apiCommandMeta() != null) {
+                            APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
+                            if (meta.plugin().equals(plugin))
                                 return;
                         }
                         else if (BukkitCommandNode.REFLECT.get().isInstance(actualNode)) {
@@ -233,12 +237,16 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
                             if (bcn.getBukkitCommand() instanceof PluginCommand pc && pc.getPlugin().equals(plugin))
                                 return;
                         }
+                        Log.warning("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode));
                         vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(aliasToForce));
                     }
-                /*else {
-                    Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
-                }*/
-                    LiteralCommandNode<CommandSourceStack> newPCN = unwrap(new PluginCommandNode(aliasToForce, plugin.getPluginMeta(), commandNode, description));
+                    /*else {
+                        Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
+                    }*/
+                    LiteralCommandNode<CommandSourceStack> newPCN = getAliasNode(commandNode, aliasToForce);
+                    @SuppressWarnings("unchecked")
+                    fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedNewPCN = wrap(newPCN, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+                    wrappedNewPCN.apiCommandMeta(registeredNode.apiCommandMeta());
                     vanillaPaperDispatcher.getRoot().addChild(newPCN);
                 }
             });
@@ -296,11 +304,8 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
     }
 
     private static String getCommandIdentity(CommandNode<CommandSourceStack> command) {
-        if (PluginCommandNode.REFLECT.get().isInstance(command)) {
-            PluginCommandNode wrappedPCN = wrap(command, PluginCommandNode.class);
-            return "Node /" + command.getName() + " from plugin " + wrappedPCN.getPlugin().getName();
-        }
-        else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
+
+        if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
             BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
             Command bukkitCmd = wrappedBCN.getBukkitCommand();
             if (bukkitCmd instanceof PluginCommand cmd) {
@@ -318,16 +323,22 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
                 return "Node /" + command.getName() + " wrapping " + bukkitCmd.getClass().getName() + " /" + bukkitCmd.getName();
         }
         else {
-            return "Node /" + command.getName() + " (unspecific)";
+            @SuppressWarnings("unchecked")
+            fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+
+            if (wrappedCommandNode.apiCommandMeta() != null) {
+                APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
+                return "Node /" + command.getName() + " from plugin " + meta.plugin().getName();
+            }
+            else {
+                return "Node /" + command.getName() + " (unspecific)";
+            }
         }
     }
 
 
     private static Boolean isPluginCommand(CommandNode<CommandSourceStack> command) {
-        if (PluginCommandNode.REFLECT.get().isInstance(command)) {
-            return true;
-        }
-        else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
+        if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
             BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
             Command bukkitCmd = wrappedBCN.getBukkitCommand();
             if (bukkitCmd instanceof PluginCommand) {
@@ -345,7 +356,9 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
                 return null;
         }
         else {
-            return false;
+            @SuppressWarnings("unchecked")
+            fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+            return wrappedCommandNode.apiCommandMeta() != null;
         }
     }
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/gui/GUIHotBar.java

@@ -39,7 +39,7 @@ public class GUIHotBar implements Listener {
 	private final List<Player> currentPlayers = new ArrayList<>();
 
 	/**
-	 * Setup a new gui hot  bar. You should not instantiate more than one hot bar.
+	 * Set up a new gui hot  bar. You should not instantiate more than one hot bar.
 	 * @param defaultSlot the default slot (currently held item) when the player joins the hot bar.
 	 */
 	public GUIHotBar(int defaultSlot) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/inventory/DummyPlayerInventory.java

@@ -18,6 +18,11 @@ import java.util.Objects;
  */
 public class DummyPlayerInventory extends InventoryWrapper implements PlayerInventory {
 
+    /**
+     * Total number of item slots in the player inventory.
+     */
+    public static final int PLAYER_INVENTORY_SIZE = 43; // 36 base inventory + 4 armor slots + 1 off hand + 2 hidden slots (body and saddle)
+
     private int heldItemSlot;
 
     /**
@@ -27,8 +32,8 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
      */
     public DummyPlayerInventory(Inventory base, int heldItemSlot) {
         super(base);
-        if (base.getSize() < 41)
-            throw new IllegalArgumentException("base inventory should have a size of 41 (" + base.getSize() + " given).");
+        if (base.getSize() < PLAYER_INVENTORY_SIZE)
+            throw new IllegalArgumentException("base inventory should have a size of " + PLAYER_INVENTORY_SIZE + " (" + base.getSize() + " given).");
         if (heldItemSlot < 0 || heldItemSlot > 8)
             throw new IllegalArgumentException("heldItemSlot should be between 0 and 8 inclusive.");
         this.heldItemSlot = heldItemSlot;
@@ -114,6 +119,40 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
         setItem(36, boots);
     }
 
+    /**
+     * Gets the item stack in the SADDLE {@link EquipmentSlot}.
+     * @return the SADDLE item stack.
+     */
+    public ItemStack getSaddle() {
+        return getItem(42);
+    }
+
+    /**
+     * Puts the provided item stack in the SADDLE {@link EquipmentSlot}.
+     * @param saddle the item.
+     */
+    public void setSaddle(@Nullable ItemStack saddle) {
+        setItem(42, saddle);
+    }
+
+    /**
+     * Gets the item stack in the BODY {@link EquipmentSlot}.
+     * @return the BODY item stack.
+     */
+    public ItemStack getBody() {
+        return getItem(41);
+    }
+
+    /**
+     * Puts the provided item stack in the BODY {@link EquipmentSlot}.
+     * @param body the item.
+     */
+    public void setBody(@Nullable ItemStack body) {
+        setItem(41, body);
+    }
+
+
+
     @Override
     public void setItem(EquipmentSlot slot, ItemStack item) {
         Preconditions.checkArgument(slot != null, "slot must not be null");
@@ -125,7 +164,8 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
             case LEGS -> this.setLeggings(item);
             case CHEST -> this.setChestplate(item);
             case HEAD -> this.setHelmet(item);
-            default -> throw new IllegalArgumentException("Not implemented. This is a bug");
+            case BODY -> this.setBody(item);
+            case SADDLE -> this.setSaddle(item);
         }
     }
 
@@ -138,7 +178,8 @@ public class DummyPlayerInventory extends InventoryWrapper implements PlayerInve
             case LEGS -> Objects.requireNonNullElseGet(this.getLeggings(), () -> new ItemStack(Material.AIR));
             case CHEST -> Objects.requireNonNullElseGet(this.getChestplate(), () -> new ItemStack(Material.AIR));
             case HEAD -> Objects.requireNonNullElseGet(this.getHelmet(), () -> new ItemStack(Material.AIR));
-            case BODY -> new ItemStack(Material.AIR); // for horses/wolves armor
+            case BODY -> Objects.requireNonNullElseGet(this.getBody(), () -> new ItemStack(Material.AIR)); // for horses/wolves armor
+            case SADDLE -> Objects.requireNonNullElseGet(this.getSaddle(), () -> new ItemStack(Material.AIR));
         };
     }
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/inventory/ItemStackBuilder.java

@@ -2,9 +2,14 @@ package fr.pandacube.lib.paper.inventory;
 
 import com.google.common.collect.Streams;
 import fr.pandacube.lib.chat.Chat;
+import io.papermc.paper.datacomponent.DataComponentType;
+import io.papermc.paper.datacomponent.DataComponentType.Valued;
+import io.papermc.paper.datacomponent.DataComponentTypes;
+import io.papermc.paper.datacomponent.item.ResolvableProfile;
 import net.kyori.adventure.text.Component;
 import net.kyori.adventure.text.ComponentLike;
 import org.bukkit.Material;
+import org.bukkit.NamespacedKey;
 import org.bukkit.enchantments.Enchantment;
 import org.bukkit.inventory.ItemFlag;
 import org.bukkit.inventory.ItemStack;
@@ -12,6 +17,7 @@ import org.bukkit.inventory.meta.Damageable;
 import org.bukkit.inventory.meta.ItemMeta;
 
 import java.util.Arrays;
+import java.util.Collection;
 import java.util.Collections;
 import java.util.List;
 import java.util.function.Consumer;
@@ -70,15 +76,10 @@ public class ItemStackBuilder {
 	
 	
 	private final ItemStack stack;
-	private ItemMeta cachedMeta;
 	
 	private ItemStackBuilder(ItemStack base) {
 		stack = base;
 	}
-	
-	private ItemMeta getOrInitMeta() {
-		return (cachedMeta != null) ? cachedMeta : (cachedMeta = stack.getItemMeta());
-	}
 
 	/**
 	 * Runs the provided updater on the {@link ItemMeta} instance of the built stack.
@@ -97,10 +98,7 @@ public class ItemStackBuilder {
 	 * @return itself.
 	 */
 	public <T extends ItemMeta> ItemStackBuilder meta(Consumer<T> metaUpdater, Class<T> metaType) {
-		stack.editMeta(metaType, m -> {
-			metaUpdater.accept(m);
-			cachedMeta = m;
-		});
+		stack.editMeta(metaType, metaUpdater);
 		return this;
 	}
 
@@ -166,7 +164,7 @@ public class ItemStackBuilder {
 	 */
 	public ItemStackBuilder addLoreAfter(List<? extends ComponentLike> lores) {
 		if (lores != null) {
-			List<Component> baseLore = getOrInitMeta().lore();
+			List<Component> baseLore = stack.getItemMeta().lore();
 			if (baseLore == null) baseLore = Collections.emptyList();
 			return rawLore(
 					Streams.concat(
@@ -302,6 +300,107 @@ public class ItemStackBuilder {
 	}
 
 
+	/**
+	 * Sets a value for a data component of this item.
+	 * @param dataType the data component type.
+	 * @param dataValue the data component value.
+	 * @return itself.
+	 * @param <T> the data component API type.
+	 */
+	public <T> ItemStackBuilder data(Valued<T> dataType, T dataValue) {
+		stack.setData(dataType, dataValue);
+		return this;
+	}
+
+	/**
+	 * Unset (set to empty) a value for a data component of this item.
+	 * @param dataType the data component type.
+	 * @return itself.
+	 */
+	public ItemStackBuilder unsetData(DataComponentType dataType) {
+		stack.unsetData(dataType);
+		return this;
+	}
+
+	/**
+	 * Reset (act as default) a value for a data component of this item.
+	 * @param dataType the data component type.
+	 * @return itself.
+	 */
+	public ItemStackBuilder resetData(DataComponentType dataType) {
+		stack.resetData(dataType);
+		return this;
+	}
+
+
+	/**
+	 * Sets the {@code can_break} data component to the provided list of {@link Material}.
+	 * @param canBreak a list of {@link Material}.
+	 * @return itself.
+	 */
+	public ItemStackBuilder canBreakMaterials(Collection<Material> canBreak) {
+		return canBreak(canBreak.stream().map(Material::getKey).toList());
+	}
+
+
+	/**
+	 * Sets the {@code can_break} data component to the provided list of {@link NamespacedKey}.
+	 * @param canBreak a list of block predicate. If empty, unsets the data component. If null, reset to default.
+	 * @return itself.
+	 */
+	@SuppressWarnings("removal")
+	public ItemStackBuilder canBreak(Collection<NamespacedKey> canBreak) {
+		@SuppressWarnings("unchecked")
+		Collection<com.destroystokyo.paper.Namespaced> nsCanBreak = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canBreak;
+		return meta(m -> m.setDestroyableKeys(nsCanBreak));
+
+		/*
+		if (canBreak == null)
+			return resetData(DataComponentTypes.CAN_BREAK);
+		else if (canBreak.isEmpty())
+			return unsetData(DataComponentTypes.CAN_BREAK);
+		else
+			return data(DataComponentTypes.CAN_BREAK, ItemAdventurePredicate.itemAdventurePredicate(canBreak));*/
+	}
+
+	/**
+	 * Sets the {@code can_place_on} data component to the provided list of {@link Material}.
+	 * @param canPlaceOn a list of {@link Material}.
+	 * @return itself.
+	 */
+	public ItemStackBuilder canPlaceOnMaterials(Collection<Material> canPlaceOn) {
+		return canPlaceOn(canPlaceOn.stream().map(Material::getKey).toList());
+	}
+
+	/**
+	 * Sets the {@code can_place_on} data component to the provided list of {@link NamespacedKey}.
+	 * @param canPlaceOn a list of block predicate. If empty, unsets the data component. If null, reset to default.
+	 * @return itself.
+	 */
+	@SuppressWarnings("removal")
+	public ItemStackBuilder canPlaceOn(Collection<NamespacedKey> canPlaceOn) {
+		@SuppressWarnings("unchecked")
+		Collection<com.destroystokyo.paper.Namespaced> nsCanPlaceOn = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canPlaceOn;
+		return meta(m -> m.setPlaceableKeys(nsCanPlaceOn));
+
+		/* if (canPlaceOn == null)
+			return resetData(DataComponentTypes.CAN_PLACE_ON);
+		else if (canPlaceOn.isEmpty())
+			return unsetData(DataComponentTypes.CAN_PLACE_ON);
+		else
+			return data(DataComponentTypes.CAN_PLACE_ON, ItemAdventurePredicate.itemAdventurePredicate(canPlaceOn)); */
+	}
+
+	/**
+	 * Sets the {@code profile} data component to the provided profile.
+	 * @param profile the profile to use as the component value.
+	 * @return itself.
+	 */
+	public ItemStackBuilder profile(ResolvableProfile profile) {
+		return data(DataComponentTypes.PROFILE, profile);
+	}
+
+
 	/**
 	 * Build the {@link ItemStack}.
 	 * @return the build item stack.

pandalib-paper/src/main/java/fr/pandacube/lib/paper/inventory/Skull.java

@@ -0,0 +1,126 @@
+package fr.pandacube.lib.paper.inventory;
+
+import com.destroystokyo.paper.profile.ProfileProperty;
+import io.papermc.paper.datacomponent.item.ResolvableProfile;
+import org.bukkit.Material;
+import org.bukkit.inventory.ItemStack;
+
+import java.util.Base64;
+import java.util.regex.Pattern;
+
+/**
+ * Represents some special mob heads, also support creating player skulls and custom skulls.
+ */
+public enum Skull {
+
+    /** Jungle wood arrow left. */
+    ARROW_LEFT("http://textures.minecraft.net/texture/3625902b389ed6c147574e422da8f8f361c8eb57e7631676a72777e7b1d"),
+    /** Jungle wood arrow right. */
+    ARROW_RIGHT("http://textures.minecraft.net/texture/d4be8aeec11849697adc6fd1f189b16642dff19f2955c05deaba68c9dff1be"),
+    /** Jungle wood arrow up. */
+    ARROW_UP("http://textures.minecraft.net/texture/88c0f37dec764d6e26b57aa8212572fbace5ee8f27f7b61c1fdaa47dd4c893"),
+    /** Jungle wood arrow down. */
+    ARROW_DOWN("http://textures.minecraft.net/texture/751ced2e647366f8f3ad2dfe415cca85651bfaf9739a95cd57b6f21cba053"),
+    /** Jungle wood question mark. */
+    QUESTION("http://textures.minecraft.net/texture/b4d7cc4dca986a53f1d6b52aaf376dc6acc73b8b287f42dc8fef5808bb5d76"),
+    /** Jungle wood exclamation mark. */
+    EXCLAMATION("http://textures.minecraft.net/texture/e869dc405a3155f281c16a3e8d9ff54afc1599153b4d9385c9b7bab88680f0");
+
+    private final String skinUrl;
+
+    Skull(String skinUrl) {
+        this.skinUrl = skinUrl;
+    }
+
+    /**
+     * Return the item based on this Skull enum.
+     * @return the item stack.
+     */
+    public ItemStack get() {
+        return getFromSkinURL(skinUrl);
+    }
+
+    /**
+     * Return an item stack builder already containing the skull.
+     * @return an item stack builder already containing the skull.
+     */
+    public ItemStackBuilder builder() {
+        return ItemStackBuilder.wrap(get());
+    }
+
+
+
+
+
+
+
+
+    /**
+     * Return a skull of a player based on their name.
+     *
+     * @param name player's name
+     * @return item stack
+     */
+    public static ItemStack getFromPlayerName(String name) {
+        return getFromProfile(ResolvableProfile.resolvableProfile().name(name).build());
+    }
+
+
+
+
+
+
+    /**
+     * Return a skull that has a custom texture specified by url.
+     * @param url skin url.
+     * @return item stack
+     */
+    public static ItemStack getFromSkinURL(String url) {
+        return getFromProfile(ResolvableProfile.resolvableProfile().addProperty(getTexturesProperty(url)).build());
+    }
+
+
+
+    private static ItemStack getFromProfile(ResolvableProfile profile) {
+        return ItemStackBuilder.of(Material.PLAYER_HEAD).profile(profile).build();
+    }
+
+
+    /**
+     * The URL prefix for all the player related textures (skin, cape)
+     */
+    public static final String TEXTURE_URL_PREFIX = "http://textures.minecraft.net/texture/";
+
+    private static final Pattern textureIdMatcher = Pattern.compile("^[0-9a-fA-F]+$");
+
+    /**
+     * Generate the base64 value of the "textures" profile property, based on the provided skin url!
+     * @param skinURL the URL of the skin. The "https" will be replaced by "http" because this is the protocol used in
+     *                the profile property url. If only the texture id part is provided, {@link #TEXTURE_URL_PREFIX} is
+     *                prepended.
+     * @return the base64 encoded texture data.
+     */
+    private static String encodeTextureBase64String(String skinURL) {
+        if (skinURL.startsWith("https://")) // secure url is not the url found in texture data (even if it actually works in the browser)
+            skinURL = "http://" + skinURL.substring("https://".length());
+        if (!skinURL.startsWith(TEXTURE_URL_PREFIX)) { // accept taking only the texture id part ()
+            if (textureIdMatcher.matcher(skinURL).matches())
+                skinURL = TEXTURE_URL_PREFIX + skinURL;
+            else
+                throw new IllegalArgumentException("Invalid skin URL. Must be from " + TEXTURE_URL_PREFIX + ".");
+        }
+        return Base64.getEncoder().encodeToString(String.format("{\"textures\":{\"SKIN\":{\"url\":\"%s\"}}}", skinURL).getBytes());
+    }
+
+
+    private static ProfileProperty getTexturesProperty(String skinURL) {
+        return new ProfileProperty("textures", encodeTextureBase64String(skinURL));
+    }
+    
+    
+    
+    
+    
+
+}
+ 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/json/ConfigurationSerializableAdapter.java

@@ -23,7 +23,7 @@ import java.util.Map;
 /**
  * Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease
  * serialization to YAML.
- *
+ * <p>
  * To not reinvent the wheel, this class uses the Bukkit’s Yaml API to convert the objects from/to json.
  */
 /* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/json/ItemStackAdapter.java

@@ -9,10 +9,13 @@ import com.google.gson.JsonObject;
 import com.google.gson.JsonParseException;
 import com.google.gson.JsonSerializationContext;
 import com.google.gson.JsonSerializer;
+import com.google.gson.Strictness;
 import com.google.gson.TypeAdapterFactory;
 import com.google.gson.internal.bind.TreeTypeAdapter;
 import com.google.gson.reflect.TypeToken;
+import net.kyori.adventure.key.Key;
 import org.bukkit.Bukkit;
+import org.bukkit.Registry;
 import org.bukkit.configuration.serialization.ConfigurationSerializable;
 import org.bukkit.configuration.serialization.ConfigurationSerialization;
 import org.bukkit.inventory.ItemStack;
@@ -28,16 +31,27 @@ import java.util.Map;
     private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { };
 
     /** Gson instance with no custom type adapter */
-    private static final Gson vanillaGson = new GsonBuilder().setLenient().create();
+    private static final Gson vanillaGson = new GsonBuilder().setStrictness(Strictness.LENIENT).create();
 
     @Override
     public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
         if (!(json instanceof JsonObject jsonObj))
             throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure.");
+
+        // the deserialized json may contain older data compatible with pre 1.21.5 but not compatible after.
+        // if it contains both old and new data, delete the old one introduced for compatibility
+        if (jsonObj.has("DataVersion")) { // it uses the new DataVersion data
+            jsonObj.remove("v");
+        }
+        if (jsonObj.has("id")) {
+            jsonObj.remove("type");
+        }
+
         if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY))
             return context.deserialize(jsonObj, ConfigurationSerializable.class);
 
 
+
         if (jsonObj.has("meta")
                 && jsonObj.get("meta") instanceof JsonObject metaJson
                 && !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) {
@@ -47,6 +61,8 @@ import java.util.Map;
             Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType());
             fixDeserializationVersion(map);
             map.remove("meta");
+
+
             ItemStack is = ItemStack.deserialize(map);
 
             Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass();
@@ -63,7 +79,17 @@ import java.util.Map;
 
     @Override
     public JsonElement serialize(ItemStack src, Type typeOfSrc, JsonSerializationContext context) {
-        return context.serialize(src.serialize(), MAP_STR_OBJ_TYPE.getType());
+        Map<String, Object> serialized = src.serialize();
+
+        // make the generated json compatible with pre 1.21.5 deserializer (temporary fix during the upgrade of the server)
+        if (serialized.containsKey("DataVersion")) {
+            serialized.put("v", serialized.get("DataVersion"));
+        }
+        if (serialized.containsKey("id")) {
+            serialized.put("type", Registry.MATERIAL.getOrThrow(Key.key((String)serialized.get("id"))).name());
+        }
+
+        return context.serialize(serialized, MAP_STR_OBJ_TYPE.getType());
     }
 
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/modules/PerformanceAnalysisManager.java

@@ -21,6 +21,7 @@ import net.kyori.adventure.bossbar.BossBar.Color;
 import net.kyori.adventure.bossbar.BossBar.Overlay;
 import net.kyori.adventure.text.format.NamedTextColor;
 import net.kyori.adventure.text.format.TextColor;
+import org.apache.commons.lang3.tuple.Pair;
 import org.bukkit.Bukkit;
 import org.bukkit.command.CommandSender;
 import org.bukkit.command.ConsoleCommandSender;
@@ -36,6 +37,7 @@ import java.lang.management.ThreadMXBean;
 import java.util.ArrayList;
 import java.util.LinkedList;
 import java.util.List;
+import java.util.concurrent.atomic.AtomicInteger;
 
 import static fr.pandacube.lib.chat.ChatStatic.chat;
 import static fr.pandacube.lib.chat.ChatStatic.failureText;
@@ -317,22 +319,25 @@ public class PerformanceAnalysisManager implements Listener {
 					
 					
 					int[] tpsHistory = getTPSHistory();
-					
-					// keep the legacy text when generating the bar to save space when converting to component
-					StringBuilder s = new StringBuilder();
-					TextColor prevC = null;
+
+					List<Pair<TextColor, AtomicInteger>> barComponents = new ArrayList<>(60);
 					for (int i = 58; i >= 0; i--) {
 						int t = tpsHistory[i];
 						TextColor newC = tps1sGradient.pickColorAt(t);
-						if (!newC.equals(prevC)) {
-							s.append(text("|").color(newC).getLegacyText());
-							prevC = newC;
+						if (barComponents.isEmpty() || !newC.equals(barComponents.get(barComponents.size() - 1).getKey())) {
+							barComponents.add(Pair.of(newC, new AtomicInteger(1)));
 						}
 						else {
-							s.append("|");
+							barComponents.get(barComponents.size() - 1).getValue().incrementAndGet();
 						}
 					}
-					
+					Chat history = chat();
+					barComponents.forEach(p -> {
+						history.then(text("|".repeat(p.getValue().get()))
+								.color(p.getKey())
+						);
+					});
+
 					
 					
 					// tick time measurement
@@ -355,7 +360,7 @@ public class PerformanceAnalysisManager implements Listener {
 								: (avgTickCPUTime1s < 50) ? NamedTextColor.RED
 								: NamedTextColor.DARK_RED;
 						
-						float avgTickWaitingTime1s = avgTickDuration1s - avgTickCPUTime1s;
+						float avgTickWaitingTime1s = Math.max(0, avgTickDuration1s - avgTickCPUTime1s);
 						TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL
 								: (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW
 								: (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD
@@ -371,16 +376,16 @@ public class PerformanceAnalysisManager implements Listener {
 								: NamedTextColor.RED;
 						
 						timings = text("(R/W/S:")
-								.then(text(Math.round(avgTickCPUTime1s)).color(avgTickCPUTime1sColor))
+								.then(text("%02d".formatted(Math.round(avgTickCPUTime1s))).color(avgTickCPUTime1sColor))
 								.thenText("/")
-								.then(text(Math.round(avgTickWaitingTime1s)).color(avgTickWaitingTime1sColor))
+								.then(text("%02d".formatted(Math.round(avgTickWaitingTime1s))).color(avgTickWaitingTime1sColor))
 								.thenText("/")
-								.then(text(Math.round(avgInterTickDuration1s)).color(avgInterTickDuration1sColor))
+								.then(text("%02d".formatted(Math.round(avgInterTickDuration1s))).color(avgInterTickDuration1sColor))
 								.thenText("ms)");
 					}
 					
 					title = infoText("TPS [")
-							.thenLegacyText(s.toString())
+							.then(history)
 							.thenText("] ")
 							.then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s)))
 							.then(timings);
@@ -493,7 +498,7 @@ public class PerformanceAnalysisManager implements Listener {
 	/**
 	 * Runs the garbage collector on the server.
 	 * Depending on the server load and the used memory, this can freeze the server for a second.
-	 * @param sender the command sender that triggers the garbase collector. Can be null (the report will be sent to the
+	 * @param sender the command sender that triggers the garbage collector. Can be null (the report will be sent to the
 	 *               console)
 	 */
 	public static void gc(CommandSender sender) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/players/PaperOffPlayer.java

@@ -1,5 +1,6 @@
 package fr.pandacube.lib.paper.players;
 
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
 import fr.pandacube.lib.paper.world.PrimaryWorlds;
 import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
@@ -166,7 +167,7 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
                     .getServer()
                     .getPlayerList()
                     .playerIo()
-                    .load(getName(), getUniqueId().toString()).orElse(null);
+                    .load(getName(), getUniqueId().toString(), ProblemReporter.DISCARDING()).orElse(null);
         } catch (Exception|LinkageError e) {
             throw new PlayerDataLoadException(getName(), getUniqueId(), e);
         }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/players/PlayerDataWrapper.java

@@ -3,9 +3,14 @@ package fr.pandacube.lib.paper.players;
 import fr.pandacube.lib.paper.inventory.DummyPlayerInventory;
 import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftItemStack;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.ListTag;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.Tag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
 import fr.pandacube.lib.paper.util.ExperienceUtil;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
 import org.bukkit.Bukkit;
 import org.bukkit.event.inventory.InventoryType;
 import org.bukkit.inventory.Inventory;
@@ -14,6 +19,7 @@ import org.bukkit.inventory.PlayerInventory;
 
 import java.util.Map;
 import java.util.Map.Entry;
+import java.util.Optional;
 import java.util.TreeMap;
 import java.util.UUID;
 import java.util.function.IntUnaryOperator;
@@ -118,17 +124,17 @@ public record PlayerDataWrapper(CompoundTag data) {
     }
 
     private Map<Integer, ItemStack> getRawInventoryContent(String key) {
-        if (!data.contains(key, Tag.TAG_LIST()))
-            return Map.of();
-        ListTag list = data.getList(key, Tag.TAG_COMPOUND());
-        if (list == null)
-            return Map.of();
+
+        ValueInput vi = TagValueInput.createGlobal(ProblemReporter.DISCARDING(), data);
+        Iterable<?> listNMSItemStackWithSlot = ReflectWrapper.unwrap(vi.listOrEmpty(key, ItemStackWithSlot.CODEC()));
 
         Map<Integer, ItemStack> stacks = new TreeMap<>();
-        for (int i = 0; i < list.size(); i++) {
-            CompoundTag itemTag = list.getCompound(i);
-            int nbtSlot = itemTag.getByte("Slot") & 255;
-            fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack.parse(itemTag)
+
+        for (Object nmsISWS : listNMSItemStackWithSlot) {
+            ItemStackWithSlot isws = ReflectWrapper.wrap(nmsISWS, ItemStackWithSlot.class);
+
+            int nbtSlot = isws.slot() & 255;
+            Optional.of(isws.stack())
                     .map(nms -> filterStack(CraftItemStack.asCraftMirror(nms)))
                     .ifPresent(is -> stacks.put(nbtSlot, is));
         }
@@ -153,28 +159,27 @@ public record PlayerDataWrapper(CompoundTag data) {
     }
 
     private void setRawInventoryContent(String key, Map<Integer, ItemStack> stacks) {
-        ListTag list = new ListTag();
+
+        TagValueOutput vo = TagValueOutput.createWrappingGlobal(ProblemReporter.DISCARDING(), data);
+        ValueOutputTypedOutputList listNMSItemStackWithSlot = vo.list(key, ItemStackWithSlot.CODEC());
+
         for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
             ItemStack stack = filterStack(is.getValue());
             if (stack == null)
                 continue;
-            CompoundTag itemTag = new CompoundTag();
-            itemTag.putByte("Slot", is.getKey().byteValue());
-            list.add(list.size(), CraftItemStack.asNMSCopy(is.getValue()).save(itemTag));
+
+            listNMSItemStackWithSlot.add(ReflectWrapper.unwrap(new ItemStackWithSlot(is.getKey(), CraftItemStack.asNMSCopy(is.getValue()))));
         }
-        data.put(key, list);
     }
 
 
     private ItemStack filterStack(ItemStack is) {
-        return is == null || is.getType().isEmpty() || is.getAmount() == 0 ? null : is;
+        return is == null || is.isEmpty() || is.getAmount() <= 0 ? null : is;
     }
 
 
     private int getHeldItemSlot() {
-        if (!data.contains("SelectedItemSlot"))
-            return 0;
-        return data.getInt("SelectedItemSlot");
+        return data.getInt("SelectedItemSlot").orElse(0);
     }
 
     private void setHeldItemSlot(int slot) {
@@ -187,9 +192,7 @@ public record PlayerDataWrapper(CompoundTag data) {
      * @return the value of Score.
      */
     public int getScore() {
-        if (!data.contains("Score"))
-            return 0;
-        return data.getInt("Score");
+        return data.getInt("Score").orElse(0);
 
     }
 
@@ -207,9 +210,7 @@ public record PlayerDataWrapper(CompoundTag data) {
      * @return the value of XpTotal.
      */
     public int getTotalExperience() {
-        if (!data.contains("XpTotal"))
-            return 0;
-        return data.getInt("XpTotal");
+        return data.getInt("XpTotal").orElse(0);
     }
 
     /**

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/PandalibPaperReflect.java

@@ -14,9 +14,7 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
 import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter;
 import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType;
 import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.DetectedVersion;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.WorldVersion;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
@@ -54,18 +52,25 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerGamePacketL
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.RegionFileStorage;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInputTypedInputList;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock;
@@ -73,9 +78,9 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.Block;
 import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf;
 import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure;
+import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PaperBrigadier;
-import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.ShadowBrigNode;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration;
@@ -180,6 +185,7 @@ public class PandalibPaperReflect {
         thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.REFLECT.get()));
         // minecraft.util
+        thAcc.catchThrowable(() -> initWrapper(ProblemReporter.class, ProblemReporter.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.REFLECT.get()));
         // minecraft.world.block
         thAcc.catchThrowable(() -> initWrapper(Block.class, Block.REFLECT.get()));
@@ -188,29 +194,33 @@ public class PandalibPaperReflect {
         thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.REFLECT.get()));
-        thAcc.catchThrowable(() -> initWrapper(DataVersion.class, DataVersion.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ItemStackWithSlot.class, ItemStackWithSlot.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Level.class, Level.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(RegionFileStorage.class, RegionFileStorage.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(TagValueInput.class, TagValueInput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(TagValueOutput.class, TagValueOutput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueInput.class, ValueInput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueInputTypedInputList.class, ValueInputTypedInputList.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueOutput.class, ValueOutput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueOutputTypedOutputList.class, ValueOutputTypedOutputList.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.REFLECT.get()));
         // minecraft
-        thAcc.catchThrowable(() -> initWrapper(DetectedVersion.class, DetectedVersion.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.REFLECT.get()));
-        thAcc.catchThrowable(() -> initWrapper(WorldVersion.class, WorldVersion.REFLECT.get()));
 
         // netty
         thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get()));
 
         // paper.commands
+        thAcc.catchThrowable(() -> initWrapper(APICommandMeta.class, APICommandMeta.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(BukkitCommandNode.class, BukkitCommandNode.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(PaperBrigadier.class, PaperBrigadier.REFLECT.get()));
-        thAcc.catchThrowable(() -> initWrapper(PluginCommandNode.class, PluginCommandNode.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ShadowBrigNode.class, ShadowBrigNode.REFLECT.get()));
         // paper.configuration
         thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get()));

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/util/BedrockBambooCollisionFixer.java

@@ -34,7 +34,7 @@ public final class BedrockBambooCollisionFixer implements Listener {
     public BedrockBambooCollisionFixer() {
         // Make the bamboo block have zero collision.
         try {
-            BambooStalkBlock.COLLISION_SHAPE(Block.box(8, 0, 8, 8, 0, 8));
+            BambooStalkBlock.SHAPE_COLLISION(Block.box(8, 0, 8, 8, 0, 8));
             Log.info("Bamboo block collision box removed successfully.");
         } catch (Exception e) {
             Log.severe("Unable to remove the collision box of the Bamboo block.", e);

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/brigadier/CommandNode.java

@@ -1,6 +1,8 @@
 package fr.pandacube.lib.paper.reflect.wrapper.brigadier;
 
+import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
 import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectField;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -11,11 +13,20 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class CommandNode<S> extends ReflectWrapperTyped<com.mojang.brigadier.tree.CommandNode<S>> {
     public static final ReflectClass<?> REFLECT = Reflect.ofClass(com.mojang.brigadier.tree.CommandNode.class);
     private static final ReflectMethod<?> removeCommand = wrapEx(() -> REFLECT.method("removeCommand", String.class));
+    private static final ReflectField<?> apiCommandMeta = wrapEx(() -> REFLECT.field("apiCommandMeta"));
 
     public void removeCommand(String cmd) {
         wrapReflectEx(() -> removeCommand.invoke(__getRuntimeInstance(), cmd));
     }
 
+    public APICommandMeta apiCommandMeta() {
+        return wrap(wrapReflectEx(() -> apiCommandMeta.getValue(__getRuntimeInstance())), APICommandMeta.class);
+    }
+
+    public void apiCommandMeta(APICommandMeta meta) {
+        wrapReflectEx(() -> apiCommandMeta.setValue(__getRuntimeInstance(), unwrap(meta)));
+    }
+
     protected CommandNode(Object obj) {
         super(obj);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/craftbukkit/CraftVector.java

@@ -1,12 +1,10 @@
 package fr.pandacube.lib.paper.reflect.wrapper.craftbukkit;
 
 import fr.pandacube.lib.paper.reflect.OBCReflect;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.BlockPos;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
-
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
 import fr.pandacube.lib.util.ThrowableUtil;
 import org.bukkit.util.Vector;
 
@@ -16,26 +14,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class CraftVector extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("util.CraftVector"));
     public static final ReflectMethod<?> toBukkit_Vec3 = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", Vec3.REFLECT.get()));
-    public static final ReflectMethod<?> toBukkit_BlockPos = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", BlockPos.REFLECT.get()));
-    public static final ReflectMethod<?> toNMS = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
-    public static final ReflectMethod<?> toBlockPos = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
 
     public static Vector toBukkit(Vec3 nms) {
         return (Vector) wrapReflectEx(() -> toBukkit_Vec3.invokeStatic(unwrap(nms)));
     }
 
-    public static Vector toBukkit(BlockPos blockPos) {
-        return (Vector) wrapReflectEx(() -> toBukkit_BlockPos.invokeStatic(unwrap(blockPos)));
-    }
-
-    public static Vec3 toNMS(Vector bukkit) {
-        return wrap(wrapReflectEx(() -> toNMS.invokeStatic(bukkit)), Vec3.class);
-    }
-
-    public static BlockPos toBlockPos(Vector bukkit) {
-        return wrap(wrapReflectEx(() -> toBlockPos.invokeStatic(bukkit)), BlockPos.class);
-    }
-
 
     protected CraftVector(Object obj) {
         super(obj);

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/craftbukkit/VanillaCommandWrapper.java

@@ -17,13 +17,9 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class VanillaCommandWrapper extends ReflectWrapperTyped<BukkitCommand> {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("command.VanillaCommandWrapper"));
-    public static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(Commands.REFLECT.get(), CommandNode.class));
     public static final ReflectField<?> vanillaCommand = wrapEx(() -> REFLECT.field("vanillaCommand"));
     public static final ReflectMethod<?> getListener = wrapEx(() -> REFLECT.method("getListener", CommandSender.class));
 
-    public VanillaCommandWrapper(Commands dispatcher, CommandNode<CommandSourceStack> vanillaCommand) {
-        this(wrapReflectEx(() -> CONSTRUCTOR.instantiate(unwrap(dispatcher), vanillaCommand)));
-    }
 
     @SuppressWarnings("unchecked")
     public CommandNode<CommandSourceStack> vanillaCommand() {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/DetectedVersion.java

@@ -1,15 +0,0 @@
-package fr.pandacube.lib.paper.reflect.wrapper.minecraft;
-
-import fr.pandacube.lib.reflect.Reflect;
-import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-
-import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-
-public class DetectedVersion extends ReflectWrapper implements WorldVersion {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.DetectedVersion"));
-
-    protected DetectedVersion(Object obj) {
-        super(obj);
-    }
-}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/SharedConstants.java

@@ -10,15 +10,10 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class SharedConstants extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.SharedConstants"));
-    private static final ReflectMethod<?> getCurrentVersion = wrapEx(() -> REFLECT.method("getCurrentVersion"));
     private static final ReflectMethod<?> getProtocolVersion = wrapEx(() -> REFLECT.method("getProtocolVersion"));
 
 
 
-    public static WorldVersion getCurrentVersion() {
-        return wrap(wrapReflectEx(() -> getCurrentVersion.invokeStatic()), WorldVersion.class);
-    }
-
     public static int getProtocolVersion() {
         return (int) wrapReflectEx(() -> getProtocolVersion.invokeStatic());
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/commands/Coordinates.java

@@ -14,7 +14,7 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 @ConcreteWrapper(Coordinates.__concrete.class)
 public interface Coordinates extends ReflectWrapperI {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates"));
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates"));
     ReflectMethod<?> getPosition = wrapEx(() -> REFLECT.method("getPosition", CommandSourceStack.REFLECT.get()));
 
     default Vec3 getPosition(io.papermc.paper.command.brigadier.CommandSourceStack source) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/nbt/CompoundTag.java

@@ -6,10 +6,9 @@ import fr.pandacube.lib.reflect.ReflectConstructor;
 import fr.pandacube.lib.reflect.ReflectMethod;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
 
-import java.util.List;
 import java.util.Map;
+import java.util.Optional;
 import java.util.Set;
-import java.util.UUID;
 
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@@ -20,21 +19,16 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	private static final ReflectMethod<?> putBoolean = wrapEx(() -> REFLECT.method("putBoolean", String.class, boolean.class));
 	private static final ReflectMethod<?> putByte = wrapEx(() -> REFLECT.method("putByte", String.class, byte.class));
 	private static final ReflectMethod<?> putByteArray = wrapEx(() -> REFLECT.method("putByteArray", String.class, byte[].class));
-	private static final ReflectMethod<?> putByteArray_List = wrapEx(() -> REFLECT.method("putByteArray", String.class, List.class));
 	private static final ReflectMethod<?> putDouble = wrapEx(() -> REFLECT.method("putDouble", String.class, double.class));
 	private static final ReflectMethod<?> putFloat = wrapEx(() -> REFLECT.method("putFloat", String.class, float.class));
 	private static final ReflectMethod<?> putInt = wrapEx(() -> REFLECT.method("putInt", String.class, int.class));
 	private static final ReflectMethod<?> putIntArray = wrapEx(() -> REFLECT.method("putIntArray", String.class, int[].class));
-	private static final ReflectMethod<?> putIntArray_List = wrapEx(() -> REFLECT.method("putIntArray", String.class, List.class));
 	private static final ReflectMethod<?> putString = wrapEx(() -> REFLECT.method("putString", String.class, String.class));
-	private static final ReflectMethod<?> putUUID = wrapEx(() -> REFLECT.method("putUUID", String.class, UUID.class));
 	private static final ReflectMethod<?> putLong = wrapEx(() -> REFLECT.method("putLong", String.class, long.class));
 	private static final ReflectMethod<?> putLongArray = wrapEx(() -> REFLECT.method("putLongArray", String.class, long[].class));
-	private static final ReflectMethod<?> putLongArray_List = wrapEx(() -> REFLECT.method("putLongArray", String.class, List.class));
 	private static final ReflectMethod<?> putShort = wrapEx(() -> REFLECT.method("putShort", String.class, short.class));
 	private static final ReflectMethod<?> put = wrapEx(() -> REFLECT.method("put", String.class, Tag.REFLECT.get()));
 
-	private static final ReflectMethod<?> getTagType = wrapEx(() -> REFLECT.method("getTagType", String.class));
 	private static final ReflectMethod<?> getByte = wrapEx(() -> REFLECT.method("getByte", String.class));
 	private static final ReflectMethod<?> getShort = wrapEx(() -> REFLECT.method("getShort", String.class));
 	private static final ReflectMethod<?> getInt = wrapEx(() -> REFLECT.method("getInt", String.class));
@@ -47,14 +41,13 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	private static final ReflectMethod<?> getLongArray = wrapEx(() -> REFLECT.method("getLongArray", String.class));
 	private static final ReflectMethod<?> getCompound = wrapEx(() -> REFLECT.method("getCompound", String.class));
 	private static final ReflectMethod<?> getBoolean = wrapEx(() -> REFLECT.method("getBoolean", String.class));
-	private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class, int.class));
+	private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class));
 
 	private static final ReflectMethod<?> get = wrapEx(() -> REFLECT.method("get", String.class));
-	private static final ReflectMethod<?> getAllKeys = wrapEx(() -> REFLECT.method("getAllKeys"));
+	private static final ReflectMethod<?> keySet = wrapEx(() -> REFLECT.method("keySet"));
 	private static final ReflectMethod<?> entrySet = wrapEx(() -> REFLECT.method("entrySet"));
 	private static final ReflectMethod<?> size = wrapEx(() -> REFLECT.method("size"));
 	private static final ReflectMethod<?> contains = wrapEx(() -> REFLECT.method("contains", String.class));
-	private static final ReflectMethod<?> containsStringInt = wrapEx(() -> REFLECT.method("contains", String.class, int.class));
 
 	public CompoundTag() {
 		this(wrapReflectEx(() -> CONSTRUCTOR.instantiate()));
@@ -73,9 +66,6 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	public void putByteArray(String key, byte[] value) {
 		wrapReflectEx(() -> putByteArray.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putByteArray(String key, List<Byte> value) {
-		wrapReflectEx(() -> putByteArray_List.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putDouble(String key, double value) {
 		wrapReflectEx(() -> putDouble.invoke(__getRuntimeInstance(), key, value));
 	}
@@ -88,78 +78,79 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	public void putIntArray(String key, int[] value) {
 		wrapReflectEx(() -> putIntArray.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putIntArray(String key, List<Integer> value) {
-		wrapReflectEx(() -> putIntArray_List.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putString(String key, String value) {
 		wrapReflectEx(() -> putString.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putUUID(String key, UUID value) {
-		wrapReflectEx(() -> putUUID.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putLong(String key, long value) {
 		wrapReflectEx(() -> putLong.invoke(__getRuntimeInstance(), key, value));
 	}
 	public void putLongArray(String key, long[] value) {
 		wrapReflectEx(() -> putLongArray.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putLongArray(String key, List<Long> value) {
-		wrapReflectEx(() -> putLongArray_List.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putShort(String key, short value) {
 		wrapReflectEx(() -> putShort.invoke(__getRuntimeInstance(), key, value));
 	}
 	public void put(String key, Tag value) {
 		wrapReflectEx(() -> put.invoke(__getRuntimeInstance(), key, unwrap(value)));
 	}
-	public byte getTagType(String key) {
-		return (byte) wrapReflectEx(() -> getTagType.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Byte> getByte(String key) {
+		return (Optional<Byte>) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key));
 	}
-	public byte getByte(String key) {
-		return (byte) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Short> getShort(String key) {
+		return (Optional<Short>) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key));
 	}
-	public short getShort(String key) {
-		return (short) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Integer> getInt(String key) {
+		return (Optional<Integer>) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key));
 	}
-	public int getInt(String key) {
-		return (int) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Long> getLong(String key) {
+		return (Optional<Long>) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key));
 	}
-	public long getLong(String key) {
-		return (long) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Float> getFloat(String key) {
+		return (Optional<Float>) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key));
 	}
-	public float getFloat(String key) {
-		return (float) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Double> getDouble(String key) {
+		return (Optional<Double>) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key));
 	}
-	public double getDouble(String key) {
-		return (double) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<String> getString(String key) {
+		return (Optional<String>) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key));
 	}
-	public String getString(String key) {
-		return (String) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<byte[]> getByteArray(String key) {
+		return (Optional<byte[]>) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key));
 	}
-	public byte[] getByteArray(String key) {
-		return (byte[]) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<int[]> getIntArray(String key) {
+		return (Optional<int[]>) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key));
 	}
-	public int[] getIntArray(String key) {
-		return (int[]) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<long[]> getLongArray(String key) {
+		return (Optional<long[]>) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key));
 	}
-	public long[] getLongArray(String key) {
-		return (long[]) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key));
+	public Optional<CompoundTag> getCompound(String key) {
+		return ((Optional<?>) wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)))
+				.map(u -> wrap(u, CompoundTag.class));
 	}
-	public CompoundTag getCompound(String key) {
-		return wrap(wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)), CompoundTag.class);
+	@SuppressWarnings("unchecked")
+	public Optional<Boolean> getBoolean(String key) {
+		return (Optional<Boolean>) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key));
 	}
-	public boolean getBoolean(String key) {
-		return (boolean) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key));
-	}
-	public ListTag getList(String key, int type) {
-		return wrap(wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key, type)), ListTag.class);
+	public Optional<ListTag> getList(String key) {
+		return ((Optional<?>) wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key)))
+				.map(u -> wrap(u, ListTag.class));
 	}
 	public Tag get(String key) {
 		return wrap(wrapReflectEx(() -> get.invoke(__getRuntimeInstance(), key)), Tag.class);
 	}
 	@SuppressWarnings("unchecked")
-	public Set<String> getAllKeys() {
-		return (Set<String>) wrapReflectEx(() -> getAllKeys.invoke(__getRuntimeInstance()));
+	public Set<String> keySet() {
+		return (Set<String>) wrapReflectEx(() -> keySet.invoke(__getRuntimeInstance()));
 	}
 
 	/**
@@ -176,8 +167,5 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	public boolean contains(String key) {
 		return (boolean) wrapReflectEx(() -> contains.invoke(__getRuntimeInstance(), key));
 	}
-	public boolean contains(String key, int type) {
-		return (boolean) wrapReflectEx(() -> containsStringInt.invoke(__getRuntimeInstance(), key, type));
-	}
 
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/nbt/Tag.java

@@ -8,20 +8,22 @@ import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
 
+import java.util.Optional;
+
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 @ConcreteWrapper(Tag.__concrete.class)
 public interface Tag extends ReflectWrapperI {
 	ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.nbt.Tag"));
-	ReflectMethod<?> getAsString = wrapEx(() -> REFLECT.method("getAsString"));
+	ReflectMethod<?> asString = wrapEx(() -> REFLECT.method("asString"));
 	ReflectField<?> TAG_LIST = wrapEx(() -> REFLECT.field("TAG_LIST"));
 	ReflectField<?> TAG_COMPOUND = wrapEx(() -> REFLECT.field("TAG_COMPOUND"));
-	ReflectField<?> TAG_ANY_NUMERIC = wrapEx(() -> REFLECT.field("TAG_ANY_NUMERIC"));
 
 	
-	default String getAsString() {
-		return wrapReflectEx(() -> (String) getAsString.invoke(__getRuntimeInstance()));
+	@SuppressWarnings("unchecked")
+	default Optional<String> asString() {
+		return wrapReflectEx(() -> (Optional<String>) asString.invoke(__getRuntimeInstance()));
 	}
 
 	static byte TAG_LIST() {
@@ -32,10 +34,6 @@ public interface Tag extends ReflectWrapperI {
 		return wrapReflectEx(() -> (byte) TAG_COMPOUND.getStaticValue());
 	}
 
-	static byte TAG_ANY_NUMERIC() {
-		return wrapReflectEx(() -> (byte) TAG_ANY_NUMERIC.getStaticValue());
-	}
-
 	
 	class __concrete extends ReflectWrapper implements Tag {
 		private __concrete(Object obj) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/util/ProblemReporter.java

@@ -0,0 +1,31 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.util;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectField;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
+
+import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+@ConcreteWrapper(ProblemReporter.__concrete.class)
+public interface ProblemReporter extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.util.ProblemReporter"));
+    ReflectField<?> DISCARDING = wrapEx(() -> REFLECT.field("DISCARDING"));
+
+    static ProblemReporter DISCARDING() {
+        return wrap(wrapReflectEx(DISCARDING::getStaticValue), ProblemReporter.class);
+    }
+
+
+
+
+    class __concrete extends ReflectWrapper implements ProblemReporter {
+        protected __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/DataVersion.java

@@ -1,32 +0,0 @@
-package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
-
-import fr.pandacube.lib.reflect.Reflect;
-import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.ReflectMethod;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-
-import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
-
-public class DataVersion extends ReflectWrapper {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.DataVersion"));
-    private static final ReflectMethod<?> getVersion = wrapEx(() -> REFLECT.method("getVersion"));
-    private static final ReflectMethod<?> getSeries = wrapEx(() -> REFLECT.method("getSeries"));
-
-
-
-    public int getVersion() {
-        return (int) wrapReflectEx(() -> getVersion.invoke(__getRuntimeInstance()));
-    }
-
-    public String getSeries() {
-        return (String) wrapReflectEx(() -> getSeries.invoke(__getRuntimeInstance()));
-    }
-
-
-
-
-    protected DataVersion(Object obj) {
-        super(obj);
-    }
-}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/Entity.java

@@ -1,6 +1,5 @@
 package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -12,16 +11,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class Entity extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.entity.Entity"));
     public static final ReflectMethod<?> getBukkitEntity = wrapEx(() -> REFLECT.method("getBukkitEntity")); // spigot method
-    public static final ReflectMethod<?> serializeEntity = wrapEx(() -> REFLECT.method("serializeEntity", CompoundTag.REFLECT.get())); // paper method
 
     public org.bukkit.entity.Entity getBukkitEntity() {
         return (org.bukkit.entity.Entity) wrapReflectEx(() -> getBukkitEntity.invoke(__getRuntimeInstance()));
     }
 
-    public boolean serializeEntity(CompoundTag nbt) {
-        return wrapReflectEx(() -> (Boolean) serializeEntity.invoke(__getRuntimeInstance(), unwrap(nbt)));
-    }
-
     protected Entity(Object obj) {
         super(obj);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ItemStack.java

@@ -1,63 +1,15 @@
 package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
-import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.HolderLookupProvider;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.RegistryAccess;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.Tag;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.ReflectMethod;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-import org.bukkit.Bukkit;
-
-import java.util.Optional;
 
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class ItemStack extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.item.ItemStack"));
-    private static final ReflectMethod<?> parse = wrapEx(() -> REFLECT.method("parse", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
-    private static final ReflectMethod<?> saveWithPrefix = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
-    private static final ReflectMethod<?> save = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get()));
-
-    @SuppressWarnings("unchecked")
-    public static Optional<ItemStack> parse(HolderLookupProvider registries, Tag nbt) {
-        return ((Optional<Object>) wrapReflectEx(() -> parse.invokeStatic(unwrap(registries), unwrap(nbt))))
-                .map(o -> wrap(o, ItemStack.class));
-    }
-
-    
-    public static Optional<ItemStack> parse(Tag nbt) {
-        return parse(getRegistries(), nbt);
-    }
-
 
     protected ItemStack(Object obj) {
         super(obj);
     }
-
-
-    public Tag save(HolderLookupProvider registries, Tag prefix) {
-        return wrap(wrapReflectEx(() -> saveWithPrefix.invoke(__getRuntimeInstance(), unwrap(registries), unwrap(prefix))), Tag.class);
-    }
-
-
-    public Tag save(HolderLookupProvider registries) {
-        return wrap(wrapReflectEx(() -> save.invoke(__getRuntimeInstance(), unwrap(registries))), Tag.class);
-    }
-
-
-    public Tag save(Tag prefix) {
-        return save(getRegistries(), prefix);
-    }
-
-
-    public Tag save() {
-        return save(getRegistries());
-    }
-
-    private static RegistryAccess getRegistries() {
-        return wrap(Bukkit.getServer(), CraftServer.class).getServer().registryAccess();
-    }
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ItemStackWithSlot.java

@@ -0,0 +1,44 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import com.mojang.serialization.Codec;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectConstructor;
+import fr.pandacube.lib.reflect.ReflectField;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class ItemStackWithSlot extends ReflectWrapper {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.ItemStackWithSlot"));
+    private static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(int.class, ItemStack.REFLECT.get()));
+    private static final ReflectField<?> CODEC = wrapEx(() -> REFLECT.field("CODEC"));
+    private static final ReflectMethod<?> slot = wrapEx(() -> REFLECT.method("slot"));
+    private static final ReflectMethod<?> stack = wrapEx(() -> REFLECT.method("stack"));
+
+    public static Codec<?> CODEC() {
+        return (Codec<?>) wrapReflectEx(CODEC::getStaticValue);
+    }
+
+
+
+    protected ItemStackWithSlot(Object obj) {
+        super(obj);
+    }
+
+    public ItemStackWithSlot(int slot, ItemStack stack) {
+        super(wrapReflectEx(() -> CONSTRUCTOR.instantiate(slot, unwrap(stack))));
+    }
+
+
+    public int slot() {
+        return (int) wrapReflectEx(() -> slot.invoke(__getRuntimeInstance()));
+    }
+
+    public ItemStack stack() {
+        return wrap(wrapReflectEx(() -> stack.invoke(__getRuntimeInstance())), ItemStack.class);
+    }
+
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/Level.java

@@ -12,17 +12,12 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class Level extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.Level"));
     public static final ReflectMethod<?> getGameTime = wrapEx(() -> REFLECT.method("getGameTime"));
-    public static final ReflectMethod<?> getFreeMapId = wrapEx(() -> REFLECT.method("getFreeMapId"));
     public static final ReflectMethod<?> paperConfig = wrapEx(() -> REFLECT.method("paperConfig")); // paper method
 
     public long getGameTime() {
         return (long) wrapReflectEx(() -> getGameTime.invoke(__getRuntimeInstance()));
     }
 
-    public int getFreeMapId() {
-        return (int) wrapReflectEx(() -> getFreeMapId.invoke(__getRuntimeInstance()));
-    }
-
     public WorldConfiguration paperConfig() {
         return wrap(wrapReflectEx(() -> paperConfig.invoke(__getRuntimeInstance())), WorldConfiguration.class);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/PlayerDataStorage.java

@@ -1,6 +1,7 @@
 package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -13,15 +14,15 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class PlayerDataStorage extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.PlayerDataStorage"));
-    public static final ReflectMethod<?> load = wrapEx(() -> REFLECT.method("load", String.class, String.class));
+    public static final ReflectMethod<?> load = wrapEx(() -> REFLECT.method("load", String.class, String.class, ProblemReporter.REFLECT.get()));
 
     /**
      * @param playerName the name of the player: used for loading error message and for offline UUID generation.
      * @param playerId UUID of a player as it is used to name the player data file (UUID.toString()).
      */
     @SuppressWarnings("unchecked")
-    public Optional<CompoundTag> load(String playerName, String playerId) {
-        return wrapOptional((Optional<Object>) wrapReflectEx(() -> load.invoke(__getRuntimeInstance(), playerName, playerId)), CompoundTag.class);
+    public Optional<CompoundTag> load(String playerName, String playerId, ProblemReporter problemReporter) {
+        return wrapOptional((Optional<Object>) wrapReflectEx(() -> load.invoke(__getRuntimeInstance(), playerName, playerId, unwrap(problemReporter))), CompoundTag.class);
     }
 
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/TagValueInput.java

@@ -0,0 +1,25 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class TagValueInput extends ReflectWrapper implements ValueInput {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.TagValueInput"));
+    private static final ReflectMethod<?> createGlobal = wrapEx(() -> REFLECT.method("createGlobal", ProblemReporter.REFLECT.get(), CompoundTag.REFLECT.get()));
+
+    public static ValueInput createGlobal(ProblemReporter problemReporter, CompoundTag nbt) {
+        return wrap(wrapReflectEx(() -> createGlobal.invokeStatic(unwrap(problemReporter), unwrap(nbt))), ValueInput.class);
+    }
+
+    protected TagValueInput(Object obj) {
+        super(obj);
+    }
+
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/TagValueOutput.java

@@ -0,0 +1,25 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class TagValueOutput extends ReflectWrapper implements ValueOutput {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.TagValueOutput"));
+    private static final ReflectMethod<?> createWrappingGlobal = wrapEx(() -> REFLECT.method("createWrappingGlobal", ProblemReporter.REFLECT.get(), CompoundTag.REFLECT.get()));
+
+    public static TagValueOutput createWrappingGlobal(ProblemReporter problemReporter, CompoundTag nbt) {
+        return wrap(wrapReflectEx(() -> createWrappingGlobal.invokeStatic(unwrap(problemReporter), unwrap(nbt))), TagValueOutput.class);
+    }
+
+    protected TagValueOutput(Object obj) {
+        super(obj);
+    }
+
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueInput.java

@@ -0,0 +1,31 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import com.mojang.serialization.Codec;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
+
+import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+@ConcreteWrapper(ValueInput.__concrete.class)
+public interface ValueInput extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueInput"));
+    ReflectMethod<?> listOrEmpty = wrapEx(() -> REFLECT.method("listOrEmpty", String.class, Codec.class));
+
+
+
+    default ValueInputTypedInputList listOrEmpty(String key, Codec<?> elementCodec) {
+        return wrap(wrapReflectEx(() -> listOrEmpty.invoke(__getRuntimeInstance(), key, elementCodec)), ValueInputTypedInputList.class);
+    }
+
+    class __concrete extends ReflectWrapper implements ValueInput {
+        private __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueInputTypedInputList.java

@@ -0,0 +1,21 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTypedI;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+
+@ConcreteWrapper(ValueInputTypedInputList.__concrete.class)
+public interface ValueInputTypedInputList extends ReflectWrapperTypedI<Iterable<?>> {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueInput$TypedInputList"));
+
+
+    class __concrete extends ReflectWrapperTyped<Iterable<?>> implements ValueInputTypedInputList {
+        private __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueOutput.java

@@ -1,6 +1,6 @@
-package fr.pandacube.lib.paper.reflect.wrapper.minecraft;
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion;
+import com.mojang.serialization.Codec;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -12,18 +12,18 @@ import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
-@ConcreteWrapper(WorldVersion.__concrete.class)
-public interface WorldVersion extends ReflectWrapperI {
-    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.WorldVersion"));
-    ReflectMethod<?> getDataVersion = wrapEx(() -> REFLECT.method("getDataVersion"));
+@ConcreteWrapper(ValueOutput.__concrete.class)
+public interface ValueOutput extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueOutput"));
+    ReflectMethod<?> list = wrapEx(() -> REFLECT.method("list", String.class, Codec.class));
 
-    default DataVersion getDataVersion() {
-        return wrap(wrapReflectEx(() -> getDataVersion.invoke(__getRuntimeInstance())), DataVersion.class);
+
+
+    default ValueOutputTypedOutputList list(String key, Codec<?> elementCodec) {
+        return wrap(wrapReflectEx(() -> list.invoke(__getRuntimeInstance(), key, elementCodec)), ValueOutputTypedOutputList.class);
     }
 
-
-
-    class __concrete extends ReflectWrapper implements WorldVersion {
+    class __concrete extends ReflectWrapper implements ValueOutput {
         private __concrete(Object obj) {
             super(obj);
         }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueOutputTypedOutputList.java

@@ -0,0 +1,28 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+@ConcreteWrapper(ValueOutputTypedOutputList.__concrete.class)
+public interface ValueOutputTypedOutputList extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueOutput$TypedOutputList"));
+    ReflectMethod<?> add = wrapEx(() -> REFLECT.method("add", Object.class));
+
+    default void add(Object rawElement) {
+        wrapReflectEx(() -> add.invoke(__getRuntimeInstance(), rawElement));
+    }
+
+
+    class __concrete extends ReflectWrapper implements ValueOutputTypedOutputList {
+        private __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/block/BambooStalkBlock.java

@@ -10,14 +10,14 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class BambooStalkBlock extends Block {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.block.BambooStalkBlock"));
-    public static final ReflectField<?> COLLISION_SHAPE = wrapEx(() -> REFLECT.field("COLLISION_SHAPE"));
+    public static final ReflectField<?> SHAPE_COLLISION = wrapEx(() -> REFLECT.field("SHAPE_COLLISION"));
 
-    public static VoxelShape COLLISION_SHAPE() {
-        return wrap(wrapReflectEx(COLLISION_SHAPE::getStaticValue), VoxelShape.class);
+    public static VoxelShape SHAPE_COLLISION() {
+        return wrap(wrapReflectEx(SHAPE_COLLISION::getStaticValue), VoxelShape.class);
     }
 
-    public static void COLLISION_SHAPE(VoxelShape shape) {
-        wrapReflectEx(() -> COLLISION_SHAPE.setStaticValue(unwrap(shape)));
+    public static void SHAPE_COLLISION(VoxelShape shape) {
+        wrapReflectEx(() -> SHAPE_COLLISION.setStaticValue(unwrap(shape)));
     }
 
     protected BambooStalkBlock(Object obj) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/paper/commands/APICommandMeta.java

@@ -0,0 +1,39 @@
+package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import org.bukkit.plugin.Plugin;
+
+import java.util.List;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class APICommandMeta extends ReflectWrapper {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.APICommandMeta"));
+    private static final ReflectMethod<?> plugin = wrapEx(() -> REFLECT.method("plugin"));
+    private static final ReflectMethod<?> description = wrapEx(() -> REFLECT.method("description"));
+    private static final ReflectMethod<?> aliases = wrapEx(() -> REFLECT.method("aliases"));
+
+
+    public Plugin plugin() {
+        return (Plugin) wrapReflectEx(() -> plugin.invoke(__getRuntimeInstance()));
+    }
+
+    public String description() {
+        return (String) wrapReflectEx(() -> description.invoke(__getRuntimeInstance()));
+    }
+
+    @SuppressWarnings("unchecked")
+    public List<String> aliases() {
+        return (List<String>) wrapReflectEx(() -> aliases.invoke(__getRuntimeInstance()));
+    }
+
+
+
+    protected APICommandMeta(Object obj) {
+        super(obj);
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/paper/commands/BukkitCommandNode.java

@@ -1,18 +1,15 @@
 package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
 
-import com.mojang.brigadier.tree.LiteralCommandNode;
+import fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
-import io.papermc.paper.command.brigadier.CommandSourceStack;
 import org.bukkit.command.Command;
-import org.bukkit.plugin.Plugin;
 
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
-public class BukkitCommandNode extends ReflectWrapperTyped<LiteralCommandNode<CommandSourceStack>> {
+public class BukkitCommandNode<S> extends CommandNode<S> {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.bukkit.BukkitCommandNode"));
     private static final ReflectMethod<?> getBukkitCommand = wrapEx(() -> REFLECT.method("getBukkitCommand"));
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/paper/commands/PluginCommandNode.java

@@ -1,43 +0,0 @@
-package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
-
-import com.mojang.brigadier.tree.LiteralCommandNode;
-import fr.pandacube.lib.reflect.Reflect;
-import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.ReflectConstructor;
-import fr.pandacube.lib.reflect.ReflectMethod;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
-import io.papermc.paper.command.brigadier.CommandSourceStack;
-import io.papermc.paper.plugin.configuration.PluginMeta;
-import org.bukkit.plugin.Plugin;
-import org.jetbrains.annotations.NotNull;
-import org.jetbrains.annotations.Nullable;
-
-import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
-
-public class PluginCommandNode extends ReflectWrapperTyped<LiteralCommandNode<CommandSourceStack>> {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.PluginCommandNode"));
-    private static final ReflectMethod<?> getPlugin = wrapEx(() -> REFLECT.method("getPlugin"));
-    private static final ReflectMethod<?> getDescription = wrapEx(() -> REFLECT.method("getDescription"));
-    private static final ReflectConstructor CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(String.class, PluginMeta.class, LiteralCommandNode.class, String.class));
-
-
-    public PluginCommandNode(@NotNull String literal, @NotNull PluginMeta plugin, @NotNull LiteralCommandNode<CommandSourceStack> rootLiteral, @Nullable String description) {
-        this(wrapReflectEx(() -> CONSTRUCTOR.instantiate(literal, plugin, rootLiteral, description)));
-    }
-
-
-    public Plugin getPlugin() {
-        return (Plugin) wrapReflectEx(() -> getPlugin.invoke(__getRuntimeInstance()));
-    }
-
-    public String getDescription() {
-        return (String) wrapReflectEx(() -> getDescription.invoke(__getRuntimeInstance()));
-    }
-
-
-
-    protected PluginCommandNode(Object obj) {
-        super(obj);
-    }
-}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/paper/commands/ShadowBrigNode.java

@@ -1,14 +1,12 @@
 package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
 
-import com.mojang.brigadier.tree.LiteralCommandNode;
+import fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
-import io.papermc.paper.command.brigadier.CommandSourceStack;
 
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 
-public class ShadowBrigNode extends ReflectWrapperTyped<LiteralCommandNode<CommandSourceStack>> {
+public class ShadowBrigNode<S> extends CommandNode<S> {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.ShadowBrigNode"));
 
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/util/AutoUpdatedBossBar.java

@@ -57,8 +57,8 @@ public class AutoUpdatedBossBar implements Listener {
 	 * Schedule the update of this boss bar with synchronisation with the system clock.
 	 * The underlying method called is {@link Timer#schedule(TimerTask, long, long)}.
 	 * The updater is executed in a separate Thread.
-	 * @param msDelay ms before running the first update of this bossbar
-	 * @param msPeriod ms between each call of the updater
+	 * @param msDelay ms before running the first update of this boss bar.
+	 * @param msPeriod ms between each call of the updater.
 	 */
 	public synchronized void scheduleUpdateTimeSyncThreadAsync(long msDelay, long msPeriod) {
 		if (scheduled)
@@ -82,8 +82,8 @@ public class AutoUpdatedBossBar implements Listener {
 	 * Schedule the update of this boss bar with synchronisation with the ticking of this Minecraft server.
 	 * The underlying method called is {@link BukkitScheduler#runTaskTimer(org.bukkit.plugin.Plugin, Runnable, long, long)}.
 	 * The updater is executed by the main Server Thread.
-	 * @param tickDelay number of server tick before running the first update of this boss bar
-	 * @param tickPeriod number of server tick between each call of the updater
+	 * @param tickDelay number of server tick before running the first update of this boss bar.
+	 * @param tickPeriod number of server tick between each call of the updater.
 	 */
 	public synchronized void scheduleUpdateTickSyncThreadSync(long tickDelay, long tickPeriod) {
 		if (scheduled)

pandalib-paper/src/main/java/fr/pandacube/lib/paper/util/BukkitEvent.java

@@ -141,7 +141,7 @@ public class BukkitEvent {
 
 
 	/**
-	 * An single executor event listener. Used for the {@link #register(Class, EventListener)} static method and the other variants.
+	 * A single executor event listener. Used for the {@link #register(Class, EventListener)} static method and the other variants.
 	 * @param <E> the event type.
 	 */
 	public interface EventListener<E extends Event> extends Listener, EventExecutor {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/util/Skull.java

@@ -1,230 +0,0 @@
-package fr.pandacube.lib.paper.util;
-
-import java.util.Base64;
-import java.util.List;
-import java.util.UUID;
-import java.util.stream.Collectors;
-
-import org.bukkit.Bukkit;
-import org.bukkit.Material;
-import org.bukkit.inventory.ItemStack;
-import org.bukkit.inventory.meta.SkullMeta;
-
-import com.destroystokyo.paper.profile.PlayerProfile;
-import com.destroystokyo.paper.profile.ProfileProperty;
-
-import fr.pandacube.lib.chat.Chat;
-
-/**
- * Represents some special mob heads, also support creating player skulls and custom skulls.
- *
- * @author xigsag, SBPrime
- *
- * @see <a href="https://github.com/TigerHix/Hex-Utils/blob/9954159a323d12733b29c287a56980991cee2948/hex/util/Skull.java">github.com/TigerHix/Hex-Utils/hex/util/Skull.java</a>
- */
-public enum Skull {
-
-    /** Standard skull of player MHF_ArrowLeft. */
-    ARROW_LEFT("MHF_ArrowLeft"),
-    /** Standard skull of player MHF_ArrowRight. */
-    ARROW_RIGHT("MHF_ArrowRight"),
-    /** Standard skull of player MHF_ArrowUp. */
-    ARROW_UP("MHF_ArrowUp"),
-    /** Standard skull of player MHF_ArrowDown. */
-    ARROW_DOWN("MHF_ArrowDown"),
-    /** Standard skull of player MHF_Question. */
-    QUESTION("MHF_Question"),
-    /** Standard skull of player MHF_Exclamation. */
-    EXCLAMATION("MHF_Exclamation"),
-    /** Standard skull of player FHG_Cam. */
-    CAMERA("FHG_Cam"),
-
-    /** Standard skull of player MHF_PigZombie. */
-    ZOMBIE_PIGMAN("MHF_PigZombie"),
-    /** Standard skull of player MHF_Pig. */
-    PIG("MHF_Pig"),
-    /** Standard skull of player MHF_Sheep. */
-    SHEEP("MHF_Sheep"),
-    /** Standard skull of player MHF_Blaze. */
-    BLAZE("MHF_Blaze"),
-    /** Standard skull of player MHF_Chicken. */
-    CHICKEN("MHF_Chicken"),
-    /** Standard skull of player MHF_Cow. */
-    COW("MHF_Cow"),
-    /** Standard skull of player MHF_Slime. */
-    SLIME("MHF_Slime"),
-    /** Standard skull of player MHF_Spider. */
-    SPIDER("MHF_Spider"),
-    /** Standard skull of player MHF_Squid. */
-    SQUID("MHF_Squid"),
-    /** Standard skull of player MHF_Villager. */
-    VILLAGER("MHF_Villager"),
-    /** Standard skull of player MHF_Ocelot. */
-    OCELOT("MHF_Ocelot"),
-    /** Standard skull of player MHF_Herobrine. */
-    HEROBRINE("MHF_Herobrine"),
-    /** Standard skull of player MHF_LavaSlime. */
-    LAVA_SLIME("MHF_LavaSlime"),
-    /** Standard skull of player MHF_MushroomCow. */
-    MOOSHROOM("MHF_MushroomCow"),
-    /** Standard skull of player MHF_Golem. */
-    GOLEM("MHF_Golem"),
-    /** Standard skull of player MHF_Ghast. */
-    GHAST("MHF_Ghast"),
-    /** Standard skull of player MHF_Enderman. */
-    ENDERMAN("MHF_Enderman"),
-    /** Standard skull of player MHF_CaveSpider. */
-    CAVE_SPIDER("MHF_CaveSpider"),
-
-    /** Standard skull of player MHF_Cactus. */
-    CACTUS("MHF_Cactus"),
-    /** Standard skull of player MHF_Cake. */
-    CAKE("MHF_Cake"),
-    /** Standard skull of player MHF_Chest. */
-    CHEST("MHF_Chest"),
-    /** Standard skull of player MHF_Melon. */
-    MELON("MHF_Melon"),
-    /** Standard skull of player MHF_OakLog. */
-    LOG("MHF_OakLog"),
-    /** Standard skull of player MHF_Pumpkin. */
-    PUMPKIN("MHF_Pumpkin"),
-    /** Standard skull of player MHF_TNT. */
-    TNT("MHF_TNT"),
-    /** Standard skull of player MHF_TNT2. */
-    DYNAMITE("MHF_TNT2");
-
-    private final String name;
-
-    Skull(String mcName) {
-        name = mcName;
-    }
-
-    /**
-     * Return the item based on this Skull enum.
-     *
-     * @return item stack
-     */
-    public ItemStack get() {
-    	return get(null, null);
-    }
-    /**
-     * Return the item based on this Skull enum, with the provided display name and lore.
-     * @param displayName the display name to add to the returned skull.
-     * @param lore the lore to add to the returned skull.
-     * @return item stack
-     */
-    public ItemStack get(Chat displayName, List<Chat> lore) {
-        return getFromPlayerName(name, displayName, lore);
-    }
-
-    
-    
-    /**
-     * Return a skull of a player based on their name.
-     *
-     * @param name player's name
-     * @param displayName the display name to add to the returned skull.
-     * @param lore the lore to add to the returned skull.
-     * @return item stack
-     */
-	public static ItemStack getFromPlayerName(String name, Chat displayName, List<Chat> lore) {
-        ItemStack itemStack = new ItemStack(Material.PLAYER_HEAD, 1);
-        SkullMeta meta = (SkullMeta) itemStack.getItemMeta();
-        
-        @SuppressWarnings({ "deprecation", "unused" })
-        boolean b = meta.setOwner(name);
-        
-        if (displayName != null)
-        	meta.displayName(displayName.get());
-        
-        if (lore != null)
-        	meta.lore(lore.stream().map(Chat::get).collect(Collectors.toList()));
-        
-        itemStack.setItemMeta(meta);
-        return itemStack;
-    }
-    
-    
-    
-    
-	
-	
-	
-	
-	
-    
-
-    /**
-     * Return a skull that has a custom texture specified by url.
-     * @param url skin url.
-     * @return item stack
-     */
-    public static ItemStack getFromSkinURL(String url) {
-        return getFromSkinURL(url, null, null);
-    }
-
-    /**
-     * Return a skull that has a custom texture specified by url.
-     *
-     * @param url the skin full url.
-     * @param displayName the display name to add to the returned skull.
-     * @param lore the lore to add to the returned skull.
-     * @return item stack
-     */
-    public static ItemStack getFromSkinURL(String url, Chat displayName, List<Chat> lore) {
-        return getFromBase64String(Base64.getEncoder().encodeToString(String.format("{\"textures\":{\"SKIN\":{\"url\":\"%s\"}}}", url).getBytes()), displayName, lore);
-    }
-    
-    
-    
-    
-    
-
-    
-
-    /**
-     * Return a skull that has a custom texture specified by a base64 String.
-     *
-     * @param str the base64 string from game profile information.
-     * @return item stack
-     */
-    public static ItemStack getFromBase64String(String str) {
-    	return getFromBase64String(str, null, null);
-    }
-    
-
-    /**
-     * Return a skull that has a custom texture specified by a base64 String.
-     *
-     * @param str the base64 string from game profile information.
-     * @param displayName the display name to add to the returned skull.
-     * @param lore the lore to add to the returned skull.
-     * @return item stack
-     */
-    public static ItemStack getFromBase64String(String str, Chat displayName, List<Chat> lore) {
-        ItemStack head = new ItemStack(Material.PLAYER_HEAD, 1);
-        
-        SkullMeta headMeta = (SkullMeta) head.getItemMeta();
-
-        PlayerProfile profile = Bukkit.createProfile(UUID.nameUUIDFromBytes(str.getBytes()));
-        profile.setProperty(new ProfileProperty("textures", str));
-        headMeta.setPlayerProfile(profile);
-        
-        if (displayName != null)
-        	headMeta.displayName(displayName.get());
-        
-        if (lore != null)
-        	headMeta.lore(lore.stream().map(Chat::get).collect(Collectors.toList()));
-        
-        head.setItemMeta(headMeta);
-        
-        return head;
-    }
-    
-    
-    
-    
-    
-
-}
- 

pandalib-permissions/src/main/java/fr/pandacube/lib/permissions/PermissionsCachedBackendReader.java

@@ -71,9 +71,7 @@ import fr.pandacube.lib.util.log.Log;
 		try {
             DB.getAll(SQLPermissions.class, SQLPermissions.type.eq(EntityType.User.getCode()))
 					.stream()
-					.collect(Collectors.groupingBy(el -> el.get(SQLPermissions.name),
-							Collectors.toCollection(() -> new SQLElementList<SQLPermissions>())
-							)
+					.collect(Collectors.groupingBy(el -> el.get(SQLPermissions.name))
 					)
 					.forEach((idStr, pData) -> {
 						try {
@@ -100,7 +98,7 @@ import fr.pandacube.lib.util.log.Log;
 		return initPlayer(playerId, playerData);
 	}
 
-	private CachedPlayer initPlayer(UUID playerId, SQLElementList<SQLPermissions> playerData) {
+	private CachedPlayer initPlayer(UUID playerId, List<SQLPermissions> playerData) {
 		
 		Map<String, List<SQLPermissions>> playerRawData = playerData.stream()
 				.collect(

pandalib-reflect/src/main/java/fr/pandacube/lib/reflect/ReflectField.java

@@ -122,9 +122,11 @@ public final class ReflectField<T> extends ReflectMember<T, String, Field, NoSuc
             // if the field is final, we have to do some unsafe stuff :/
             if (sunMiscUnsafeInstance != null) { // Java >= 16
                 // set the value of the field, directly in the memory
+                @SuppressWarnings("deprecation") // no other options yet. VarHandle blocks edition of final fields
                 Object unsafeObjInstance = Modifier.isStatic(realModifiers)
                         ? sunMiscUnsafeInstance.staticFieldBase(f)
                         : instance;
+                @SuppressWarnings("deprecation") // no other options yet. VarHandle blocks edition of final fields
                 long offset = Modifier.isStatic(realModifiers)
                         ? sunMiscUnsafeInstance.staticFieldOffset(f)
                         : sunMiscUnsafeInstance.objectFieldOffset(f);

pandalib-reflect/src/main/java/fr/pandacube/lib/reflect/wrapper/ReflectListWrapper.java

@@ -39,7 +39,7 @@ public class ReflectListWrapper<W extends ReflectWrapperI> extends MappedListVie
      */
     @Override
     public boolean equals(Object o) {
-        return o instanceof List l && backend.equals(l instanceof ReflectListWrapper<?> rw ? rw.backend : l);
+        return o instanceof List<?> l && backend.equals(l instanceof ReflectListWrapper<?> rw ? rw.backend : l);
     }
 
     @Override

pandalib-reflect/src/main/java/fr/pandacube/lib/reflect/wrapper/ReflectWrapper.java

@@ -116,7 +116,7 @@ public abstract class ReflectWrapper implements ReflectWrapperI {
 			}
 
 			if (expectedWrapperClass != null && !expectedWrapperClass.isAssignableFrom(wrapperClass)) {
-				throw new ClassCastException("Wrapper class " + wrapperClass + " is not a sub-class or a sub-interface of expected wrapper class" + expectedWrapperClass);
+				throw new ClassCastException("Wrapper class " + wrapperClass + " is not a sub-class or a sub-interface of expected wrapper class " + expectedWrapperClass);
 			}
 			ReflectConstructor<? extends ReflectWrapperI> constructor = WrapperRegistry.getWrapperConstructorOfWrapperClass(wrapperClass);
 			if (constructor == null) {
@@ -198,16 +198,20 @@ public abstract class ReflectWrapper implements ReflectWrapperI {
 	@Override
 	public boolean equals(Object obj) {
 		if (obj instanceof ReflectWrapper wr) {
-			return Objects.equals(reflectObject, wr.reflectObject);
+			return reflectObject.equals(wr.reflectObject);
 		}
 		return false;
 	}
 	
 	@Override
 	public int hashCode() {
-		return Objects.hashCode(reflectObject);
+		return reflectObject.hashCode();
+	}
+
+	@Override
+	public String toString() {
+		return reflectObject.toString();
 	}
 
 
-
 }

pandalib-reflect/src/main/java/fr/pandacube/lib/reflect/wrapper/ReflectWrapperTyped.java

@@ -16,11 +16,6 @@ public abstract class ReflectWrapperTyped<T> extends ReflectWrapper implements R
         super(obj);
     }
 
-    @Override
-    public Class<? extends T> __getRuntimeClass() {
-        return ReflectWrapperTypedI.super.__getRuntimeClass();
-    }
-
     @SuppressWarnings("unchecked")
     @Override
     public T __getRuntimeInstance() {

pandalib-util/src/main/java/fr/pandacube/lib/util/AmountPerTimeLimiter.java

@@ -6,10 +6,10 @@ import java.util.stream.Collectors;
 
 /**
  * Utility class to track and limit the amount of a specific value for a specified amount of duration.
- *
+ * <p>
  * An exemple of application is for rolling expense limit of a debit card: you cannot expense more that {@code $X}
  * during a rolling period of {@code $Y} time.
- *
+ * <p>
  * Here is an example usage of this class:
  * <pre>
  *     AmountPerTimeLimiter instance = new AmountPerTimeLimiter(X, Y);

pandalib-util/src/main/java/fr/pandacube/lib/util/EnumUtil.java

@@ -55,7 +55,7 @@ public class EnumUtil {
 	 * Search for a specific enum entry in the provided enum type, using the case-insensitive search string.
 	 * unlike {@link #searchEnum(Class, String)}, this method does not statically check the enum type, in case it is not
 	 * known at compilation time.
-	 *
+	 * <p>
 	 * For a statically checked enum type, uses {@link #searchEnum(Class, String)} instead.
 	 *
 	 * @param enumType the class of the enum in which to search

pandalib-util/src/main/java/fr/pandacube/lib/util/IteratorIterator.java

@@ -15,7 +15,7 @@ public class IteratorIterator<T> implements Iterator<T> {
 
 	/**
 	 * Create an {@link IteratorIterator} with the provided {@link Collection} of {@link Iterable}.
-	 * The iterables’ iterators will be concatenated in the order of the collection’s iterator.
+	 * The iterable's iterators will be concatenated in the order of the collection’s iterator.
 	 * @param coll the collection of iterables.
 	 * @return a new instance of {@link IteratorIterator} iterating over the elements of the provided iterables.
 	 * @param <T> the type of the values in the iterables.
@@ -37,7 +37,7 @@ public class IteratorIterator<T> implements Iterator<T> {
 
 	/**
 	 * Create an {@link IteratorIterator} with the provided array of {@link Iterable}.
-	 * The iterables’ iterators will be concatenated in the order of the array.
+	 * The iterable's iterators will be concatenated in the order of the array.
 	 * @param arr the array of iterables.
 	 * @return a new instance of {@link IteratorIterator} iterating over the elements of the provided iterables.
 	 * @param <T> the type of the values in the iterables.

pandalib-util/src/main/java/fr/pandacube/lib/util/RandomUtil.java

@@ -1,6 +1,11 @@
 package fr.pandacube.lib.util;
 
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.Iterator;
+import java.util.LinkedHashMap;
 import java.util.List;
+import java.util.Map;
 import java.util.Random;
 import java.util.Set;
 
@@ -101,7 +106,7 @@ public class RandomUtil {
 	 * The probability of each value to be returned depends on the frequencies provided.
 	 * @param frequencies the frequencies of each entry
 	 * @return the index of an entry, or -1 if it is unable to pick anything (all the frequencies are 0 or there is no provided frequency)
-	 * @throws IllegalArgumentException if frequencies is null.
+	 * @throws IllegalArgumentException if frequencies is null or one of the values is negative.
 	 */
 	public static int randomIndexOfFrequencies(double... frequencies) {
 		if (frequencies == null)
@@ -123,6 +128,30 @@ public class RandomUtil {
 	}
 
 
+	/**
+	 * Creates a new map with the values shuffled, and the key in the same iteration order as the provided map.
+	 * @param input the source map, untouched.
+	 * @return a new map with shuffled values.
+	 * @param <K> the key type.
+	 * @param <V> the value type.
+	 */
+	public static <K, V> Map<K, V> shuffleMap(Map<K, V> input) {
+		Map<K, V> ret = new LinkedHashMap<>();
+
+		List<V> values = new ArrayList<>(input.values());
+		Collections.shuffle(values, rand);
+
+		Iterator<K> iK = input.keySet().iterator();
+		Iterator<V> iV = values.iterator();
+		while (iK.hasNext() && iV.hasNext()) {
+			ret.put(iK.next(), iV.next());
+		}
+		return ret;
+	}
+
+
+
+
 	/**
 	 * A set of characters representing all the lowercase letters of the latin alphabet (only in the ASCII table).
 	 */

pandalib-util/src/main/java/fr/pandacube/lib/util/log/Log.java

@@ -7,7 +7,7 @@ import java.util.logging.Logger;
 /**
  * Utility class to easily log info into a provided logger. This class avoid the needs to fetch the logger everytime it
  * is needed.
- *
+ * <p>
  * For instance, this piece of code:
  * <pre>
  * getTheLoggerFromSomewhere().info(message);
@@ -22,7 +22,7 @@ import java.util.logging.Logger;
  * Log.info(message);
  * </pre>
  *
- * This the {@link #setLogger(Logger)} method is not called, thi class will use the logger returned by
+ * If the {@link #setLogger(Logger)} method is not called, this class will use the logger returned by
  * {@link Logger#getGlobal()}.
  */
 public final class Log {

pandalib-ws-client/src/main/java/fr/pandacube/lib/ws/client/AbstractClientWS.java

@@ -23,6 +23,7 @@ public abstract class AbstractClientWS implements AbstractWS {
     private final URI uri;
     private boolean autoReconnect;
     private boolean isConnecting;
+    private HttpClient httpClient = HttpClient.newHttpClient();
     private final AtomicReference<WebSocket> socket = new AtomicReference<>();
 
 
@@ -114,7 +115,7 @@ public abstract class AbstractClientWS implements AbstractWS {
         synchronized (socket) {
             if (autoReconnect && !isConnecting && socket.get() == null) {
                 try {
-                    Thread.sleep(1000);
+                    Thread.sleep(2000);
                 } catch (InterruptedException ignored) {
                     Thread.currentThread().interrupt();
                 }
@@ -127,8 +128,10 @@ public abstract class AbstractClientWS implements AbstractWS {
     private void connect() {
         synchronized (socket) {
             isConnecting = true;
-            HttpClient.newHttpClient()
-                    .newWebSocketBuilder()
+            if (httpClient == null)
+                httpClient = HttpClient.newHttpClient();
+
+            httpClient.newWebSocketBuilder()
                     .connectTimeout(Duration.ofSeconds(5))
                     .buildAsync(uri, receiveListener)
                     .whenCompleteAsync((ws, ex) -> {
@@ -145,13 +148,15 @@ public abstract class AbstractClientWS implements AbstractWS {
                             ex = ex.getCause();
                         if (ex instanceof IOException) {
                             reconnectIfNecessary();
-                            log("Unable to connect. Trying again...: " + ex);
+                            log("Can't connect. Trying again. " + ex);
                         }
                         else {
                             autoReconnect = false;
                             logError("Error connecting (not trying to reconnect even if asked)", ex);
                         }
                     });
+
+
         }
     }
 

pandalib-ws-server/src/main/java/fr/pandacube/lib/ws/server/AbstractServerWS.java

@@ -61,7 +61,7 @@ public abstract class AbstractServerWS extends WebSocketAdapter implements Abstr
 	}
 
 	@Override
-	public final void sendClose(int code, String reason) throws IOException {
+	public final void sendClose(int code, String reason) {
 		getSession().close(code, reason);
 		isClosed = true;
 	}

pom.xml

@@ -55,11 +55,14 @@
         <maven.compiler.target>21</maven.compiler.target>
         <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
         
-        <bungeecord.version>1.21-R0.1-SNAPSHOT</bungeecord.version>
-        <paper.version>1.21.3-R0.1</paper.version>
-        <mc.version>1.21.3</mc.version>
+        <bungeecord.version>1.21-R0.4-SNAPSHOT</bungeecord.version>
+        <paper.version>1.21.8-R0.1</paper.version>
+        <mc.version>1.21.8</mc.version>
 
-        <guava.version>32.1.2-jre</guava.version> <!-- Match the version imported by Paper API/BungeeCord API if possible -->
+        <guava.version>33.3.1-jre</guava.version> <!-- Match the version imported by Paper API/BungeeCord API if possible -->
+        <gson.version>2.11.0</gson.version> <!-- Match the version imported by Paper API/BungeeCord API if possible -->
+        <brigadier.version>1.3.10</brigadier.version> <!-- Match the version imported by Paper API if possible -->
+        <datafixerupper.version>8.0.16</datafixerupper.version> <!-- Match the version used internally in Paper Server -->
     </properties>
 	
     <modules>