Compare commits

..

86 Commits

Author SHA1 Message Date
b42bbb4887 ItemStackAdapter for Json: removed backward compatibility of serialized data (was temporary during the server upgrade) 2025-07-20 00:22:41 +02:00
34809d4618 ItemStackAdapter for Json: fix again deserialization 2025-07-18 17:17:08 +02:00
843d9c3509 ItemStackAdapter for Json: deserialized json cannot contains both old and new data. When both are present (because old server needs the old one), keeping only the new data. 2025-07-18 17:09:30 +02:00
1716e0b5a8 ItemStackAdapter for Json: make the generated json compatible with pre 1.21.5 deserializer
-> temporary fix so the older servers does not throw an error when trying to deserialize (e.g. when using the lobby compass menu)
2025-07-18 16:53:22 +02:00
254b885648 Fix reflection for 1.21.7/8 (round 6) 2025-07-18 15:12:38 +02:00
e2c0098eb9 Fix reflection for 1.21.7/8 (round 5) 2025-07-18 14:37:12 +02:00
2fc3eb50f5 Added missing javadoc 2025-07-18 01:56:28 +02:00
fc44151f2b Fix reflection for 1.21.7/8 (round 4) 2025-07-18 01:52:17 +02:00
f8a7c5f1e7 Small dependency upgrade 2025-07-18 01:39:58 +02:00
a9ea8c3038 Fix reflection for 1.21.7/8 (round 3) 2025-07-18 01:37:57 +02:00
e611d06987 MC 1.21.8 2025-07-17 19:12:03 +02:00
638e57bb7f Fix reflection wrappers for 1.21.7 (round 2) 2025-07-17 14:41:44 +02:00
0009dd22cd Fix reflection wrappers for 1.21.7 2025-07-17 13:22:05 +02:00
79474b14d2 Make pandalib compile against Paper API 1.21.7 (prepare to full 1.21.7 update) 2025-07-14 22:31:55 +02:00
ee4812bdbb Adjust debugging message for command registration 2025-07-14 00:29:32 +02:00
7d2a5e7862 Fix another reflection wrapper inheritance 2025-07-14 00:26:04 +02:00
c09362c75e Fix reflection wrapper inheritance 2025-07-14 00:20:00 +02:00
457262049d Fix some reflection wrapping issues 2025-07-14 00:16:38 +02:00
ebbbc3a1f0 Fixes to support last Paper 1.21.4 build 2025-07-14 00:02:07 +02:00
8c0db895da Added MC 1.21.7 2025-07-01 21:39:39 +02:00
5943b10d16 Added MC 1.21.6 2025-06-21 18:14:18 +02:00
cda7ebadcc Updated Bungeecord version 2025-06-21 18:13:51 +02:00
dbdf1eeb7c Fix ItemStackBuilder#canBreak 2025-05-24 17:26:42 +02:00
500163d8f4 Spaces around hyphen of versions range in MinecraftVersionUtil#toString() 2025-04-05 00:14:06 +02:00
9374f8d280 Updated MC version json file 2025-04-04 00:29:52 +02:00
f5194334de Fix PerformanceAnalysisManager 2025-02-20 21:54:00 +01:00
21777d4b9e Fully use chat components in PerformanceAnalysisManager lag bar 2025-02-20 21:31:13 +01:00
3b4cf63c48 Updated Skull class handling custom heads. No more relying on MHF_* accounts 2025-02-17 00:30:38 +01:00
e2b2ab466d New RandomUtil method shuffleMap 2025-02-12 23:10:48 +01:00
50e21896ba Override VaultAPI Permission extra methods #playerAdd and @playerRemove to ignore the current player world when another plugin changes permissions 2025-02-06 23:19:06 +01:00
07af67b33f Less verbose client websocket when reconnecting 2025-01-20 00:00:14 +01:00
f4d0ccca51 Do not put the HttpClient of a persistent websocket into a try-with-resources 2025-01-19 23:30:56 +01:00
51bc0bd6e8 Removed unused reflected method. 2025-01-19 17:53:53 +01:00
c229b14779 ItemStackBuilder: make canPlaceOn and canBreak actually working (must use old deprecated API because the new API is not yet working) 2025-01-18 19:17:33 +01:00
49942b35da Add support for item data components in ItemStackBuilder 2025-01-17 00:50:15 +01:00
0ffe3198e6 Fixed hundreds of small issues, code improvements, typos, ... 2025-01-16 00:25:23 +01:00
ace34fc0e8 MC 1.21.4 + small fixes 2025-01-13 23:57:48 +01:00
27c444f3b4 test: adjusted BadCommandUsage javadoc 2025-01-11 23:52:18 +01:00
c589da2a14 mvn: updated papermc repo url 2025-01-11 23:27:38 +01:00
3fe4a1b244 Big Javadoc update + cleaned/refactored some code 2025-01-11 00:17:44 +01:00
1925dd9b36 Removed utility method to remove stacked entities (as Paper API now provides a way to teleport entities riding other entities) 2025-01-01 17:59:04 +01:00
d637b92f6c Fix deprecation in 1.21.3 API 2025-01-01 13:47:38 +01:00
af4bab0d12 1.21.3 API 2024-12-30 00:00:41 +01:00
44dc690736 Few javadoc update 2024-12-27 23:15:55 +01:00
c9af5ad308 New module pandalib-config 2024-12-27 23:15:37 +01:00
27403a6e20 Backup : ignore error when a source file has been deleted during the backup precess 2024-12-26 19:51:25 +01:00
38a42dcca0 Fix reflection again 2024-12-26 00:30:09 +01:00
5782046b7a Reduce verbosity on some reflection errors 2024-12-26 00:24:17 +01:00
2b407d7f27 Fix various reflection issues for Paper 1.21.1 2024-12-26 00:23:53 +01:00
8f5f880754 More complete Javadoc 2024-12-22 23:45:10 +01:00
3d92c3afb6 Update Paper API to 1.21.1 2024-12-22 19:48:21 +01:00
5e1f98ab70 Update MC version file with 1.21.4 2024-12-11 21:56:30 +01:00
276f5b2dc1 Added temporary workaround due to Paper/Brigadier API not keeping modifier and forks properties of command nodes 2024-11-24 16:49:22 +01:00
9c72b8cda4 Properly handle setting final fields in reflection API 2024-11-24 16:18:14 +01:00
ee023b5d2c Trying again to do some shady reflection stuff to fix a Paper issue.
Paper plugin should be able to register Brigadier commands that redirects to the root command node (similar to vanilla /execute run)
2024-11-23 00:11:16 +01:00
974347cbde Paper commands should be built right before registration into command dispatcher (so the root command node exists in case we need it) 2024-11-22 22:40:18 +01:00
e6b77bcad6 Updated JDBC connection string for Database connection
- Updated SSL setting
- Due to a weard bug with MySQL in Docker in WSL (Windows), added allowPublicKeyRetrieval=true
2024-10-02 00:05:35 +02:00
36eb1227cf Do not use bungeecord-chat as a dependency for pandalib-chat anymore 2024-07-28 01:04:34 +02:00
4be37945cb Replace google guava with lighter library for a specific map implementation. 2024-07-27 17:41:21 +02:00
3e6cf96040 GameWorld loading ony runs /mvm command when Multiverse plugin is present 2024-07-19 23:12:56 +02:00
d1a04a7a66 Proper exception handling when not able to load player data file 2024-07-19 00:23:12 +02:00
fcac9af7d1 Fix reflection in PlayerDataStorage + new wrapOptional method in reflection library 2024-07-17 23:24:13 +02:00
e16487431d Removed some debug messages 2024-07-10 23:15:33 +02:00
50f5ab671a Debug better the alias registration forcing 2024-07-10 22:28:47 +02:00
5a04052f8e Fix (again) command registering 2024-07-10 21:34:03 +02:00
c86855ac16 Fix (again) command registering 2024-07-10 21:13:32 +02:00
001239fe57 Fix command identity 2024-07-10 16:08:42 +02:00
0c7fb9b370 Some other fixes to command registration 2024-07-10 15:31:00 +02:00
f416e30d45 Better log info with commands 2024-07-10 14:04:05 +02:00
e271ac2964 Trying to fix the command registration process
Interact only with the brigadier command dispatcher, since the bukkit command map is backed by the brigadier dispatcher.
2024-07-10 13:23:48 +02:00
2bb09ad42b Trying to fix the post command registration process 2024-07-10 11:30:30 +02:00
4f55890092 Fix reflection in PaperBrigadier 2024-07-10 01:15:01 +02:00
76470b963e Trying to register our Brigadier commands by force if necessary 2024-07-10 01:04:05 +02:00
76fc673e98 New reflected class ShadowBrigNode 2024-07-09 21:55:31 +02:00
307b5132df Command should also register in place of vanilla (e.g. /list) 2024-07-07 15:50:16 +02:00
ac52e024f3 Fix potential StackOverflowException 2024-06-29 00:30:18 +02:00
bb6d221ced MC client 1.21 support 2024-06-27 21:19:00 +02:00
2acfa53b63 Use $ to reflect on inner classes 2024-06-26 23:59:07 +02:00
640b255e1d Bypass PaperReflectionHolder that try to understand our Mojang mapped reflection call as Spigot mapped 2024-06-26 23:10:13 +02:00
ed0db5391d Added missing @ConcreteWrapper 2024-06-15 13:29:41 +02:00
cef4af80f0 Update reflection in NMS/OBC 2024-06-15 13:15:50 +02:00
7f56645ba5 new FunctionException type 2024-06-12 23:32:13 +02:00
827c13887c Removed all NMS mapping stuff since paper jar is now mojang mapped 2024-06-12 23:31:54 +02:00
0ff2ae1296 Fix Brigadier command stuff in pandalib-paper 2024-06-09 22:48:54 +02:00
e7b528718c Update paper plugin to MC 1.20.6
- Convert Brigadier command to use the new Brigadier/Paper API
- EquipmentSlot now has BODY value for horses and wolves armor
- ItemMeta’ canPlaceOn and canDestroy does not work anymore. Removed the related methods from ItemStackBuilder
- Enchantment DURABILITY now has the proper vanilla name UNBREAKING
- Pandalib-chat now uses Adventure’s TranslationArgument
2024-06-07 00:05:07 +02:00
d411618e63 Fix Javadoc warnings due to Java 21 update (+ some other warnings)
The default implicit constructor must also have a doc comment, so I have to make it explicit and either properly restrict the visibility of the constructor, or actually document it.
2024-06-06 23:59:32 +02:00
248 changed files with 5020 additions and 4604 deletions

2
.gitignore vendored
View File

@@ -1,3 +1,5 @@
/.idea /.idea
/*/target /*/target
dependency-reduced-pom.xml dependency-reduced-pom.xml
*.iml

View File

@@ -9,17 +9,18 @@ that are detailed in their respective Readme file (if any).
- `pandalib-util` General purpose utility and helper classes; - `pandalib-util` General purpose utility and helper classes;
- `pandalib-chat` A chat API working on top of the Adventure API; - `pandalib-chat` A chat API working on top of the Adventure API;
- `pandalib-db` An ORM working with a MySQL server through JDBC; - `pandalib-db` An ORM working with a MySQL server through JDBC;
- `pandalib-bungee` Utility and helper classes to use in Bungeecord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`; - `pandalib-bungee` Utility and helper classes to use in BungeeCord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
- `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`; - `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
- `pandalib-reflect` A reflection wrapper to make reflective operation easier; - `pandalib-reflect` A reflection wrapper to make reflective operation easier;
- `pandalib-permissions` A general purpose permission system; - `pandalib-permissions` A general purpose permission system;
- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into Bungeecord; - `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into BungeeCord;
- `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems; - `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems;
- `pandalib-players` A library to handle classes representing online or offline players; - `pandalib-players` A library to handle classes representing online or offline players;
- `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`; - `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`;
- `pandalib-netapi` A poorly designed, but working TCP network library; - `pandalib-netapi` A poorly designed, but working TCP network library;
- `pandalib-config` Utility and helper classes to handle configuration related files and folders;
- `pandalib-commands` An abstract command manager working on top of [Brigadier](https://github.com/Mojang/brigadier); - `pandalib-commands` An abstract command manager working on top of [Brigadier](https://github.com/Mojang/brigadier);
- `pandalib-cli` Utility and helper classes for a standalone CLI Java application. - `pandalib-cli` Utility and helper classes for a standalone CLI Java application;
- `pandalib-core` A catch-all module for some helper classes that didn't have their own module yet; - `pandalib-core` A catch-all module for some helper classes that didn't have their own module yet;
### Use in your projects ### Use in your projects

1
pandalib-bungee-chat/.gitignore vendored Normal file
View File

@@ -0,0 +1 @@
/target/

View File

@@ -0,0 +1,44 @@
<?xml version="1.0" encoding="UTF-8"?>
<project xmlns="http://maven.apache.org/POM/4.0.0"
xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 https://maven.apache.org/xsd/maven-4.0.0.xsd">
<parent>
<artifactId>pandalib-parent</artifactId>
<groupId>fr.pandacube.lib</groupId>
<version>1.0-SNAPSHOT</version>
<relativePath>../pom.xml</relativePath>
</parent>
<modelVersion>4.0.0</modelVersion>
<artifactId>pandalib-bungee-chat</artifactId>
<packaging>jar</packaging>
<repositories>
<repository>
<id>bungeecord-repo</id>
<url>https://oss.sonatype.org/content/repositories/snapshots</url>
</repository>
</repositories>
<dependencies>
<dependency>
<groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-chat</artifactId>
<version>${project.version}</version>
</dependency>
<dependency>
<groupId>net.md-5</groupId>
<artifactId>bungeecord-chat</artifactId>
<version>${bungeecord.version}</version>
<scope>provided</scope>
</dependency>
<dependency>
<groupId>net.kyori</groupId>
<artifactId>adventure-platform-bungeecord</artifactId>
<version>4.3.0</version>
</dependency>
</dependencies>
</project>

View File

@@ -0,0 +1,77 @@
package fr.pandacube.lib.bungee.chat;
import fr.pandacube.lib.chat.Chat;
import fr.pandacube.lib.chat.Chat.FormattableChat;
import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
import net.md_5.bungee.api.chat.BaseComponent;
/**
* Utility class to ease conversion between our Adventure backed Chat API and BungeeCord chat API.
*/
public class ChatBungee {
/**
* Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent}.
* @param c the {@link BaseComponent}.
* @return a new {@link FormattableChat}.
*/
public static FormattableChat chatComponent(BaseComponent c) {
return Chat.chatComponent(toAdventure(c));
}
/**
* Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
* @param c the array of {@link BaseComponent}.
* @return a new {@link FormattableChat}.
*/
public static FormattableChat chatComponent(BaseComponent[] c) {
return Chat.chatComponent(toAdventure(c));
}
/**
* Converts the Bungee {@link BaseComponent} array into Adventure {@link Component}.
* @param components the Bungee {@link BaseComponent} array.
* @return a {@link Component}.
*/
public static Component toAdventure(BaseComponent[] components) {
return BungeeComponentSerializer.get().deserialize(components);
}
/**
* Converts the Bungee {@link BaseComponent} into Adventure {@link Component}.
* @param component the Bungee {@link BaseComponent}.
* @return a {@link Component}.
*/
public static Component toAdventure(BaseComponent component) {
return toAdventure(new BaseComponent[] { component });
}
/**
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent} array.
* @param component the Adventure {@link Component}.
* @return a {@link BaseComponent} array.
*/
public static BaseComponent[] toBungeeArray(ComponentLike component) {
return BungeeComponentSerializer.get().serialize(component.asComponent());
}
/**
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent}.
* @param component the Adventure {@link Component}.
* @return a {@link BaseComponent}.
*/
public static BaseComponent toBungee(ComponentLike component) {
BaseComponent[] arr = toBungeeArray(component);
return arr.length == 1 ? arr[0] : new net.md_5.bungee.api.chat.TextComponent(arr);
}
private ChatBungee() {}
}

View File

@@ -25,7 +25,6 @@ import java.util.function.Function;
*/ */
public class PandalibBungeePermissions implements Listener { public class PandalibBungeePermissions implements Listener {
/** /**
* Registers event listener to redirect permission checks to {@code pandalib-permissions}. * Registers event listener to redirect permission checks to {@code pandalib-permissions}.
* @param bungeePlugin a BungeeCord plugin. * @param bungeePlugin a BungeeCord plugin.
@@ -35,6 +34,8 @@ public class PandalibBungeePermissions implements Listener {
} }
private PandalibBungeePermissions() {}
/** /**
* Event handler called when a plugin asks if a player has a permission. * Event handler called when a plugin asks if a player has a permission.
* @param event the permission check event. * @param event the permission check event.

View File

@@ -33,7 +33,7 @@
</dependency> </dependency>
<dependency> <dependency>
<groupId>fr.pandacube.lib</groupId> <groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-chat</artifactId> <artifactId>pandalib-bungee-chat</artifactId>
<version>${project.version}</version> <version>${project.version}</version>
</dependency> </dependency>
<dependency> <dependency>

View File

@@ -1,7 +1,7 @@
package fr.pandacube.lib.bungee; package fr.pandacube.lib.bungee;
import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler; import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler;
import fr.pandacube.lib.bungee.util.PluginMessagePassthrough; import fr.pandacube.lib.bungee.util.PluginMessagePassThrough;
import net.md_5.bungee.api.plugin.Plugin; import net.md_5.bungee.api.plugin.Plugin;
/** /**
@@ -24,7 +24,7 @@ public class PandaLibBungee {
* Method to be called in {@link Plugin#onEnable()} method. * Method to be called in {@link Plugin#onEnable()} method.
*/ */
public static void onEnable() { public static void onEnable() {
PluginMessagePassthrough.init(plugin); PluginMessagePassThrough.init(plugin);
BungeeDailyLogRotateFileHandler.init(true); BungeeDailyLogRotateFileHandler.init(true);
} }
@@ -43,4 +43,7 @@ public class PandaLibBungee {
public static Plugin getPlugin() { public static Plugin getPlugin() {
return plugin; return plugin;
} }
private PandaLibBungee() {}
} }

View File

@@ -7,7 +7,7 @@ import java.util.ArrayList;
import java.util.List; import java.util.List;
/** /**
* Class that holds the configuration varables for {@link BungeeBackupManager}. * Class that holds the configuration variables for {@link BungeeBackupManager}.
*/ */
@SuppressWarnings("CanBeFinal") @SuppressWarnings("CanBeFinal")
public class BungeeBackupConfig { public class BungeeBackupConfig {
@@ -35,4 +35,11 @@ public class BungeeBackupConfig {
* A list of ignored files or directory in the workdir to exclude from the backup. * A list of ignored files or directory in the workdir to exclude from the backup.
*/ */
public List<String> workdirIgnoreList = new ArrayList<>(); public List<String> workdirIgnoreList = new ArrayList<>();
/**
* Creates a new {@link BungeeBackupConfig}.
*/
public BungeeBackupConfig() {
}
} }

View File

@@ -7,14 +7,14 @@ import fr.pandacube.lib.core.backup.RotatedLogsBackupProcess;
import java.io.File; import java.io.File;
/** /**
* Handles the backup processes for a Bungeecord instance. * Handles the backup processes for a BungeeCord instance.
*/ */
public class BungeeBackupManager extends BackupManager { public class BungeeBackupManager extends BackupManager {
BungeeBackupConfig config; BungeeBackupConfig config;
/** /**
* Instanciate a new {@link BungeeBackupManager}. * Creates a new {@link BungeeBackupManager}.
* @param config the configuration. * @param config the configuration.
*/ */
public BungeeBackupManager(BungeeBackupConfig config) { public BungeeBackupManager(BungeeBackupConfig config) {

View File

@@ -6,7 +6,7 @@ import java.io.File;
import java.util.function.BiPredicate; import java.util.function.BiPredicate;
/** /**
* The backup process responsible for the working directory of the current Bungeecord instance. * The backup process responsible for the working directory of the current BungeeCord instance.
*/ */
public class BungeeWorkdirProcess extends BackupProcess { public class BungeeWorkdirProcess extends BackupProcess {

View File

@@ -1,6 +1,6 @@
package fr.pandacube.lib.bungee.commands; package fr.pandacube.lib.bungee.commands;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.bungee.chat.ChatBungee;
import fr.pandacube.lib.commands.BrigadierDispatcher; import fr.pandacube.lib.commands.BrigadierDispatcher;
import net.kyori.adventure.text.ComponentLike; import net.kyori.adventure.text.ComponentLike;
import net.md_5.bungee.api.CommandSender; import net.md_5.bungee.api.CommandSender;
@@ -71,6 +71,6 @@ public class BungeeBrigadierDispatcher extends BrigadierDispatcher<CommandSender
@Override @Override
protected void sendSenderMessage(CommandSender sender, ComponentLike message) { protected void sendSenderMessage(CommandSender sender, ComponentLike message) {
sender.sendMessage(Chat.toBungee(message.asComponent())); sender.sendMessage(ChatBungee.toBungee(message.asComponent()));
} }
} }

View File

@@ -6,7 +6,7 @@ import net.md_5.bungee.api.connection.ProxiedPlayer;
import fr.pandacube.lib.players.standalone.AbstractOffPlayer; import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
/** /**
* Represents any player on a Bungeecord proxy, either offline or online. * Represents any player on a BungeeCord proxy, either offline or online.
*/ */
public interface BungeeOffPlayer extends AbstractOffPlayer { public interface BungeeOffPlayer extends AbstractOffPlayer {

View File

@@ -1,6 +1,6 @@
package fr.pandacube.lib.bungee.players; package fr.pandacube.lib.bungee.players;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.bungee.chat.ChatBungee;
import fr.pandacube.lib.core.mc_version.ProtocolVersion; import fr.pandacube.lib.core.mc_version.ProtocolVersion;
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer; import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
import fr.pandacube.lib.reflect.Reflect; import fr.pandacube.lib.reflect.Reflect;
@@ -20,7 +20,7 @@ import net.md_5.bungee.protocol.packet.PluginMessage;
import java.util.Locale; import java.util.Locale;
/** /**
* Represents any online player on a Bungeecord proxy. * Represents any online player on a BungeeCord proxy.
*/ */
public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer { public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer {
@@ -84,13 +84,13 @@ public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlaye
@Override @Override
default void sendMessage(Component message) { default void sendMessage(Component message) {
getBungeeProxiedPlayer().sendMessage(Chat.toBungee(message)); getBungeeProxiedPlayer().sendMessage(ChatBungee.toBungee(message));
} }
@Override @Override
default void sendTitle(Component title, Component subtitle, int fadeIn, int stay, int fadeOut) { default void sendTitle(Component title, Component subtitle, int fadeIn, int stay, int fadeOut) {
ProxyServer.getInstance().createTitle() ProxyServer.getInstance().createTitle()
.title(Chat.toBungee(title)).subTitle(Chat.toBungee(subtitle)) .title(ChatBungee.toBungee(title)).subTitle(ChatBungee.toBungee(subtitle))
.fadeIn(fadeIn).stay(stay).fadeOut(fadeOut) .fadeIn(fadeIn).stay(stay).fadeOut(fadeOut)
.send(getBungeeProxiedPlayer()); .send(getBungeeProxiedPlayer());
} }

View File

@@ -19,16 +19,16 @@ import net.md_5.bungee.event.EventHandler;
* <p> * <p>
* Usage example, in your plugin init code: * Usage example, in your plugin init code:
* <pre>{@code * <pre>{@code
* PluginMessagePassthrough.init(yourPluginInstance); * PluginMessagePassThrough.init(yourPluginInstance);
* PluginMessagePassthrough.register("worldedit:cui"); // plugin message used by WorldEdit * PluginMessagePassThrough.register("worldedit:cui"); // plugin message used by WorldEdit
* }</pre> * }</pre>
*/ */
public class PluginMessagePassthrough implements Listener { public class PluginMessagePassThrough implements Listener {
private static final List<String> channels = Collections.synchronizedList(new ArrayList<>()); private static final List<String> channels = Collections.synchronizedList(new ArrayList<>());
private static final PluginMessagePassthrough instance = new PluginMessagePassthrough(); private static final PluginMessagePassThrough instance = new PluginMessagePassThrough();
/** /**
* Initialize the {@link PluginMessagePassthrough}. * Initialize the {@link PluginMessagePassThrough}.
* It registers the required event listener. * It registers the required event listener.
* @param plugin the plugin instance. * @param plugin the plugin instance.
*/ */
@@ -92,7 +92,7 @@ public class PluginMessagePassthrough implements Listener {
} }
private PluginMessagePassthrough() { } private PluginMessagePassThrough() { }
/** /**

View File

@@ -30,8 +30,13 @@
</dependency> </dependency>
<dependency> <dependency>
<groupId>net.kyori</groupId> <groupId>net.kyori</groupId>
<artifactId>adventure-platform-bungeecord</artifactId> <artifactId>adventure-text-serializer-gson</artifactId>
<version>4.3.0</version> <version>4.13.0</version>
</dependency>
<dependency>
<groupId>net.kyori</groupId>
<artifactId>adventure-text-serializer-legacy</artifactId>
<version>4.13.0</version>
</dependency> </dependency>
<dependency> <dependency>
<groupId>net.kyori</groupId> <groupId>net.kyori</groupId>
@@ -46,17 +51,10 @@
<dependency>
<groupId>net.md-5</groupId>
<artifactId>bungeecord-chat</artifactId>
<version>${bungeecord.version}</version>
<scope>compile</scope>
</dependency>
<dependency> <dependency>
<groupId>com.google.code.gson</groupId> <groupId>com.google.code.gson</groupId>
<artifactId>gson</artifactId> <artifactId>gson</artifactId>
<version>2.10.1</version> <version>${gson.version}</version>
</dependency> </dependency>
</dependencies> </dependencies>

View File

@@ -5,6 +5,8 @@ import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentBuilder; import net.kyori.adventure.text.ComponentBuilder;
import net.kyori.adventure.text.ComponentLike; import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.TextComponent; import net.kyori.adventure.text.TextComponent;
import net.kyori.adventure.text.TranslationArgument;
import net.kyori.adventure.text.TranslationArgumentLike;
import net.kyori.adventure.text.event.ClickEvent; import net.kyori.adventure.text.event.ClickEvent;
import net.kyori.adventure.text.event.HoverEvent; import net.kyori.adventure.text.event.HoverEvent;
import net.kyori.adventure.text.event.HoverEventSource; import net.kyori.adventure.text.event.HoverEventSource;
@@ -14,15 +16,13 @@ import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.format.TextDecoration; import net.kyori.adventure.text.format.TextDecoration;
import net.kyori.adventure.text.format.TextDecoration.State; import net.kyori.adventure.text.format.TextDecoration.State;
import net.kyori.adventure.text.minimessage.MiniMessage; import net.kyori.adventure.text.minimessage.MiniMessage;
import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
import net.kyori.adventure.text.serializer.gson.GsonComponentSerializer; import net.kyori.adventure.text.serializer.gson.GsonComponentSerializer;
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer; import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
import net.kyori.adventure.text.serializer.plain.PlainTextComponentSerializer; import net.kyori.adventure.text.serializer.plain.PlainTextComponentSerializer;
import net.md_5.bungee.api.ChatColor;
import net.md_5.bungee.api.chat.BaseComponent;
import org.jetbrains.annotations.NotNull; import org.jetbrains.annotations.NotNull;
import java.awt.*; import java.awt.*;
import java.util.Locale;
import java.util.Objects; import java.util.Objects;
import java.util.function.Consumer; import java.util.function.Consumer;
import java.util.function.UnaryOperator; import java.util.function.UnaryOperator;
@@ -35,8 +35,8 @@ import java.util.function.UnaryOperator;
* This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in * This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
* Adventure API and its implementation without using the final methods of this builder. * Adventure API and its implementation without using the final methods of this builder.
* <p> * <p>
* The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the * The unique possible concrete subclass of this class, {@link FormattableChat}, takes care of the formatting of the
* built component. The rationale for this design is explained in the documentation of {@link FormatableChat}. * built component. The rationale for this design is explained in the documentation of {@link FormattableChat}.
*/ */
public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike { public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
@@ -65,26 +65,10 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* Builds the component into Adventure Component instance. * Builds the component into Adventure Component instance.
* @return the {@link Component} built from this {@link Chat} component. * @return the {@link Component} built from this {@link Chat} component.
*/ */
public Component getAdv() { public Component get() {
return builder.build(); return builder.build();
} }
/**
* Builds the component into BungeeCord {@link BaseComponent} instance.
* @return the {@link BaseComponent} built from this {@link Chat} component.
*/
public BaseComponent get() {
return toBungee(getAdv());
}
/**
* Builds the component into BungeeCord {@link BaseComponent} array.
* @return the {@link BaseComponent} array built from this {@link Chat} component.
*/
public BaseComponent[] getAsArray() {
return toBungeeArray(getAdv());
}
private static final LegacyComponentSerializer LEGACY_SERIALIZER_BUNGEE_FRIENDLY = LegacyComponentSerializer.builder() private static final LegacyComponentSerializer LEGACY_SERIALIZER_BUNGEE_FRIENDLY = LegacyComponentSerializer.builder()
.hexColors() .hexColors()
.useUnusualXRepeatedCharacterHexFormat() .useUnusualXRepeatedCharacterHexFormat()
@@ -95,7 +79,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @return the legacy text. RGB colors are in BungeeCord format. * @return the legacy text. RGB colors are in BungeeCord format.
*/ */
public String getLegacyText() { public String getLegacyText() {
return LEGACY_SERIALIZER_BUNGEE_FRIENDLY.serialize(getAdv()); return LEGACY_SERIALIZER_BUNGEE_FRIENDLY.serialize(get());
} }
/** /**
@@ -103,12 +87,12 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @return the plain text of this component. * @return the plain text of this component.
*/ */
public String getPlainText() { public String getPlainText() {
return PlainTextComponentSerializer.plainText().serializeOr(getAdv(), ""); return PlainTextComponentSerializer.plainText().serializeOr(get(), "");
} }
@Override @Override
public @NotNull HoverEvent<Component> asHoverEvent(@NotNull UnaryOperator<Component> op) { public @NotNull HoverEvent<Component> asHoverEvent(@NotNull UnaryOperator<Component> op) {
return HoverEvent.showText(op.apply(getAdv())); return HoverEvent.showText(op.apply(get()));
} }
/** /**
@@ -117,7 +101,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
*/ */
@Override @Override
public @NotNull Component asComponent() { public @NotNull Component asComponent() {
return getAdv(); return get();
} }
/** /**
@@ -125,7 +109,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @return the {@link Component} built from this {@link Chat} component, with down-sampled colors. * @return the {@link Component} built from this {@link Chat} component, with down-sampled colors.
*/ */
public Component getAsDownSampledColorsComponent() { public Component getAsDownSampledColorsComponent() {
String json = GsonComponentSerializer.colorDownsamplingGson().serialize(getAdv()); String json = GsonComponentSerializer.colorDownsamplingGson().serialize(get());
return GsonComponentSerializer.gson().deserialize(json); return GsonComponentSerializer.gson().deserialize(json);
} }
@@ -142,7 +126,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @return the MiniMessage representation if this {@link Chat} component. * @return the MiniMessage representation if this {@link Chat} component.
*/ */
public String getMiniMessage() { public String getMiniMessage() {
return MiniMessage.miniMessage().serialize(getAdv()); return MiniMessage.miniMessage().serialize(get());
} }
@@ -182,15 +166,6 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
return this; return this;
} }
/**
* Appends a BungeeCord {@link BaseComponent} to this component.
* @param comp the component to append.
* @return this.
*/
public Chat then(BaseComponent comp) {
return then(toAdventure(comp));
}
/** /**
* Appends a component to this component. * Appends a component to this component.
* @param comp the component to append. * @param comp the component to append.
@@ -205,15 +180,6 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
return then(comp.asComponent()); return then(comp.asComponent());
} }
/**
* Appends a BungeeCord {@link BaseComponent} array to this component.
* @param comp the components to append.
* @return this.
*/
public Chat then(BaseComponent[] comp) {
return then(toAdventure(comp));
}
@@ -330,7 +296,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param key the keybinding to display. * @param key the keybinding to display.
* @return this. * @return this.
*/ */
public Chat thenKeyBind(String key) { return then(keybind(key)); } public Chat thenKeyBind(String key) { return then(keyBind(key)); }
/** /**
* Appends a component with the provided score name and objective. * Appends a component with the provided score name and objective.
@@ -488,69 +454,34 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* Appends a component filling a chat line with the configured decoration character and * Appends a component filling a chat line with the configured decoration character and
* color and a left-aligned text. * color and a left-aligned text.
* @param leftText the text aligned to the left. * @param leftText the text aligned to the left.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a left-aligned text. * and color and a left-aligned text.
*/ */
public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); } public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
/**
* Appends a component filling a chat line with the configured decoration character and
* color and a left-aligned text.
* @param leftText the text aligned to the left.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
* and color and a left-aligned text.
* @deprecated uses Bungeecord chat API.
*/
@Deprecated
public Chat thenLeftText(BaseComponent leftText) { return thenLeftText(chatComponent(leftText)); }
/** /**
* Appends a component filling a chat line with the configured decoration character and * Appends a component filling a chat line with the configured decoration character and
* color and a right-aligned text. * color and a right-aligned text.
* @param rightText the text aligned to the right. * @param rightText the text aligned to the right.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a right-aligned text. * and color and a right-aligned text.
*/ */
public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); } public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
/**
* Appends a component filling a chat line with the configured decoration character and
* color and a right-aligned text.
* @param rightText the text aligned to the right.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
* and color and a right-aligned text.
* @deprecated uses Bungeecord chat API.
*/
@Deprecated
public Chat thenRightText(BaseComponent rightText) { return thenRightText(chatComponent(rightText)); }
/** /**
* Appends a component filling a chat line with the configured decoration character and * Appends a component filling a chat line with the configured decoration character and
* color and a centered text. * color and a centered text.
* @param centerText the text aligned to the center. * @param centerText the text aligned to the center.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a centered text. * and color and a centered text.
*/ */
public Chat thenCenterText(ComponentLike centerText) { public Chat thenCenterText(ComponentLike centerText) {
return then(centerText(centerText, console)); return then(centerText(centerText, console));
} }
/**
* Appends a component filling a chat line with the configured decoration character and
* color and a centered text.
* @param centerText the text aligned to the center.
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
* and color and a centered text.
* @deprecated uses Bungeecord chat API.
*/
@Deprecated
public Chat thenCenterText(BaseComponent centerText) {
return thenCenterText(chatComponent(centerText));
}
/** /**
* Appends a component filling a chat line with the configured decoration character and color. * Appends a component filling a chat line with the configured decoration character and color.
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color. * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
*/ */
public Chat thenFilledLine() { return then(filledLine(console)); } public Chat thenFilledLine() { return then(filledLine(console)); }
@@ -589,10 +520,10 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* .thenText("!"); // short for .then(Chat.text("!")) * .thenText("!"); // short for .then(Chat.text("!"))
* // the red color for "!" is not needed because the parent component is already red. * // the red color for "!" is not needed because the parent component is already red.
* }</pre> * }</pre>
* When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast * When calling {@link #then(Component) #then(...)} on a {@link FormattableChat}, the method returns itself, cast
* to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended * to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
* subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed * subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
* class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again. * class which only subclass is {@link FormattableChat}, you can cast the builder, and use the format methods again.
* <pre>{@code * <pre>{@code
* Chat component = Chat.text("Hello ").red() * Chat component = Chat.text("Hello ").red()
* .then(Chat.text("world").darkRed().bold()) * .then(Chat.text("world").darkRed().bold())
@@ -601,8 +532,8 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* ((FormatableChat)component).underlined(); // this will not format only the last appended text. * ((FormatableChat)component).underlined(); // this will not format only the last appended text.
* }</pre> * }</pre>
*/ */
public static final class FormatableChat extends Chat { public static final class FormattableChat extends Chat {
/* package */ FormatableChat(ComponentBuilder<?, ?> c) { /* package */ FormattableChat(ComponentBuilder<?, ?> c) {
super(c); super(c);
} }
@@ -612,177 +543,180 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param c true for console, false for game UI. * @param c true for console, false for game UI.
* @return this. * @return this.
*/ */
public FormatableChat console(boolean c) { console = c; return this; } public FormattableChat console(boolean c) { console = c; return this; }
/** /**
* Configure the width of the line. * Configure the width of the line.
* @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for * @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
* console rendering. * console rendering.
* @return this. * @return this.
*/ */
public FormatableChat maxWidth(int w) { maxWidth = w; return this; } public FormattableChat maxWidth(int w) { maxWidth = w; return this; }
/** /**
* Sets the color of this component. * Sets the color of this component.
* @param c the color. * @param c the color.
* @return this. * @return this.
*/ */
public FormatableChat color(TextColor c) { builder.color(c); return this; } public FormattableChat color(TextColor c) { builder.color(c); return this; }
/** /**
* Sets the color of this component. * Sets the color of this component.
* @param c the color. * @param c the color.
* @return this. * @return this.
*/ */
public FormatableChat color(ChatColor c) { return color(c == null ? null : TextColor.color(c.getColor().getRGB())); } public FormattableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
/** /**
* Sets the color of this component. * Sets the color of this component.
* @param c the color. * @param c the color.
* @return this. * @return this.
*/ */
public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); } public FormattableChat color(String c) {
/** if (c == null)
* Sets the color of this component. return color((TextColor) null);
* @param c the color. TextColor tc = c.startsWith("#")
* @return this. ? TextColor.fromCSSHexString(c)
*/ : NamedTextColor.NAMES.value(c.toLowerCase(Locale.ROOT));
public FormatableChat color(String c) { return color(c == null ? null : ChatColor.of(c)); } if (tc == null)
throw new IllegalArgumentException("Invalid color string '" + c + "'.");
return color(tc);
}
/** /**
* Sets the color of this component to {@link NamedTextColor#BLACK}. * Sets the color of this component to {@link NamedTextColor#BLACK}.
* @return this. * @return this.
*/ */
public FormatableChat black() { return color(NamedTextColor.BLACK); } public FormattableChat black() { return color(NamedTextColor.BLACK); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_BLUE}. * Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
* @return this. * @return this.
*/ */
public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); } public FormattableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_GREEN}. * Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
* @return this. * @return this.
*/ */
public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); } public FormattableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_AQUA}. * Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
* @return this. * @return this.
*/ */
public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); } public FormattableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_RED}. * Sets the color of this component to {@link NamedTextColor#DARK_RED}.
* @return this. * @return this.
*/ */
public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); } public FormattableChat darkRed() { return color(NamedTextColor.DARK_RED); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}. * Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
* @return this. * @return this.
*/ */
public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); } public FormattableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#GOLD}. * Sets the color of this component to {@link NamedTextColor#GOLD}.
* @return this. * @return this.
*/ */
public FormatableChat gold() { return color(NamedTextColor.GOLD); } public FormattableChat gold() { return color(NamedTextColor.GOLD); }
/** /**
* Sets the color of this component to {@link NamedTextColor#GRAY}. * Sets the color of this component to {@link NamedTextColor#GRAY}.
* @return this. * @return this.
*/ */
public FormatableChat gray() { return color(NamedTextColor.GRAY); } public FormattableChat gray() { return color(NamedTextColor.GRAY); }
/** /**
* Sets the color of this component to {@link NamedTextColor#DARK_GRAY}. * Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
* @return this. * @return this.
*/ */
public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); } public FormattableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
/** /**
* Sets the color of this component to {@link NamedTextColor#BLUE}. * Sets the color of this component to {@link NamedTextColor#BLUE}.
* @return this. * @return this.
*/ */
public FormatableChat blue() { return color(NamedTextColor.BLUE); } public FormattableChat blue() { return color(NamedTextColor.BLUE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#GREEN}. * Sets the color of this component to {@link NamedTextColor#GREEN}.
* @return this. * @return this.
*/ */
public FormatableChat green() { return color(NamedTextColor.GREEN); } public FormattableChat green() { return color(NamedTextColor.GREEN); }
/** /**
* Sets the color of this component to {@link NamedTextColor#AQUA}. * Sets the color of this component to {@link NamedTextColor#AQUA}.
* @return this. * @return this.
*/ */
public FormatableChat aqua() { return color(NamedTextColor.AQUA); } public FormattableChat aqua() { return color(NamedTextColor.AQUA); }
/** /**
* Sets the color of this component to {@link NamedTextColor#RED}. * Sets the color of this component to {@link NamedTextColor#RED}.
* @return this. * @return this.
*/ */
public FormatableChat red() { return color(NamedTextColor.RED); } public FormattableChat red() { return color(NamedTextColor.RED); }
/** /**
* Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}. * Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
* @return this. * @return this.
*/ */
public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); } public FormattableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
/** /**
* Sets the color of this component to {@link NamedTextColor#YELLOW}. * Sets the color of this component to {@link NamedTextColor#YELLOW}.
* @return this. * @return this.
*/ */
public FormatableChat yellow() { return color(NamedTextColor.YELLOW); } public FormattableChat yellow() { return color(NamedTextColor.YELLOW); }
/** /**
* Sets the color of this component to {@link NamedTextColor#WHITE}. * Sets the color of this component to {@link NamedTextColor#WHITE}.
* @return this. * @return this.
*/ */
public FormatableChat white() { return color(NamedTextColor.WHITE); } public FormattableChat white() { return color(NamedTextColor.WHITE); }
/** /**
* Sets the color of this component to {@link ChatConfig#successColor}. * Sets the color of this component to {@link ChatConfig#successColor}.
* @return this. * @return this.
*/ */
public FormatableChat successColor() { return color(ChatConfig.successColor); } public FormattableChat successColor() { return color(ChatConfig.successColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#failureColor}. * Sets the color of this component to {@link ChatConfig#failureColor}.
* @return this. * @return this.
*/ */
public FormatableChat failureColor() { return color(ChatConfig.failureColor); } public FormattableChat failureColor() { return color(ChatConfig.failureColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#infoColor}. * Sets the color of this component to {@link ChatConfig#infoColor}.
* @return this. * @return this.
*/ */
public FormatableChat infoColor() { return color(ChatConfig.infoColor); } public FormattableChat infoColor() { return color(ChatConfig.infoColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#warningColor}. * Sets the color of this component to {@link ChatConfig#warningColor}.
* @return this. * @return this.
*/ */
public FormatableChat warningColor() { return color(ChatConfig.warningColor); } public FormattableChat warningColor() { return color(ChatConfig.warningColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#dataColor}. * Sets the color of this component to {@link ChatConfig#dataColor}.
* @return this. * @return this.
*/ */
public FormatableChat dataColor() { return color(ChatConfig.dataColor); } public FormattableChat dataColor() { return color(ChatConfig.dataColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#decorationColor}. * Sets the color of this component to {@link ChatConfig#decorationColor}.
* @return this. * @return this.
*/ */
public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); } public FormattableChat decorationColor() { return color(ChatConfig.decorationColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#urlColor}. * Sets the color of this component to {@link ChatConfig#urlColor}.
* @return this. * @return this.
*/ */
public FormatableChat urlColor() { return color(ChatConfig.urlColor); } public FormattableChat urlColor() { return color(ChatConfig.urlColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#commandColor}. * Sets the color of this component to {@link ChatConfig#commandColor}.
* @return this. * @return this.
*/ */
public FormatableChat commandColor() { return color(ChatConfig.commandColor); } public FormattableChat commandColor() { return color(ChatConfig.commandColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#highlightedCommandColor}. * Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
* @return this. * @return this.
*/ */
public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); } public FormattableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
/** /**
* Sets the color of this component to {@link ChatConfig#broadcastColor}. * Sets the color of this component to {@link ChatConfig#broadcastColor}.
* @return this. * @return this.
*/ */
public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); } public FormattableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; } private FormattableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
private FormatableChat setDecoration(TextDecoration deco, Boolean state) { private FormattableChat setDecoration(TextDecoration deco, Boolean state) {
return setStyle(b -> b.decoration(deco, State.byBoolean(state))); return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
} }
@@ -792,56 +726,56 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param b true to enable, false to disable, or null to inherit from parent. * @param b true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); } public FormattableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
/** /**
* Enables the bold status of this component. * Enables the bold status of this component.
* @return this. * @return this.
*/ */
public FormatableChat bold() { return bold(true); } public FormattableChat bold() { return bold(true); }
/** /**
* Sets the italic status of this component. * Sets the italic status of this component.
* @param i true to enable, false to disable, or null to inherit from parent. * @param i true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); } public FormattableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
/** /**
* Enables the italic status of this component. * Enables the italic status of this component.
* @return this. * @return this.
*/ */
public FormatableChat italic() { return italic(true); } public FormattableChat italic() { return italic(true); }
/** /**
* Sets the underlined status of this component. * Sets the underlined status of this component.
* @param u true to enable, false to disable, or null to inherit from parent. * @param u true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); } public FormattableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
/** /**
* Enables the underlined status of this component. * Enables the underlined status of this component.
* @return this. * @return this.
*/ */
public FormatableChat underlined() { return underlined(true); } public FormattableChat underlined() { return underlined(true); }
/** /**
* Sets the strikethrough status of this component. * Sets the strikethrough status of this component.
* @param s true to enable, false to disable, or null to inherit from parent. * @param s true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); } public FormattableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
/** /**
* Enables the strikethrough status of this component. * Enables the strikethrough status of this component.
* @return this. * @return this.
*/ */
public FormatableChat strikethrough() { return strikethrough(true); } public FormattableChat strikethrough() { return strikethrough(true); }
/** /**
* Sets the obfuscated status of this component. * Sets the obfuscated status of this component.
* @param o true to enable, false to disable, or null to inherit from parent. * @param o true to enable, false to disable, or null to inherit from parent.
* @return this. * @return this.
*/ */
public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); } public FormattableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
/** /**
* Enables the obfuscated status of this component. * Enables the obfuscated status of this component.
* @return this. * @return this.
*/ */
public FormatableChat obfuscated() { return obfuscated(true); } public FormattableChat obfuscated() { return obfuscated(true); }
/** /**
@@ -849,7 +783,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param f the font namespaced key. * @param f the font namespaced key.
* @return this. * @return this.
*/ */
public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); } public FormattableChat font(Key f) { return setStyle(s -> s.font(f)); }
/** /**
@@ -857,7 +791,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param i the text to insert. * @param i the text to insert.
* @return this. * @return this.
*/ */
public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; } public FormattableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
/** /**
@@ -865,37 +799,37 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param e the {@link ClickEvent}. * @param e the {@link ClickEvent}.
* @return this. * @return this.
*/ */
private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; } private FormattableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
/** /**
* Configure this component to execute the specified command when clicked. * Configure this component to execute the specified command when clicked.
* @param cmdWithSlash the command to execute. * @param cmdWithSlash the command to execute.
* @return this. * @return this.
*/ */
public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); } public FormattableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
/** /**
* Configure this component to insert in the chat-box the specified command when clicked. * Configure this component to insert in the chat-box the specified command when clicked.
* @param cmdWithSlash the command to suggest. * @param cmdWithSlash the command to suggest.
* @return this. * @return this.
*/ */
public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); } public FormattableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
/** /**
* Configure this component to copy into clipboard the specified text when clicked. * Configure this component to copy into clipboard the specified text when clicked.
* @param value the text to copy. * @param value the text to copy.
* @return this. * @return this.
*/ */
public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); } public FormattableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
/** /**
* Configure this component to open the specified URL when clicked. * Configure this component to open the specified URL when clicked.
* @param url the URL to open. * @param url the URL to open.
* @return this. * @return this.
*/ */
public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); } public FormattableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
/** /**
* Configure this component to change the page of the opened book when clicked. * Configure this component to change the page of the opened book when clicked.
* @param page the page to go to. * @param page the page to go to.
* @return this. * @return this.
*/ */
public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); } public FormattableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
/** /**
@@ -903,43 +837,31 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
* @param e the {@link HoverEventSource}. * @param e the {@link HoverEventSource}.
* @return this. * @return this.
*/ */
public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; } public FormattableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
/** /**
* Configure this component to show the provided component when hovered. * Configure this component to show the provided component when hovered.
* @param v the component to show. * @param v the component to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); } public FormattableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
/** /**
* Configure this component to show the provided component when hovered. * Configure this component to show the provided component when hovered.
* @param v the component to show. * @param v the component to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); } public FormattableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
/** /**
* Configure this component to show the provided component when hovered. * Configure this component to show the provided component when hovered.
* @param v the component to show. * @param v the component to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); } public FormattableChat hover(ComponentLike v) { return hover(v.asComponent()); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(BaseComponent v) { return hover(toAdventure(v)); }
/**
* Configure this component to show the provided component when hovered.
* @param v the component to show.
* @return this.
*/
public FormatableChat hover(BaseComponent[] v) { return hover(toAdventure(v)); }
/** /**
* Configure this component to show the provided legacy text when hovered. * Configure this component to show the provided legacy text when hovered.
* @param legacyText the legacy text to show. * @param legacyText the legacy text to show.
* @return this. * @return this.
*/ */
public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); } public FormattableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
} }
@@ -961,7 +883,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
@Override @Override
public int hashCode() { public int hashCode() {
return getAdv().hashCode(); return get().hashCode();
} }
@Override @Override
@@ -972,71 +894,52 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
/* package */ static ComponentLike filterObjToComponentLike(Object v) {
return switch (v) {
case ComponentLike componentLike -> componentLike;
case null, default -> Component.text(Objects.toString(v));
};
}
/* package */ static ComponentLike[] filterObjToComponentLike(Object[] values) { /* package */ static ComponentLike[] filterObjToComponentLike(Object[] values) {
if (values == null) if (values == null)
return null; return null;
ComponentLike[] ret = new ComponentLike[values.length]; ComponentLike[] ret = new ComponentLike[values.length];
for (int i = 0; i < values.length; i++) { for (int i = 0; i < values.length; i++) {
Object v = values[i]; ret[i] = filterObjToComponentLike(values[i]);
if (v instanceof BaseComponent[])
ret[i] = toAdventure((BaseComponent[]) v);
else if (v instanceof BaseComponent)
ret[i] = toAdventure((BaseComponent) v);
else if (v instanceof ComponentLike)
ret[i] = (ComponentLike) v;
else
ret[i] = Component.text(Objects.toString(v));
} }
return ret; return ret;
} }
/** /* package */ static TranslationArgumentLike[] filterObjToTranslationArgumentLike(Object[] values) {
* Converts the Bungee {@link BaseComponent} array into Adventure {@link Component}. if (values == null)
* @param components the Bungee {@link BaseComponent} array. return null;
* @return a {@link Component}. TranslationArgumentLike[] ret = new TranslationArgumentLike[values.length];
*/ for (int i = 0; i < values.length; i++) {
public static Component toAdventure(BaseComponent[] components) { Object v = values[i];
return BungeeComponentSerializer.get().deserialize(components); if (v instanceof Number n)
ret[i] = TranslationArgument.numeric(n);
else if (v instanceof Boolean b)
ret[i] = TranslationArgument.bool(b);
else
ret[i] = TranslationArgument.component(filterObjToComponentLike(values[i]));
} }
/** return ret;
* Converts the Bungee {@link BaseComponent} into Adventure {@link Component}.
* @param component the Bungee {@link BaseComponent}.
* @return a {@link Component}.
*/
public static Component toAdventure(BaseComponent component) {
return toAdventure(new BaseComponent[] { component });
} }
/**
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent} array.
* @param component the Adventure {@link Component}.
* @return a {@link BaseComponent} array.
*/
public static BaseComponent[] toBungeeArray(Component component) {
return BungeeComponentSerializer.get().serialize(component);
}
/**
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent}.
* @param component the Adventure {@link Component}.
* @return a {@link BaseComponent}.
*/
public static BaseComponent toBungee(Component component) {
BaseComponent[] arr = toBungeeArray(component);
return arr.length == 1 ? arr[0] : new net.md_5.bungee.api.chat.TextComponent(arr);
}
/** /**
* Force the italic formatting to be set to false if it is not explicitly set in the component. * Force the italic formatting to be set to false if it is not explicitly set in the component.
* This is useful for item lores that defaults to italic in the game UI. * This is useful for item lore that defaults to italic in the game UI.
* @param c the {@link Chat} in which to set the italic property if needed. * @param c the {@link Chat} in which to set the italic property if needed.
* @return the provided {@link Chat} instance. * @return the provided {@link Chat} instance.
*/ */
public static Chat italicFalseIfNotSet(Chat c) { public static Chat italicFalseIfNotSet(Chat c) {
c.builder.style(b -> { c.builder.style(b -> {
if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) { if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
((FormatableChat) c).italic(false); ((FormattableChat) c).italic(false);
} }
}); });
return c; return c;

View File

@@ -10,6 +10,7 @@ import org.jetbrains.annotations.NotNull;
* A custom gradient with at least 2 colors in it. * A custom gradient with at least 2 colors in it.
*/ */
public class ChatColorGradient { public class ChatColorGradient {
private record GradientColor( private record GradientColor(
float location, float location,
TextColor color TextColor color
@@ -22,6 +23,11 @@ public class ChatColorGradient {
private final List<GradientColor> colors = new ArrayList<>(); private final List<GradientColor> colors = new ArrayList<>();
/**
* Create the custom gradient.
*/
public ChatColorGradient() {}
/** /**
* Put a specific color at a specific location in the gradient. * Put a specific color at a specific location in the gradient.
* @param gradientLocation the location in the gradient. * @param gradientLocation the location in the gradient.
@@ -43,7 +49,7 @@ public class ChatColorGradient {
if (colors.isEmpty()) if (colors.isEmpty())
throw new IllegalStateException("Must define at least one color in this ChatColorGradient instance."); throw new IllegalStateException("Must define at least one color in this ChatColorGradient instance.");
if (colors.size() == 1) if (colors.size() == 1)
return colors.get(0).color(); return colors.getFirst().color();
int i = 0; int i = 0;
for (; i < colors.size(); i++) { for (; i < colors.size(); i++) {
@@ -54,7 +60,7 @@ public class ChatColorGradient {
if (i == 0) if (i == 0)
return colors.get(i).color(); return colors.get(i).color();
if (i == colors.size()) if (i == colors.size())
return colors.get(colors.size() - 1).color(); return colors.getLast().color();
int p = i - 1; int p = i - 1;
float pLoc = colors.get(p).location(); float pLoc = colors.get(p).location();

View File

@@ -1,14 +1,14 @@
package fr.pandacube.lib.chat; package fr.pandacube.lib.chat;
import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.format.TextDecoration;
import net.kyori.adventure.text.format.TextFormat;
import net.kyori.adventure.util.RGBLike;
import java.util.regex.Pattern; import java.util.regex.Pattern;
import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.util.RGBLike;
import net.md_5.bungee.api.ChatColor;
/** /**
* Provides methods to manipulate legacy colors and {@link ChatColor} class. * Provides methods to manipulate legacy colors.
*/ */
public class ChatColorUtil { public class ChatColorUtil {
@@ -38,12 +38,12 @@ public class ChatColorUtil {
int length = legacyText.length(); int length = legacyText.length();
for (int index = length - 2; index >= 0; index--) { for (int index = length - 2; index >= 0; index--) {
if (legacyText.charAt(index) == ChatColor.COLOR_CHAR) { if (legacyText.charAt(index) == LegacyChatFormat.COLOR_CHAR) {
// detection of rgb color §x§0§1§2§3§4§5 // detection of rgb color §x§0§1§2§3§4§5
String rgb; String rgb;
if (index > 11 if (index > 11
&& legacyText.charAt(index - 12) == ChatColor.COLOR_CHAR && legacyText.charAt(index - 12) == LegacyChatFormat.COLOR_CHAR
&& (legacyText.charAt(index - 11) == 'x' && (legacyText.charAt(index - 11) == 'x'
|| legacyText.charAt(index - 11) == 'X') || legacyText.charAt(index - 11) == 'X')
&& HEX_COLOR_PATTERN.matcher(rgb = legacyText.substring(index - 12, index + 2)).matches()) { && HEX_COLOR_PATTERN.matcher(rgb = legacyText.substring(index - 12, index + 2)).matches()) {
@@ -64,7 +64,7 @@ public class ChatColorUtil {
// try detect non-rgb format // try detect non-rgb format
char colorChar = legacyText.charAt(index + 1); char colorChar = legacyText.charAt(index + 1);
ChatColor legacyColor = getChatColorByChar(colorChar); LegacyChatFormat legacyColor = LegacyChatFormat.of(colorChar);
if (legacyColor != null) { if (legacyColor != null) {
result.insert(0, legacyColor); result.insert(0, legacyColor);
@@ -83,15 +83,6 @@ public class ChatColorUtil {
return result.toString(); return result.toString();
} }
/**
* Returns the {@link ChatColor} associated with the provided char, case-insensitive.
* @param code the case-insensitive char code.
* @return the corresponding {@link ChatColor}.
*/
public static ChatColor getChatColorByChar(char code) {
return ChatColor.getByChar(Character.toLowerCase(code));
}
@@ -99,7 +90,7 @@ public class ChatColorUtil {
* Translate the color code of the provided string, that uses the alt color char, to the {@code §} color code * Translate the color code of the provided string, that uses the alt color char, to the {@code §} color code
* format. * format.
* <p> * <p>
* This method is the improved version of {@link ChatColor#translateAlternateColorCodes(char, String)}, * This method is the improved version of Bukkits {@code ChatColor.translateAlternateColorCodes(char, String)},
* because it takes into account essentials RGB color code, and {@code altColorChar} escaping (by doubling it). * because it takes into account essentials RGB color code, and {@code altColorChar} escaping (by doubling it).
* Essentials RGB color code are converted to Bungee chat RGB format, so the returned string can be converted * Essentials RGB color code are converted to Bungee chat RGB format, so the returned string can be converted
* to component (see {@link Chat#legacyText(Object)}). * to component (see {@link Chat#legacyText(Object)}).
@@ -112,7 +103,7 @@ public class ChatColorUtil {
*/ */
public static String translateAlternateColorCodes(char altColorChar, String textToTranslate) public static String translateAlternateColorCodes(char altColorChar, String textToTranslate)
{ {
char colorChar = ChatColor.COLOR_CHAR; char colorChar = LegacyChatFormat.COLOR_CHAR;
StringBuilder acc = new StringBuilder(); StringBuilder acc = new StringBuilder();
char[] b = textToTranslate.toCharArray(); char[] b = textToTranslate.toCharArray();
for ( int i = 0; i < b.length; i++ ) for ( int i = 0; i < b.length; i++ )
@@ -180,7 +171,7 @@ public class ChatColorUtil {
* @return the text fully italic. * @return the text fully italic.
*/ */
public static String forceItalic(String legacyText) { public static String forceItalic(String legacyText) {
return forceFormat(legacyText, ChatColor.ITALIC); return forceFormat(legacyText, TextDecoration.ITALIC);
} }
/** /**
@@ -190,7 +181,7 @@ public class ChatColorUtil {
* @return the text fully bold. * @return the text fully bold.
*/ */
public static String forceBold(String legacyText) { public static String forceBold(String legacyText) {
return forceFormat(legacyText, ChatColor.BOLD); return forceFormat(legacyText, TextDecoration.BOLD);
} }
/** /**
@@ -200,7 +191,7 @@ public class ChatColorUtil {
* @return the text fully underlined. * @return the text fully underlined.
*/ */
public static String forceUnderline(String legacyText) { public static String forceUnderline(String legacyText) {
return forceFormat(legacyText, ChatColor.UNDERLINE); return forceFormat(legacyText, TextDecoration.UNDERLINED);
} }
/** /**
@@ -210,7 +201,7 @@ public class ChatColorUtil {
* @return the text fully stroked through. * @return the text fully stroked through.
*/ */
public static String forceStrikethrough(String legacyText) { public static String forceStrikethrough(String legacyText) {
return forceFormat(legacyText, ChatColor.STRIKETHROUGH); return forceFormat(legacyText, TextDecoration.STRIKETHROUGH);
} }
/** /**
@@ -220,15 +211,16 @@ public class ChatColorUtil {
* @return the text fully obfuscated. * @return the text fully obfuscated.
*/ */
public static String forceObfuscated(String legacyText) { public static String forceObfuscated(String legacyText) {
return forceFormat(legacyText, ChatColor.MAGIC); return forceFormat(legacyText, TextDecoration.OBFUSCATED);
} }
private static String forceFormat(String legacyText, ChatColor format) { private static String forceFormat(String legacyText, TextFormat format) {
String formatStr = LegacyChatFormat.of(format).toString();
return format + legacyText return format + legacyText
.replace(format.toString(), "") // remove previous tag to make the result cleaner .replace(formatStr, "") // remove previous tag to make the result cleaner
.replaceAll("§([a-frA-FR\\d])", "§$1" + format); .replaceAll("§([a-frA-FR\\d])", "§$1" + formatStr);
} }
@@ -243,40 +235,12 @@ public class ChatColorUtil {
* @return the resulting text. * @return the resulting text.
*/ */
public static String resetToColor(String legacyText, String color) { public static String resetToColor(String legacyText, String color) {
return legacyText.replace(ChatColor.RESET.toString(), color); return legacyText.replace(LegacyChatFormat.RESET.toString(), color);
} }
/**
* Converts the provided {@link ChatColor} to its Adventure counterpart.
* @param bungee a BungeeCord {@link ChatColor} instance.
* @return the {@link TextColor} equivalent to the provided {@link ChatColor}.
*/
public static TextColor toAdventure(ChatColor bungee) {
if (bungee == null)
return null;
if (bungee.getColor() == null)
throw new IllegalArgumentException("The provided Bungee ChatColor must be an actual color (not format nor reset).");
return TextColor.color(bungee.getColor().getRGB());
}
/**
* Converts the provided {@link TextColor} to its BungeeCord counterpart.
* @param col a Adventure {@link TextColor} instance.
* @return the {@link ChatColor} equivalent to the provided {@link TextColor}.
*/
public static ChatColor toBungee(TextColor col) {
if (col == null)
return null;
if (col instanceof NamedTextColor) {
return ChatColor.of(((NamedTextColor) col).toString());
}
return ChatColor.of(col.asHexString());
}
/** /**
* Create a color, interpolating between 2 colors. * Create a color, interpolating between 2 colors.
* @param v0 the value corresponding to color {@code cc0}. * @param v0 the value corresponding to color {@code cc0}.
@@ -293,4 +257,7 @@ public class ChatColorUtil {
} }
private ChatColorUtil() {}
} }

View File

@@ -87,7 +87,7 @@ public class ChatConfig {
*/ */
public static int getPrefixWidth(boolean console) { public static int getPrefixWidth(boolean console) {
Chat c; Chat c;
return prefix == null ? 0 : (c = prefix.get()) == null ? 0 : ChatUtil.componentWidth(c.getAdv(), console); return prefix == null ? 0 : (c = prefix.get()) == null ? 0 : ChatUtil.componentWidth(c.get(), console);
} }
@@ -157,5 +157,9 @@ public class ChatConfig {
.thenText("] "); .thenText("] ");
} }
private PandaTheme() {}
} }
private ChatConfig() {}
} }

View File

@@ -5,7 +5,7 @@ import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.format.TextColor; import net.kyori.adventure.text.format.TextColor;
import org.jetbrains.annotations.NotNull; import org.jetbrains.annotations.NotNull;
import fr.pandacube.lib.chat.Chat.FormatableChat; import fr.pandacube.lib.chat.Chat.FormattableChat;
/** /**
* Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text. * Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text.
@@ -150,10 +150,10 @@ public class ChatFilledLine implements ComponentLike {
/** /**
* Renders this line to a {@link FormatableChat}. * Renders this line to a {@link FormattableChat}.
* @return a new {@link FormatableChat} built by this {@link ChatFilledLine}. * @return a new {@link FormattableChat} built by this {@link ChatFilledLine}.
*/ */
public FormatableChat toChat() { public FormattableChat toChat() {
int maxWidth = (this.maxWidth != null) int maxWidth = (this.maxWidth != null)
? this.maxWidth ? this.maxWidth
: console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH; : console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH;
@@ -170,7 +170,7 @@ public class ChatFilledLine implements ComponentLike {
int textWidth = ChatUtil.componentWidth(text.asComponent(), console); int textWidth = ChatUtil.componentWidth(text.asComponent(), console);
if (textWidth > maxWidth) if (textWidth > maxWidth)
return (FormatableChat) text; return (FormattableChat) text;
int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold); int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold);
int nbCharLeft = 0, nbCharRight = 0; int nbCharLeft = 0, nbCharRight = 0;
@@ -179,12 +179,12 @@ public class ChatFilledLine implements ComponentLike {
case CENTER -> { case CENTER -> {
nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth; nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth;
if (nbCharLeft == 0) if (nbCharLeft == 0)
return (FormatableChat) text; return (FormattableChat) text;
} }
case LEFT, RIGHT -> { case LEFT, RIGHT -> {
int remWidth = textWidth + nbSide * repeatedCharWidth; int remWidth = textWidth + nbSide * repeatedCharWidth;
if (remWidth > maxWidth) if (remWidth > maxWidth)
return (FormatableChat) text; return (FormattableChat) text;
boolean left = alignment == Alignment.LEFT; boolean left = alignment == Alignment.LEFT;
int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth; int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth;
nbCharLeft = left ? nbSide : nbOtherSide; nbCharLeft = left ? nbSide : nbOtherSide;
@@ -197,7 +197,7 @@ public class ChatFilledLine implements ComponentLike {
.then(text); .then(text);
if (decorationChar != ' ' || spacesDecorationRightSide) if (decorationChar != ' ' || spacesDecorationRightSide)
d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold)); d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold));
return (FormatableChat) d; return (FormattableChat) d;
} }

View File

@@ -1,7 +1,6 @@
package fr.pandacube.lib.chat; package fr.pandacube.lib.chat;
import java.util.Objects; import fr.pandacube.lib.chat.Chat.FormattableChat;
import net.kyori.adventure.text.BlockNBTComponent; import net.kyori.adventure.text.BlockNBTComponent;
import net.kyori.adventure.text.Component; import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentBuilder; import net.kyori.adventure.text.ComponentBuilder;
@@ -18,9 +17,8 @@ import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.TextColor; import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.minimessage.MiniMessage; import net.kyori.adventure.text.minimessage.MiniMessage;
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer; import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
import net.md_5.bungee.api.chat.BaseComponent;
import fr.pandacube.lib.chat.Chat.FormatableChat; import java.util.Objects;
/** /**
* Abstract class holding the publicly accessible methods to create an instance of {@link Chat} component. * Abstract class holding the publicly accessible methods to create an instance of {@link Chat} component.
@@ -29,45 +27,27 @@ public abstract class ChatStatic {
private static FormatableChat chatComponent(Component c) { private static FormattableChat chatComponent(Component c) {
return new FormatableChat(componentToBuilder(c)); return new FormattableChat(componentToBuilder(c));
} }
/** /**
* Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent}. * Creates a {@link FormattableChat} from the provided {@link ComponentLike}.
* @param c the {@link BaseComponent}.
* @return a new {@link FormatableChat}.
*/
public static FormatableChat chatComponent(BaseComponent c) {
return new FormatableChat(componentToBuilder(Chat.toAdventure(c)));
}
/**
* Creates a {@link FormatableChat} from the provided {@link ComponentLike}.
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
* will be untouched. * will be untouched.
* @param c the {@link ComponentLike}. * @param c the {@link ComponentLike}.
* @return a new {@link FormatableChat}. * @return a new {@link FormattableChat}.
*/ */
public static FormatableChat chatComponent(ComponentLike c) { public static FormattableChat chatComponent(ComponentLike c) {
return chatComponent(c.asComponent()); return chatComponent(c.asComponent());
} }
/** /**
* Creates a {@link FormatableChat} with an empty main text content. * Creates a {@link FormattableChat} with an empty main text content.
* @return a new empty {@link FormatableChat}. * @return a new empty {@link FormattableChat}.
*/ */
public static FormatableChat chat() { public static FormattableChat chat() {
return new FormatableChat(Component.text()); return new FormattableChat(Component.text());
}
/**
* Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
* @param c the array of {@link BaseComponent}.
* @return a new {@link FormatableChat}.
*/
public static FormatableChat chatComponent(BaseComponent[] c) {
return chatComponent(Chat.toAdventure(c));
} }
@@ -76,60 +56,60 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content. * Creates a {@link FormattableChat} with the provided plain text as its main text content.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content. * @return a new {@link FormattableChat} with the provided text as its main text content.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
public static FormatableChat text(Object plainText) { public static FormattableChat text(Object plainText) {
if (plainText instanceof ComponentLike) { if (plainText instanceof ComponentLike) {
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead."); throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
} }
return new FormatableChat(Component.text().content(Objects.toString(plainText))); return new FormattableChat(Component.text().content(Objects.toString(plainText)));
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the section {@code "§"} * Creates a {@link FormattableChat} with the provided legacy text as its content, using the section {@code "§"}
* character. * character.
* @param legacyText the legacy text to use as the content, that uses the {@code "§"} character. * @param legacyText the legacy text to use as the content, that uses the {@code "§"} character.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
public static FormatableChat legacyText(Object legacyText) { public static FormattableChat legacyText(Object legacyText) {
return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR); return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR);
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the ampersand {@code "&"} * Creates a {@link FormattableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
* character. * character.
* @param legacyText the legacy text to use as the content, that uses the {@code "&"} character. * @param legacyText the legacy text to use as the content, that uses the {@code "&"} character.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
public static FormatableChat legacyAmpersandText(Object legacyText) { public static FormattableChat legacyAmpersandText(Object legacyText) {
return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR); return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR);
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the specified * Creates a {@link FormattableChat} with the provided legacy text as its content, using the specified
* legacyCharacter. * legacyCharacter.
* @param legacyText the legacy text to use as the content. * @param legacyText the legacy text to use as the content.
* @param legacyCharacter the character used in the provided text to prefix color and format code. * @param legacyCharacter the character used in the provided text to prefix color and format code.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
* instead. * instead.
*/ */
private static FormatableChat legacyText(Object legacyText, char legacyCharacter) { private static FormattableChat legacyText(Object legacyText, char legacyCharacter) {
if (legacyText instanceof ComponentLike) { if (legacyText instanceof ComponentLike) {
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead."); throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
} }
@@ -138,118 +118,118 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} with the provided MiniMessage text as its content. * Creates a {@link FormattableChat} with the provided MiniMessage text as its content.
* @param miniMessageText the MiniMessage text to use as the content. * @param miniMessageText the MiniMessage text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its content. * @return a new {@link FormattableChat} with the provided text as its content.
*/ */
public static FormatableChat miniMessageText(String miniMessageText) { public static FormattableChat miniMessageText(String miniMessageText) {
return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText)); return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText));
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#infoColor configured info color}. * {@link ChatConfig#infoColor configured info color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#infoColor()} instead. * {@link FormattableChat#infoColor()} instead.
*/ */
public static FormatableChat infoText(Object plainText) { public static FormattableChat infoText(Object plainText) {
return text(plainText).infoColor(); return text(plainText).infoColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#warningColor configured warning color}. * {@link ChatConfig#warningColor configured warning color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#warningColor()} instead. * {@link FormattableChat#warningColor()} instead.
*/ */
public static FormatableChat warningText(Object plainText) { public static FormattableChat warningText(Object plainText) {
return text(plainText).warningColor(); return text(plainText).warningColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#dataColor configured data color}. * {@link ChatConfig#dataColor configured data color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#dataColor()} instead. * {@link FormattableChat#dataColor()} instead.
*/ */
public static FormatableChat dataText(Object plainText) { public static FormattableChat dataText(Object plainText) {
return text(plainText).dataColor(); return text(plainText).dataColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#decorationColor configured decorationColor color}. * {@link ChatConfig#decorationColor configured decorationColor color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#decorationColor()} instead. * {@link FormattableChat#decorationColor()} instead.
*/ */
public static FormatableChat decorationText(Object plainText) { public static FormattableChat decorationText(Object plainText) {
return text(plainText).decorationColor(); return text(plainText).decorationColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#successColor configured success color}. * {@link ChatConfig#successColor configured success color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#successColor()} instead. * {@link FormattableChat#successColor()} instead.
*/ */
public static FormatableChat successText(Object plainText) { public static FormattableChat successText(Object plainText) {
return text(plainText).successColor(); return text(plainText).successColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
* {@link ChatConfig#failureColor configured failure color}. * {@link ChatConfig#failureColor configured failure color}.
* @param plainText the text to use as the content. * @param plainText the text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#failureColor()} instead. * {@link FormattableChat#failureColor()} instead.
*/ */
public static FormatableChat failureText(Object plainText) { public static FormattableChat failureText(Object plainText) {
return text(plainText).failureColor(); return text(plainText).failureColor();
} }
/** /**
* Creates a {@link FormatableChat} with the provided legacy text as its main text content, and colored in white in * Creates a {@link FormattableChat} with the provided legacy text as its main text content, and colored in white in
* case there is no color on the generated parent component. * case there is no color on the generated parent component.
* @param legacyText the legacy text to use as the content. * @param legacyText the legacy text to use as the content.
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color. * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and * {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
* {@link FormatableChat#failureColor()} instead. * {@link FormattableChat#failureColor()} instead.
*/ */
public static FormatableChat playerNameText(String legacyText) { public static FormattableChat playerNameText(String legacyText) {
FormatableChat fc = legacyText(legacyText); FormattableChat fc = legacyText(legacyText);
fc.builder.colorIfAbsent(NamedTextColor.WHITE); fc.builder.colorIfAbsent(NamedTextColor.WHITE);
return fc; return fc;
} }
/** /**
* Creates a {@link FormatableChat} from the provided {@link Component}, coloring in white the generated parent * Creates a {@link FormattableChat} from the provided {@link Component}, coloring in white the generated parent
* component in case there is no color defined. * component in case there is no color defined.
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
* will be untouched. * will be untouched.
* @param c the {@link Component}. * @param c the {@link Component}.
* @return a new {@link FormatableChat}. * @return a new {@link FormattableChat}.
*/ */
public static FormatableChat playerNameComponent(ComponentLike c) { public static FormattableChat playerNameComponent(ComponentLike c) {
FormatableChat fc = chatComponent(c); FormattableChat fc = chatComponent(c);
fc.builder.colorIfAbsent(NamedTextColor.WHITE); fc.builder.colorIfAbsent(NamedTextColor.WHITE);
return fc; return fc;
} }
@@ -258,32 +238,32 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} with the provided translation key and parameters. * Creates a {@link FormattableChat} with the provided translation key and parameters.
* @param key the translation key. * @param key the translation key.
* @param with the translation parameters. * @param with the translation parameters.
* @return a new {@link FormatableChat} with the provided translation key and parameters. * @return a new {@link FormattableChat} with the provided translation key and parameters.
*/ */
public static FormatableChat translation(String key, Object... with) { public static FormattableChat translation(String key, Object... with) {
return new FormatableChat(Component.translatable().key(key).args(Chat.filterObjToComponentLike(with))); return new FormattableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
} }
/** /**
* Creates a {@link FormatableChat} with the provided keybinding. * Creates a {@link FormattableChat} with the provided keybinding.
* @param key the keybinding to display. * @param key the keybinding to display.
* @return a new {@link FormatableChat} with the provided keybinding. * @return a new {@link FormattableChat} with the provided keybinding.
*/ */
public static FormatableChat keybind(String key) { public static FormattableChat keyBind(String key) {
return new FormatableChat(Component.keybind().keybind(key)); return new FormattableChat(Component.keybind().keybind(key));
} }
/** /**
* Creates a {@link FormatableChat} with the provided score name and objective. * Creates a {@link FormattableChat} with the provided score name and objective.
* @param name the score name. * @param name the score name.
* @param objective the score objective. * @param objective the score objective.
* @return a new {@link FormatableChat} with the provided score name and objective. * @return a new {@link FormattableChat} with the provided score name and objective.
*/ */
public static FormatableChat score(String name, String objective) { public static FormattableChat score(String name, String objective) {
return new FormatableChat(Component.score().name(name).objective(objective)); return new FormattableChat(Component.score().name(name).objective(objective));
} }
@@ -292,49 +272,49 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) { public static FormattableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
Objects.requireNonNull(url, "url"); Objects.requireNonNull(url, "url");
if (inner == null) if (inner == null)
inner = text(url); inner = text(url);
if (hover == null) if (hover == null)
hover = text(ChatUtil.wrapInLimitedPixels(url, 240)); hover = text(ChatUtil.wrapInLimitedPixels(url, 240));
return (FormatableChat) chat().clickURL(url).urlColor().hover(hover).then(inner); return (FormattableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
} }
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* <p> * <p>
* When hovered, the component will display the url. To customize the hover content, use * When hovered, the component will display the url. To customize the hover content, use
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}. * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(ComponentLike inner, String url) { public static FormattableChat clickableURL(ComponentLike inner, String url) {
return clickableURL(inner, url, null); return clickableURL(inner, url, null);
} }
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* <p> * <p>
* The text on which to click will be the URL itself. To configure the clicked text, use * The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}. * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(String url, HoverEventSource<?> hover) { public static FormattableChat clickableURL(String url, HoverEventSource<?> hover) {
return clickableURL(null, url, hover); return clickableURL(null, url, hover);
} }
/** /**
* Creates a {@link FormatableChat} that leads to a URL when clicked. * Creates a {@link FormattableChat} that leads to a URL when clicked.
* <p> * <p>
* The text on which to click will be the URL itself. To configure the clicked text, use * The text on which to click will be the URL itself. To configure the clicked text, use
* {@link #clickableURL(ComponentLike, String)}. * {@link #clickableURL(ComponentLike, String)}.
@@ -342,9 +322,9 @@ public abstract class ChatStatic {
* When hovered, the component will display the url. To customize the hover content, use * When hovered, the component will display the url. To customize the hover content, use
* {@link #clickableURL(String, HoverEventSource)}. * {@link #clickableURL(String, HoverEventSource)}.
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}. * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
* @return a new {@link FormatableChat} that leads to a URL when clicked. * @return a new {@link FormattableChat} that leads to a URL when clicked.
*/ */
public static FormatableChat clickableURL(String url) { public static FormattableChat clickableURL(String url) {
return clickableURL(null, url, null); return clickableURL(null, url, null);
} }
@@ -354,14 +334,14 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
Objects.requireNonNull(commandWithSlash, "commandWithSlash"); Objects.requireNonNull(commandWithSlash, "commandWithSlash");
if (!commandWithSlash.startsWith("/")) if (!commandWithSlash.startsWith("/"))
throw new IllegalArgumentException("commandWithSlash must start with a '/' character."); throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -369,39 +349,39 @@ public abstract class ChatStatic {
inner = text(commandWithSlash); inner = text(commandWithSlash);
if (hover == null) if (hover == null)
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240)); hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
return (FormatableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner); return (FormattableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
} }
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* <p> * <p>
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}. * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash) { public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
return clickableCommand(inner, commandWithSlash, null); return clickableCommand(inner, commandWithSlash, null);
} }
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}. * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
return clickableCommand(null, commandWithSlash, hover); return clickableCommand(null, commandWithSlash, hover);
} }
/** /**
* Creates a {@link FormatableChat} that runs a command when clicked. * Creates a {@link FormattableChat} that runs a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableCommand(ComponentLike, String)}. * {@link #clickableCommand(ComponentLike, String)}.
@@ -409,10 +389,10 @@ public abstract class ChatStatic {
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableCommand(String, HoverEventSource)}. * {@link #clickableCommand(String, HoverEventSource)}.
* @param commandWithSlash the command to run. Must start with {@code "/"}. * @param commandWithSlash the command to run. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that runs a command when clicked. * @return a new {@link FormattableChat} that runs a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableCommand(String commandWithSlash) { public static FormattableChat clickableCommand(String commandWithSlash) {
return clickableCommand(null, commandWithSlash, null); return clickableCommand(null, commandWithSlash, null);
} }
@@ -422,14 +402,14 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
Objects.requireNonNull(commandWithSlash, "commandWithSlash"); Objects.requireNonNull(commandWithSlash, "commandWithSlash");
if (!commandWithSlash.startsWith("/")) if (!commandWithSlash.startsWith("/"))
throw new IllegalArgumentException("commandWithSlash must start with a '/' character."); throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -437,39 +417,39 @@ public abstract class ChatStatic {
inner = text(commandWithSlash); inner = text(commandWithSlash);
if (hover == null) if (hover == null)
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240)); hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
return (FormatableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner); return (FormattableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
} }
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* <p> * <p>
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}. * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
* @param inner the component to make clickable. * @param inner the component to make clickable.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash) { public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
return clickableSuggest(inner, commandWithSlash, null); return clickableSuggest(inner, commandWithSlash, null);
} }
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}. * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @param hover the content to display when hovering the component. * @param hover the content to display when hovering the component.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) { public static FormattableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
return clickableSuggest(null, commandWithSlash, hover); return clickableSuggest(null, commandWithSlash, hover);
} }
/** /**
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked. * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* <p> * <p>
* The text on which to click will be the command itself. To configure the clicked text, use * The text on which to click will be the command itself. To configure the clicked text, use
* {@link #clickableSuggest(ComponentLike, String)}. * {@link #clickableSuggest(ComponentLike, String)}.
@@ -477,10 +457,10 @@ public abstract class ChatStatic {
* When hovered, the component will display the command itself. To customize the hover content, use * When hovered, the component will display the command itself. To customize the hover content, use
* {@link #clickableSuggest(String, HoverEventSource)}. * {@link #clickableSuggest(String, HoverEventSource)}.
* @param commandWithSlash the command to suggest. Must start with {@code "/"}. * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked. * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}. * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
*/ */
public static FormatableChat clickableSuggest(String commandWithSlash) { public static FormattableChat clickableSuggest(String commandWithSlash) {
return clickableSuggest(null, commandWithSlash, null); return clickableSuggest(null, commandWithSlash, null);
} }
@@ -492,112 +472,112 @@ public abstract class ChatStatic {
/** /**
* Creates a {@link FormatableChat} filling a chat line with decoration and a left-aligned text. * Creates a {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
* @param text the text aligned to the left. * @param text the text aligned to the left.
* @param decorationChar the character used for decoration around the text. * @param decorationChar the character used for decoration around the text.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with decoration and a left-aligned text. * @return a new {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
* @see ChatFilledLine#leftText(ComponentLike) * @see ChatFilledLine#leftText(ComponentLike)
*/ */
public static FormatableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat(); return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color and a left-aligned text. * color and a left-aligned text.
* @param text the text aligned to the left. * @param text the text aligned to the left.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a left-aligned text. * and color and a left-aligned text.
* @see ChatFilledLine#leftText(ComponentLike) * @see ChatFilledLine#leftText(ComponentLike)
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat leftText(ComponentLike text, boolean console) { public static FormattableChat leftText(ComponentLike text, boolean console) {
return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat(); return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with decoration and a right-aligned text. * Creates a {@link FormattableChat} filling a chat line with decoration and a right-aligned text.
* @param text the text aligned to the right. * @param text the text aligned to the right.
* @param decorationChar the character used for decoration around the text. * @param decorationChar the character used for decoration around the text.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with decoration and a right-aligned * @return a new {@link FormattableChat} filling a chat line with decoration and a right-aligned
* text. * text.
* @see ChatFilledLine#rightText(ComponentLike) * @see ChatFilledLine#rightText(ComponentLike)
*/ */
public static FormatableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat(); return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color and a right-aligned text. * color and a right-aligned text.
* @param text the text aligned to the right. * @param text the text aligned to the right.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a right-aligned text. * and color and a right-aligned text.
* @see ChatFilledLine#rightText(ComponentLike) * @see ChatFilledLine#rightText(ComponentLike)
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat rightText(ComponentLike text, boolean console) { public static FormattableChat rightText(ComponentLike text, boolean console) {
return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat(); return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with decoration and a centered text. * Creates a {@link FormattableChat} filling a chat line with decoration and a centered text.
* @param text the text aligned to the center. * @param text the text aligned to the center.
* @param decorationChar the character used for decoration around the text. * @param decorationChar the character used for decoration around the text.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with decoration and a centered text. * @return a new {@link FormattableChat} filling a chat line with decoration and a centered text.
* @see ChatFilledLine#centerText(ComponentLike) * @see ChatFilledLine#centerText(ComponentLike)
*/ */
public static FormatableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat(); return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color and a centered text. * color and a centered text.
* @param text the text aligned to the center. * @param text the text aligned to the center.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
* and color and a centered text. * and color and a centered text.
* @see ChatFilledLine#centerText(ComponentLike) * @see ChatFilledLine#centerText(ComponentLike)
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat centerText(ComponentLike text, boolean console) { public static FormattableChat centerText(ComponentLike text, boolean console) {
return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat(); return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with a decoration character and color. * Creates a {@link FormattableChat} filling a chat line with a decoration character and color.
* @param decorationChar the character used for decoration. * @param decorationChar the character used for decoration.
* @param decorationColor the color used for the decoration characters. * @param decorationColor the color used for the decoration characters.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color. * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
* @see ChatFilledLine#filled() * @see ChatFilledLine#filled()
*/ */
public static FormatableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) { public static FormattableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat(); return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat();
} }
/** /**
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
* color. * color.
* @param console if the line is rendered on console (true) or IG (false). * @param console if the line is rendered on console (true) or IG (false).
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color. * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
* @see ChatFilledLine#filled() * @see ChatFilledLine#filled()
* @see ChatConfig#decorationChar * @see ChatConfig#decorationChar
* @see ChatConfig#decorationColor * @see ChatConfig#decorationColor
*/ */
public static FormatableChat filledLine(boolean console) { public static FormattableChat filledLine(boolean console) {
return ChatFilledLine.filled().console(console).toChat(); return ChatFilledLine.filled().console(console).toChat();
} }
@@ -632,52 +612,39 @@ public abstract class ChatStatic {
private static ComponentBuilder<?, ?> componentToBuilder(Component c) { private static ComponentBuilder<?, ?> componentToBuilder(Component c) {
ComponentBuilder<?, ?> builder; ComponentBuilder<?, ?> builder = switch (c) {
if (c instanceof TextComponent) { case TextComponent textComponent -> Component.text()
builder = Component.text() .content(textComponent.content());
.content(((TextComponent) c).content()); case TranslatableComponent translatableComponent -> Component.translatable()
} .key(translatableComponent.key()).arguments(translatableComponent.arguments());
else if (c instanceof TranslatableComponent) { case SelectorComponent selectorComponent -> Component.selector()
builder = Component.translatable() .pattern(selectorComponent.pattern());
.key(((TranslatableComponent) c).key()) case ScoreComponent scoreComponent -> Component.score()
.args(((TranslatableComponent) c).args()); .name(scoreComponent.name())
} .objective(scoreComponent.objective());
else if (c instanceof SelectorComponent) { case KeybindComponent keybindComponent -> Component.keybind()
builder = Component.selector() .keybind(keybindComponent.keybind());
.pattern(((SelectorComponent) c).pattern()); case BlockNBTComponent blockNBTComponent -> Component.blockNBT()
} .interpret(blockNBTComponent.interpret())
else if (c instanceof ScoreComponent) { .nbtPath(blockNBTComponent.nbtPath())
builder = Component.score() .pos(blockNBTComponent.pos());
.name(((ScoreComponent) c).name()) case EntityNBTComponent entityNBTComponent -> Component.entityNBT()
.objective(((ScoreComponent) c).objective()); .interpret(entityNBTComponent.interpret())
} .nbtPath(entityNBTComponent.nbtPath())
else if (c instanceof KeybindComponent) { .selector(entityNBTComponent.selector());
builder = Component.keybind() case StorageNBTComponent storageNBTComponent -> Component.storageNBT()
.keybind(((KeybindComponent) c).keybind()); .interpret(storageNBTComponent.interpret())
} .nbtPath(storageNBTComponent.nbtPath())
else if (c instanceof BlockNBTComponent) { .storage(storageNBTComponent.storage());
builder = Component.blockNBT() case null, default -> throw new IllegalArgumentException("Unknown component type " + (c == null ? "null" : c.getClass()));
.interpret(((BlockNBTComponent) c).interpret()) };
.nbtPath(((BlockNBTComponent) c).nbtPath())
.pos(((BlockNBTComponent) c).pos());
}
else if (c instanceof EntityNBTComponent) {
builder = Component.entityNBT()
.interpret(((EntityNBTComponent) c).interpret())
.nbtPath(((EntityNBTComponent) c).nbtPath())
.selector(((EntityNBTComponent) c).selector());
}
else if (c instanceof StorageNBTComponent) {
builder = Component.storageNBT()
.interpret(((StorageNBTComponent) c).interpret())
.nbtPath(((StorageNBTComponent) c).nbtPath())
.storage(((StorageNBTComponent) c).storage());
}
else {
throw new IllegalArgumentException("Unknown component type " + c.getClass());
}
return builder.style(c.style()).append(c.children()); return builder.style(c.style()).append(c.children());
} }
/**
* Creates a new {@link ChatStatic} instance.
*/
protected ChatStatic() {}
} }

View File

@@ -1,5 +1,17 @@
package fr.pandacube.lib.chat; package fr.pandacube.lib.chat;
import fr.pandacube.lib.chat.Chat.FormattableChat;
import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.TextComponent;
import net.kyori.adventure.text.TranslatableComponent;
import net.kyori.adventure.text.TranslationArgument;
import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.format.TextDecoration;
import net.kyori.adventure.text.format.TextDecoration.State;
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
import java.util.ArrayList; import java.util.ArrayList;
import java.util.Arrays; import java.util.Arrays;
import java.util.Collections; import java.util.Collections;
@@ -10,18 +22,6 @@ import java.util.Set;
import java.util.TreeSet; import java.util.TreeSet;
import java.util.stream.Collectors; import java.util.stream.Collectors;
import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentLike;
import net.kyori.adventure.text.TextComponent;
import net.kyori.adventure.text.TranslatableComponent;
import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.format.TextDecoration;
import net.kyori.adventure.text.format.TextDecoration.State;
import net.md_5.bungee.api.ChatColor;
import fr.pandacube.lib.chat.Chat.FormatableChat;
import static fr.pandacube.lib.chat.ChatStatic.chat; import static fr.pandacube.lib.chat.ChatStatic.chat;
/** /**
@@ -152,7 +152,7 @@ public class ChatUtil {
else else
first = false; first = false;
FormatableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page)); FormattableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
if (page == currentPage) { if (page == currentPage) {
pDisplay.highlightedCommandColor(); pDisplay.highlightedCommandColor();
} }
@@ -180,12 +180,12 @@ public class ChatUtil {
* @param elements the components to join. * @param elements the components to join.
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators. * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
*/ */
public static FormatableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) { public static FormattableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
int size = elements == null ? 0 : elements.size(); int size = elements == null ? 0 : elements.size();
int last = size - 1; int last = size - 1;
return switch (size) { return switch (size) {
case 0, 1, 2 -> join(finalSeparator, elements); case 0, 1, 2 -> join(finalSeparator, elements);
default -> (FormatableChat) join(regularSeparator, elements.subList(0, last)) default -> (FormattableChat) join(regularSeparator, elements.subList(0, last))
.then(finalSeparator) .then(finalSeparator)
.then(elements.get(last)); .then(elements.get(last));
}; };
@@ -202,8 +202,8 @@ public class ChatUtil {
* @param elements the components to join. * @param elements the components to join.
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators. * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
*/ */
public static FormatableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) { public static FormattableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
FormatableChat c = chat(); FormattableChat c = chat();
if (elements == null) if (elements == null)
return c; return c;
boolean first = true; boolean first = true;
@@ -265,8 +265,8 @@ public class ChatUtil {
count += strWidth(((TextComponent)component).content(), console, actuallyBold); count += strWidth(((TextComponent)component).content(), console, actuallyBold);
} }
else if (component instanceof TranslatableComponent) { else if (component instanceof TranslatableComponent) {
for (Component c : ((TranslatableComponent)component).args()) for (TranslationArgument c : ((TranslatableComponent)component).arguments())
count += componentWidth(c, console, actuallyBold); count += componentWidth(c.asComponent(), console, actuallyBold);
} }
for (Component c : component.children()) for (Component c : component.children())
@@ -350,7 +350,7 @@ public class ChatUtil {
do { do {
char c = legacyText.charAt(index); char c = legacyText.charAt(index);
if (c == ChatColor.COLOR_CHAR && index < legacyText.length() - 1) { if (c == LegacyComponentSerializer.SECTION_CHAR && index < legacyText.length() - 1) {
currentWord.append(c); currentWord.append(c);
c = legacyText.charAt(++index); c = legacyText.charAt(++index);
currentWord.append(c); currentWord.append(c);
@@ -480,8 +480,8 @@ public class ChatUtil {
spacedRow.thenText(space); spacedRow.thenText(space);
} }
if (!row.isEmpty()) if (!row.isEmpty())
spacedRow.then(row.get(row.size() - 1)); spacedRow.then(row.getLast());
spacedRows.add(spacedRow.getAdv()); spacedRows.add(spacedRow.get());
} }
return spacedRows; return spacedRows;
@@ -503,14 +503,14 @@ public class ChatUtil {
*/ */
public static Component customWidthSpace(int width, boolean console) { public static Component customWidthSpace(int width, boolean console) {
if (console) if (console)
return Chat.text(" ".repeat(width)).getAdv(); return Chat.text(" ".repeat(width)).get();
return switch (width) { return switch (width) {
case 0, 1 -> Component.empty(); case 0, 1 -> Component.empty();
case 2 -> Chat.text(".").black().getAdv(); case 2 -> Chat.text(".").black().get();
case 3 -> Chat.text("`").black().getAdv(); case 3 -> Chat.text("`").black().get();
case 6 -> Chat.text(". ").black().getAdv(); case 6 -> Chat.text(". ").black().get();
case 7 -> Chat.text("` ").black().getAdv(); case 7 -> Chat.text("` ").black().get();
case 11 -> Chat.text("` ").black().getAdv(); case 11 -> Chat.text("` ").black().get();
default -> { default -> {
int nbSpace = width / 4; int nbSpace = width / 4;
int nbBold = width % 4; int nbBold = width % 4;
@@ -519,13 +519,13 @@ public class ChatUtil {
if (nbBold > 0) { if (nbBold > 0) {
yield Chat.text(" ".repeat(nbNotBold)).bold(false) yield Chat.text(" ".repeat(nbNotBold)).bold(false)
.then(Chat.text(" ".repeat(nbBold)).bold(true)) .then(Chat.text(" ".repeat(nbBold)).bold(true))
.getAdv(); .get();
} }
else else
yield Chat.text(" ".repeat(nbNotBold)).bold(false).getAdv(); yield Chat.text(" ".repeat(nbNotBold)).bold(false).get();
} }
else if (nbBold > 0) { else if (nbBold > 0) {
yield Chat.text(" ".repeat(nbBold)).bold(true).getAdv(); yield Chat.text(" ".repeat(nbBold)).bold(true).get();
} }
throw new IllegalStateException("Should not be here (width=" + width + "; nbSpace=" + nbSpace + "; nbBold=" + nbBold + "; nbNotBold=" + nbNotBold + ")"); throw new IllegalStateException("Should not be here (width=" + width + "; nbSpace=" + nbSpace + "; nbBold=" + nbBold + "; nbNotBold=" + nbNotBold + ")");
} }
@@ -596,7 +596,7 @@ public class ChatUtil {
for (int i = 0; i < sizes.length; i++) { for (int i = 0; i < sizes.length; i++) {
sumSizes += sizes[i]; sumSizes += sizes[i];
FormatableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i])); FormattableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
if (colors != null && i < colors.length && colors[i] != null) if (colors != null && i < colors.length && colors[i] != null)
subC.color(colors[i]); subC.color(colors[i]);
@@ -657,5 +657,6 @@ public class ChatUtil {
return str; return str;
} }
private ChatUtil() {}
} }

View File

@@ -0,0 +1,230 @@
package fr.pandacube.lib.chat;
import net.kyori.adventure.text.format.TextColor;
import net.kyori.adventure.text.format.TextDecoration;
import net.kyori.adventure.text.format.TextFormat;
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
import net.kyori.adventure.text.serializer.legacy.LegacyFormat;
import java.util.Arrays;
import java.util.LinkedHashMap;
import java.util.Map;
import java.util.stream.Collectors;
/**
* Convenient enum to uses legacy format while keeping compatibility with modern chat format and API (Adventure, ...)
*/
public enum LegacyChatFormat {
/**
* Black (0) color format code.
*/
BLACK('0'),
/**
* Dark blue (1) color format code.
*/
DARK_BLUE('1'),
/**
* Dark green (2) color format code.
*/
DARK_GREEN('2'),
/**
* Dark aqua (3) color format code.
*/
DARK_AQUA('3'),
/**
* Dark red (4) color format code.
*/
DARK_RED('4'),
/**
* Dark purple (5) color format code.
*/
DARK_PURPLE('5'),
/**
* Gold (6) color format code.
*/
GOLD('6'),
/**
* Gray (7) color format code.
*/
GRAY('7'),
/**
* Dark gray (8) color format code.
*/
DARK_GRAY('8'),
/**
* Blue (9) color format code.
*/
BLUE('9'),
/**
* Green (A) color format code.
*/
GREEN('a'),
/**
* Aqua (B) color format code.
*/
AQUA('b'),
/**
* Red (C) color format code.
*/
RED('c'),
/**
* Light purple (D) color format code.
*/
LIGHT_PURPLE('d'),
/**
* Yellow (E) color format code.
*/
YELLOW('e'),
/**
* White (F) color format code.
*/
WHITE('f'),
/**
* Obfuscated (K) decoration format code.
*/
OBFUSCATED('k'),
/**
* Bold (L) decoration format code.
*/
BOLD('l'),
/**
* Strikethrough (M) decoration format code.
*/
STRIKETHROUGH('m'),
/**
* Underlined (N) decoration format code.
*/
UNDERLINED('n'),
/**
* Italic (O) decoration format code.
*/
ITALIC('o'),
/**
* Reset (R) format code.
*/
RESET('r');
/**
* The character used by Minecraft for legacy chat format.
*/
public static final char COLOR_CHAR = LegacyComponentSerializer.SECTION_CHAR;
/** {@link #COLOR_CHAR} but as a String! */
public static final String COLOR_STR_PREFIX = Character.toString(COLOR_CHAR);
private static final Map<Character, LegacyChatFormat> BY_CHAR;
private static final Map<TextFormat, LegacyChatFormat> BY_FORMAT;
private static final Map<LegacyFormat, LegacyChatFormat> BY_LEGACY;
/**
* Gets the {@link LegacyChatFormat} from the provided chat color code.
* @param code the character code from [0-9A-Fa-fK-Ok-oRr].
* @return the {@link LegacyChatFormat} related to the provided code.
*/
public static LegacyChatFormat of(char code) {
return BY_CHAR.get(Character.toLowerCase(code));
}
/**
* Gets the {@link LegacyChatFormat} from the provided {@link TextFormat} instance.
* @param format the {@link TextFormat} instance.
* @return the {@link LegacyChatFormat} related to the provided format.
*/
public static LegacyChatFormat of(TextFormat format) {
LegacyChatFormat colorOrDecoration = BY_FORMAT.get(format);
if (colorOrDecoration != null)
return colorOrDecoration;
if (format.getClass().getSimpleName().equals("Reset")) // an internal class of legacy serializer library
return RESET;
throw new IllegalArgumentException("Unsupported format of type " + format.getClass());
}
/**
* Gets the {@link LegacyChatFormat} from the provided {@link LegacyFormat} instance.
* @param advLegacy the {@link LegacyFormat} instance.
* @return the {@link LegacyChatFormat} related to the provided format.
*/
public static LegacyChatFormat of(LegacyFormat advLegacy) {
return BY_LEGACY.get(advLegacy);
}
/**
* The format code of this chat format.
*/
public final char code;
/**
* The Adventure legacy format instance related to this chat format.
*/
public final LegacyFormat advLegacyFormat;
LegacyChatFormat(char code) {
this.code = code;
advLegacyFormat = LegacyComponentSerializer.parseChar(code);
}
/**
* Gets the related {@link TextColor}, or null if it's not a color.
* @return the related {@link TextColor}, or null if it's not a color.
*/
public TextColor getTextColor() {
return advLegacyFormat.color();
}
/**
* Tells if this format is a color.
* @return true if this format is a color, false otherwise.
*/
public boolean isColor() {
return getTextColor() != null;
}
/**
* Gets the related {@link TextDecoration}, or null if it's not a decoration.
* @return the related {@link TextDecoration}, or null if it's not a decoration.
*/
public TextDecoration getTextDecoration() {
return advLegacyFormat.decoration();
}
/**
* Tells if this format is a decoration (bold, italic, ...).
* @return true if this format is a decoration, false otherwise.
*/
public boolean isDecoration() {
return getTextDecoration() != null;
}
/**
* Tells if this format is the reset.
* @return true if this format is the reset, false otherwise.
*/
public boolean isReset() {
return this == RESET;
}
@Override
public String toString() {
return COLOR_STR_PREFIX + code;
}
static {
BY_CHAR = Arrays.stream(values()).sequential()
.collect(Collectors.toMap(e -> e.code, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
BY_FORMAT = Arrays.stream(values()).sequential()
.filter(e -> e.isColor() || e.isDecoration())
.collect(Collectors.toMap(e -> {
if (e.isColor())
return e.getTextColor();
return e.getTextDecoration();
}, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
BY_LEGACY = Arrays.stream(values()).sequential()
.collect(Collectors.toMap(e -> e.advLegacyFormat, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
}
}

View File

@@ -15,11 +15,6 @@
<packaging>jar</packaging> <packaging>jar</packaging>
<repositories> <repositories>
<repository>
<id>minecraft-libraries</id>
<name>Minecraft Libraries</name>
<url>https://libraries.minecraft.net</url>
</repository>
<repository> <repository>
<id>bungeecord-repo</id> <id>bungeecord-repo</id>
<url>https://oss.sonatype.org/content/repositories/snapshots</url> <url>https://oss.sonatype.org/content/repositories/snapshots</url>
@@ -32,27 +27,16 @@
<artifactId>pandalib-core</artifactId> <artifactId>pandalib-core</artifactId>
<version>${project.version}</version> <version>${project.version}</version>
</dependency> </dependency>
<dependency>
<groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-reflect</artifactId>
<version>${project.version}</version>
</dependency>
<dependency> <dependency>
<groupId>fr.pandacube.lib</groupId> <groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-commands</artifactId> <artifactId>pandalib-commands</artifactId>
<version>${project.version}</version> <version>${project.version}</version>
</dependency> </dependency>
<dependency> <dependency>
<groupId>net.md-5</groupId> <groupId>net.md-5</groupId>
<artifactId>bungeecord-log</artifactId> <artifactId>bungeecord-log</artifactId>
<version>${bungeecord.version}</version> <version>${bungeecord.version}</version>
</dependency> </dependency>
<dependency>
<groupId>net.md-5</groupId>
<artifactId>bungeecord-config</artifactId>
<version>${bungeecord.version}</version>
</dependency>
</dependencies> </dependencies>

View File

@@ -1,22 +1,25 @@
package fr.pandacube.lib.cli; package fr.pandacube.lib.cli;
import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
import fr.pandacube.lib.cli.log.CLILogger;
import fr.pandacube.lib.util.log.Log;
import org.jline.reader.EndOfFileException;
import org.jline.reader.LineReader;
import org.jline.reader.LineReaderBuilder;
import org.jline.reader.UserInterruptException;
import org.jline.terminal.Terminal;
import org.jline.terminal.TerminalBuilder;
import java.io.IOException; import java.io.IOException;
import java.util.logging.Logger; import java.util.logging.Logger;
import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
import fr.pandacube.lib.cli.log.CLILogger;
import jline.console.ConsoleReader;
import org.fusesource.jansi.AnsiConsole;
import fr.pandacube.lib.util.log.Log;
/** /**
* Class to handle general standard IO operation for a CLI application. It uses Jlines {@link ConsoleReader} for the * Class to handle general standard IO operation for a CLI application. It uses Jlines {@link LineReader} for the
* console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands. * console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands.
*/ */
public class CLI extends Thread { public class CLI extends Thread {
private final ConsoleReader reader; private final LineReader reader;
private final Logger logger; private final Logger logger;
@@ -28,10 +31,11 @@ public class CLI extends Thread {
super("Console Thread"); super("Console Thread");
setDaemon(true); setDaemon(true);
AnsiConsole.systemInstall(); Terminal terminal = TerminalBuilder.builder().build();
reader = new ConsoleReader(); reader = LineReaderBuilder.builder().terminal(terminal)
reader.setPrompt(">"); .completer(CLIBrigadierDispatcher.instance)
reader.addCompleter(CLIBrigadierDispatcher.instance); .build()
;
// configure logger's formatter // configure logger's formatter
System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss"); System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss");
@@ -40,10 +44,10 @@ public class CLI extends Thread {
/** /**
* Gets the Jline {@link ConsoleReader} of this CLI instance. * Gets the Jline {@link LineReader} of this CLI instance.
* @return the Jline {@link ConsoleReader} of this CLI instance. * @return the Jline {@link LineReader} of this CLI instance.
*/ */
public ConsoleReader getConsoleReader() { public LineReader getConsoleReader() {
return reader; return reader;
} }
@@ -65,15 +69,14 @@ public class CLI extends Thread {
int i = 0; int i = 0;
String line; String line;
try { try {
while((line = reader.readLine()) != null) { while((line = reader.readLine(">")) != null) {
if (line.trim().equals("")) if (line.trim().isEmpty())
continue; continue;
String cmdLine = line; String cmdLine = line;
new Thread(() -> CLIBrigadierDispatcher.instance.execute(cmdLine), "CLICmdThread #"+(i++)).start(); Thread.ofVirtual().name("CLICmdThread #"+(i++))
} .start(() -> CLIBrigadierDispatcher.instance.execute(cmdLine));
} catch (IOException e) {
Log.severe(e);
} }
} catch (UserInterruptException | EndOfFileException ignore) { }
} }

View File

@@ -32,6 +32,7 @@ public abstract class CLIApplication {
/** /**
* Creates a new application instance. * Creates a new application instance.
*/ */
@SuppressWarnings("CallToPrintStackTrace")
protected CLIApplication() { protected CLIApplication() {
instance = this; instance = this;
CLI tmpCLI = null; CLI tmpCLI = null;

View File

@@ -39,13 +39,6 @@ public abstract class CLIBrigadierCommand extends BrigadierCommand<CLICommandSen
protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand(); protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand();
protected String[] getAliases() {
return new String[0];
}
public boolean isPlayer(CLICommandSender sender) { public boolean isPlayer(CLICommandSender sender) {
return sender.isPlayer(); return sender.isPlayer();

View File

@@ -3,8 +3,11 @@ package fr.pandacube.lib.cli.commands;
import com.mojang.brigadier.suggestion.Suggestion; import com.mojang.brigadier.suggestion.Suggestion;
import com.mojang.brigadier.suggestion.Suggestions; import com.mojang.brigadier.suggestion.Suggestions;
import fr.pandacube.lib.commands.BrigadierDispatcher; import fr.pandacube.lib.commands.BrigadierDispatcher;
import jline.console.completer.Completer;
import net.kyori.adventure.text.ComponentLike; import net.kyori.adventure.text.ComponentLike;
import org.jline.reader.Candidate;
import org.jline.reader.Completer;
import org.jline.reader.LineReader;
import org.jline.reader.ParsedLine;
import java.util.List; import java.util.List;
@@ -25,6 +28,9 @@ public class CLIBrigadierDispatcher extends BrigadierDispatcher<CLICommandSender
public static final CLICommandSender CLI_CONSOLE_COMMAND_SENDER = new CLIConsoleCommandSender(); public static final CLICommandSender CLI_CONSOLE_COMMAND_SENDER = new CLIConsoleCommandSender();
private CLIBrigadierDispatcher() {}
/** /**
* Executes the provided command as the console. * Executes the provided command as the console.
* @param commandWithoutSlash the command, without the eventual slash at the beginning. * @param commandWithoutSlash the command, without the eventual slash at the beginning.
@@ -36,17 +42,15 @@ public class CLIBrigadierDispatcher extends BrigadierDispatcher<CLICommandSender
@Override @Override
public int complete(String buffer, int cursor, List<CharSequence> candidates) { public void complete(LineReader lineReader, ParsedLine parsedLine, List<Candidate> candidates) {
String bufferBeforeCursor = parsedLine.line().substring(0, parsedLine.cursor());
String bufferBeforeCursor = buffer.substring(0, cursor);
Suggestions completeResult = getSuggestions(bufferBeforeCursor); Suggestions completeResult = getSuggestions(bufferBeforeCursor);
completeResult.getList().stream() completeResult.getList().stream()
.map(Suggestion::getText) .map(Suggestion::getText)
.map(Candidate::new)
.forEach(candidates::add); .forEach(candidates::add);
return completeResult.getRange().getStart();
} }
/** /**

View File

@@ -41,6 +41,9 @@ public interface CLICommandSender extends Audience {
*/ */
void sendMessage(String message); void sendMessage(String message);
@SuppressWarnings({"UnstableApiUsage", "deprecation"})
@Override // force implementation of super-interface default method @Override // force implementation of super-interface default method
void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type); void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type);
} }

View File

@@ -11,6 +11,12 @@ import org.jetbrains.annotations.NotNull;
* The console command sender. * The console command sender.
*/ */
public class CLIConsoleCommandSender implements CLICommandSender { public class CLIConsoleCommandSender implements CLICommandSender {
/**
* Creates a new console command sender.
*/
protected CLIConsoleCommandSender() {}
public String getName() { public String getName() {
return "Console"; return "Console";
} }
@@ -32,7 +38,7 @@ public class CLIConsoleCommandSender implements CLICommandSender {
} }
@Override @Override
public void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type) { public void sendMessage(@NotNull Identity source, @NotNull Component message, @SuppressWarnings({"UnstableApiUsage", "deprecation"}) @NotNull MessageType type) {
sendMessage(Chat.chatComponent(message).getLegacyText()); sendMessage(Chat.chatComponent(message).getLegacyText());
} }
} }

View File

@@ -14,11 +14,11 @@ import com.mojang.brigadier.tree.CommandNode;
import com.mojang.brigadier.tree.LiteralCommandNode; import com.mojang.brigadier.tree.LiteralCommandNode;
import com.mojang.brigadier.tree.RootCommandNode; import com.mojang.brigadier.tree.RootCommandNode;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.chat.Chat;
import fr.pandacube.lib.chat.Chat.FormatableChat; import fr.pandacube.lib.chat.Chat.FormattableChat;
import fr.pandacube.lib.chat.ChatTreeNode; import fr.pandacube.lib.chat.ChatTreeNode;
import fr.pandacube.lib.cli.CLIApplication; import fr.pandacube.lib.cli.CLIApplication;
import fr.pandacube.lib.util.log.Log; import fr.pandacube.lib.util.log.Log;
import net.md_5.bungee.api.chat.BaseComponent; import net.kyori.adventure.text.Component;
import java.util.ArrayList; import java.util.ArrayList;
import java.util.Arrays; import java.util.Arrays;
@@ -36,6 +36,11 @@ import static fr.pandacube.lib.chat.ChatStatic.text;
*/ */
public class CommandAdmin extends CLIBrigadierCommand { public class CommandAdmin extends CLIBrigadierCommand {
/**
* Initializes the admin command.
*/
public CommandAdmin() {}
@Override @Override
protected LiteralArgumentBuilder<CLICommandSender> buildCommand() { protected LiteralArgumentBuilder<CLICommandSender> buildCommand() {
return literal("admin") return literal("admin")
@@ -187,16 +192,16 @@ public class CommandAdmin extends CLIBrigadierCommand {
private BaseComponent displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) { private Component displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) {
if (node == null) if (node == null)
throw new IllegalArgumentException("node must not be null"); throw new IllegalArgumentException("node must not be null");
FormatableChat d; FormattableChat d;
if (node instanceof RootCommandNode) { if (node instanceof RootCommandNode) {
d = text("(root)").italic() d = text("(root)").italic()
.hover("Root command node"); .hover("Root command node");
} }
else if (node instanceof ArgumentCommandNode) { else if (node instanceof ArgumentCommandNode<?, ?> argNode) {
ArgumentType<?> type = ((ArgumentCommandNode<?, ?>) node).getType(); ArgumentType<?> type = argNode.getType();
String typeStr = type.getClass().getSimpleName(); String typeStr = type.getClass().getSimpleName();
if (type instanceof IntegerArgumentType if (type instanceof IntegerArgumentType
|| type instanceof LongArgumentType || type instanceof LongArgumentType

View File

@@ -9,6 +9,11 @@ import fr.pandacube.lib.cli.CLIApplication;
*/ */
public class CommandStop extends CLIBrigadierCommand { public class CommandStop extends CLIBrigadierCommand {
/**
* Initializes the admin command.
*/
public CommandStop() {}
@Override @Override
protected LiteralArgumentBuilder<CLICommandSender> buildCommand() { protected LiteralArgumentBuilder<CLICommandSender> buildCommand() {
return literal("stop") return literal("stop")

View File

@@ -98,4 +98,6 @@ public class CLILogger {
return ps; return ps;
} }
private CLILogger() {}
} }

View File

@@ -45,7 +45,7 @@
<dependency> <dependency>
<groupId>com.mojang</groupId> <groupId>com.mojang</groupId>
<artifactId>brigadier</artifactId> <artifactId>brigadier</artifactId>
<version>1.0.18</version> <version>${brigadier.version}</version>
</dependency> </dependency>
</dependencies> </dependencies>

View File

@@ -3,35 +3,39 @@ package fr.pandacube.lib.commands;
import java.util.logging.Logger; import java.util.logging.Logger;
/** /**
* Throw an instance of this exception to indicate to the plugin command handler that the user has missused the command. * Throw an instance of this exception to indicate to the plugin command handler that the user has badly used the command.
* The message, if provided, must indicate the reason of the mussusage of the command. It will be displayed on the * The message, if provided, must indicate the reason of the bad usage of the command. It will be displayed on the
* screen with eventual indications of how to use the command (help command for example). * screen with eventual indications of how to use the command (help command for example).
* If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}. * If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}.
* *
*/ */
public class BadCommandUsage extends RuntimeException { public class BadCommandUsage extends RuntimeException {
/** Constructs a new runtime exception with no message or cause. /**
* Constructs a new runtime exception with no message or cause.
*/ */
public BadCommandUsage() { public BadCommandUsage() {
super(); super();
} }
/** Constructs a new runtime exception with the specified cause. /**
* Constructs a new runtime exception with the specified cause.
* @param cause the cause. * @param cause the cause.
*/ */
public BadCommandUsage(Throwable cause) { public BadCommandUsage(Throwable cause) {
super(cause); super(cause);
} }
/** Constructs a new runtime exception with the specified message. /**
* Constructs a new runtime exception with the specified message.
* @param message the message. * @param message the message.
*/ */
public BadCommandUsage(String message) { public BadCommandUsage(String message) {
super(message); super(message);
} }
/** Constructs a new runtime exception with the specified message and cause. /**
* Constructs a new runtime exception with the specified message and cause.
* @param message the message. * @param message the message.
* @param cause the cause. * @param cause the cause.
*/ */

View File

@@ -25,6 +25,11 @@ import java.util.function.Predicate;
*/ */
public abstract class BrigadierCommand<S> { public abstract class BrigadierCommand<S> {
/**
* Creates a Brigadier command.
*/
public BrigadierCommand() {}
/** /**
* Returns a builder for this command. * Returns a builder for this command.
@@ -218,14 +223,14 @@ public abstract class BrigadierCommand<S> {
/** /**
* Wraps the provided {@link SuggestionsSupplier} into a Brigadiers {@link SuggestionProvider}. * Wraps the provided {@link SuggestionsSupplier} into a Brigadiers {@link SuggestionProvider}.
* @param suggestions the suggestions to wrap. * @param suggestions the suggestions to wrap.
* @param senderUnwrapper function to convert the command sender provided by brigadier into the command sender * @param senderUnWrapper function to convert the command sender provided by brigadier into the command sender
* supported by {@link SuggestionsSupplier}. * supported by {@link SuggestionsSupplier}.
* @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}. * @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}.
* @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}. * @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}.
*/ */
protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnwrapper) { protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnWrapper) {
return (context, builder) -> { return (context, builder) -> {
AS sender = senderUnwrapper.apply(context.getSource()); AS sender = senderUnWrapper.apply(context.getSource());
String message = builder.getInput(); String message = builder.getInput();
try { try {
int tokenStartPos = builder.getStart(); int tokenStartPos = builder.getStart();

View File

@@ -21,6 +21,11 @@ public abstract class BrigadierDispatcher<S> {
private final CommandDispatcher<S> dispatcher = new CommandDispatcher<>(); private final CommandDispatcher<S> dispatcher = new CommandDispatcher<>();
/**
* Creates a new Dispatcher instance.
*/
public BrigadierDispatcher() {}
/** /**
* Registers the provided command node into this dispatcher. * Registers the provided command node into this dispatcher.

View File

@@ -140,4 +140,8 @@ public class BrigadierSuggestionsUtil {
} }
private BrigadierSuggestionsUtil() {}
} }

View File

@@ -241,7 +241,7 @@ public interface SuggestionsSupplier<S> {
return (s, ti, token, a) -> { return (s, ti, token, a) -> {
try { try {
List<Long> proposedValues = new ArrayList<>(); List<Long> proposedValues = new ArrayList<>();
if (token.length() == 0) { if (token.isEmpty()) {
long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9); long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9);
long end = Math.min(Math.min(start + 9, max), 9); long end = Math.min(Math.min(start + 9, max), 9);
ListUtil.addLongRangeToList(proposedValues, start, end); ListUtil.addLongRangeToList(proposedValues, start, end);
@@ -399,7 +399,7 @@ public interface SuggestionsSupplier<S> {
*/ */
default SuggestionsSupplier<S> quotableString() { default SuggestionsSupplier<S> quotableString() {
return (s, ti, token, a) -> { return (s, ti, token, a) -> {
boolean startWithQuote = token.length() > 0 && (token.charAt(0) == '"' || token.charAt(0) == '\''); boolean startWithQuote = !token.isEmpty() && (token.charAt(0) == '"' || token.charAt(0) == '\'');
String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token; String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token;
String[] argsCopy = Arrays.copyOf(a, a.length); String[] argsCopy = Arrays.copyOf(a, a.length);
argsCopy[a.length - 1] = realToken; argsCopy[a.length - 1] = realToken;

33
pandalib-config/pom.xml Normal file
View File

@@ -0,0 +1,33 @@
<?xml version="1.0" encoding="UTF-8"?>
<project xmlns="http://maven.apache.org/POM/4.0.0"
xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
<parent>
<artifactId>pandalib-parent</artifactId>
<groupId>fr.pandacube.lib</groupId>
<version>1.0-SNAPSHOT</version>
<relativePath>../pom.xml</relativePath>
</parent>
<modelVersion>4.0.0</modelVersion>
<artifactId>pandalib-config</artifactId>
<packaging>jar</packaging>
<repositories>
<repository>
<id>bungeecord-repo</id>
<url>https://oss.sonatype.org/content/repositories/snapshots</url>
</repository>
</repositories>
<dependencies>
<dependency>
<groupId>net.md-5</groupId>
<artifactId>bungeecord-config</artifactId>
<version>${bungeecord.version}</version>
</dependency>
</dependencies>
</project>

View File

@@ -1,7 +1,4 @@
package fr.pandacube.lib.core.config; package fr.pandacube.lib.config;
import fr.pandacube.lib.chat.ChatColorUtil;
import fr.pandacube.lib.util.log.Log;
import java.io.BufferedReader; import java.io.BufferedReader;
import java.io.File; import java.io.File;
@@ -56,7 +53,7 @@ public abstract class AbstractConfig {
while ((line = reader.readLine()) != null) { while ((line = reader.readLine()) != null) {
String trimmedLine = line.trim(); String trimmedLine = line.trim();
if (ignoreEmpty && trimmedLine.equals("")) if (ignoreEmpty && trimmedLine.isEmpty())
continue; continue;
if (ignoreHashtagComment && trimmedLine.startsWith("#")) if (ignoreHashtagComment && trimmedLine.startsWith("#"))
@@ -114,25 +111,6 @@ public abstract class AbstractConfig {
} }
/**
* Utility method to that translate the {@code '&'} formatted string to the legacy format.
* @param string the string to convert.
* @return a legacy formatted string (using {@code '§'}).
*/
public static String getTranslatedColorCode(String string) {
return ChatColorUtil.translateAlternateColorCodes('&', string);
}
/**
* Logs the message as a warning into console, prefixed with the context of this config.
* @param message the message to log.
*/
protected void warning(String message) {
Log.warning("Error in configuration '"+configFile.getName()+"': " + message);
}
/** /**
* The type of config. * The type of config.
*/ */

View File

@@ -1,4 +1,4 @@
package fr.pandacube.lib.core.config; package fr.pandacube.lib.config;
import java.io.File; import java.io.File;
import java.io.IOException; import java.io.IOException;

View File

@@ -37,6 +37,12 @@
<version>${project.version}</version> <version>${project.version}</version>
</dependency> </dependency>
<dependency>
<groupId>com.google.guava</groupId>
<artifactId>guava</artifactId>
<version>${guava.version}</version>
</dependency>
<!-- Cron expression interpreter --> <!-- Cron expression interpreter -->
<dependency> <dependency>
<groupId>ch.eitchnet</groupId> <groupId>ch.eitchnet</groupId>

View File

@@ -1,8 +1,8 @@
package fr.pandacube.lib.core.backup; package fr.pandacube.lib.core.backup;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.chat.Chat;
import fr.pandacube.lib.chat.LegacyChatFormat;
import fr.pandacube.lib.util.log.Log; import fr.pandacube.lib.util.log.Log;
import net.md_5.bungee.api.ChatColor;
import java.io.File; import java.io.File;
import java.time.LocalDateTime; import java.time.LocalDateTime;
@@ -70,6 +70,11 @@ public abstract class BackupCleaner implements UnaryOperator<TreeSet<LocalDateTi
}; };
} }
/**
* Create a backup cleaner.
*/
public BackupCleaner() {}
/** /**
* Creates a new {@link BackupCleaner} that keeps the archives kept by this {@link BackupCleaner} or by the provided * Creates a new {@link BackupCleaner} that keeps the archives kept by this {@link BackupCleaner} or by the provided
@@ -102,14 +107,14 @@ public abstract class BackupCleaner implements UnaryOperator<TreeSet<LocalDateTi
if (files == null) if (files == null)
return; return;
Log.info("[Backup] Cleaning up backup directory " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + "..."); Log.info("[Backup] Cleaning up backup directory " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + "...");
TreeMap<LocalDateTime, File> datedFiles = new TreeMap<>(); TreeMap<LocalDateTime, File> datedFiles = new TreeMap<>();
for (String filename : files) { for (String filename : files) {
File file = new File(archiveDir, filename); File file = new File(archiveDir, filename);
if (!filename.matches("\\d{8}-\\d{6}\\.zip")) { if (!filename.matches("\\d{8}-\\d{6}\\.zip")) {
Log.warning("[Backup] " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + " Invalid file in backup directory: " + filename); Log.warning("[Backup] " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + " Invalid file in backup directory: " + filename);
continue; continue;
} }
@@ -118,7 +123,7 @@ public abstract class BackupCleaner implements UnaryOperator<TreeSet<LocalDateTi
try { try {
ldt = LocalDateTime.parse(dateTimeStr, BackupProcess.dateFileNameFormatter); ldt = LocalDateTime.parse(dateTimeStr, BackupProcess.dateFileNameFormatter);
} catch (DateTimeParseException e) { } catch (DateTimeParseException e) {
Log.warning("[Backup] " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + " Unable to parse file name to a date-time: " + filename, e); Log.warning("[Backup] " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + " Unable to parse file name to a date-time: " + filename, e);
continue; continue;
} }
@@ -151,7 +156,7 @@ public abstract class BackupCleaner implements UnaryOperator<TreeSet<LocalDateTi
if (testOnly || oneDeleted) if (testOnly || oneDeleted)
Log.warning(c.getLegacyText()); Log.warning(c.getLegacyText());
Log.info("[Backup] Backup directory " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + " cleaned."); Log.info("[Backup] Backup directory " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + " cleaned.");
} }

View File

@@ -1,10 +1,10 @@
package fr.pandacube.lib.core.backup; package fr.pandacube.lib.core.backup;
import fc.cron.CronExpression; import fc.cron.CronExpression;
import fr.pandacube.lib.chat.LegacyChatFormat;
import fr.pandacube.lib.core.cron.CronScheduler; import fr.pandacube.lib.core.cron.CronScheduler;
import fr.pandacube.lib.util.FileUtils; import fr.pandacube.lib.util.FileUtils;
import fr.pandacube.lib.util.log.Log; import fr.pandacube.lib.util.log.Log;
import net.md_5.bungee.api.ChatColor;
import java.io.File; import java.io.File;
import java.text.DateFormat; import java.text.DateFormat;
@@ -209,7 +209,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
File sourceDir = getSourceDir(); File sourceDir = getSourceDir();
if (!sourceDir.exists()) { if (!sourceDir.exists()) {
Log.warning("[Backup] Unable to compress " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + ": source directory " + sourceDir + " doesn't exist"); Log.warning("[Backup] Unable to compress " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + ": source directory " + sourceDir + " doesn't exist");
return; return;
} }
@@ -219,7 +219,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
onBackupStart(); onBackupStart();
new Thread(() -> { new Thread(() -> {
Log.info("[Backup] Starting for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " ..."); Log.info("[Backup] Starting for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " ...");
compressor = new ZipCompressor(sourceDir, target, 9, filter); compressor = new ZipCompressor(sourceDir, target, 9, filter);
@@ -229,7 +229,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
success = true; success = true;
Log.info("[Backup] Finished for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET); Log.info("[Backup] Finished for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET);
try { try {
BackupCleaner cleaner = getBackupCleaner(); BackupCleaner cleaner = getBackupCleaner();
@@ -267,7 +267,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
* Logs the scheduling status of this backup process. * Logs the scheduling status of this backup process.
*/ */
public void displayNextSchedule() { public void displayNextSchedule() {
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " next backup on " Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " next backup on "
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext()))); + DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext())));
} }
@@ -297,7 +297,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
public void logProgress() { public void logProgress() {
if (compressor == null) if (compressor == null)
return; return;
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + ": " + compressor.getState().getLegacyText()); Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + ": " + compressor.getState().getLegacyText());
} }

View File

@@ -1,8 +1,8 @@
package fr.pandacube.lib.core.backup; package fr.pandacube.lib.core.backup;
import com.google.common.io.Files; import com.google.common.io.Files;
import fr.pandacube.lib.chat.LegacyChatFormat;
import fr.pandacube.lib.util.log.Log; import fr.pandacube.lib.util.log.Log;
import net.md_5.bungee.api.ChatColor;
import java.io.File; import java.io.File;
import java.io.IOException; import java.io.IOException;
@@ -53,7 +53,7 @@ public class RotatedLogsBackupProcess extends BackupProcess {
if (!getSourceDir().isDirectory()) if (!getSourceDir().isDirectory())
return; return;
Log.info("[Backup] Starting for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " ..."); Log.info("[Backup] Starting for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " ...");
try { try {
// wait a little after the log message above, in case the log file rotation has to be performed. // wait a little after the log message above, in case the log file rotation has to be performed.
@@ -82,9 +82,9 @@ public class RotatedLogsBackupProcess extends BackupProcess {
success = true; success = true;
Log.info("[Backup] Finished for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET); Log.info("[Backup] Finished for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET);
} catch (Exception e) { } catch (Exception e) {
Log.severe("[Backup] Failed for : " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET, e); Log.severe("[Backup] Failed for : " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET, e);
} finally { } finally {
onBackupEnd(success); onBackupEnd(success);

View File

@@ -5,6 +5,7 @@ import java.io.File;
import java.io.FileOutputStream; import java.io.FileOutputStream;
import java.io.IOException; import java.io.IOException;
import java.nio.file.Files; import java.nio.file.Files;
import java.nio.file.NoSuchFileException;
import java.nio.file.attribute.BasicFileAttributes; import java.nio.file.attribute.BasicFileAttributes;
import java.util.ArrayList; import java.util.ArrayList;
import java.util.List; import java.util.List;
@@ -117,7 +118,11 @@ public class ZipCompressor {
} }
for (Entry entry : entriesToCompress) { for (Entry entry : entriesToCompress) {
try {
entry.zip(); entry.zip();
} catch (NoSuchFileException ignored) {
// file has been deleted since
}
} }
synchronized (stateLock) { synchronized (stateLock) {

View File

@@ -54,7 +54,7 @@ public class CronScheduler {
long now = System.currentTimeMillis(); long now = System.currentTimeMillis();
if (!tasks.isEmpty()) { if (!tasks.isEmpty()) {
CronTask next = tasks.get(0); CronTask next = tasks.getFirst();
if (next.nextRun <= now) { if (next.nextRun <= now) {
next.runAsync(); next.runAsync();
setLastRun(next.taskId, now); setLastRun(next.taskId, now);
@@ -224,5 +224,6 @@ public class CronScheduler {
.toEpochMilli(); .toEpochMilli();
} }
private CronScheduler() {}
} }

View File

@@ -3,6 +3,7 @@ package fr.pandacube.lib.core.json;
import com.google.gson.Gson; import com.google.gson.Gson;
import com.google.gson.GsonBuilder; import com.google.gson.GsonBuilder;
import com.google.gson.JsonParseException; import com.google.gson.JsonParseException;
import com.google.gson.Strictness;
import com.google.gson.ToNumberStrategy; import com.google.gson.ToNumberStrategy;
import com.google.gson.TypeAdapter; import com.google.gson.TypeAdapter;
import com.google.gson.TypeAdapterFactory; import com.google.gson.TypeAdapterFactory;
@@ -32,7 +33,7 @@ public class Json {
boolean isFloat = value.contains("."); boolean isFloat = value.contains(".");
if (isFloat) { if (isFloat) {
// if float, will only parse to Double // if is float, will only parse to Double
// (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat) // (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat)
try { try {
Double d = Double.valueOf(value); Double d = Double.valueOf(value);
@@ -74,21 +75,21 @@ public class Json {
public static final Gson gson = build(Function.identity()); public static final Gson gson = build(Function.identity());
/** /**
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#setPrettyPrinting()} and support * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#setPrettyPrinting()} and support
* for Java records and additional {@link TypeAdapterFactory} provided with * for Java records and additional {@link TypeAdapterFactory} provided with
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}. * {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
*/ */
public static final Gson gsonPrettyPrinting = build(GsonBuilder::setPrettyPrinting); public static final Gson gsonPrettyPrinting = build(GsonBuilder::setPrettyPrinting);
/** /**
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()} and support for * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()} and support for
* Java records and additional {@link TypeAdapterFactory} provided with * Java records and additional {@link TypeAdapterFactory} provided with
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}. * {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
*/ */
public static final Gson gsonSerializeNulls = build(GsonBuilder::serializeNulls); public static final Gson gsonSerializeNulls = build(GsonBuilder::serializeNulls);
/** /**
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()}, * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()},
* {@link GsonBuilder#setPrettyPrinting()} and support for Java records and additional {@link TypeAdapterFactory} * {@link GsonBuilder#setPrettyPrinting()} and support for Java records and additional {@link TypeAdapterFactory}
* provided with {@link #registerTypeAdapterFactory(TypeAdapterFactory)}. * provided with {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
*/ */
@@ -105,7 +106,7 @@ public class Json {
.registerTypeAdapterFactory(new CustomAdapterFactory()) .registerTypeAdapterFactory(new CustomAdapterFactory())
.disableHtmlEscaping() .disableHtmlEscaping()
.setObjectToNumberStrategy(YAML_EQUIVALENT_NUMBER_STRATEGY) .setObjectToNumberStrategy(YAML_EQUIVALENT_NUMBER_STRATEGY)
.setLenient(); .setStrictness(Strictness.LENIENT);
return builderModifier.apply(base).create(); return builderModifier.apply(base).create();
} }
@@ -163,4 +164,6 @@ public class Json {
} }
}*/ }*/
private Json() {}
} }

View File

@@ -30,6 +30,8 @@ public class ThrowableAdapter implements JsonSerializer<Throwable>, JsonDeserial
/* package */ static final TypeAdapterFactory FACTORY = TreeTypeAdapter.newTypeHierarchyFactory(Throwable.class, new ThrowableAdapter()); /* package */ static final TypeAdapterFactory FACTORY = TreeTypeAdapter.newTypeHierarchyFactory(Throwable.class, new ThrowableAdapter());
private ThrowableAdapter() {}
@Override @Override
public Throwable deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException { public Throwable deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
@@ -132,30 +134,30 @@ public class ThrowableAdapter implements JsonSerializer<Throwable>, JsonDeserial
} }
private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) { private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) {
BiFunction<String, Throwable, T> constructor = null; BiFunction<String, Throwable, T> constructionFunction = null;
// try (String, Throwable) constructor // try (String, Throwable) constructor
try { try {
Constructor<T> constr = clazz.getConstructor(String.class, Throwable.class); Constructor<T> constructor = clazz.getConstructor(String.class, Throwable.class);
if (constr.canAccess(null)) { if (constructor.canAccess(null)) {
constructor = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m, t)); constructionFunction = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m, t));
} }
} catch (ReflectiveOperationException ignore) { } } catch (ReflectiveOperationException ignore) { }
// try (String) constructor // try (String) constructor
try { try {
Constructor<T> constr = clazz.getConstructor(String.class); Constructor<T> constructor = clazz.getConstructor(String.class);
if (constr.canAccess(null)) { if (constructor.canAccess(null)) {
constructor = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m))); constructionFunction = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m)));
} }
} catch (ReflectiveOperationException ignore) { } } catch (ReflectiveOperationException ignore) { }
if (constructor == null) { if (constructionFunction == null) {
Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String)."); Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String).");
return null; return null;
} }
return new ThrowableSubAdapter<>(constructor); return new ThrowableSubAdapter<>(constructionFunction);
} }

View File

@@ -238,4 +238,7 @@ public class TypeConverter {
} }
private TypeConverter() {}
} }

View File

@@ -58,6 +58,9 @@ public record MinecraftVersionList(
private static final TypeToken<Map<String, Integer>> MAP_STR_INT_TYPE = new TypeToken<>() { }; private static final TypeToken<Map<String, Integer>> MAP_STR_INT_TYPE = new TypeToken<>() { };
private static final TypeToken<Map<Integer, List<String>>> MAP_INT_LIST_STRING_TYPE = new TypeToken<>() { }; private static final TypeToken<Map<Integer, List<String>>> MAP_INT_LIST_STRING_TYPE = new TypeToken<>() { };
private MinecraftVersionListAdapter() {}
@Override @Override
public MinecraftVersionList deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException { public MinecraftVersionList deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
if (!(json instanceof JsonObject jsonObj)) if (!(json instanceof JsonObject jsonObj))

View File

@@ -37,8 +37,8 @@ public class MinecraftVersionUtil {
/** /**
* Decompose a version string into a series of integers. * Decompose a version string into a series of integers.
* @param v a string representation of a version (eg. 1.19.1). * @param v a string representation of a version (e.g. 1.19.1).
* @return an array of int representing the provided version (eg. [1, 19, 1]). * @return an array of int representing the provided version (e.g. [1, 19, 1]).
*/ */
public static int[] decomposedVersion(String v) { public static int[] decomposedVersion(String v) {
try { try {
@@ -135,4 +135,7 @@ public class MinecraftVersionUtil {
return set; return set;
} }
private MinecraftVersionUtil() {}
} }

View File

@@ -68,11 +68,11 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
private static void init() { private static void init() {
// try online source first // try online source first
try { try (HttpClient cl = HttpClient.newBuilder()
HttpResponse<String> response = HttpClient.newBuilder()
.connectTimeout(Duration.ofSeconds(5)) .connectTimeout(Duration.ofSeconds(5))
.build() .build()) {
.send(HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(), HttpResponse<String> response = cl.send(
HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
BodyHandlers.ofString() BodyHandlers.ofString()
); );
if (response.statusCode() == 200) { if (response.statusCode() == 200) {
@@ -123,7 +123,7 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
/** /**
* Gets the {@link ProtocolVersion} associated with the provided Minecraft version. * Gets the {@link ProtocolVersion} associated with the provided Minecraft version.
* @param version The Minecraft version, in the format "X.X[.X]" (eg. "1.17" or "1.8.8"). * @param version The Minecraft version, in the format "X.X[.X]" (e.g. "1.17" or "1.8.8").
* @return an instance of {@link ProtocolVersion}. * @return an instance of {@link ProtocolVersion}.
*/ */
public static ProtocolVersion ofVersion(String version) { public static ProtocolVersion ofVersion(String version) {

View File

@@ -66,7 +66,16 @@
"1.20.3": 765, "1.20.3": 765,
"1.20.4": 765, "1.20.4": 765,
"1.20.5": 766, "1.20.5": 766,
"1.20.6": 766 "1.20.6": 766,
"1.21": 767,
"1.21.1": 767,
"1.21.2": 768,
"1.21.3": 768,
"1.21.4": 769,
"1.21.5": 770,
"1.21.6": 771,
"1.21.7": 772,
"1.21.8": 772
}, },
"versionsOfProtocol": { "versionsOfProtocol": {
"4": [ "4": [
@@ -217,6 +226,27 @@
"766": [ "766": [
"1.20.5", "1.20.5",
"1.20.6" "1.20.6"
],
"767": [
"1.21",
"1.21.1"
],
"768": [
"1.21.2",
"1.21.3"
],
"769": [
"1.21.4"
],
"770": [
"1.21.5"
],
"771": [
"1.21.6"
],
"772": [
"1.21.7",
"1.21.8"
] ]
} }
} }

View File

@@ -56,18 +56,21 @@
<artifact>org.apache.commons:commons-dbcp2</artifact> <artifact>org.apache.commons:commons-dbcp2</artifact>
<excludes> <excludes>
<exclude>META-INF/MANIFEST.MF</exclude> <exclude>META-INF/MANIFEST.MF</exclude>
<exclude>META-INF/versions/9/**</exclude>
</excludes> </excludes>
</filter> </filter>
<filter> <filter>
<artifact>org.apache.commons:commons-pool2</artifact> <artifact>org.apache.commons:commons-pool2</artifact>
<excludes> <excludes>
<exclude>META-INF/MANIFEST.MF</exclude> <exclude>META-INF/MANIFEST.MF</exclude>
<exclude>META-INF/versions/9/**</exclude>
</excludes> </excludes>
</filter> </filter>
<filter> <filter>
<artifact>commons-logging:commons-logging</artifact> <artifact>commons-logging:commons-logging</artifact>
<excludes> <excludes>
<exclude>META-INF/MANIFEST.MF</exclude> <exclude>META-INF/MANIFEST.MF</exclude>
<exclude>META-INF/versions/9/**</exclude>
</excludes> </excludes>
</filter> </filter>
</filters> </filters>

View File

@@ -227,7 +227,7 @@ public final class DB {
*/ */
public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException { public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException {
SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset); SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset);
return (elements.size() == 0) ? null : elements.get(0); return (elements.isEmpty()) ? null : elements.get(0);
} }
/** /**

View File

@@ -23,7 +23,8 @@ public class DBConnection {
public DBConnection(String host, int port, String dbname, String login, String password) { public DBConnection(String host, int port, String dbname, String login, String password) {
this("jdbc:mysql://" + host + ":" + port + "/" + dbname this("jdbc:mysql://" + host + ":" + port + "/" + dbname
+ "?useUnicode=true" + "?useUnicode=true"
+ "&useSSL=false" + "&sslMode=DISABLED"
+ "&allowPublicKeyRetrieval=true"
+ "&characterEncoding=utf8" + "&characterEncoding=utf8"
+ "&characterSetResults=utf8" + "&characterSetResults=utf8"
+ "&character_set_server=utf8mb4" + "&character_set_server=utf8mb4"

View File

@@ -16,6 +16,11 @@ import java.util.stream.Collectors;
*/ */
public class SQLElementList<E extends SQLElement<E>> extends ArrayList<E> { public class SQLElementList<E extends SQLElement<E>> extends ArrayList<E> {
/**
* Creates an empty list of sql elements.
*/
public SQLElementList() {}
/** /**
* Stores all the values modified by {@link #setCommon(SQLField, Object)}. * Stores all the values modified by {@link #setCommon(SQLField, Object)}.
*/ */

View File

@@ -232,12 +232,8 @@ public class SQLField<E extends SQLElement<E>, T> {
} }
@SuppressWarnings({"rawtypes", "unchecked"}) @SuppressWarnings({"rawtypes", "unchecked"})
public Object fromJavaTypeToJDBCType(Object value) throws DBException { /* package */ Object fromJavaTypeToJDBCType(Object value) throws DBException {
Object ret = value; Object ret = value;
if (value != null && type instanceof SQLCustomType customType) { if (value != null && type instanceof SQLCustomType customType) {
try { try {
@@ -250,7 +246,7 @@ public class SQLField<E extends SQLElement<E>, T> {
return ret; return ret;
} }
public Collection<Object> fromListJavaTypeToJDBCType(Collection<?> values) throws DBException { /* package */ Collection<Object> fromListJavaTypeToJDBCType(Collection<?> values) throws DBException {
if (values == null) if (values == null)
return null; return null;
List<Object> ret = new ArrayList<>(values.size()); List<Object> ret = new ArrayList<>(values.size());

View File

@@ -42,7 +42,7 @@ public class SQLType<T> {
@Override @Override
public boolean equals(Object obj) { public boolean equals(Object obj) {
return obj instanceof SQLType o return obj instanceof SQLType<?> o
&& toString().equals(o.toString()); && toString().equals(o.toString());
} }

View File

@@ -13,6 +13,11 @@ import fr.pandacube.lib.util.log.Log;
*/ */
public abstract class SQLWhere<E extends SQLElement<E>> { public abstract class SQLWhere<E extends SQLElement<E>> {
/**
* Creates a SQL WHERE expression.
*/
protected SQLWhere() {}
/* package */ abstract ParameterizedSQLString toSQL() throws DBException; /* package */ abstract ParameterizedSQLString toSQL() throws DBException;
@Override @Override
@@ -69,6 +74,7 @@ public abstract class SQLWhere<E extends SQLElement<E>> {
* Create a custom SQL {@code WHERE} expression. * Create a custom SQL {@code WHERE} expression.
* @param whereExpr the raw SQL {@code WHERE} expression. * @param whereExpr the raw SQL {@code WHERE} expression.
* @return a new SQL {@code WHERE} expression. * @return a new SQL {@code WHERE} expression.
* @param <E> the table type.
*/ */
public static <E extends SQLElement<E>> SQLWhere<E> expression(String whereExpr) { public static <E extends SQLElement<E>> SQLWhere<E> expression(String whereExpr) {
return expression(whereExpr, List.of()); return expression(whereExpr, List.of());
@@ -79,6 +85,7 @@ public abstract class SQLWhere<E extends SQLElement<E>> {
* @param whereExpr the raw SQL {@code WHERE} expression. * @param whereExpr the raw SQL {@code WHERE} expression.
* @param params the parameters of the provided expression. * @param params the parameters of the provided expression.
* @return a new SQL {@code WHERE} expression. * @return a new SQL {@code WHERE} expression.
* @param <E> the table type.
*/ */
public static <E extends SQLElement<E>> SQLWhere<E> expression(String whereExpr, List<Object> params) { public static <E extends SQLElement<E>> SQLWhere<E> expression(String whereExpr, List<Object> params) {
return new SQLWhereCustomExpression<>(whereExpr, params); return new SQLWhereCustomExpression<>(whereExpr, params);
@@ -89,6 +96,7 @@ public abstract class SQLWhere<E extends SQLElement<E>> {
* @param leftExpr the raw SQL left operand. * @param leftExpr the raw SQL left operand.
* @param valuesIn the values on the right of the {@code IN} operator. * @param valuesIn the values on the right of the {@code IN} operator.
* @return a new SQL {@code WHERE} expression. * @return a new SQL {@code WHERE} expression.
* @param <E> the table type.
*/ */
public static <E extends SQLElement<E>> SQLWhere<E> expressionIn(String leftExpr, Collection<?> valuesIn) { public static <E extends SQLElement<E>> SQLWhere<E> expressionIn(String leftExpr, Collection<?> valuesIn) {
return expressionIn(leftExpr, List.of(), valuesIn); return expressionIn(leftExpr, List.of(), valuesIn);
@@ -100,6 +108,7 @@ public abstract class SQLWhere<E extends SQLElement<E>> {
* @param leftParams the parameters of the left operand. * @param leftParams the parameters of the left operand.
* @param valuesIn the values on the right of the {@code IN} operator. * @param valuesIn the values on the right of the {@code IN} operator.
* @return a new SQL {@code WHERE} expression. * @return a new SQL {@code WHERE} expression.
* @param <E> the table type.
*/ */
public static <E extends SQLElement<E>> SQLWhere<E> expressionIn(String leftExpr, List<Object> leftParams, Collection<?> valuesIn) { public static <E extends SQLElement<E>> SQLWhere<E> expressionIn(String leftExpr, List<Object> leftParams, Collection<?> valuesIn) {
return new SQLWhereInCustom<>(leftExpr, leftParams, valuesIn); return new SQLWhereInCustom<>(leftExpr, leftParams, valuesIn);

View File

@@ -21,4 +21,8 @@
</dependency> </dependency>
</dependencies> </dependencies>
<properties>
<maven.javadoc.skip>true</maven.javadoc.skip>
</properties>
</project> </project>

View File

@@ -16,7 +16,7 @@
<repositories> <repositories>
<repository> <repository>
<id>papermc</id> <id>papermc</id>
<url>https://papermc.io/repo/repository/maven-public/</url> <url>https://repo.papermc.io/repository/maven-public/</url>
</repository> </repository>
<!-- WorldEdit --> <!-- WorldEdit -->

View File

@@ -82,6 +82,12 @@ public class PandalibPaperPermissions implements Listener {
} }
} }
/**
* Creates a {@link PandalibPaperPermissions} instance.
*/
private PandalibPaperPermissions() {}
/** /**
* Player login event handler. * Player login event handler.
* @param event the event. * @param event the event.

View File

@@ -7,6 +7,7 @@ import net.milkbowl.vault.chat.Chat;
import net.milkbowl.vault.permission.Permission; import net.milkbowl.vault.permission.Permission;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.OfflinePlayer; import org.bukkit.OfflinePlayer;
import org.bukkit.entity.Player;
import org.bukkit.plugin.ServicePriority; import org.bukkit.plugin.ServicePriority;
import java.util.List; import java.util.List;
@@ -120,6 +121,13 @@ import java.util.List;
return true; return true;
} }
@Override
public boolean playerAdd(Player player, String permission) {
// override because the super class sets the permission on the current world of the player, that is probably
// not intended by the calling plugin
return playerAdd(null, player, permission);
}
@Deprecated @Deprecated
@Override @Override
public boolean playerRemove(String world, String player, String permission) { public boolean playerRemove(String world, String player, String permission) {
@@ -136,6 +144,14 @@ import java.util.List;
return true; return true;
} }
@Override
public boolean playerRemove(Player player, String permission) {
// to stay coherent with the override of #playerAdd(Player, String), we also override this method.
// Will try first to remove the permission on the world itself (like super-method), then if it doesn't exist,
// removes on the server level.
return super.playerRemove(player, permission) || playerRemove(null, player, permission);
}
@Override @Override
public boolean groupHas(String world, String group, String permission) { public boolean groupHas(String world, String group, String permission) {
checkEnabled(); checkEnabled();

View File

@@ -16,12 +16,17 @@
<repositories> <repositories>
<repository> <repository>
<id>papermc</id> <id>papermc</id>
<url>https://papermc.io/repo/repository/maven-public/</url> <url>https://repo.papermc.io/repository/maven-public/</url>
</repository> </repository>
<repository> <repository>
<id>fabricmc</id> <id>fabricmc</id>
<url>https://maven.fabricmc.net/</url> <url>https://maven.fabricmc.net/</url>
</repository> </repository>
<repository>
<id>minecraft-libraries</id>
<name>Minecraft Libraries</name>
<url>https://libraries.minecraft.net</url>
</repository>
</repositories> </repositories>
<dependencies> <dependencies>
@@ -71,6 +76,12 @@
<version>${project.version}</version> <version>${project.version}</version>
</dependency> </dependency>
<dependency>
<groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-bungee-chat</artifactId>
<version>${project.version}</version>
</dependency>
<dependency> <dependency>
<groupId>fr.pandacube.lib</groupId> <groupId>fr.pandacube.lib</groupId>
<artifactId>pandalib-paper-permissions</artifactId> <artifactId>pandalib-paper-permissions</artifactId>
@@ -78,25 +89,18 @@
<scope>provided</scope> <scope>provided</scope>
</dependency> </dependency>
<dependency>
<groupId>com.mojang</groupId>
<artifactId>datafixerupper</artifactId>
<version>${datafixerupper.version}</version>
</dependency>
<!-- Paper --> <!-- Paper -->
<dependency> <dependency>
<groupId>io.papermc.paper</groupId> <groupId>io.papermc.paper</groupId>
<artifactId>paper-api</artifactId> <artifactId>paper-api</artifactId>
<version>${paper.version}-SNAPSHOT</version> <version>${paper.version}-SNAPSHOT</version>
</dependency> </dependency>
<dependency>
<groupId>io.papermc.paper</groupId>
<artifactId>paper-mojangapi</artifactId>
<version>${paper.version}-SNAPSHOT</version>
</dependency>
<!-- Needed to read obfuscation mapping file. Already included in Paper -->
<dependency>
<groupId>net.fabricmc</groupId>
<artifactId>mapping-io</artifactId>
<version>0.5.0</version>
<scope>provided</scope>
</dependency>
</dependencies> </dependencies>
<build> <build>

View File

@@ -5,27 +5,47 @@ import fr.pandacube.lib.paper.json.PaperJson;
import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager; import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager;
import org.bukkit.plugin.Plugin; import org.bukkit.plugin.Plugin;
/**
* Main class for pandalib-paper.
*/
public class PandaLibPaper { public class PandaLibPaper {
private static Plugin plugin; private static Plugin plugin;
/**
* Method to call in plugin's {@link Plugin#onLoad()} method.
* @param plugin the plugin instance.
*/
public static void onLoad(Plugin plugin) { public static void onLoad(Plugin plugin) {
PandaLibPaper.plugin = plugin; PandaLibPaper.plugin = plugin;
PaperJson.init(); PaperJson.init();
} }
/**
* Method to call in plugin's {@link Plugin#onEnable()} method.
*/
public static void onEnable() { public static void onEnable() {
PerformanceAnalysisManager.getInstance(); // initialize PerformanceAnalysisManager.getInstance(); // initialize
ServerStopEvent.init(); ServerStopEvent.init();
} }
/**
* Method to call in plugin's {@link Plugin#onDisable()} method.
*/
public static void disable() { public static void disable() {
PerformanceAnalysisManager.getInstance().cancelInternalBossBar(); PerformanceAnalysisManager.getInstance().deinit();
} }
/**
* Gets the plugin instance.
* @return the plugin instance provided with {@link #onLoad(Plugin)}.
*/
public static Plugin getPlugin() { public static Plugin getPlugin() {
return plugin; return plugin;
} }
private PandaLibPaper() {}
} }

View File

@@ -6,14 +6,65 @@ import java.io.File;
import java.util.ArrayList; import java.util.ArrayList;
import java.util.List; import java.util.List;
/**
* A basic class holding configuration for {@link PaperBackupManager}.
*/
@SuppressWarnings("CanBeFinal") @SuppressWarnings("CanBeFinal")
public class PaperBackupConfig { public class PaperBackupConfig {
/**
* Creates a new Paper backup config.
*/
public PaperBackupConfig() {}
/**
* Set to true to enable worlds backup.
* Defaults to true.
*/
public boolean worldBackupEnabled = true; public boolean worldBackupEnabled = true;
/**
* Set to true to enable the backup of the working directory.
* The workdir backup will already ignore the logs directory and any world folder (folder with a level.dat file in it).
* Defaults to true.
*/
public boolean workdirBackupEnabled = true; public boolean workdirBackupEnabled = true;
/**
* Set to true to enable the backup of logs.
* Defaults to true.
*/
public boolean logsBackupEnabled = true; public boolean logsBackupEnabled = true;
/**
* The cron-formatted scheduling of the worlds and workdir backups.
* The default value is {@code "0 2 * * *"}, that is every day at 2am.
*/
public String scheduling = "0 2 * * *"; // cron format, here is every day at 2am public String scheduling = "0 2 * * *"; // cron format, here is every day at 2am
/**
* The backup target directory.
* Must be set (defaults to null).
*/
public File backupDirectory = null; public File backupDirectory = null;
/**
* The backup cleaner for the worlds backup.
* Defaults to keep 1 backup every 3 month + the last 5 backups.
*/
public BackupCleaner worldBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5)); public BackupCleaner worldBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
/**
* The backup cleaner for the workdir backup.
* Defaults to keep 1 backup every 3 month + the last 5 backups.
*/
public BackupCleaner workdirBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5)); public BackupCleaner workdirBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
/**
* The list of files or directory to ignore.
* Defaults to none.
* The workdir backup will already ignore the logs directory and any world folder (folder with a level.dat file in it).
*/
public List<String> workdirIgnoreList = new ArrayList<>(); public List<String> workdirIgnoreList = new ArrayList<>();
} }

View File

@@ -23,12 +23,19 @@ import java.util.Map;
import java.util.Set; import java.util.Set;
import java.util.concurrent.CancellationException; import java.util.concurrent.CancellationException;
/**
* The backup manager for Paper servers.
*/
public class PaperBackupManager extends BackupManager implements Listener { public class PaperBackupManager extends BackupManager implements Listener {
private final Map<String, PaperWorldProcess> compressWorlds = new HashMap<>(); private final Map<String, PaperWorldProcess> compressWorlds = new HashMap<>();
PaperBackupConfig config; PaperBackupConfig config;
/**
* Instantiate a new backup manager.
* @param config the configuration of the backups.
*/
public PaperBackupManager(PaperBackupConfig config) { public PaperBackupManager(PaperBackupConfig config) {
super(config.backupDirectory); super(config.backupDirectory);
setConfig(config); setConfig(config);
@@ -49,13 +56,17 @@ public class PaperBackupManager extends BackupManager implements Listener {
super.addProcess(process); super.addProcess(process);
} }
/**
* Updates the backups config
* @param config the new config.
*/
public void setConfig(PaperBackupConfig config) { public void setConfig(PaperBackupConfig config) {
this.config = config; this.config = config;
backupQueue.forEach(this::updateProcessConfig); backupQueue.forEach(this::updateProcessConfig);
} }
public void updateProcessConfig(BackupProcess process) { private void updateProcessConfig(BackupProcess process) {
if (process instanceof PaperWorkdirProcess) { if (process instanceof PaperWorkdirProcess) {
process.setEnabled(config.workdirBackupEnabled); process.setEnabled(config.workdirBackupEnabled);
process.setBackupCleaner(config.workdirBackupCleaner); process.setBackupCleaner(config.workdirBackupCleaner);
@@ -119,12 +130,12 @@ public class PaperBackupManager extends BackupManager implements Listener {
private final Set<String> dirtyForSave = new HashSet<>(); private final Set<String> dirtyForSave = new HashSet<>();
@EventHandler(priority = EventPriority.MONITOR) @EventHandler(priority = EventPriority.MONITOR)
public void onWorldLoad(WorldLoadEvent event) { void onWorldLoad(WorldLoadEvent event) {
initWorldProcess(event.getWorld().getName()); initWorldProcess(event.getWorld().getName());
} }
@EventHandler(priority = EventPriority.MONITOR) @EventHandler(priority = EventPriority.MONITOR)
public void onWorldSave(WorldSaveEvent event) { void onWorldSave(WorldSaveEvent event) {
if (event.getWorld().getLoadedChunks().length > 0 if (event.getWorld().getLoadedChunks().length > 0
|| dirtyForSave.contains(event.getWorld().getName())) { || dirtyForSave.contains(event.getWorld().getName())) {
compressWorlds.get(event.getWorld().getName()).setDirtyAfterSave(); compressWorlds.get(event.getWorld().getName()).setDirtyAfterSave();
@@ -137,18 +148,18 @@ public class PaperBackupManager extends BackupManager implements Listener {
@EventHandler(priority = EventPriority.MONITOR) @EventHandler(priority = EventPriority.MONITOR)
public void onPlayerChangeWorldEvent(PlayerChangedWorldEvent event) { void onPlayerChangeWorldEvent(PlayerChangedWorldEvent event) {
dirtyForSave.add(event.getFrom().getName()); dirtyForSave.add(event.getFrom().getName());
dirtyForSave.add(event.getPlayer().getWorld().getName()); dirtyForSave.add(event.getPlayer().getWorld().getName());
} }
@EventHandler(priority = EventPriority.MONITOR) @EventHandler(priority = EventPriority.MONITOR)
public void onPlayerJoin(PlayerJoinEvent event) { void onPlayerJoin(PlayerJoinEvent event) {
dirtyForSave.add(event.getPlayer().getWorld().getName()); dirtyForSave.add(event.getPlayer().getWorld().getName());
} }
@EventHandler(priority = EventPriority.MONITOR) @EventHandler(priority = EventPriority.MONITOR)
public void onPlayerQuit(PlayerQuitEvent event) { void onPlayerQuit(PlayerQuitEvent event) {
dirtyForSave.add(event.getPlayer().getWorld().getName()); dirtyForSave.add(event.getPlayer().getWorld().getName());
} }

View File

@@ -10,11 +10,19 @@ import net.kyori.adventure.bossbar.BossBar.Color;
import net.kyori.adventure.bossbar.BossBar.Overlay; import net.kyori.adventure.bossbar.BossBar.Overlay;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
/**
* A backup process with specific logic around Paper server.
*/
public abstract class PaperBackupProcess extends BackupProcess { public abstract class PaperBackupProcess extends BackupProcess {
private BossBar bossBar; private BossBar bossBar;
/**
* Instantiates a new backup process.
* @param bm the associated backup manager.
* @param id the process identifier.
*/
protected PaperBackupProcess(PaperBackupManager bm, String id) { protected PaperBackupProcess(PaperBackupManager bm, String id) {
super(bm, id); super(bm, id);
} }

View File

@@ -3,8 +3,15 @@ package fr.pandacube.lib.paper.backup;
import java.io.File; import java.io.File;
import java.util.function.BiPredicate; import java.util.function.BiPredicate;
/**
* A backup process with specific logic around Paper server working directory.
*/
public class PaperWorkdirProcess extends PaperBackupProcess { public class PaperWorkdirProcess extends PaperBackupProcess {
/**
* Instantiates a new backup process for the paper server working directory.
* @param bm the associated backup manager.
*/
protected PaperWorkdirProcess(PaperBackupManager bm) { protected PaperWorkdirProcess(PaperBackupManager bm) {
super(bm, "workdir"); super(bm, "workdir");
} }

View File

@@ -1,9 +1,9 @@
package fr.pandacube.lib.paper.backup; package fr.pandacube.lib.paper.backup;
import fr.pandacube.lib.chat.LegacyChatFormat;
import fr.pandacube.lib.paper.scheduler.SchedulerUtil; import fr.pandacube.lib.paper.scheduler.SchedulerUtil;
import fr.pandacube.lib.paper.world.WorldUtil; import fr.pandacube.lib.paper.world.WorldUtil;
import fr.pandacube.lib.util.log.Log; import fr.pandacube.lib.util.log.Log;
import net.md_5.bungee.api.ChatColor;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.World; import org.bukkit.World;
@@ -11,14 +11,22 @@ import java.io.File;
import java.text.DateFormat; import java.text.DateFormat;
import java.util.Date; import java.util.Date;
/**
* A backup process with specific logic around Paper server world.
*/
public class PaperWorldProcess extends PaperBackupProcess { public class PaperWorldProcess extends PaperBackupProcess {
private final String worldName; private final String worldName;
private boolean autoSave = true; private boolean autoSave = true;
protected PaperWorldProcess(PaperBackupManager bm, final String n) { /**
super(bm, "worlds/" + n); * Instantiates a new backup process for a world.
worldName = n; * @param bm the associated backup manager.
* @param worldName the name of the world.
*/
protected PaperWorldProcess(PaperBackupManager bm, final String worldName) {
super(bm, "worlds/" + worldName);
this.worldName = worldName;
} }
private World getWorld() { private World getWorld() {
@@ -62,11 +70,11 @@ public class PaperWorldProcess extends PaperBackupProcess {
public void displayNextSchedule() { public void displayNextSchedule() {
if (hasNextScheduled()) { if (hasNextScheduled()) {
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " is dirty. Next backup on " Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " is dirty. Next backup on "
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext()))); + DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext())));
} }
else { else {
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " is clean. Next backup not scheduled."); Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " is clean. Next backup not scheduled.");
} }
} }
@@ -80,7 +88,7 @@ public class PaperWorldProcess extends PaperBackupProcess {
public void setDirtyAfterSave() { public void setDirtyAfterSave() {
if (!isDirty()) { // don't set dirty if it is already if (!isDirty()) { // don't set dirty if it is already
setDirtySinceNow(); setDirtySinceNow();
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " was saved and is now dirty. Next backup on " Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " was saved and is now dirty. Next backup on "
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG) + DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG)
.format(new Date(getNext())) .format(new Date(getNext()))
); );

View File

@@ -1,8 +1,8 @@
package fr.pandacube.lib.paper.commands; package fr.pandacube.lib.paper.commands;
import com.destroystokyo.paper.brigadier.BukkitBrigadierCommandSource;
import com.mojang.brigadier.CommandDispatcher; import com.mojang.brigadier.CommandDispatcher;
import com.mojang.brigadier.arguments.ArgumentType; import com.mojang.brigadier.arguments.ArgumentType;
import com.mojang.brigadier.builder.LiteralArgumentBuilder;
import com.mojang.brigadier.context.CommandContext; import com.mojang.brigadier.context.CommandContext;
import com.mojang.brigadier.exceptions.CommandSyntaxException; import com.mojang.brigadier.exceptions.CommandSyntaxException;
import com.mojang.brigadier.suggestion.SuggestionProvider; import com.mojang.brigadier.suggestion.SuggestionProvider;
@@ -13,116 +13,124 @@ import fr.pandacube.lib.chat.Chat;
import fr.pandacube.lib.commands.BadCommandUsage; import fr.pandacube.lib.commands.BadCommandUsage;
import fr.pandacube.lib.commands.BrigadierCommand; import fr.pandacube.lib.commands.BrigadierCommand;
import fr.pandacube.lib.commands.SuggestionsSupplier; import fr.pandacube.lib.commands.SuggestionsSupplier;
import fr.pandacube.lib.paper.permissions.PandalibPaperPermissions; import fr.pandacube.lib.paper.PandaLibPaper;
import fr.pandacube.lib.paper.reflect.PandalibPaperReflect;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftVector; import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftVector;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper; import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.BlockPosArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.ComponentArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.EntityArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.EntitySelector;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.BlockPos; import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer; import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure;
import fr.pandacube.lib.players.standalone.AbstractOffPlayer; import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer; import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
import fr.pandacube.lib.players.standalone.AbstractPlayerManager; import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper; import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.util.log.Log; import fr.pandacube.lib.util.log.Log;
import net.kyori.adventure.text.Component; import io.papermc.paper.command.brigadier.CommandSourceStack;
import io.papermc.paper.plugin.lifecycle.event.types.LifecycleEvents;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.World; import org.bukkit.World;
import org.bukkit.command.Command; import org.bukkit.command.Command;
import org.bukkit.command.CommandMap;
import org.bukkit.command.CommandSender; import org.bukkit.command.CommandSender;
import org.bukkit.command.ConsoleCommandSender; import org.bukkit.command.ConsoleCommandSender;
import org.bukkit.command.PluginCommand; import org.bukkit.command.PluginCommand;
import org.bukkit.command.defaults.BukkitCommand;
import org.bukkit.entity.Entity;
import org.bukkit.entity.Player; import org.bukkit.entity.Player;
import org.bukkit.event.EventHandler;
import org.bukkit.event.Listener; import org.bukkit.event.Listener;
import org.bukkit.event.player.PlayerCommandSendEvent;
import org.bukkit.event.server.ServerLoadEvent;
import org.bukkit.plugin.Plugin; import org.bukkit.plugin.Plugin;
import org.bukkit.util.BlockVector;
import org.bukkit.util.Vector; import org.bukkit.util.Vector;
import java.util.ArrayList; import java.lang.reflect.InvocationTargetException;
import java.util.HashSet; import java.util.HashSet;
import java.util.List; import java.util.List;
import java.util.Set; import java.util.Set;
import java.util.function.Predicate; import java.util.function.Predicate;
import java.util.stream.Stream; import java.util.stream.Stream;
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx; import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
/** /**
* Abstract class to hold a command to be integrated into a Paper server vanilla command dispatcher. * Abstract class to hold a command to be integrated into a Paper server vanilla command dispatcher.
*/ */
public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBrigadierCommandSource> implements Listener { @SuppressWarnings("UnstableApiUsage")
public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSourceStack> implements Listener {
private static final Commands vanillaCommandDispatcher; private static CommandDispatcher<CommandSourceStack> vanillaPaperDispatcher = null;
private static final CommandDispatcher<BukkitBrigadierCommandSource> nmsDispatcher;
static { /**
wrapEx(PandalibPaperReflect::init); * Gets the Brigadier dispatcher provided by paper API during {@link LifecycleEvents#COMMANDS}.
vanillaCommandDispatcher = ReflectWrapper.wrapTyped(Bukkit.getServer(), CraftServer.class) * <p>
.getServer() * This Dispatcher is not the vanilla one. Instead, Paper implementation wraps the vanilla one to handle proper registration
.vanillaCommandDispatcher(); * of commands from plugins.
nmsDispatcher = vanillaCommandDispatcher.dispatcher(); * @return the Brigadier dispatcher.
*/
public static CommandDispatcher<CommandSourceStack> getVanillaPaperDispatcher() {
return vanillaPaperDispatcher;
} }
/**
* Gets the root node of the dispatcher from {@link #getVanillaPaperDispatcher()}.
* @return the root node, or null if {@link #getVanillaPaperDispatcher()} is also null.
*/
public static RootCommandNode<CommandSourceStack> getRootNode() {
return vanillaPaperDispatcher == null ? null : vanillaPaperDispatcher.getRoot();
}
private static void updateVanillaPaperDispatcher(CommandDispatcher<CommandSourceStack> newDispatcher) {
if (vanillaPaperDispatcher == null || newDispatcher != vanillaPaperDispatcher) {
vanillaPaperDispatcher = newDispatcher;
// vanillaPaperDispatcher.getRoot() is not the real root but a wrapped root. Trying to map the fake root with the real one to trick the Paper/Brigadier (un)wrapper
RootCommandNode<CommandSourceStack> wrappedRoot = vanillaPaperDispatcher.getRoot();
ReflectClass<?> apiMirrorRootNodeClass = Reflect.ofClassOfInstance(wrappedRoot);
try {
RootCommandNode<?> unwrappedRoot = ((CommandDispatcher<?>) apiMirrorRootNodeClass.method("getDispatcher").invoke(wrappedRoot)).getRoot();
Reflect.ofClass(CommandNode.class).field("unwrappedCached").setValue(wrappedRoot, unwrappedRoot);
Reflect.ofClass(CommandNode.class).field("wrappedCached").setValue(unwrappedRoot, wrappedRoot);
} catch (InvocationTargetException|IllegalAccessException|NoSuchMethodException|NoSuchFieldException e) {
Log.severe("Unable to trick the Paper/Brigadier unwrapper to properly handle commands redirecting to root command node.", e);
}
}
}
/** /**
* Removes a plugin command that overrides a vanilla command, so the vanilla command functionalities are fully * Removes a plugin command that overrides a vanilla command, so the vanilla command functionalities are fully
* restored (so, not only the usage, but also the suggestions and the command structure sent to the client). * restored (so, not only the usage, but also the suggestions and the command structure sent to the client).
* @param name the name of the command to restore. * @param name the name of the command to restore.
*/ */
public static void restoreVanillaCommand(String name) { public static void restoreVanillaCommand(String name) {
CommandMap bukkitCmdMap = Bukkit.getCommandMap();
Command bukkitCommand = bukkitCmdMap.getCommand(name); PandaLibPaper.getPlugin().getLifecycleManager().registerEventHandler(LifecycleEvents.COMMANDS,
if (bukkitCommand != null) { event -> updateVanillaPaperDispatcher(event.registrar().getDispatcher()));
if (VanillaCommandWrapper.REFLECT.get().isInstance(bukkitCommand)) {
//Log.info("Command /" + name + " is already a vanilla command.");
Bukkit.getServer().getScheduler().runTask(PandaLibPaper.getPlugin(), () -> {
if (vanillaPaperDispatcher == null)
return;
CommandNode<CommandSourceStack> targetCommand = vanillaPaperDispatcher.getRoot().getChild("minecraft:" + name);
if (targetCommand == null) {
Log.warning("There is no vanilla command '" + name + "' to restore.");
return; return;
} }
Log.info("Removing Bukkit command /" + name + " (" + getCommandIdentity(bukkitCommand) + ")");
bukkitCmdMap.getKnownCommands().remove(name.toLowerCase(java.util.Locale.ENGLISH));
bukkitCommand.unregister(bukkitCmdMap);
LiteralCommandNode<BukkitBrigadierCommandSource> node = (LiteralCommandNode<BukkitBrigadierCommandSource>) getRootNode().getChild(name); CommandNode<CommandSourceStack> eventuallyBadCommandToReplace = vanillaPaperDispatcher.getRoot().getChild(name);
Command newCommand = new VanillaCommandWrapper(vanillaCommandDispatcher, node).__getRuntimeInstance(); Boolean isPluginCommand = isPluginCommand(eventuallyBadCommandToReplace);
bukkitCmdMap.getKnownCommands().put(name.toLowerCase(), newCommand); if (isPluginCommand != null && isPluginCommand) {
newCommand.register(bukkitCmdMap); Log.info(getCommandIdentity(eventuallyBadCommandToReplace) + " found in the dispatcher. Restoring the vanilla command.");
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(name));
vanillaPaperDispatcher.getRoot().addChild(getAliasNode(targetCommand, name));
} }
/*else if (isPluginCommand == null) {
Log.info(getCommandIdentity(eventuallyBadCommandToReplace) + " found in the dispatcher. Unsure if we restore the vanilla command.");
}*/
});
} }
/**
* Returns the vanilla instance of the Brigadier dispatcher.
* @return the vanilla instance of the Brigadier dispatcher.
*/
public static CommandDispatcher<BukkitBrigadierCommandSource> getNMSDispatcher() {
return nmsDispatcher;
}
/**
* Returns the root command node of the Brigadier dispatcher.
* @return the root command node of the Brigadier dispatcher.
*/
protected static RootCommandNode<BukkitBrigadierCommandSource> getRootNode() {
return nmsDispatcher.getRoot();
}
@@ -131,7 +139,16 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
/** /**
* The command node of this command. * The command node of this command.
*/ */
protected final LiteralCommandNode<BukkitBrigadierCommandSource> commandNode; protected LiteralCommandNode<CommandSourceStack> commandNode;
/**
* The command requested aliases.
*/
protected final String[] aliases;
/**
* The command description.
*/
protected final String description;
private final RegistrationPolicy registrationPolicy; private final RegistrationPolicy registrationPolicy;
@@ -146,13 +163,13 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
public PaperBrigadierCommand(Plugin pl, RegistrationPolicy regPolicy) { public PaperBrigadierCommand(Plugin pl, RegistrationPolicy regPolicy) {
plugin = pl; plugin = pl;
registrationPolicy = regPolicy; registrationPolicy = regPolicy;
commandNode = buildCommand().build(); String[] aliasesTmp = getAliases();
postBuildCommand(commandNode); aliases = aliasesTmp == null ? new String[0] : aliasesTmp;
description = getDescription();
register(); register();
Bukkit.getPluginManager().registerEvents(this, plugin); //try {
try { // PandalibPaperPermissions.addPermissionMapping("minecraft.command." + commandNode.getLiteral().toLowerCase(), getTargetPermission().toLowerCase());
PandalibPaperPermissions.addPermissionMapping("minecraft.command." + commandNode.getLiteral().toLowerCase(), getTargetPermission().toLowerCase()); //} catch (NoClassDefFoundError ignored) { }
} catch (NoClassDefFoundError ignored) { }
} }
/** /**
@@ -167,163 +184,193 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
private void register() { private void register() {
plugin.getLifecycleManager().registerEventHandler(LifecycleEvents.COMMANDS, event -> {
updateVanillaPaperDispatcher(event.registrar().getDispatcher());
String[] aliases = getAliases(); commandNode = buildCommand().build();
if (aliases == null) postBuildCommand(commandNode);
aliases = new String[0];
String pluginName = plugin.getName().toLowerCase(); if (vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()) != null) {
Log.info("Command /" + commandNode.getName() + " found in the vanilla dispatcher during initial command registration. Replacing it by force.");
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(commandNode.getName()));
}
registeredAliases = new HashSet<>(); registeredAliases = new HashSet<>(event.registrar().register(commandNode, description, List.of(aliases)));
registerNode(commandNode, false); doPostRegistrationFixes();
registerAlias(pluginName + ":" + commandNode.getLiteral(), true);
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> registeredNode = wrap(vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()), fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
if (registrationPolicy == RegistrationPolicy.ALL) {
// enforce registration of aliases
for (String alias : aliases) { for (String alias : aliases) {
registerAlias(alias, false); if (!registeredAliases.contains(alias)) {
registerAlias(pluginName + ":" + alias, true); Log.info("Command /" + commandNode.getName() + ": forcing registration of alias " + alias);
registeredAliases.addAll(event.registrar().register(getAliasNode(commandNode, alias), description));
}
} }
} }
private void registerAlias(String alias, boolean prefixed) { Bukkit.getServer().getScheduler().runTask(plugin, () -> {
LiteralCommandNode<BukkitBrigadierCommandSource> node = literal(alias) if (vanillaPaperDispatcher == null)
return;
Set<String> forceRegistrationAgain = new HashSet<>();
forceRegistrationAgain.add(commandNode.getName());
if (registrationPolicy == RegistrationPolicy.ALL)
forceRegistrationAgain.addAll(List.of(aliases));
for (String aliasToForce : forceRegistrationAgain) {
CommandNode<CommandSourceStack> actualNode = vanillaPaperDispatcher.getRoot().getChild(aliasToForce);
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(actualNode, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
if (actualNode != null) {
if (wrappedCommandNode.apiCommandMeta() != null) {
APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
if (meta.plugin().equals(plugin))
return;
}
else if (BukkitCommandNode.REFLECT.get().isInstance(actualNode)) {
BukkitCommandNode bcn = wrap(actualNode, BukkitCommandNode.class);
if (bcn.getBukkitCommand() instanceof PluginCommand pc && pc.getPlugin().equals(plugin))
return;
}
Log.warning("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode));
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(aliasToForce));
}
/*else {
Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
}*/
LiteralCommandNode<CommandSourceStack> newPCN = getAliasNode(commandNode, aliasToForce);
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedNewPCN = wrap(newPCN, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
wrappedNewPCN.apiCommandMeta(registeredNode.apiCommandMeta());
vanillaPaperDispatcher.getRoot().addChild(newPCN);
}
});
});
}
private void doPostRegistrationFixes() {
postRegistrationFixNode(new HashSet<>(), commandNode);
}
private void postRegistrationFixNode(Set<CommandNode<CommandSourceStack>> fixedNodes, CommandNode<CommandSourceStack> originalNode) {
if (originalNode instanceof RootCommandNode)
return;
if (fixedNodes.contains(originalNode))
return;
fixedNodes.add(originalNode);
if (originalNode.getRedirect() != null) {
try {
@SuppressWarnings("rawtypes")
ReflectClass<CommandNode> cmdNodeClass = Reflect.ofClass(CommandNode.class);
@SuppressWarnings("unchecked")
CommandNode<CommandSourceStack> unwrappedNode = (CommandNode<CommandSourceStack>) cmdNodeClass.field("unwrappedCached").getValue(originalNode);
if (unwrappedNode != null) {
cmdNodeClass.field("modifier").setValue(unwrappedNode, cmdNodeClass.field("modifier").getValue(originalNode));
cmdNodeClass.field("forks").setValue(unwrappedNode, cmdNodeClass.field("forks").getValue(originalNode));
}
} catch (IllegalAccessException | NoSuchFieldException e) {
throw new RuntimeException(e);
}
postRegistrationFixNode(fixedNodes, originalNode.getRedirect());
}
else {
try {
for (CommandNode<CommandSourceStack> child : originalNode.getChildren())
postRegistrationFixNode(fixedNodes, child);
} catch (UnsupportedOperationException ignored) {
// in case getChildren is not possible (vanilla commands are wrapped by Paper API)
}
}
}
private static LiteralCommandNode<CommandSourceStack> getAliasNode(CommandNode<CommandSourceStack> commandNode, String alias) {
return LiteralArgumentBuilder.<CommandSourceStack>literal(alias)
.requires(commandNode.getRequirement()) .requires(commandNode.getRequirement())
.executes(commandNode.getCommand()) .executes(commandNode.getCommand())
.redirect(commandNode) .redirect(commandNode)
.build(); .build();
registerNode(node, prefixed);
} }
private static String getCommandIdentity(CommandNode<CommandSourceStack> command) {
private void registerNode(LiteralCommandNode<BukkitBrigadierCommandSource> node, boolean prefixed) { if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
RootCommandNode<BukkitBrigadierCommandSource> root = getRootNode(); BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
String name = node.getLiteral(); Command bukkitCmd = wrappedBCN.getBukkitCommand();
boolean isAlias = node.getRedirect() == commandNode;
boolean forceRegistration = switch (registrationPolicy) {
case NONE -> false;
case ONLY_BASE_COMMAND -> prefixed || !isAlias;
case ALL -> true;
};
// nmsDispatcher integration and conflit resolution
boolean nmsRegister = false, nmsRegistered = false;
CommandNode<BukkitBrigadierCommandSource> nmsConflicted = root.getChild(name);
if (nmsConflicted != null) {
if (isFromThisCommand(nmsConflicted)) {
// this command is already registered in NMS. Dont need to register again
nmsRegistered = true;
}
else if (forceRegistration) {
nmsRegister = true;
Log.info("Overwriting Brigadier command /" + name);
}
else if (prefixed || !isAlias) {
Log.severe("/" + name + " already in NMS Brigadier instance."
+ " Wont replace it because registration is not forced for prefixed or initial name of a command.");
}
else { // conflict, won't replace, not forced but only an alias anyway
Log.info("/" + name + " already in NMS Brigadier instance."
+ " Wont replace it because registration is not forced for a non-prefixed alias.");
}
}
else {
nmsRegister = true;
}
if (nmsRegister) {
@SuppressWarnings("unchecked")
var rCommandNode = ReflectWrapper.wrapTyped(root, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
rCommandNode.removeCommand(name);
root.addChild(node);
nmsRegistered = true;
}
if (!nmsRegistered) {
return;
}
registeredAliases.add(name);
// bukkit dispatcher conflict resolution
boolean bukkitRegister = false;
CommandMap bukkitCmdMap = Bukkit.getCommandMap();
Command bukkitConflicted = bukkitCmdMap.getCommand(name);
if (bukkitConflicted != null) {
if (!isFromThisCommand(bukkitConflicted)) {
if (forceRegistration) {
bukkitRegister = true;
Log.info("Overwriting Bukkit command /" + name
+ " (" + getCommandIdentity(bukkitConflicted) + ")");
}
else if (prefixed || !isAlias) {
Log.severe("/" + name + " already in Bukkit dispatcher (" + getCommandIdentity(bukkitConflicted) + ")." +
" Wont replace it because registration is not forced for prefixed or initial name of a command.");
}
else {
Log.info("/" + name + " already in Bukkit dispatcher (" + getCommandIdentity(bukkitConflicted) + ")." +
" Wont replace it because registration is not forced for a non-prefixed alias.");
}
}
}
else {
bukkitRegister = true;
}
if (bukkitRegister) {
bukkitCmdMap.getKnownCommands().remove(name.toLowerCase());
if (bukkitConflicted != null)
bukkitConflicted.unregister(bukkitCmdMap);
Command newCommand = new VanillaCommandWrapper(vanillaCommandDispatcher, node).__getRuntimeInstance();
bukkitCmdMap.getKnownCommands().put(name.toLowerCase(), newCommand);
newCommand.register(bukkitCmdMap);
}
}
private boolean isFromThisCommand(CommandNode<BukkitBrigadierCommandSource> node) {
return node == commandNode || node.getRedirect() == commandNode;
}
private boolean isFromThisCommand(Command bukkitCmd) {
if (VanillaCommandWrapper.REFLECT.get().isInstance(bukkitCmd)) {
return isFromThisCommand(ReflectWrapper.wrapTyped((BukkitCommand) bukkitCmd, VanillaCommandWrapper.class).vanillaCommand());
}
return false;
}
private static String getCommandIdentity(Command bukkitCmd) {
if (bukkitCmd instanceof PluginCommand cmd) { if (bukkitCmd instanceof PluginCommand cmd) {
return "Bukkit command: /" + cmd.getName() + " from plugin " + cmd.getPlugin().getName(); return "Node /" + command.getName() + " wrapping Bukkit command /" + bukkitCmd.getName() + " from plugin " + cmd.getPlugin().getName();
} }
else if (VanillaCommandWrapper.REFLECT.get().isInstance(bukkitCmd)) { else if (VanillaCommandWrapper.REFLECT.get().isInstance(bukkitCmd)) {
return "Vanilla command: /" + bukkitCmd.getName(); VanillaCommandWrapper vcw = wrap(bukkitCmd, VanillaCommandWrapper.class);
CommandNode<CommandSourceStack> vanillaCmd = vcw.vanillaCommand();
if (vanillaCmd != command)
return "Node /" + command.getName() + " wrapping non-plugin command /" + bukkitCmd.getName() + " wrapping: " + getCommandIdentity(vcw.vanillaCommand());
else
return "Node /" + command.getName() + " wrapping non-plugin command /" + bukkitCmd.getName() + " wrapping back the node (risk of StackOverflow?)";
} }
else else
return bukkitCmd.getClass().getName() + ": /" + bukkitCmd.getName(); return "Node /" + command.getName() + " wrapping " + bukkitCmd.getClass().getName() + " /" + bukkitCmd.getName();
}
else {
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
if (wrappedCommandNode.apiCommandMeta() != null) {
APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
return "Node /" + command.getName() + " from plugin " + meta.plugin().getName();
}
else {
return "Node /" + command.getName() + " (unspecific)";
}
}
} }
private static Boolean isPluginCommand(CommandNode<CommandSourceStack> command) {
if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
Command bukkitCmd = wrappedBCN.getBukkitCommand();
if (bukkitCmd instanceof PluginCommand) {
return true;
}
else if (VanillaCommandWrapper.REFLECT.get().isInstance(bukkitCmd)) {
VanillaCommandWrapper vcw = wrap(bukkitCmd, VanillaCommandWrapper.class);
CommandNode<CommandSourceStack> vanillaCmd = vcw.vanillaCommand();
if (vanillaCmd != command)
return isPluginCommand(vcw.vanillaCommand());
else
return false;
}
else
return null;
}
else {
@SuppressWarnings("unchecked")
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
return wrappedCommandNode.apiCommandMeta() != null;
}
}
/** /**
* Player command sender event handler. * Gets the aliases that are actually registered in the server.
* @param event the event. * @return the actually registered aliases.
*/ */
@EventHandler protected Set<String> getRegisteredAliases() {
public void onPlayerCommandSend(PlayerCommandSendEvent event) { return Set.copyOf(registeredAliases);
event.getCommands().removeAll(registeredAliases.stream().map(s -> "minecraft:" + s).toList());
} }
/**
* Server load event handler.
* @param event the event.
*/
@EventHandler
public void onServerLoad(ServerLoadEvent event) {
register();
}
@@ -342,6 +389,15 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
*/ */
protected abstract String getTargetPermission(); protected abstract String getTargetPermission();
/**
* Returns the permission that should be tested instead of "minecraft.command.cmdName". The conversion from the
* minecraft prefixed permission node to the returned node is done by the {@code pandalib-paper-permissions} if it
* is present in the classpath during runtime.
* @return the permission that should be tested instead of "minecraft.command.cmdName".
*/
protected String getDescription() {
return "A command from " + plugin.getName();
}
@@ -355,13 +411,17 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
public boolean isConsole(BukkitBrigadierCommandSource wrapper) {
@Override
public boolean isConsole(CommandSourceStack wrapper) {
return isConsole(getCommandSender(wrapper)); return isConsole(getCommandSender(wrapper));
} }
public boolean isPlayer(BukkitBrigadierCommandSource wrapper) { @Override
public boolean isPlayer(CommandSourceStack wrapper) {
return isPlayer(getCommandSender(wrapper)); return isPlayer(getCommandSender(wrapper));
} }
public Predicate<BukkitBrigadierCommandSource> hasPermission(String permission) { @Override
public Predicate<CommandSourceStack> hasPermission(String permission) {
return wrapper -> getCommandSender(wrapper).hasPermission(permission); return wrapper -> getCommandSender(wrapper).hasPermission(permission);
} }
@@ -395,7 +455,7 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
* @param context the command context from which to get the Bukkit command sender. * @param context the command context from which to get the Bukkit command sender.
* @return the Bukkit command sender. * @return the Bukkit command sender.
*/ */
public static CommandSender getCommandSender(CommandContext<BukkitBrigadierCommandSource> context) { public static CommandSender getCommandSender(CommandContext<CommandSourceStack> context) {
return getCommandSender(context.getSource()); return getCommandSender(context.getSource());
} }
@@ -404,8 +464,8 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
* @param wrapper the wrapper from which to get the Bukkit command sender. * @param wrapper the wrapper from which to get the Bukkit command sender.
* @return the Bukkit command sender. * @return the Bukkit command sender.
*/ */
public static CommandSender getCommandSender(BukkitBrigadierCommandSource wrapper) { public static CommandSender getCommandSender(CommandSourceStack wrapper) {
return wrapper.getBukkitSender(); return wrapper.getSender();
} }
/** /**
@@ -413,8 +473,8 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
* @param sender the command sender. * @param sender the command sender.
* @return a new instance of a command sender wrapper for the provided command sender. * @return a new instance of a command sender wrapper for the provided command sender.
*/ */
public static BukkitBrigadierCommandSource getBrigadierCommandSource(CommandSender sender) { public static CommandSourceStack getBrigadierCommandSource(CommandSender sender) {
return VanillaCommandWrapper.getListener(sender); throw new UnsupportedOperationException("The 1.20.6 Paper API update uses a different wrapper for Brigadier command sender.");
} }
@@ -443,7 +503,7 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
* @param suggestions the suggestions to wrap. * @param suggestions the suggestions to wrap.
* @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}. * @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}.
*/ */
public SuggestionProvider<BukkitBrigadierCommandSource> wrapSuggestions(SuggestionsSupplier<CommandSender> suggestions) { public SuggestionProvider<CommandSourceStack> wrapSuggestions(SuggestionsSupplier<CommandSender> suggestions) {
return wrapSuggestions(suggestions, PaperBrigadierCommand::getCommandSender); return wrapSuggestions(suggestions, PaperBrigadierCommand::getCommandSender);
} }
@@ -456,7 +516,7 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
* @param cmd the command executor to wrap. * @param cmd the command executor to wrap.
* @return a wrapper command executor. * @return a wrapper command executor.
*/ */
protected static com.mojang.brigadier.Command<BukkitBrigadierCommandSource> wrapCommand(com.mojang.brigadier.Command<BukkitBrigadierCommandSource> cmd) { protected static com.mojang.brigadier.Command<CommandSourceStack> wrapCommand(com.mojang.brigadier.Command<CommandSourceStack> cmd) {
return context -> { return context -> {
try { try {
return cmd.run(context); return cmd.run(context);
@@ -484,117 +544,6 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
* Minecraft's argument type * Minecraft's argument type
*/ */
/**
* Creates a new instance of the Brigadier argument type {@code minecraft:entity}.
* @param singleTarget if this argument takes only a single target.
* @param playersOnly if this argument takes players only.
* @return the {@code minecraft:entity} argument type with the specified parameters.
*/
public static ArgumentType<Object> argumentMinecraftEntity(boolean singleTarget, boolean playersOnly) {
if (playersOnly) {
return singleTarget ? EntityArgument.player() : EntityArgument.players();
}
else {
return singleTarget ? EntityArgument.entity() : EntityArgument.entities();
}
}
/**
* Gets the value of the provided argument of type {@code minecraft:entity} (list of entities), from the provided context.
* @param context the command execution context.
* @param argument the argument name.
* @return the value of the argument, or null if not found.
*/
public List<Entity> tryGetMinecraftEntityArgument(CommandContext<BukkitBrigadierCommandSource> context, String argument) {
EntitySelector es = ReflectWrapper.wrap(tryGetArgument(context, argument, EntitySelector.MAPPING.runtimeClass()), EntitySelector.class);
if (es == null)
return null;
List<fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity> nmsEntityList = es.findEntities(context.getSource());
List<Entity> entityList = new ArrayList<>(nmsEntityList.size());
for (fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity nmsEntity : nmsEntityList) {
entityList.add(nmsEntity.getBukkitEntity());
}
return entityList;
}
/**
* Gets the value of the provided argument of type {@code minecraft:entity} (list of players), from the provided context.
* @param context the command execution context.
* @param argument the argument name.
* @return the value of the argument, or null if not found.
*/
public List<Player> tryGetMinecraftEntityArgumentPlayers(CommandContext<BukkitBrigadierCommandSource> context, String argument) {
EntitySelector es = ReflectWrapper.wrap(tryGetArgument(context, argument, EntitySelector.MAPPING.runtimeClass()), EntitySelector.class);
if (es == null)
return null;
List<ServerPlayer> nmsPlayerList = es.findPlayers(context.getSource());
List<Player> playerList = new ArrayList<>(nmsPlayerList.size());
for (ServerPlayer nmsPlayer : nmsPlayerList) {
playerList.add(nmsPlayer.getBukkitEntity());
}
return playerList;
}
/**
* Gets the value of the provided argument of type {@code minecraft:entity} (one entity), from the provided context.
* @param context the command execution context.
* @param argument the argument name.
* @return the value of the argument, or null if not found.
*/
public Entity tryGetMinecraftEntityArgumentOneEntity(CommandContext<BukkitBrigadierCommandSource> context, String argument) {
EntitySelector es = ReflectWrapper.wrap(tryGetArgument(context, argument, EntitySelector.MAPPING.runtimeClass()), EntitySelector.class);
if (es == null)
return null;
fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity nmsEntity = es.findSingleEntity(context.getSource());
return nmsEntity == null ? null : nmsEntity.getBukkitEntity();
}
/**
* Gets the value of the provided argument of type {@code minecraft:entity} (one player), from the provided context.
* @param context the command execution context.
* @param argument the argument name.
* @return the value of the argument, or null if not found.
*/
public Player tryGetMinecraftEntityArgumentOnePlayer(CommandContext<BukkitBrigadierCommandSource> context, String argument) {
EntitySelector es = ReflectWrapper.wrap(tryGetArgument(context, argument, EntitySelector.MAPPING.runtimeClass()), EntitySelector.class);
if (es == null)
return null;
ServerPlayer nmsPlayer = es.findSinglePlayer(context.getSource());
return nmsPlayer == null ? null : nmsPlayer.getBukkitEntity();
}
/**
* Creates a new instance of the Brigadier argument type {@code minecraft:block_pos}.
* @return the {@code minecraft:block_pos} argument type.
*/
public static ArgumentType<Object> argumentMinecraftBlockPosition() {
return BlockPosArgument.blockPos();
}
/**
* Gets the value of the provided argument of type {@code minecraft:block_pos}, from the provided context.
* @param context the command execution context.
* @param argument the argument name.
* @param deflt a default value if the argument is not found.
* @return the value of the argument.
*/
public BlockVector tryGetMinecraftBlockPositionArgument(CommandContext<BukkitBrigadierCommandSource> context,
String argument, BlockVector deflt) {
return tryGetArgument(context, argument, Coordinates.MAPPING.runtimeClass(), nmsCoordinate -> {
BlockPos bp = ReflectWrapper.wrap(nmsCoordinate, Coordinates.class).getBlockPos(context.getSource());
return new BlockVector(bp.getX(), bp.getY(), bp.getZ());
}, deflt);
}
/** /**
* Creates a new instance of the Brigadier argument type {@code minecraft:vec3}. * Creates a new instance of the Brigadier argument type {@code minecraft:vec3}.
* @return the {@code minecraft:vec3} argument type. * @return the {@code minecraft:vec3} argument type.
@@ -610,11 +559,11 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
* @param deflt a default value if the argument is not found. * @param deflt a default value if the argument is not found.
* @return the value of the argument. * @return the value of the argument.
*/ */
public Vector tryGetMinecraftVec3Argument(CommandContext<BukkitBrigadierCommandSource> context, String argument, public Vector tryGetMinecraftVec3Argument(CommandContext<CommandSourceStack> context, String argument,
Vector deflt) { Vector deflt) {
return tryGetArgument(context, argument, Coordinates.MAPPING.runtimeClass(), return tryGetArgument(context, argument, Coordinates.REFLECT.get(),
nmsCoordinate -> CraftVector.toBukkit( nmsCoordinate -> CraftVector.toBukkit(
ReflectWrapper.wrap(nmsCoordinate, Coordinates.class).getPosition(context.getSource()) wrap(nmsCoordinate, Coordinates.class).getPosition(context.getSource())
), ),
deflt); deflt);
} }
@@ -622,44 +571,11 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<BukkitBriga
/**
* Creates a new instance of the Brigadier argument type {@code minecraft:component}.
* @return the {@code minecraft:component} argument type.
*/
public static ArgumentType<Object> argumentMinecraftChatComponent() {
return ComponentArgument.textComponent();
}
/**
* Gets the value of the provided argument of type {@code minecraft:component}, from the provided context.
* @param context the command execution context.
* @param argument the argument name.
* @param deflt a default value if the argument is not found.
* @return the value of the argument.
*/
public Component tryGetMinecraftChatComponentArgument(CommandContext<BukkitBrigadierCommandSource> context,
String argument, Component deflt) {
return tryGetArgument(context, argument,
fr.pandacube.lib.paper.reflect.wrapper.minecraft.network.chat.Component.MAPPING.runtimeClass(),
nmsComp -> PaperAdventure.asAdventure(
ReflectWrapper.wrap(nmsComp,
fr.pandacube.lib.paper.reflect.wrapper.minecraft.network.chat.Component.class)
),
deflt);
}
/** /**
* All possible choices on how to force the registration of a command, based on certain conditions. * All possible choices on how to force the registration of a command, based on certain conditions.
*/ */
public enum RegistrationPolicy { public enum RegistrationPolicy {
/**
* Do not force to register a command node or an alias if there is already a command with that name in the
* vanilla Brigadier dispatcher.
* Note that all plugin-name-prefixed aliases will be registered anyway.
*/
NONE,
/** /**
* Force only the base command (but not the aliases) to be registered, even if a command with that name already * Force only the base command (but not the aliases) to be registered, even if a command with that name already
* exists in the vanilla Brigadier dispatcher. * exists in the vanilla Brigadier dispatcher.

View File

@@ -10,28 +10,38 @@ import org.bukkit.event.server.PluginDisableEvent;
import org.bukkit.event.server.ServerEvent; import org.bukkit.event.server.ServerEvent;
import org.jetbrains.annotations.NotNull; import org.jetbrains.annotations.NotNull;
/**
* Fired at the beginning of the server stop process.
* More specifically, this event is called when the first plugin is disabling ({@link PluginDisableEvent}) while
* {@link Bukkit#isStopping()} returns true.
* <p>
* This event can be useful when a plugin want to execute stuff on server stop as soon as possible in the process,
* but not when the plugin itself is disabling (because some part of the Bukkit API is not usable at that moment).
*/
public class ServerStopEvent extends ServerEvent { public class ServerStopEvent extends ServerEvent {
private static final HandlerList handlers = new HandlerList(); private static final HandlerList handlers = new HandlerList();
@NotNull /**
@Override * Gets the handler list of the event.
public HandlerList getHandlers() { * @return the handler list of the event.
return handlers; */
}
@NotNull @NotNull
public static HandlerList getHandlerList() { public static HandlerList getHandlerList() {
return handlers; return handlers;
} }
private static boolean hasTriggered = false; private static boolean hasTriggered = false;
private static boolean isInit = false;
/**
* Register the event used to detect the server stop.
*/
public static void init() { public static void init() {
if (isInit)
return;
BukkitEvent.register(new Listener() { BukkitEvent.register(new Listener() {
@EventHandler(priority = EventPriority.LOWEST) @EventHandler(priority = EventPriority.LOWEST)
@@ -45,7 +55,25 @@ public class ServerStopEvent extends ServerEvent {
} }
}); });
isInit = true;
} }
private ServerStopEvent() {}
@NotNull
@Override
public HandlerList getHandlers() {
return handlers;
}
} }

View File

@@ -63,6 +63,7 @@ public class DirectionalVector {
* contained in the provided {@link Location}. * contained in the provided {@link Location}.
* {@link Location#getYaw()} and {@link Location#getPitch()} values are automatically * {@link Location#getYaw()} and {@link Location#getPitch()} values are automatically
* converted to conform {@link #yaw} and {@link #pitch} specification. * converted to conform {@link #yaw} and {@link #pitch} specification.
* @param l the location.
*/ */
public DirectionalVector(Location l) { public DirectionalVector(Location l) {
this( this(
@@ -79,6 +80,7 @@ public class DirectionalVector {
/** /**
* Creates a new {@link DirectionalVector} from a simple {@link Vector}.
* @param v the vector representing the direction. If v.getX() and v.getZ() are 0, * @param v the vector representing the direction. If v.getX() and v.getZ() are 0,
* the yaw will be 0. This may have inconsistency if the vector is calculated * the yaw will be 0. This may have inconsistency if the vector is calculated
* from a {@link Location}'s yaw and pitch. In this case, prefer using * from a {@link Location}'s yaw and pitch. In this case, prefer using
@@ -126,7 +128,10 @@ public class DirectionalVector {
} }
/**
* Gets a Vector using the internal X, Y and Z values, that is a simple directional 3D vector.
* @return this vector as a simple 3D {@link Vector}.
*/
public Vector toVector() { public Vector toVector() {
return new Vector(x, y, z); return new Vector(x, y, z);
} }
@@ -135,7 +140,8 @@ public class DirectionalVector {
/** /**
* Set the yaw and the pitch of the provided {@link Location} * Set the yaw and the pitch of the provided {@link Location}
* with the values inside the current {@link DirectionalVector} * with the values inside the current {@link DirectionalVector}
* after conversion of these values * after conversion of these values.
* @param l the location.
*/ */
public void putIntoLocation(Location l) { public void putIntoLocation(Location l) {
/* std : -PI/2 : <0 ? +2PI : MC /* std : -PI/2 : <0 ? +2PI : MC
@@ -148,7 +154,10 @@ public class DirectionalVector {
l.setPitch((float) Math.toDegrees(-pitch)); l.setPitch((float) Math.toDegrees(-pitch));
} }
/**
* Gets the vector pointing to the opposite direction.
* @return the opposite vector.
*/
public DirectionalVector getOpposite() { public DirectionalVector getOpposite() {
return new DirectionalVector( return new DirectionalVector(
-x, -x,
@@ -163,6 +172,7 @@ public class DirectionalVector {
* If the current direction is the player face direction, * If the current direction is the player face direction,
* this method return the direction of the back of the head. * this method return the direction of the back of the head.
* This is an alias of {@link #getOpposite()} * This is an alias of {@link #getOpposite()}
* @return the opposite of this vector.
*/ */
public DirectionalVector getBackDirection() { public DirectionalVector getBackDirection() {
return getOpposite(); return getOpposite();
@@ -171,6 +181,7 @@ public class DirectionalVector {
/** /**
* If the current direction is the player face direction, * If the current direction is the player face direction,
* this method return the direction of the bottom of the head. * this method return the direction of the bottom of the head.
* @return the vector pointing on the bottom, as if this vector was the front orientation of a player head.
*/ */
public DirectionalVector getBottomDirection() { public DirectionalVector getBottomDirection() {
return new DirectionalVector( return new DirectionalVector(
@@ -182,6 +193,7 @@ public class DirectionalVector {
/** /**
* If the current direction is the player face direction, * If the current direction is the player face direction,
* this method return the direction of the top of the head. * this method return the direction of the top of the head.
* @return the vector pointing on the top, as if this vector was the front orientation of a player head.
*/ */
public DirectionalVector getTopDirection() { public DirectionalVector getTopDirection() {
return new DirectionalVector( return new DirectionalVector(
@@ -194,6 +206,7 @@ public class DirectionalVector {
/** /**
* If the current direction is the player face direction, * If the current direction is the player face direction,
* this method return the direction of the left of the head. * this method return the direction of the left of the head.
* @return the vector pointing on the left, as if this vector was the front orientation of a player head.
*/ */
public DirectionalVector getLeftDirection() { public DirectionalVector getLeftDirection() {
return new DirectionalVector( return new DirectionalVector(
@@ -206,6 +219,7 @@ public class DirectionalVector {
/** /**
* If the current direction is the player face direction, * If the current direction is the player face direction,
* this method return the direction of the right of the head. * this method return the direction of the right of the head.
* @return the vector pointing on the right, as if this vector was the front orientation of a player head.
*/ */
public DirectionalVector getRightDirection() { public DirectionalVector getRightDirection() {
return new DirectionalVector( return new DirectionalVector(

View File

@@ -2,24 +2,29 @@ package fr.pandacube.lib.paper.geometry;
import org.bukkit.Location; import org.bukkit.Location;
import org.bukkit.entity.Player; import org.bukkit.entity.Player;
import org.bukkit.util.BoundingBox;
import org.bukkit.util.RayTraceResult;
import org.bukkit.util.Vector; import org.bukkit.util.Vector;
/**
* Utility class related to geometry and Minecraft.
*/
public class GeometryUtil { public class GeometryUtil {
/** /**
* Value equal to <code>{@link Math#PI}</code>. * Value equal to <code>{@link Math#PI}</code>.
*/ */
public static final double PI = Math.PI; static final double PI = Math.PI;
/** /**
* Value equal to <code>{@link Math#PI} / 2</code>. * Value equal to <code>{@link Math#PI} / 2</code>.
*/ */
public static final double PId2 = PI/2; static final double PId2 = PI/2;
/** /**
* Value equal to <code>{@link Math#PI} * 2</code>. * Value equal to <code>{@link Math#PI} * 2</code>.
*/ */
public static final double PIx2 = PI*2; static final double PIx2 = PI*2;
@@ -55,9 +60,21 @@ public class GeometryUtil {
* Value provided by net.minecraft.world.entity.player.Player#getStandingEyeHeight * Value provided by net.minecraft.world.entity.player.Player#getStandingEyeHeight
*/ */
public static final double PLAYER_EYE_HEIGHT_SNEAK = 1.27; public static final double PLAYER_EYE_HEIGHT_SNEAK = 1.27;
/**
* The size of a skin pixel.
*/
public static final double PLAYER_SKIN_PIXEL_SIZE = PLAYER_SKIN_HEIGHT / 32; public static final double PLAYER_SKIN_PIXEL_SIZE = PLAYER_SKIN_HEIGHT / 32;
/**
* The height of the center of rotation of the head, that is the distance between neck and the player's foot.
*/
public static final double PLAYER_HEAD_ROTATION_HEIGHT = PLAYER_SKIN_PIXEL_SIZE * 24; public static final double PLAYER_HEAD_ROTATION_HEIGHT = PLAYER_SKIN_PIXEL_SIZE * 24;
/**
* The height of the center of rotation of the head, that is the distance between neck and the player's foot, but when the player is sneaking.
*/
public static final double PLAYER_HEAD_ROTATION_HEIGHT_SNEAK = PLAYER_HEAD_ROTATION_HEIGHT - (PLAYER_SKIN_HEIGHT - PLAYER_SKIN_HEIGHT_SNEAK); public static final double PLAYER_HEAD_ROTATION_HEIGHT_SNEAK = PLAYER_HEAD_ROTATION_HEIGHT - (PLAYER_SKIN_HEIGHT - PLAYER_SKIN_HEIGHT_SNEAK);
/**
* The size of the first layer of the players head.
*/
public static final double PLAYER_HEAD_SIZE = PLAYER_SKIN_PIXEL_SIZE * 8; public static final double PLAYER_HEAD_SIZE = PLAYER_SKIN_PIXEL_SIZE * 8;
@@ -72,11 +89,10 @@ public class GeometryUtil {
/** /**
* Get the {@link Location}s of the 8 vertex of the player head<br/> * Get the {@link Location}s of the 8 vertex of the player head<br/>
* This method only work if the player is standing up * This method only work if the player is standing up
* (not dead, not gliding, not sleeping). * (not dead, not gliding, not sleeping, not swimming).
* @param playerLocation the location of the player, generally provided by {@link Player#getLocation()} * @param playerLocation the location of the player, generally provided by {@link Player#getLocation()}
* @param isSneaking if the player is sneaking. Generally {@link Player#isSneaking()} * @param isSneaking if the player is sneaking. Generally {@link Player#isSneaking()}
* @return an array of 8 {@link Location}s with x, y, and z values filled (yaw and pitch are ignored). * @return an array of 8 {@link Location}s with x, y, and z values filled (yaw and pitch are ignored).
@@ -129,27 +145,22 @@ public class GeometryUtil {
/** /**
* Check if the path from <i>start</i> location to <i>end</i> pass through * Check if the path from <i>start</i> location to <i>end</i> pass through
* the axis aligned bounding box defined by <i>min</i> and <i>max</i>. * the axis aligned bounding box defined by <i>min</i> and <i>max</i>.
* @param start the start of the path.
* @param end the end of the path.
* @param min the min of the bounding box.
* @param max the max of the bounding box.
* @return true if the path intersects the bounding box.
* @deprecated use {@link BoundingBox#rayTrace(Vector, Vector, double)} instead.
*/ */
@Deprecated
public static boolean hasIntersection(Vector start, Vector end, Vector min, Vector max) { public static boolean hasIntersection(Vector start, Vector end, Vector min, Vector max) {
final double epsilon = 0.0001f; RayTraceResult res = BoundingBox.of(min, max).rayTrace(start, end.clone().subtract(start), end.distance(start));
return res != null;
Vector d = end.clone().subtract(start).multiply(0.5);
Vector e = max.clone().subtract(min).multiply(0.5);
Vector c = start.clone().add(d).subtract(min.clone().add(max).multiply(0.5));
Vector ad = d.clone();
ad.setX(Math.abs(ad.getX()));
ad.setY(Math.abs(ad.getY()));
ad.setZ(Math.abs(ad.getZ()));
return !(
Math.abs(c.getX()) > e.getX() + ad.getX()
|| Math.abs(c.getY()) > e.getY() + ad.getY()
|| Math.abs(c.getZ()) > e.getX() + ad.getZ()
|| Math.abs(d.getY() * c.getZ() - d.getZ() * c.getY()) > e.getY() * ad.getZ() + e.getZ() * ad.getY() + epsilon
|| Math.abs(d.getZ() * c.getX() - d.getX() * c.getZ()) > e.getZ() * ad.getX() + e.getX() * ad.getZ() + epsilon
|| Math.abs(d.getX() * c.getY() - d.getY() * c.getX()) > e.getX() * ad.getY() + e.getY() * ad.getX() + epsilon
);
} }
private GeometryUtil() {}
} }

View File

@@ -2,11 +2,10 @@ package fr.pandacube.lib.paper.geometry.blocks;
import fr.pandacube.lib.util.RandomUtil; import fr.pandacube.lib.util.RandomUtil;
import org.bukkit.Location; import org.bukkit.Location;
import org.bukkit.World;
import org.bukkit.block.Block;
import org.bukkit.util.BlockVector; import org.bukkit.util.BlockVector;
import org.bukkit.util.BoundingBox; import org.bukkit.util.BoundingBox;
import org.bukkit.util.Vector; import org.bukkit.util.Vector;
import org.jetbrains.annotations.NotNull;
import java.util.Iterator; import java.util.Iterator;
@@ -30,10 +29,19 @@ public class AABBBlock implements BlockSet, Cloneable {
volume = original.volume; volume = original.volume;
} }
/**
* Construct a {@link AABBBlock} based on the two provided Bukkit's {@link Vector}.
* @param p1 the first vector.
* @param p2 the second vector.
*/
public AABBBlock(Vector p1, Vector p2) { public AABBBlock(Vector p1, Vector p2) {
this(p1.getBlockX(), p1.getBlockY(), p1.getBlockZ(), p2.getBlockX(), p2.getBlockY(), p2.getBlockZ()); this(p1.getBlockX(), p1.getBlockY(), p1.getBlockZ(), p2.getBlockX(), p2.getBlockY(), p2.getBlockZ());
} }
/**
* Construct a {@link AABBBlock} based on the provided Bukkit's {@link BoundingBox}.
* @param bb the bounding box.
*/
public AABBBlock(BoundingBox bb) { public AABBBlock(BoundingBox bb) {
pos1 = bb.getMin(); pos1 = bb.getMin();
pos2 = bb.getMax(); pos2 = bb.getMax();
@@ -42,14 +50,34 @@ public class AABBBlock implements BlockSet, Cloneable {
bukkitBoundingBox = bb; bukkitBoundingBox = bb;
} }
/**
* Construct a {@link AABBBlock} based on the two provided Bukkit's {@link Location}.
* The worlds defined in the provided locations are ignored.
* @param l1 the first location.
* @param l2 the second location.
*/
public AABBBlock(Location l1, Location l2) { public AABBBlock(Location l1, Location l2) {
this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ()); this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
} }
/**
* Construct a {@link AABBBlock} based on the two provided Bukkit's {@link BlockVector}.
* @param l1 the first block vector.
* @param l2 the second block vector.
*/
public AABBBlock(BlockVector l1, BlockVector l2) { public AABBBlock(BlockVector l1, BlockVector l2) {
this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ()); this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
} }
/**
* Construct a {@link AABBBlock} based on the individual coordinates of the 2 vectors.
* @param p1x the x value of the first vector.
* @param p1y the y value of the first vector.
* @param p1z the z value of the first vector.
* @param p2x the x value of the second vector.
* @param p2y the y value of the second vector.
* @param p2z the z value of the second vector.
*/
public AABBBlock(int p1x, int p1y, int p1z, int p2x, int p2y, int p2z) { public AABBBlock(int p1x, int p1y, int p1z, int p2x, int p2y, int p2z) {
/* /*
* Prends les points extérieurs permettant de former un bounding box englobant * Prends les points extérieurs permettant de former un bounding box englobant
@@ -74,22 +102,45 @@ public class AABBBlock implements BlockSet, Cloneable {
return this; return this;
} }
/**
* Gets the value of the "minimum" {@link Vector}, that is the vector with the lowest coordinates that is inside this bounding box.
* @return the minimum vector.
*/
public Vector getMin() { public Vector getMin() {
return pos1.clone(); return pos1.clone();
} }
/**
* Gets the value of the "maximum" {@link Vector}, that is the vector with the highest coordinates that is inside this bounding box.
* @return the maximum vector.
*/
public Vector getMax() { public Vector getMax() {
return pos2.clone(); return pos2.clone();
} }
/**
* Gets the {@link BlockVector} with the lowest coordinates in this bounding box.
* @return the minimum block vector.
*/
public BlockVector getMinBlock() { public BlockVector getMinBlock() {
return pos1.toBlockVector(); return pos1.toBlockVector();
} }
/**
* Gets the {@link BlockVector} with the highest coordinates in this bounding box.
* @return the maximum block vector.
*/
public BlockVector getMaxBlock() { public BlockVector getMaxBlock() {
return pos2.clone().add(new Vector(-1, -1, -1)).toBlockVector(); return pos2.clone().add(new Vector(-1, -1, -1)).toBlockVector();
} }
/**
* Gets a new {@link AABBBlock} with its coordinates shifted by the provided amount.
* @param x the x shift.
* @param y the y shift.
* @param z the z shift.
* @return a shifted bounding box.
*/
public AABBBlock shift(int x, int y, int z) { public AABBBlock shift(int x, int y, int z) {
return new AABBBlock(this, x, y, z); return new AABBBlock(this, x, y, z);
} }
@@ -101,7 +152,6 @@ public class AABBBlock implements BlockSet, Cloneable {
} }
public boolean overlaps(BoundingBox bb) { public boolean overlaps(BoundingBox bb) {
return asBukkitBoundingBox().overlaps(bb); return asBukkitBoundingBox().overlaps(bb);
} }
@@ -110,6 +160,10 @@ public class AABBBlock implements BlockSet, Cloneable {
return asBukkitBoundingBox().contains(v); return asBukkitBoundingBox().contains(v);
} }
/**
* Gets the coordinate of the center of this bounding box.
* @return the center of this bounding box.
*/
public Vector getCenter() { public Vector getCenter() {
return center.clone(); return center.clone();
} }
@@ -118,6 +172,10 @@ public class AABBBlock implements BlockSet, Cloneable {
return volume; return volume;
} }
/**
* Gets the Bukkit equivalent of this bounding box.
* @return a {@link BoundingBox} corresponding to this {@link AABBBlock}.
*/
public BoundingBox asBukkitBoundingBox() { public BoundingBox asBukkitBoundingBox() {
if (bukkitBoundingBox == null) { if (bukkitBoundingBox == null) {
bukkitBoundingBox = new BoundingBox(pos1.getX(), pos1.getY(), pos1.getZ(), bukkitBoundingBox = new BoundingBox(pos1.getX(), pos1.getY(), pos1.getZ(),
@@ -134,7 +192,7 @@ public class AABBBlock implements BlockSet, Cloneable {
} }
@Override @Override
public Iterator<BlockVector> iterator() { public @NotNull Iterator<BlockVector> iterator() {
return new Iterator<>() { return new Iterator<>() {
private int x = pos1.getBlockX(), private int x = pos1.getBlockX(),
y = pos1.getBlockY(), y = pos1.getBlockY(),
@@ -164,22 +222,6 @@ public class AABBBlock implements BlockSet, Cloneable {
} }
public Iterable<Block> asBlockIterable(World w) {
return () -> new Iterator<>() {
final Iterator<BlockVector> nested = AABBBlock.this.iterator();
@Override
public boolean hasNext() {
return nested.hasNext();
}
@Override
public Block next() {
BlockVector bv = nested.next();
return w.getBlockAt(bv.getBlockX(), bv.getBlockY(), bv.getBlockZ());
}
};
}
@Override @Override
public String toString() { public String toString() {
return "{(" + pos1.getBlockX() + return "{(" + pos1.getBlockX() +

View File

@@ -12,12 +12,22 @@ import java.util.Collection;
import java.util.Iterator; import java.util.Iterator;
import java.util.List; import java.util.List;
/**
* A group of {@link AABBBlock}.
*/
public class AABBBlockGroup implements BlockSet { public class AABBBlockGroup implements BlockSet {
/**
* The list of {@link AABBBlock} contained in this group. This list is unmodifiable.
*/
public final List<AABBBlock> subAABB; public final List<AABBBlock> subAABB;
private final AABBBlock englobingAABB; private final AABBBlock englobingAABB;
/**
* Creates a new {@link AABBBlockGroup}.
* @param in the list of {@link AABBBlock} that will be contained in this group.
*/
public AABBBlockGroup(Collection<AABBBlock> in) { public AABBBlockGroup(Collection<AABBBlock> in) {
if (in.isEmpty()) if (in.isEmpty())
throw new IllegalArgumentException("Provided collection must not be empty."); throw new IllegalArgumentException("Provided collection must not be empty.");
@@ -25,6 +35,10 @@ public class AABBBlockGroup implements BlockSet {
englobingAABB = initEnglobingAABB(); englobingAABB = initEnglobingAABB();
} }
/**
* Creates a new {@link AABBBlockGroup}.
* @param in an array of {@link AABBBlock} that will be contained in this group.
*/
public AABBBlockGroup(AABBBlock... in) { public AABBBlockGroup(AABBBlock... in) {
this(Arrays.asList(in)); this(Arrays.asList(in));
} }

View File

@@ -1,23 +1,58 @@
package fr.pandacube.lib.paper.geometry.blocks; package fr.pandacube.lib.paper.geometry.blocks;
import org.bukkit.Location; import org.bukkit.Location;
import org.bukkit.World;
import org.bukkit.block.Block; import org.bukkit.block.Block;
import org.bukkit.entity.Entity; import org.bukkit.entity.Entity;
import org.bukkit.util.BlockVector; import org.bukkit.util.BlockVector;
import org.bukkit.util.BoundingBox; import org.bukkit.util.BoundingBox;
import org.bukkit.util.Vector; import org.bukkit.util.Vector;
import java.util.Iterator;
/**
* Represents a set of blocks in a world.
*/
public interface BlockSet extends Iterable<BlockVector> { public interface BlockSet extends Iterable<BlockVector> {
/**
* Gets a random coordinate that is inside this block set.
* @return a random coordinate inside this block set.
*/
Vector getRandomPosition(); Vector getRandomPosition();
/**
* Gets the volume, in blocks (or cubic meters), of this block set.
* @return the volume of this block set.
*/
long getVolume(); long getVolume();
/**
* Gets the englobing bounding box if this block set.
* @return the englobing bounding box if this block set.
*/
AABBBlock getEnglobingAABB(); AABBBlock getEnglobingAABB();
/**
* Tells if this block set overlaps the provided bounding box.
* @param bb the provided bounding box
* @return true if its overlaps, false otherwise.
*/
boolean overlaps(BoundingBox bb); boolean overlaps(BoundingBox bb);
/**
* Tells if this block set overlaps the bounding box of the provided entity.
* @param e the provided entity.
* @return true if its overlaps, false otherwise.
*/
default boolean overlaps(Entity e) { default boolean overlaps(Entity e) {
return overlaps(e.getBoundingBox()); return overlaps(e.getBoundingBox());
} }
/**
* Tells if this block set overlaps the provided one. that is there is at least one block in common.
* @param bs the provided block set.
* @return true if its overlaps, false otherwise.
*/
default boolean overlaps(BlockSet bs) { default boolean overlaps(BlockSet bs) {
if (this instanceof AABBBlock b1) { if (this instanceof AABBBlock b1) {
if (bs instanceof AABBBlock b2) if (bs instanceof AABBBlock b2)
@@ -37,20 +72,78 @@ public interface BlockSet extends Iterable<BlockVector> {
} }
/**
* Tells if the provided vector is inside this bounding box.
* @param v the vector.
* @return true if its inside, false otherwise.
*/
boolean isInside(Vector v); boolean isInside(Vector v);
/**
* Tells if the provided location is inside this bounding box.
* The world of the location is ignored.
* @param l the location.
* @return true if its inside, false otherwise.
*/
default boolean isInside(Location l) { default boolean isInside(Location l) {
return isInside(l.toVector()); return isInside(l.toVector());
} }
/**
* Tells if the provided block is inside this bounding box.
* The world of the block is ignored.
* @param b the block.
* @return true if its inside, false otherwise.
*/
default boolean isInside(Block b) { default boolean isInside(Block b) {
return isInside(b.getLocation().add(.5, .5, .5)); return isInside(b.getLocation().add(.5, .5, .5));
} }
default boolean isInside(Entity p) {
return isInside(p.getLocation()); /**
* Tells if the provided entity is inside this bounding box.
* It calls {@link #isInside(Location)} using the returned value of {@link Entity#getLocation()}.
* The world of the entity is ignored.
* @param e the entity.
* @return true if its inside, false otherwise.
*/
default boolean isInside(Entity e) {
return isInside(e.getLocation());
} }
/**
* Gets an iterator iterating through all the blocks of this block set.
* @param w the world of the blocks.
* @return a new iterator.
*/
default Iterable<Block> asBlockIterable(World w) {
return () -> new Iterator<>() {
final Iterator<BlockVector> nested = BlockSet.this.iterator();
@Override
public boolean hasNext() {
return nested.hasNext();
}
@Override
public Block next() {
BlockVector bv = nested.next();
return w.getBlockAt(bv.getBlockX(), bv.getBlockY(), bv.getBlockZ());
}
};
}
/**
* Tests the two block set overlap each other.
* This method works on any implementation of this interface, but they should override the
* {@link #overlaps(BlockSet)} method to provide a more optimized code.
* @param bs1 the first block set.
* @param bs2 the second block set.
* @return true if the two block set overlap, false otherwise.
*/
static boolean overlap(BlockSet bs1, BlockSet bs2) { static boolean overlap(BlockSet bs1, BlockSet bs2) {
if (!bs1.getEnglobingAABB().overlaps(bs2.getEnglobingAABB())) if (!bs1.getEnglobingAABB().overlaps(bs2.getEnglobingAABB()))
return false; return false;

View File

@@ -38,12 +38,20 @@ public class GUIHotBar implements Listener {
private final List<Player> currentPlayers = new ArrayList<>(); private final List<Player> currentPlayers = new ArrayList<>();
/**
* Set up a new gui hot bar. You should not instantiate more than one hot bar.
* @param defaultSlot the default slot (currently held item) when the player joins the hot bar.
*/
public GUIHotBar(int defaultSlot) { public GUIHotBar(int defaultSlot) {
this.defaultSlot = Math.max(0, Math.min(8, defaultSlot)); this.defaultSlot = Math.max(0, Math.min(8, defaultSlot));
BukkitEvent.register(this); BukkitEvent.register(this);
} }
/**
* Disables this hot bar.
* @param clearPlayerMenuItems if the items of this hot bar should be removed from the players inventories.
*/
public void disable(boolean clearPlayerMenuItems) { public void disable(boolean clearPlayerMenuItems) {
removeAllPlayers(clearPlayerMenuItems); removeAllPlayers(clearPlayerMenuItems);
@@ -53,9 +61,10 @@ public class GUIHotBar implements Listener {
/** /**
* Add the item to this hot bar menu. if there is already players hooked to this hot bar, the item will be directly added to * Add the item to this hot bar menu. if there is already players hooked to this hot bar, the item will be directly added to
* their inventories. * their inventories.
* @param i the item stack * @param i the item stack.
* @param setter code executed to put the item in the inventory. Additionally, check for permission before doing the addition. * @param setter code executed to put the item in the inventory. Additionally, check for permission before doing the addition.
* @param run the Runnable to run when the user right-click on the item in the hot bar. * @param run the Runnable to run when the user right-click on the item in the hot bar.
* @return itself for daisy-chaining.
*/ */
public GUIHotBar addItem(ItemStack i, BiConsumer<PlayerInventory, ItemStack> setter, Consumer<Player> run) { public GUIHotBar addItem(ItemStack i, BiConsumer<PlayerInventory, ItemStack> setter, Consumer<Player> run) {
itemsAndSetters.put(i, setter); itemsAndSetters.put(i, setter);
@@ -69,8 +78,9 @@ public class GUIHotBar implements Listener {
/** /**
* Add the hot bar elements to this player, or update them if applicable. * Add the hot bar elements to this player, or update them if applicable.
* * <br>
* The player is automatically removed when they quit. You can remove it before by calling {@link #removePlayer(Player, boolean)}. * The player is automatically removed when they quit. You can remove it before by calling {@link #removePlayer(Player, boolean)}.
* @param p the player to add.
*/ */
public void addPlayer(Player p) { public void addPlayer(Player p) {
if (!currentPlayers.contains(p)) if (!currentPlayers.contains(p))
@@ -85,6 +95,7 @@ public class GUIHotBar implements Listener {
/** /**
* Detach this player from this hot bar manager and removes the managed items from the players inventory. * Detach this player from this hot bar manager and removes the managed items from the players inventory.
* @param p the player to remove.
*/ */
public void removePlayer(Player p) { public void removePlayer(Player p) {
removePlayer(p, true); removePlayer(p, true);
@@ -92,6 +103,8 @@ public class GUIHotBar implements Listener {
/** /**
* Detach this player from this hot bar manager and optionally removes the managed items from the players inventory. * Detach this player from this hot bar manager and optionally removes the managed items from the players inventory.
* @param p the player to remove.
* @param clearMenuItems if the items from this hot bar should be removed from the player inventory.
*/ */
public void removePlayer(Player p, boolean clearMenuItems) { public void removePlayer(Player p, boolean clearMenuItems) {
if (!currentPlayers.contains(p)) if (!currentPlayers.contains(p))
@@ -107,17 +120,27 @@ public class GUIHotBar implements Listener {
} }
/**
* Tells if the provided player is attached to this hot bar.
* @param p the player to check.
* @return true if the player is attached, false otherwise.
*/
public boolean containsPlayer(Player p) { public boolean containsPlayer(Player p) {
return currentPlayers.contains(p); return currentPlayers.contains(p);
} }
/**
* Detach all players from this hot bar.
*/
public void removeAllPlayers() { public void removeAllPlayers() {
removeAllPlayers(true); removeAllPlayers(true);
} }
/**
* Detach all players from this hot bar.
* @param clearMenuItems if the items from this hot bar should be removed from the player inventory.
*/
public void removeAllPlayers(boolean clearMenuItems) { public void removeAllPlayers(boolean clearMenuItems) {
for (Player p : new ArrayList<>(currentPlayers)) for (Player p : new ArrayList<>(currentPlayers))
removePlayer(p, clearMenuItems); removePlayer(p, clearMenuItems);
@@ -127,7 +150,7 @@ public class GUIHotBar implements Listener {
public void addItemToPlayer(Player p, ItemStack is) { private void addItemToPlayer(Player p, ItemStack is) {
if (!itemsAndSetters.containsKey(is)) if (!itemsAndSetters.containsKey(is))
throw new IllegalArgumentException("The provided ItemStack is not registered in this GUIHotBar"); throw new IllegalArgumentException("The provided ItemStack is not registered in this GUIHotBar");
if (!currentPlayers.contains(p)) if (!currentPlayers.contains(p))
@@ -135,7 +158,7 @@ public class GUIHotBar implements Listener {
itemsAndSetters.get(is).accept(p.getInventory(), is.clone()); itemsAndSetters.get(is).accept(p.getInventory(), is.clone());
} }
public void removeItemFromPlayer(Player p, ItemStack is) { private void removeItemFromPlayer(Player p, ItemStack is) {
p.getInventory().remove(is); p.getInventory().remove(is);
} }
@@ -144,7 +167,7 @@ public class GUIHotBar implements Listener {
@EventHandler @EventHandler
public void onPlayerDropItem(PlayerDropItemEvent event) { void onPlayerDropItem(PlayerDropItemEvent event) {
if (!currentPlayers.contains(event.getPlayer())) if (!currentPlayers.contains(event.getPlayer()))
return; return;
@@ -159,7 +182,7 @@ public class GUIHotBar implements Listener {
@EventHandler @EventHandler
public void onPlayerInteract(PlayerInteractEvent event) { void onPlayerInteract(PlayerInteractEvent event) {
if (!currentPlayers.contains(event.getPlayer())) if (!currentPlayers.contains(event.getPlayer()))
return; return;
@@ -188,7 +211,7 @@ public class GUIHotBar implements Listener {
@EventHandler @EventHandler
public void onInventoryClick(InventoryClickEvent event) { void onInventoryClick(InventoryClickEvent event) {
if (event.getClickedInventory() == null || !(event.getClickedInventory() instanceof PlayerInventory inv)) if (event.getClickedInventory() == null || !(event.getClickedInventory() instanceof PlayerInventory inv))
return; return;
@@ -213,20 +236,20 @@ public class GUIHotBar implements Listener {
@EventHandler @EventHandler
public void onPlayerQuit(PlayerQuitEvent event) { void onPlayerQuit(PlayerQuitEvent event) {
removePlayer(event.getPlayer()); removePlayer(event.getPlayer());
} }
@EventHandler @EventHandler
public void onPlayerDeath(PlayerDeathEvent event) { void onPlayerDeath(PlayerDeathEvent event) {
if (!currentPlayers.contains(event.getEntity())) if (!currentPlayers.contains(event.getEntity()))
return; return;
event.getDrops().removeAll(itemsAndSetters.keySet()); event.getDrops().removeAll(itemsAndSetters.keySet());
} }
@EventHandler @EventHandler
public void onPlayerRespawn(PlayerRespawnEvent event) { void onPlayerRespawn(PlayerRespawnEvent event) {
if (!currentPlayers.contains(event.getPlayer())) if (!currentPlayers.contains(event.getPlayer()))
return; return;

View File

@@ -38,7 +38,7 @@ public class GUIInventory implements Listener {
if (title == null) if (title == null)
inv = Bukkit.createInventory(null, nbLines * 9); inv = Bukkit.createInventory(null, nbLines * 9);
else else
inv = Bukkit.createInventory(null, nbLines * 9, title.getAdv()); inv = Bukkit.createInventory(null, nbLines * 9, title.get());
setCloseEvent(closeEventAction); setCloseEvent(closeEventAction);
@@ -50,6 +50,10 @@ public class GUIInventory implements Listener {
} }
/**
* Sets the action when the player closes the inventory window.
* @param closeEventAction the action to run.
*/
protected void setCloseEvent(Consumer<InventoryCloseEvent> closeEventAction) { protected void setCloseEvent(Consumer<InventoryCloseEvent> closeEventAction) {
onCloseEvent = closeEventAction; onCloseEvent = closeEventAction;
} }
@@ -190,11 +194,11 @@ public class GUIInventory implements Listener {
} }
/**
* Tells the number of inventory line needed to show the provided number of slot.
* @param nb the number of slot.
* @return the number of line.
*/
public static int nbLineForNbElements(int nb) { public static int nbLineForNbElements(int nb) {
return nb / 9 + ((nb % 9 == 0) ? 0 : 1); return nb / 9 + ((nb % 9 == 0) ? 0 : 1);
} }

View File

@@ -0,0 +1,232 @@
package fr.pandacube.lib.paper.inventory;
import com.google.common.base.Preconditions;
import org.bukkit.Material;
import org.bukkit.entity.HumanEntity;
import org.bukkit.inventory.EquipmentSlot;
import org.bukkit.inventory.Inventory;
import org.bukkit.inventory.ItemStack;
import org.bukkit.inventory.PlayerInventory;
import org.jetbrains.annotations.NotNull;
import org.jetbrains.annotations.Nullable;
import java.util.Arrays;
import java.util.Objects;
/**
* Dummy implementation of a player inventory.
*/
public class DummyPlayerInventory extends InventoryWrapper implements PlayerInventory {
/**
* Total number of item slots in the player inventory.
*/
public static final int PLAYER_INVENTORY_SIZE = 43; // 36 base inventory + 4 armor slots + 1 off hand + 2 hidden slots (body and saddle)
private int heldItemSlot;
/**
* Creates a dummy player inventory.
* @param base the inventory itself.
* @param heldItemSlot the currently held item slot, from 0 to 8.
*/
public DummyPlayerInventory(Inventory base, int heldItemSlot) {
super(base);
if (base.getSize() < PLAYER_INVENTORY_SIZE)
throw new IllegalArgumentException("base inventory should have a size of " + PLAYER_INVENTORY_SIZE + " (" + base.getSize() + " given).");
if (heldItemSlot < 0 || heldItemSlot > 8)
throw new IllegalArgumentException("heldItemSlot should be between 0 and 8 inclusive.");
this.heldItemSlot = heldItemSlot;
}
@Override
public @Nullable ItemStack @NotNull [] getStorageContents() {
return Arrays.copyOfRange(getContents(), 0, 36);
}
@Override
public @Nullable ItemStack @NotNull [] getArmorContents() {
return Arrays.copyOfRange(getContents(), 36, 40);
}
@Override
public void setArmorContents(@Nullable ItemStack[] items) {
this.setSlots(items, 36, 4);
}
@Override
public @Nullable ItemStack @NotNull [] getExtraContents() {
return Arrays.copyOfRange(getContents(), 40, getSize());
}
@Override
public void setExtraContents(@Nullable ItemStack[] items) {
this.setSlots(items, 40, getSize() - 40);
}
private void setSlots(ItemStack[] items, int baseSlot, int length) {
if (items == null) {
items = new ItemStack[length];
}
Preconditions.checkArgument(items.length <= length, "items.length must be < %s", length);
for (int i = 0; i < length; i++) {
if (i >= items.length) {
this.setItem(baseSlot + i, null);
} else {
this.setItem(baseSlot + i, items[i]);
}
}
}
@Override
public ItemStack getHelmet() {
return getItem(39);
}
@Override
public void setHelmet(@Nullable ItemStack helmet) {
setItem(39, helmet);
}
@Override
public ItemStack getChestplate() {
return getItem(38);
}
@Override
public void setChestplate(@Nullable ItemStack chestplate) {
setItem(38, chestplate);
}
@Override
public ItemStack getLeggings() {
return getItem(37);
}
@Override
public void setLeggings(@Nullable ItemStack leggings) {
setItem(37, leggings);
}
@Override
public ItemStack getBoots() {
return getItem(36);
}
@Override
public void setBoots(@Nullable ItemStack boots) {
setItem(36, boots);
}
/**
* Gets the item stack in the SADDLE {@link EquipmentSlot}.
* @return the SADDLE item stack.
*/
public ItemStack getSaddle() {
return getItem(42);
}
/**
* Puts the provided item stack in the SADDLE {@link EquipmentSlot}.
* @param saddle the item.
*/
public void setSaddle(@Nullable ItemStack saddle) {
setItem(42, saddle);
}
/**
* Gets the item stack in the BODY {@link EquipmentSlot}.
* @return the BODY item stack.
*/
public ItemStack getBody() {
return getItem(41);
}
/**
* Puts the provided item stack in the BODY {@link EquipmentSlot}.
* @param body the item.
*/
public void setBody(@Nullable ItemStack body) {
setItem(41, body);
}
@Override
public void setItem(EquipmentSlot slot, ItemStack item) {
Preconditions.checkArgument(slot != null, "slot must not be null");
switch (slot) {
case HAND -> this.setItemInMainHand(item);
case OFF_HAND -> this.setItemInOffHand(item);
case FEET -> this.setBoots(item);
case LEGS -> this.setLeggings(item);
case CHEST -> this.setChestplate(item);
case HEAD -> this.setHelmet(item);
case BODY -> this.setBody(item);
case SADDLE -> this.setSaddle(item);
}
}
@Override
public @NotNull ItemStack getItem(@NotNull EquipmentSlot slot) {
return switch (slot) {
case HAND -> this.getItemInMainHand();
case OFF_HAND -> this.getItemInOffHand();
case FEET -> Objects.requireNonNullElseGet(this.getBoots(), () -> new ItemStack(Material.AIR));
case LEGS -> Objects.requireNonNullElseGet(this.getLeggings(), () -> new ItemStack(Material.AIR));
case CHEST -> Objects.requireNonNullElseGet(this.getChestplate(), () -> new ItemStack(Material.AIR));
case HEAD -> Objects.requireNonNullElseGet(this.getHelmet(), () -> new ItemStack(Material.AIR));
case BODY -> Objects.requireNonNullElseGet(this.getBody(), () -> new ItemStack(Material.AIR)); // for horses/wolves armor
case SADDLE -> Objects.requireNonNullElseGet(this.getSaddle(), () -> new ItemStack(Material.AIR));
};
}
@Override
public @NotNull ItemStack getItemInMainHand() {
return Objects.requireNonNullElse(getItem(heldItemSlot), new ItemStack(Material.AIR));
}
@Override
public void setItemInMainHand(@Nullable ItemStack item) {
setItem(heldItemSlot, item);
}
@Override
public @NotNull ItemStack getItemInOffHand() {
return Objects.requireNonNullElse(getItem(40), new ItemStack(Material.AIR));
}
@Override
public void setItemInOffHand(@Nullable ItemStack item) {
setItem(40, item);
}
@Override
public @NotNull ItemStack getItemInHand() {
return getItemInMainHand();
}
@Override
public void setItemInHand(@Nullable ItemStack stack) {
setItemInMainHand(stack);
}
@Override
public int getHeldItemSlot() {
return heldItemSlot;
}
@Override
public void setHeldItemSlot(int slot) {
if (slot < 0 || slot > 8)
throw new IllegalArgumentException("Slot is not between 0 and 8 inclusive");
heldItemSlot = slot;
}
@Override
public @Nullable HumanEntity getHolder() {
return null;
}
}

View File

@@ -1,4 +1,4 @@
package fr.pandacube.lib.paper.util; package fr.pandacube.lib.paper.inventory;
import org.bukkit.Location; import org.bukkit.Location;
import org.bukkit.Material; import org.bukkit.Material;
@@ -13,12 +13,22 @@ import org.jetbrains.annotations.Nullable;
import java.util.HashMap; import java.util.HashMap;
import java.util.List; import java.util.List;
import java.util.ListIterator; import java.util.ListIterator;
import java.util.Objects;
/**
* Wrapper for an {@link Inventory}.
* Can be overridden to add specific behaviour to some methods.
*/
public class InventoryWrapper implements Inventory { public class InventoryWrapper implements Inventory {
private final Inventory base; private final Inventory base;
/**
* Creates a wrapper for the provided inventory.
* @param base the wrapped inventory. Cannot be null.
* @throws NullPointerException if the base inventory is null.
*/
public InventoryWrapper(Inventory base) { public InventoryWrapper(Inventory base) {
this.base = base; this.base = Objects.requireNonNull(base, "base inventory cannot be null.");
} }

View File

@@ -0,0 +1,413 @@
package fr.pandacube.lib.paper.inventory;
import com.google.common.collect.Streams;
import fr.pandacube.lib.chat.Chat;
import io.papermc.paper.datacomponent.DataComponentType;
import io.papermc.paper.datacomponent.DataComponentType.Valued;
import io.papermc.paper.datacomponent.DataComponentTypes;
import io.papermc.paper.datacomponent.item.ResolvableProfile;
import net.kyori.adventure.text.Component;
import net.kyori.adventure.text.ComponentLike;
import org.bukkit.Material;
import org.bukkit.NamespacedKey;
import org.bukkit.enchantments.Enchantment;
import org.bukkit.inventory.ItemFlag;
import org.bukkit.inventory.ItemStack;
import org.bukkit.inventory.meta.Damageable;
import org.bukkit.inventory.meta.ItemMeta;
import java.util.Arrays;
import java.util.Collection;
import java.util.Collections;
import java.util.List;
import java.util.function.Consumer;
import static fr.pandacube.lib.chat.ChatStatic.chatComponent;
/**
* A builder for {@link ItemStack}.
*/
public class ItemStackBuilder {
/**
* Create a builder with a clone of the provided ItemStack.
* <p>
* The returned builder will not alter the provided ItemStack.
* If you want to modify the ItemStack with the builder, please use {@link #wrap(ItemStack)}.
* @param base the original ItemStack.
* @return the builder
*/
public static ItemStackBuilder of(ItemStack base) {
return wrap(base.clone());
}
/**
* Create a builder of a new ItemStack with the specified Material.
* @param mat the material of the new built ItemStack
* @return the builder
*/
public static ItemStackBuilder of(Material mat) {
return wrap(new ItemStack(mat));
}
/**
* Create a builder that will alter the data of the provided ItemStack.
* <p>
* The {@link #build()} method of the returned builder will return the same instance
* of ItemStack as the parameter of this method.
* <p>
* To create a builder that doesn't modify the provided ItemStack, use {@link #of(ItemStack)}.
* @param stack the wrapped item stack.
* @return the builder
*/
public static ItemStackBuilder wrap(ItemStack stack) {
return new ItemStackBuilder(stack);
}
private final ItemStack stack;
private ItemStackBuilder(ItemStack base) {
stack = base;
}
/**
* Runs the provided updater on the {@link ItemMeta} instance of the built stack.
* @param metaUpdater the updater that will modify the meta.
* @return itself.
*/
public ItemStackBuilder meta(Consumer<ItemMeta> metaUpdater) {
return meta(metaUpdater, ItemMeta.class);
}
/**
* Runs the provided updater on the {@link ItemMeta} instance of the built stack.
* @param metaUpdater the updater that will modify the meta.
* @param metaType the type of the meta instance.
* @param <T> the type of item meta.
* @return itself.
*/
public <T extends ItemMeta> ItemStackBuilder meta(Consumer<T> metaUpdater, Class<T> metaType) {
stack.editMeta(metaType, metaUpdater);
return this;
}
/**
* Sets the amount of the built stack.
* @param a the new amount.
* @return itself.
*/
public ItemStackBuilder amount(int a) {
stack.setAmount(a);
return this;
}
/**
* Sets the display name of the item, directly passing to {@link ItemMeta#displayName(Component)}.
* @param displayName the new display name. Can be null to unset.
* @return itself.
*/
public ItemStackBuilder rawDisplayName(Component displayName) {
return meta(m -> m.displayName(displayName));
}
/**
* Sets the display name of the item, filtering to make default italic to false.
* @param displayName the new display name. Can be null to unset.
* @return itself.
*/
public ItemStackBuilder displayName(ComponentLike displayName) {
return rawDisplayName(displayName != null
? Chat.italicFalseIfNotSet(chatComponent(displayName)).asComponent()
: null);
}
/**
* Sets the lore of the item, directly passing to {@link ItemMeta#lore(List)}.
* @param lore the new lore. Can be null to unset.
* @return itself.
*/
public ItemStackBuilder rawLore(List<Component> lore) {
return meta(m -> m.lore(lore));
}
/**
* Sets the lore of the item, filtering to make default italic to false.
* @param lore the new lore. Can be null to unset.
* @return itself.
*/
public ItemStackBuilder lore(List<? extends ComponentLike> lore) {
if (lore != null) {
return rawLore(lore.stream()
.map(line -> Chat.italicFalseIfNotSet(chatComponent(line)).get())
.toList());
}
else
return rawLore(Collections.emptyList());
}
/**
* Adds new lore lines to the existing lore of the item.
* @param lores the added lore lines.
* @return itself.
*/
public ItemStackBuilder addLoreAfter(List<? extends ComponentLike> lores) {
if (lores != null) {
List<Component> baseLore = stack.getItemMeta().lore();
if (baseLore == null) baseLore = Collections.emptyList();
return rawLore(
Streams.concat(
baseLore.stream(),
lores.stream()
.map(line -> Chat.italicFalseIfNotSet(chatComponent(line)).get())
)
.toList());
}
else
return this;
}
/**
* Adds new lore lines to the existing lore of the item.
* @param lores the added lore lines.
* @return itself.
*/
public ItemStackBuilder addLoreAfter(ComponentLike... lores) {
if (lores == null || lores.length == 0)
return this;
return addLoreAfter(Arrays.asList(lores));
}
/**
* Enchant the item.
* Supports unsafe enchants.
* @param enchantment the enchantment.
* @param level the enchant level.
* @return itself.
*/
public ItemStackBuilder enchant(Enchantment enchantment, int level) {
return meta(m -> m.addEnchant(enchantment, level, true));
}
/**
* Adds the provided flags to the item.
* @param flags he flags to add.
* @return itself.
*/
public ItemStackBuilder flags(ItemFlag... flags) {
return flags(true, flags);
}
/**
* Adds or removes the provided flags to the item.
* @param add true to add, false to remove.
* @param flags he flags to add.
* @return itself.
*/
public ItemStackBuilder flags(boolean add, ItemFlag... flags) {
return add ? meta(m -> m.addItemFlags(flags))
: meta(m -> m.removeItemFlags(flags));
}
/**
* Hides the enchants from the tooltip of the item.
* Will set the {@link ItemFlag#HIDE_ENCHANTS} flag of the item.
* @return itself.
*/
public ItemStackBuilder hideEnchants() {
return hideEnchants(true);
}
/**
* Sets or unsets the {@link ItemFlag#HIDE_ENCHANTS} flag of the item.
* @param hide true to hide, false to show.
* @return itself.
*/
public ItemStackBuilder hideEnchants(boolean hide) {
return flags(hide, ItemFlag.HIDE_ENCHANTS);
}
/**
* Hides the attributes from the tooltip of the item.
* Will set the {@link ItemFlag#HIDE_ATTRIBUTES} flag of the item.
* @return itself.
*/
public ItemStackBuilder hideAttributes() {
return hideAttributes(true);
}
/**
* Sets or unsets the {@link ItemFlag#HIDE_ATTRIBUTES} flag of the item.
* @param hide true to hide, false to show.
* @return itself.
*/
public ItemStackBuilder hideAttributes(boolean hide) {
return flags(hide, ItemFlag.HIDE_ATTRIBUTES);
}
/**
* Apply the enchantment glint to the item, event if it's not enchant.
* @return itself.
*/
public ItemStackBuilder fakeEnchant() {
return fakeEnchant(true);
}
/**
* Sets the enchantment glint override to the item.
* @param apply true to enforce the enchantment glint, false to set to default.
* @return itself.
*/
public ItemStackBuilder fakeEnchant(boolean apply) {
return meta(m -> m.setEnchantmentGlintOverride(apply ? true : null));
}
/**
* Sets this item as unbreakable.
* @return itself.
*/
public ItemStackBuilder unbreakable() {
return unbreakable(true);
}
/**
* Sets the unbreakable status of this item.
* @param unbreakable the unbreakable status.
* @return itself.
*/
public ItemStackBuilder unbreakable(boolean unbreakable) {
return meta(m -> m.setUnbreakable(unbreakable));
}
/**
* Sets the damage value of this item.
* @param d the new damage value.
* @return itself.
*/
public ItemStackBuilder damage(int d) {
return meta(m -> m.setDamage(d), Damageable.class);
}
/**
* Sets a value for a data component of this item.
* @param dataType the data component type.
* @param dataValue the data component value.
* @return itself.
* @param <T> the data component API type.
*/
public <T> ItemStackBuilder data(Valued<T> dataType, T dataValue) {
stack.setData(dataType, dataValue);
return this;
}
/**
* Unset (set to empty) a value for a data component of this item.
* @param dataType the data component type.
* @return itself.
*/
public ItemStackBuilder unsetData(DataComponentType dataType) {
stack.unsetData(dataType);
return this;
}
/**
* Reset (act as default) a value for a data component of this item.
* @param dataType the data component type.
* @return itself.
*/
public ItemStackBuilder resetData(DataComponentType dataType) {
stack.resetData(dataType);
return this;
}
/**
* Sets the {@code can_break} data component to the provided list of {@link Material}.
* @param canBreak a list of {@link Material}.
* @return itself.
*/
public ItemStackBuilder canBreakMaterials(Collection<Material> canBreak) {
return canBreak(canBreak.stream().map(Material::getKey).toList());
}
/**
* Sets the {@code can_break} data component to the provided list of {@link NamespacedKey}.
* @param canBreak a list of block predicate. If empty, unsets the data component. If null, reset to default.
* @return itself.
*/
@SuppressWarnings("removal")
public ItemStackBuilder canBreak(Collection<NamespacedKey> canBreak) {
@SuppressWarnings("unchecked")
Collection<com.destroystokyo.paper.Namespaced> nsCanBreak = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canBreak;
return meta(m -> m.setDestroyableKeys(nsCanBreak));
/*
if (canBreak == null)
return resetData(DataComponentTypes.CAN_BREAK);
else if (canBreak.isEmpty())
return unsetData(DataComponentTypes.CAN_BREAK);
else
return data(DataComponentTypes.CAN_BREAK, ItemAdventurePredicate.itemAdventurePredicate(canBreak));*/
}
/**
* Sets the {@code can_place_on} data component to the provided list of {@link Material}.
* @param canPlaceOn a list of {@link Material}.
* @return itself.
*/
public ItemStackBuilder canPlaceOnMaterials(Collection<Material> canPlaceOn) {
return canPlaceOn(canPlaceOn.stream().map(Material::getKey).toList());
}
/**
* Sets the {@code can_place_on} data component to the provided list of {@link NamespacedKey}.
* @param canPlaceOn a list of block predicate. If empty, unsets the data component. If null, reset to default.
* @return itself.
*/
@SuppressWarnings("removal")
public ItemStackBuilder canPlaceOn(Collection<NamespacedKey> canPlaceOn) {
@SuppressWarnings("unchecked")
Collection<com.destroystokyo.paper.Namespaced> nsCanPlaceOn = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canPlaceOn;
return meta(m -> m.setPlaceableKeys(nsCanPlaceOn));
/* if (canPlaceOn == null)
return resetData(DataComponentTypes.CAN_PLACE_ON);
else if (canPlaceOn.isEmpty())
return unsetData(DataComponentTypes.CAN_PLACE_ON);
else
return data(DataComponentTypes.CAN_PLACE_ON, ItemAdventurePredicate.itemAdventurePredicate(canPlaceOn)); */
}
/**
* Sets the {@code profile} data component to the provided profile.
* @param profile the profile to use as the component value.
* @return itself.
*/
public ItemStackBuilder profile(ResolvableProfile profile) {
return data(DataComponentTypes.PROFILE, profile);
}
/**
* Build the {@link ItemStack}.
* @return the build item stack.
*/
public ItemStack build() {
return stack;
}
}

View File

@@ -0,0 +1,126 @@
package fr.pandacube.lib.paper.inventory;
import com.destroystokyo.paper.profile.ProfileProperty;
import io.papermc.paper.datacomponent.item.ResolvableProfile;
import org.bukkit.Material;
import org.bukkit.inventory.ItemStack;
import java.util.Base64;
import java.util.regex.Pattern;
/**
* Represents some special mob heads, also support creating player skulls and custom skulls.
*/
public enum Skull {
/** Jungle wood arrow left. */
ARROW_LEFT("http://textures.minecraft.net/texture/3625902b389ed6c147574e422da8f8f361c8eb57e7631676a72777e7b1d"),
/** Jungle wood arrow right. */
ARROW_RIGHT("http://textures.minecraft.net/texture/d4be8aeec11849697adc6fd1f189b16642dff19f2955c05deaba68c9dff1be"),
/** Jungle wood arrow up. */
ARROW_UP("http://textures.minecraft.net/texture/88c0f37dec764d6e26b57aa8212572fbace5ee8f27f7b61c1fdaa47dd4c893"),
/** Jungle wood arrow down. */
ARROW_DOWN("http://textures.minecraft.net/texture/751ced2e647366f8f3ad2dfe415cca85651bfaf9739a95cd57b6f21cba053"),
/** Jungle wood question mark. */
QUESTION("http://textures.minecraft.net/texture/b4d7cc4dca986a53f1d6b52aaf376dc6acc73b8b287f42dc8fef5808bb5d76"),
/** Jungle wood exclamation mark. */
EXCLAMATION("http://textures.minecraft.net/texture/e869dc405a3155f281c16a3e8d9ff54afc1599153b4d9385c9b7bab88680f0");
private final String skinUrl;
Skull(String skinUrl) {
this.skinUrl = skinUrl;
}
/**
* Return the item based on this Skull enum.
* @return the item stack.
*/
public ItemStack get() {
return getFromSkinURL(skinUrl);
}
/**
* Return an item stack builder already containing the skull.
* @return an item stack builder already containing the skull.
*/
public ItemStackBuilder builder() {
return ItemStackBuilder.wrap(get());
}
/**
* Return a skull of a player based on their name.
*
* @param name player's name
* @return item stack
*/
public static ItemStack getFromPlayerName(String name) {
return getFromProfile(ResolvableProfile.resolvableProfile().name(name).build());
}
/**
* Return a skull that has a custom texture specified by url.
* @param url skin url.
* @return item stack
*/
public static ItemStack getFromSkinURL(String url) {
return getFromProfile(ResolvableProfile.resolvableProfile().addProperty(getTexturesProperty(url)).build());
}
private static ItemStack getFromProfile(ResolvableProfile profile) {
return ItemStackBuilder.of(Material.PLAYER_HEAD).profile(profile).build();
}
/**
* The URL prefix for all the player related textures (skin, cape)
*/
public static final String TEXTURE_URL_PREFIX = "http://textures.minecraft.net/texture/";
private static final Pattern textureIdMatcher = Pattern.compile("^[0-9a-fA-F]+$");
/**
* Generate the base64 value of the "textures" profile property, based on the provided skin url!
* @param skinURL the URL of the skin. The "https" will be replaced by "http" because this is the protocol used in
* the profile property url. If only the texture id part is provided, {@link #TEXTURE_URL_PREFIX} is
* prepended.
* @return the base64 encoded texture data.
*/
private static String encodeTextureBase64String(String skinURL) {
if (skinURL.startsWith("https://")) // secure url is not the url found in texture data (even if it actually works in the browser)
skinURL = "http://" + skinURL.substring("https://".length());
if (!skinURL.startsWith(TEXTURE_URL_PREFIX)) { // accept taking only the texture id part ()
if (textureIdMatcher.matcher(skinURL).matches())
skinURL = TEXTURE_URL_PREFIX + skinURL;
else
throw new IllegalArgumentException("Invalid skin URL. Must be from " + TEXTURE_URL_PREFIX + ".");
}
return Base64.getEncoder().encodeToString(String.format("{\"textures\":{\"SKIN\":{\"url\":\"%s\"}}}", skinURL).getBytes());
}
private static ProfileProperty getTexturesProperty(String skinURL) {
return new ProfileProperty("textures", encodeTextureBase64String(skinURL));
}
}

View File

@@ -23,7 +23,7 @@ import java.util.Map;
/** /**
* Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease * Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease
* serialization to YAML. * serialization to YAML.
* * <p>
* To not reinvent the wheel, this class uses the Bukkits Yaml API to convert the objects from/to json. * To not reinvent the wheel, this class uses the Bukkits Yaml API to convert the objects from/to json.
*/ */
/* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> { /* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> {

View File

@@ -9,10 +9,13 @@ import com.google.gson.JsonObject;
import com.google.gson.JsonParseException; import com.google.gson.JsonParseException;
import com.google.gson.JsonSerializationContext; import com.google.gson.JsonSerializationContext;
import com.google.gson.JsonSerializer; import com.google.gson.JsonSerializer;
import com.google.gson.Strictness;
import com.google.gson.TypeAdapterFactory; import com.google.gson.TypeAdapterFactory;
import com.google.gson.internal.bind.TreeTypeAdapter; import com.google.gson.internal.bind.TreeTypeAdapter;
import com.google.gson.reflect.TypeToken; import com.google.gson.reflect.TypeToken;
import net.kyori.adventure.key.Key;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.Registry;
import org.bukkit.configuration.serialization.ConfigurationSerializable; import org.bukkit.configuration.serialization.ConfigurationSerializable;
import org.bukkit.configuration.serialization.ConfigurationSerialization; import org.bukkit.configuration.serialization.ConfigurationSerialization;
import org.bukkit.inventory.ItemStack; import org.bukkit.inventory.ItemStack;
@@ -28,16 +31,25 @@ import java.util.Map;
private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { }; private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { };
/** Gson instance with no custom type adapter */ /** Gson instance with no custom type adapter */
private static final Gson vanillaGson = new GsonBuilder().setLenient().create(); private static final Gson vanillaGson = new GsonBuilder().setStrictness(Strictness.LENIENT).create();
@Override @Override
public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException { public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
if (!(json instanceof JsonObject jsonObj)) if (!(json instanceof JsonObject jsonObj))
throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure."); throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure.");
// if it contains both old and new data, delete the old one introduced for compatibility
if (jsonObj.has("DataVersion") || jsonObj.has("id")) {
jsonObj.remove("v");
jsonObj.remove("type");
}
// format used when using ConfigurationSerialization
if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY))
return context.deserialize(jsonObj, ConfigurationSerializable.class); return context.deserialize(jsonObj, ConfigurationSerializable.class);
if (jsonObj.has("meta") if (jsonObj.has("meta")
&& jsonObj.get("meta") instanceof JsonObject metaJson && jsonObj.get("meta") instanceof JsonObject metaJson
&& !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) { && !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) {
@@ -47,6 +59,8 @@ import java.util.Map;
Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType()); Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType());
fixDeserializationVersion(map); fixDeserializationVersion(map);
map.remove("meta"); map.remove("meta");
ItemStack is = ItemStack.deserialize(map); ItemStack is = ItemStack.deserialize(map);
Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass(); Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass();

View File

@@ -14,4 +14,7 @@ public class PaperJson {
Json.registerTypeAdapterFactory(ItemStackAdapter.FACTORY); Json.registerTypeAdapterFactory(ItemStackAdapter.FACTORY);
Json.registerTypeAdapterFactory(ConfigurationSerializableAdapter.FACTORY); Json.registerTypeAdapterFactory(ConfigurationSerializableAdapter.FACTORY);
} }
private PaperJson() {}
} }

View File

@@ -4,7 +4,6 @@ import com.destroystokyo.paper.event.server.ServerTickEndEvent;
import com.destroystokyo.paper.event.server.ServerTickStartEvent; import com.destroystokyo.paper.event.server.ServerTickStartEvent;
import fr.pandacube.lib.chat.Chat; import fr.pandacube.lib.chat.Chat;
import fr.pandacube.lib.chat.ChatColorGradient; import fr.pandacube.lib.chat.ChatColorGradient;
import fr.pandacube.lib.chat.ChatColorUtil;
import fr.pandacube.lib.chat.ChatConfig.PandaTheme; import fr.pandacube.lib.chat.ChatConfig.PandaTheme;
import fr.pandacube.lib.paper.PandaLibPaper; import fr.pandacube.lib.paper.PandaLibPaper;
import fr.pandacube.lib.paper.players.PaperOffPlayer; import fr.pandacube.lib.paper.players.PaperOffPlayer;
@@ -13,16 +12,16 @@ import fr.pandacube.lib.paper.scheduler.SchedulerUtil;
import fr.pandacube.lib.paper.util.AutoUpdatedBossBar; import fr.pandacube.lib.paper.util.AutoUpdatedBossBar;
import fr.pandacube.lib.paper.util.AutoUpdatedBossBar.BarUpdater; import fr.pandacube.lib.paper.util.AutoUpdatedBossBar.BarUpdater;
import fr.pandacube.lib.players.standalone.AbstractPlayerManager; import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
import fr.pandacube.lib.util.log.Log;
import fr.pandacube.lib.util.MemoryUtil; import fr.pandacube.lib.util.MemoryUtil;
import fr.pandacube.lib.util.MemoryUtil.MemoryUnit; import fr.pandacube.lib.util.MemoryUtil.MemoryUnit;
import fr.pandacube.lib.util.TimeUtil; import fr.pandacube.lib.util.TimeUtil;
import fr.pandacube.lib.util.log.Log;
import net.kyori.adventure.bossbar.BossBar; import net.kyori.adventure.bossbar.BossBar;
import net.kyori.adventure.bossbar.BossBar.Color; import net.kyori.adventure.bossbar.BossBar.Color;
import net.kyori.adventure.bossbar.BossBar.Overlay; import net.kyori.adventure.bossbar.BossBar.Overlay;
import net.kyori.adventure.text.format.NamedTextColor; import net.kyori.adventure.text.format.NamedTextColor;
import net.kyori.adventure.text.format.TextColor; import net.kyori.adventure.text.format.TextColor;
import net.md_5.bungee.api.ChatColor; import org.apache.commons.lang3.tuple.Pair;
import org.bukkit.Bukkit; import org.bukkit.Bukkit;
import org.bukkit.command.CommandSender; import org.bukkit.command.CommandSender;
import org.bukkit.command.ConsoleCommandSender; import org.bukkit.command.ConsoleCommandSender;
@@ -38,6 +37,7 @@ import java.lang.management.ThreadMXBean;
import java.util.ArrayList; import java.util.ArrayList;
import java.util.LinkedList; import java.util.LinkedList;
import java.util.List; import java.util.List;
import java.util.concurrent.atomic.AtomicInteger;
import static fr.pandacube.lib.chat.ChatStatic.chat; import static fr.pandacube.lib.chat.ChatStatic.chat;
import static fr.pandacube.lib.chat.ChatStatic.failureText; import static fr.pandacube.lib.chat.ChatStatic.failureText;
@@ -45,10 +45,17 @@ import static fr.pandacube.lib.chat.ChatStatic.infoText;
import static fr.pandacube.lib.chat.ChatStatic.successText; import static fr.pandacube.lib.chat.ChatStatic.successText;
import static fr.pandacube.lib.chat.ChatStatic.text; import static fr.pandacube.lib.chat.ChatStatic.text;
/**
* Various tools to supervise the JVM RAM and the CPU usage of the main server thread.
*/
public class PerformanceAnalysisManager implements Listener { public class PerformanceAnalysisManager implements Listener {
private static PerformanceAnalysisManager instance; private static PerformanceAnalysisManager instance;
/**
* Gets the instance of {@link PerformanceAnalysisManager}.
* @return the instance of {@link PerformanceAnalysisManager}.
*/
public static synchronized PerformanceAnalysisManager getInstance() { public static synchronized PerformanceAnalysisManager getInstance() {
if (instance == null) if (instance == null)
instance = new PerformanceAnalysisManager(); instance = new PerformanceAnalysisManager();
@@ -77,14 +84,22 @@ public class PerformanceAnalysisManager implements Listener {
private final LinkedList<Long> interTPSDurations = new LinkedList<>(); private final LinkedList<Long> interTPSDurations = new LinkedList<>();
/**
* The boss bar that shows in real time the CPU performance of the main server thread.
*/
public final AutoUpdatedBossBar tpsBar; public final AutoUpdatedBossBar tpsBar;
/**
* The boss bar that shows in real time the JVM RAM usage.
*/
public final AutoUpdatedBossBar memoryBar; public final AutoUpdatedBossBar memoryBar;
private final List<Player> barPlayers = new ArrayList<>(); private final List<Player> barPlayers = new ArrayList<>();
private final List<BossBar> relatedBossBars = new ArrayList<>(); private final List<BossBar> relatedBossBars = new ArrayList<>();
/**
* The gradient of color covering the common range of TPS values.
*/
public final ChatColorGradient tps1sGradient = new ChatColorGradient() public final ChatColorGradient tps1sGradient = new ChatColorGradient()
.add(0, NamedTextColor.BLACK) .add(0, NamedTextColor.BLACK)
.add(1, NamedTextColor.DARK_RED) .add(1, NamedTextColor.DARK_RED)
@@ -95,23 +110,7 @@ public class PerformanceAnalysisManager implements Listener {
.add(21, PandaTheme.CHAT_GREEN_1_NORMAL) .add(21, PandaTheme.CHAT_GREEN_1_NORMAL)
.add(26, NamedTextColor.BLUE); .add(26, NamedTextColor.BLUE);
private final ChatColorGradient memoryUsageGradient = new ChatColorGradient()
public final ChatColorGradient tps10sGradient = new ChatColorGradient()
.add(0, NamedTextColor.DARK_RED)
.add(5, NamedTextColor.RED)
.add(10, NamedTextColor.GOLD)
.add(14, NamedTextColor.YELLOW)
.add(19, PandaTheme.CHAT_GREEN_1_NORMAL);
public final ChatColorGradient tps1mGradient = new ChatColorGradient()
.add(0, NamedTextColor.DARK_RED)
.add(8, NamedTextColor.RED)
.add(14, NamedTextColor.GOLD)
.add(17, NamedTextColor.YELLOW)
.add(19, PandaTheme.CHAT_GREEN_1_NORMAL);
public final ChatColorGradient memoryUsageGradient = new ChatColorGradient()
.add(.60f, PandaTheme.CHAT_GREEN_1_NORMAL) .add(.60f, PandaTheme.CHAT_GREEN_1_NORMAL)
.add(.70f, NamedTextColor.YELLOW) .add(.70f, NamedTextColor.YELLOW)
.add(.80f, NamedTextColor.GOLD) .add(.80f, NamedTextColor.GOLD)
@@ -133,10 +132,19 @@ public class PerformanceAnalysisManager implements Listener {
} }
/**
* Tells if the provided players is seeing the performance boss bars.
* @param p the player to verify.
* @return true if the provided players is seeing the performance boss bars, false otherwise.
*/
public boolean barsContainsPlayer(Player p) { public boolean barsContainsPlayer(Player p) {
return barPlayers.contains(p); return barPlayers.contains(p);
} }
/**
* Shows the performance boss bars to the provided player.
* @param p the player.
*/
public synchronized void addPlayerToBars(Player p) { public synchronized void addPlayerToBars(Player p) {
barPlayers.add(p); barPlayers.add(p);
p.showBossBar(tpsBar.bar); p.showBossBar(tpsBar.bar);
@@ -145,6 +153,10 @@ public class PerformanceAnalysisManager implements Listener {
p.showBossBar(bar); p.showBossBar(bar);
} }
/**
* Hides the performance boss bars from the provided player.
* @param p the player.
*/
public synchronized void removePlayerToBars(Player p) { public synchronized void removePlayerToBars(Player p) {
p.hideBossBar(tpsBar.bar); p.hideBossBar(tpsBar.bar);
p.hideBossBar(memoryBar.bar); p.hideBossBar(memoryBar.bar);
@@ -153,6 +165,10 @@ public class PerformanceAnalysisManager implements Listener {
barPlayers.remove(p); barPlayers.remove(p);
} }
/**
* Show an additional boss bar to the players currently seeing the performance ones.
* @param bar the new bar to show.
*/
public synchronized void addBossBar(BossBar bar) { public synchronized void addBossBar(BossBar bar) {
if (relatedBossBars.contains(bar)) if (relatedBossBars.contains(bar))
return; return;
@@ -161,6 +177,10 @@ public class PerformanceAnalysisManager implements Listener {
p.showBossBar(bar); p.showBossBar(bar);
} }
/**
* Hides an additional boss bar from the players currently seeing the performance ones.
* @param bar the additional bar to hide.
*/
public synchronized void removeBossBar(BossBar bar) { public synchronized void removeBossBar(BossBar bar) {
if (!relatedBossBars.contains(bar)) if (!relatedBossBars.contains(bar))
return; return;
@@ -169,7 +189,10 @@ public class PerformanceAnalysisManager implements Listener {
p.hideBossBar(bar); p.hideBossBar(bar);
} }
public synchronized void cancelInternalBossBar() { /**
* De-initialize the performance analyzer.
*/
public synchronized void deinit() {
tpsBar.cancel(); tpsBar.cancel();
memoryBar.cancel(); memoryBar.cancel();
} }
@@ -179,7 +202,7 @@ public class PerformanceAnalysisManager implements Listener {
@EventHandler @EventHandler
public synchronized void onTickStart(ServerTickStartEvent event) { synchronized void onTickStart(ServerTickStartEvent event) {
tickStartNanoTime = System.nanoTime(); tickStartNanoTime = System.nanoTime();
tickStartCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0; tickStartCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
@@ -187,7 +210,7 @@ public class PerformanceAnalysisManager implements Listener {
} }
@EventHandler @EventHandler
public synchronized void onTickEnd(ServerTickEndEvent event) { synchronized void onTickEnd(ServerTickEndEvent event) {
tickEndNanoTime = System.nanoTime(); tickEndNanoTime = System.nanoTime();
long tickEndCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0; long tickEndCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
@@ -214,7 +237,7 @@ public class PerformanceAnalysisManager implements Listener {
@EventHandler @EventHandler
public void onPlayerJoin(PlayerJoinEvent event) { void onPlayerJoin(PlayerJoinEvent event) {
plugin.getServer().getScheduler().runTaskAsynchronously(plugin, () -> { plugin.getServer().getScheduler().runTaskAsynchronously(plugin, () -> {
@SuppressWarnings("unchecked") @SuppressWarnings("unchecked")
AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer> playerManager = (AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer>) AbstractPlayerManager.getInstance(); AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer> playerManager = (AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer>) AbstractPlayerManager.getInstance();
@@ -234,7 +257,7 @@ public class PerformanceAnalysisManager implements Listener {
@EventHandler @EventHandler
public void onPlayerQuit(PlayerQuitEvent event) { void onPlayerQuit(PlayerQuitEvent event) {
removePlayerToBars(event.getPlayer()); removePlayerToBars(event.getPlayer());
} }
@@ -297,18 +320,23 @@ public class PerformanceAnalysisManager implements Listener {
int[] tpsHistory = getTPSHistory(); int[] tpsHistory = getTPSHistory();
// keep the legacy text when generating the bar to save space when converting to component List<Pair<TextColor, AtomicInteger>> barComponents = new ArrayList<>(60);
StringBuilder s = new StringBuilder();
ChatColor prevC = ChatColor.RESET;
for (int i = 58; i >= 0; i--) { for (int i = 58; i >= 0; i--) {
int t = tpsHistory[i]; int t = tpsHistory[i];
ChatColor newC = ChatColorUtil.toBungee(tps1sGradient.pickColorAt(t)); TextColor newC = tps1sGradient.pickColorAt(t);
if (!newC.equals(prevC)) { if (barComponents.isEmpty() || !newC.equals(barComponents.get(barComponents.size() - 1).getKey())) {
s.append(newC); barComponents.add(Pair.of(newC, new AtomicInteger(1)));
prevC = newC;
} }
s.append("|"); else {
barComponents.get(barComponents.size() - 1).getValue().incrementAndGet();
} }
}
Chat history = chat();
barComponents.forEach(p -> {
history.then(text("|".repeat(p.getValue().get()))
.color(p.getKey())
);
});
@@ -332,7 +360,7 @@ public class PerformanceAnalysisManager implements Listener {
: (avgTickCPUTime1s < 50) ? NamedTextColor.RED : (avgTickCPUTime1s < 50) ? NamedTextColor.RED
: NamedTextColor.DARK_RED; : NamedTextColor.DARK_RED;
float avgTickWaitingTime1s = avgTickDuration1s - avgTickCPUTime1s; float avgTickWaitingTime1s = Math.max(0, avgTickDuration1s - avgTickCPUTime1s);
TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL
: (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW : (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW
: (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD : (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD
@@ -348,16 +376,16 @@ public class PerformanceAnalysisManager implements Listener {
: NamedTextColor.RED; : NamedTextColor.RED;
timings = text("(R/W/S:") timings = text("(R/W/S:")
.then(text(Math.round(avgTickCPUTime1s)).color(avgTickCPUTime1sColor)) .then(text("%02d".formatted(Math.round(avgTickCPUTime1s))).color(avgTickCPUTime1sColor))
.thenText("/") .thenText("/")
.then(text(Math.round(avgTickWaitingTime1s)).color(avgTickWaitingTime1sColor)) .then(text("%02d".formatted(Math.round(avgTickWaitingTime1s))).color(avgTickWaitingTime1sColor))
.thenText("/") .thenText("/")
.then(text(Math.round(avgInterTickDuration1s)).color(avgInterTickDuration1sColor)) .then(text("%02d".formatted(Math.round(avgInterTickDuration1s))).color(avgInterTickDuration1sColor))
.thenText("ms)"); .thenText("ms)");
} }
title = infoText("TPS [") title = infoText("TPS [")
.thenLegacyText(s.toString()) .then(history)
.thenText("] ") .thenText("] ")
.then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s))) .then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s)))
.then(timings); .then(timings);
@@ -375,6 +403,10 @@ public class PerformanceAnalysisManager implements Listener {
private Chat alteredTPSTitle = null; private Chat alteredTPSTitle = null;
/**
* Temporary change the title of the TPS boss bar.
* @param title the title override. null to restore to the normal TPS title.
*/
public synchronized void setAlteredTPSTitle(Chat title) { public synchronized void setAlteredTPSTitle(Chat title) {
alteredTPSTitle = title; alteredTPSTitle = title;
} }
@@ -385,17 +417,19 @@ public class PerformanceAnalysisManager implements Listener {
// special case where the getTPS method always returns a whole number when retrieving the TPS for 1 sec /**
* Gets the number of tick in the last second.
* @return the number of tick in the last second.
*/
public int getTPS1s() { public int getTPS1s() {
return (int) getTPS(1_000); return (int) getTPS(1_000);
} }
/** /**
*
* @param nbTicks number of ticks when the avg value is computed from history * @param nbTicks number of ticks when the avg value is computed from history
* @return the avg number of TPS in the interval * @return the avg number of TPS in the interval
*/ */
public synchronized float getAvgNano(List<Long> data, int nbTicks) { private synchronized float getAvgNano(List<Long> data, int nbTicks) {
if (data.isEmpty()) if (data.isEmpty())
return 0; return 0;
@@ -409,7 +443,7 @@ public class PerformanceAnalysisManager implements Listener {
} }
/** /**
* * Gets the average number of tick per second in the n last milliseconds.
* @param nbMillis number of milliseconds when the avg TPS is computed from history * @param nbMillis number of milliseconds when the avg TPS is computed from history
* @return the avg number of TPS in the interval * @return the avg number of TPS in the interval
*/ */
@@ -430,6 +464,10 @@ public class PerformanceAnalysisManager implements Listener {
} }
/**
* Gets the history of TPS performance.
* @return an array of TPS values from the last minute. The value at 0 is in the last second (current second on the clock - 1), the value at index 1 is now - 2, ...
*/
public synchronized int[] getTPSHistory() { public synchronized int[] getTPSHistory() {
int[] history = new int[60]; int[] history = new int[60];
@@ -447,15 +485,22 @@ public class PerformanceAnalysisManager implements Listener {
} }
/**
* Gets the current server's target tick rate.
* Usually 20 but the server can be configured to tick at a different rate.
* @return the current server's target tick rate.
*/
public static int getTargetTickRate() { public static int getTargetTickRate() {
return Math.round(Bukkit.getServerTickManager().getTickRate()); return Math.round(Bukkit.getServerTickManager().getTickRate());
} }
/**
* Runs the garbage collector on the server.
* Depending on the server load and the used memory, this can freeze the server for a second.
* @param sender the command sender that triggers the garbage collector. Can be null (the report will be sent to the
* console)
*/
public static void gc(CommandSender sender) { public static void gc(CommandSender sender) {
long t1 = System.currentTimeMillis(); long t1 = System.currentTimeMillis();
long alloc1 = Runtime.getRuntime().totalMemory(); long alloc1 = Runtime.getRuntime().totalMemory();
@@ -477,7 +522,7 @@ public class PerformanceAnalysisManager implements Listener {
Log.info(finalMessage.getLegacyText()); Log.info(finalMessage.getLegacyText());
} }
public static String displayRound10(double val) { private static String displayRound10(double val) {
long v = (long) Math.ceil(val * 10); long v = (long) Math.ceil(val * 10);
return "" + (v / 10f); return "" + (v / 10f);
} }

View File

@@ -1,14 +1,11 @@
package fr.pandacube.lib.paper.players; package fr.pandacube.lib.paper.players;
import fr.pandacube.lib.paper.reflect.util.PrimaryWorlds; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.paper.world.PrimaryWorlds;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer; import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.NbtIo; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.NbtIo;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.Tag; import fr.pandacube.lib.paper.players.PlayerDataWrapper.PlayerDataLoadException;
import fr.pandacube.lib.paper.util.PlayerDataWrapper;
import fr.pandacube.lib.paper.world.WorldUtil; import fr.pandacube.lib.paper.world.WorldUtil;
import fr.pandacube.lib.players.standalone.AbstractOffPlayer; import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper; import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
@@ -119,26 +116,31 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
* Player config * Player config
*/ */
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
@Override @Override
default String getConfig(String key) throws Exception { default String getConfig(String key) throws Exception {
return PaperPlayerConfigStorage.get(getUniqueId(), key); return PaperPlayerConfigStorage.get(getUniqueId(), key);
} }
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
@Override @Override
default String getConfig(String key, String deflt) throws Exception { default String getConfig(String key, String deflt) throws Exception {
return PaperPlayerConfigStorage.get(getUniqueId(), key, deflt); return PaperPlayerConfigStorage.get(getUniqueId(), key, deflt);
} }
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
@Override @Override
default void setConfig(String key, String value) throws Exception { default void setConfig(String key, String value) throws Exception {
PaperPlayerConfigStorage.set(getUniqueId(), key, value); PaperPlayerConfigStorage.set(getUniqueId(), key, value);
} }
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
@Override @Override
default void updateConfig(String key, String deflt, UnaryOperator<String> updater) throws Exception { default void updateConfig(String key, String deflt, UnaryOperator<String> updater) throws Exception {
PaperPlayerConfigStorage.update(getUniqueId(), key, deflt, updater); PaperPlayerConfigStorage.update(getUniqueId(), key, deflt, updater);
} }
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
@Override @Override
default void unsetConfig(String key) throws Exception { default void unsetConfig(String key) throws Exception {
PaperPlayerConfigStorage.unset(getUniqueId(), key); PaperPlayerConfigStorage.unset(getUniqueId(), key);
@@ -154,40 +156,31 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
/** /**
* Gets the NBT data from the player-data file. * Gets the NBT data from the player-data file.
* It will not work if the player is online, because the data on the file are not synchronized with real-time values. * It will not work if the player is online, because the data on the file are not synchronized with real-time values.
* @param convertTag true to convert the data to the current MC version, false to keep the saved version * @return the NBT data from the player-data file, or null if the file does not exist.
* @return the NBT data from the player-data file, or null if the file does not exists.
* @throws IllegalStateException if the player is online. * @throws IllegalStateException if the player is online.
* @throws IOException if an error occurs reading the data.
*/ */
default CompoundTag getPlayerData(boolean convertTag) throws IOException { default CompoundTag getPlayerData() {
if (isOnline()) if (isOnline())
throw new IllegalStateException("Cannot access data file of " + getName() + " because theyre online."); throw new IllegalStateException("Cannot access data file of " + getName() + " because they're online.");
CompoundTag data = ReflectWrapper.wrapTyped(Bukkit.getServer(), CraftServer.class) try {
return ReflectWrapper.wrapTyped(Bukkit.getServer(), CraftServer.class)
.getServer() .getServer()
.getPlayerList() .getPlayerList()
.playerIo() .playerIo()
.getPlayerData(getUniqueId().toString()); .load(getName(), getUniqueId().toString(), ProblemReporter.DISCARDING()).orElse(null);
if (data != null && convertTag) { } catch (Exception|LinkageError e) {
int srcVersion = data.contains("DataVersion", Tag.TAG_ANY_NUMERIC()) ? data.getInt("DataVersion") : -1; throw new PlayerDataLoadException(getName(), getUniqueId(), e);
int destVersion = SharedConstants.getCurrentVersion().getDataVersion().getVersion();
try {
data = MCDataConverter.convertTag(MCTypeRegistry.PLAYER(), data, srcVersion, destVersion);
} catch (Exception e) {
throw new IOException("Unable to upgrade data format of player " + getName() + " (" + getUniqueId() + ") from version " + destVersion + " to " + destVersion);
} }
} }
return data;
}
/** /**
* Gets a wrapper for the NBT data from the player-data file. * Gets a wrapper for the NBT data from the player-data file.
* It will not work if the player is online, because the data on the file are not synchronized with real-time values. * It will not work if the player is online, because the data on the file are not synchronized with real-time values.
* @return the NBT data from the player-data file. * @return the NBT data from the player-data file.
* @throws IllegalStateException if the player is online. * @throws IllegalStateException if the player is online.
* @throws IOException if an error occurs reading the data.
*/ */
default PlayerDataWrapper getPlayerDataWrapper() throws IOException { default PlayerDataWrapper getPlayerDataWrapper() {
return new PlayerDataWrapper(getPlayerData(true)); return new PlayerDataWrapper(getPlayerData());
} }
/** /**
@@ -213,25 +206,23 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
* @return the file where the player-data is stored. * @return the file where the player-data is stored.
*/ */
default File getPlayerDataFile(boolean old) { default File getPlayerDataFile(boolean old) {
File playerDataDir = new File(WorldUtil.worldDir(PrimaryWorlds.PRIMARY_WORLDS.get(0)), "playerdata"); File playerDataDir = new File(WorldUtil.worldDir(PrimaryWorlds.PRIMARY_WORLDS.getFirst()), "playerdata");
return new File(playerDataDir, getUniqueId() + (old ? ".dat_old" : ".dat")); return new File(playerDataDir, getUniqueId() + (old ? ".dat_old" : ".dat"));
} }
/** /**
* Gets the players inventory. * Gets the players inventory.
* @return the players inventory. * @return the players inventory.
* @throws IOException if an error occurs reading the data.
*/ */
default PlayerInventory getInventory() throws IOException { default PlayerInventory getInventory() {
return getPlayerDataWrapper().getInventory(); return getPlayerDataWrapper().getInventory();
} }
/** /**
* Gets the players enderchest. * Gets the players enderchest.
* @return the players enderchest. * @return the players enderchest.
* @throws IOException if an error occurs reading the data.
*/ */
default Inventory getEnderChest() throws IOException { default Inventory getEnderChest() {
return getPlayerDataWrapper().getEnderChest(); return getPlayerDataWrapper().getEnderChest();
} }

View File

@@ -3,7 +3,7 @@ package fr.pandacube.lib.paper.players;
import com.destroystokyo.paper.ClientOption; import com.destroystokyo.paper.ClientOption;
import com.destroystokyo.paper.ClientOption.ChatVisibility; import com.destroystokyo.paper.ClientOption.ChatVisibility;
import com.destroystokyo.paper.SkinParts; import com.destroystokyo.paper.SkinParts;
import fr.pandacube.lib.paper.players.PlayerNonPersistentConfig.Expiration; import fr.pandacube.lib.paper.players.PlayerNonPersistentConfig.ExpirationPolicy;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftPlayer; import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftPlayer;
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer; import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper; import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
@@ -170,7 +170,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
@Override @Override
public boolean isChatFullyVisible() { public boolean isChatFullyVisible() {
ChatVisibility v = getChatVisibility(); ChatVisibility v = getChatVisibility();
return v == ChatVisibility.FULL || v == ChatVisibility.UNKNOWN; return v == ChatVisibility.FULL;
} }
@Override @Override
@@ -283,7 +283,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
* @param relZ the relative z coordinate. * @param relZ the relative z coordinate.
*/ */
default void teleportRelatively(float relX, float relY, float relZ) { default void teleportRelatively(float relX, float relY, float relZ) {
getBukkitPlayer().teleport(getBukkitPlayer().getLocation().add(relX, relY, relZ), Relative.X, Relative.Y, Relative.Z, Relative.YAW, Relative.PITCH); getBukkitPlayer().teleport(getBukkitPlayer().getLocation().add(relX, relY, relZ), Relative.VELOCITY_X, Relative.VELOCITY_Y, Relative.VELOCITY_Z, Relative.VELOCITY_ROTATION);
} }
/** /**
@@ -291,7 +291,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
* @param destination the destination. * @param destination the destination.
*/ */
default void teleportRelatively(Location destination) { default void teleportRelatively(Location destination) {
getBukkitPlayer().teleport(destination, Relative.X, Relative.Y, Relative.Z, Relative.YAW, Relative.PITCH); getBukkitPlayer().teleport(destination, Relative.VELOCITY_X, Relative.VELOCITY_Y, Relative.VELOCITY_Z, Relative.VELOCITY_ROTATION);
} }
@@ -304,18 +304,39 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
* Player config * Player config
*/ */
/**
* Gets the non-persistent value of the provided configuration key of this player.
* @param key the configuration key.
* @return the value of the configuration, or null if the configuration is not set.
*/
default String getNonPersistentConfig(String key) { default String getNonPersistentConfig(String key) {
return PlayerNonPersistentConfig.getData(getUniqueId(), key); return PlayerNonPersistentConfig.getData(getUniqueId(), key);
} }
/**
* Gets the non-persistent value of the provided configuration key of this player.
* @param key the configuration key.
* @param deflt the default value if the configuration is not set.
* @return the value of the configuration, or {@code deflt} if the configuration is not set.
*/
default String getNonPersistentConfig(String key, String deflt) { default String getNonPersistentConfig(String key, String deflt) {
return PlayerNonPersistentConfig.getData(getUniqueId(), key); return PlayerNonPersistentConfig.getData(getUniqueId(), key);
} }
default void setNonPersistentConfig(String key, String value, Expiration expiration) { /**
PlayerNonPersistentConfig.setData(getUniqueId(), key, value, expiration); * Sets the non-persistent value of the provided configuration key for this player.
* @param key the configuration key to set.
* @param value the new value.
* @param expirationPolicy the expiration policy.
*/
default void setNonPersistentConfig(String key, String value, ExpirationPolicy expirationPolicy) {
PlayerNonPersistentConfig.setData(getUniqueId(), key, value, expirationPolicy);
} }
/**
* Unsets the non-persistent value of the provided configuration key for this player.
* @param key the configuration key to update.
*/
default void unsetNonPersistentConfig(String key) { default void unsetNonPersistentConfig(String key) {
PlayerNonPersistentConfig.unsetData(getUniqueId(), key); PlayerNonPersistentConfig.unsetData(getUniqueId(), key);
} }

View File

@@ -16,6 +16,10 @@ import java.util.UUID;
import java.util.function.UnaryOperator; import java.util.function.UnaryOperator;
import java.util.stream.Collectors; import java.util.stream.Collectors;
/**
* Provides rudimentary player data storage using a file in the plugin configuration.
* The file is loaded on the first access, and is auto-saved if needed every 30 seconds.
*/
public class PaperPlayerConfigStorage { public class PaperPlayerConfigStorage {
static final File storageFile = new File(PandaLibPaper.getPlugin().getDataFolder(), "playerdata.yml"); static final File storageFile = new File(PandaLibPaper.getPlugin().getDataFolder(), "playerdata.yml");
@@ -77,6 +81,8 @@ public class PaperPlayerConfigStorage {
private static synchronized void save() { private static synchronized void save() {
if (!changed)
return;
YamlConfiguration config = new YamlConfiguration(); YamlConfiguration config = new YamlConfiguration();
for (UUID pId : playerSortedData.keySet()) { for (UUID pId : playerSortedData.keySet()) {
String pIdStr = pId.toString(); String pIdStr = pId.toString();
@@ -109,11 +115,17 @@ public class PaperPlayerConfigStorage {
} }
public static synchronized void set(UUID player, String key, String newValue) { /**
* Sets the value of the provided configuration key for the player.
* @param player the player.
* @param key the configuration key to set.
* @param value the new value.
*/
public static synchronized void set(UUID player, String key, String value) {
initIfNeeded(); initIfNeeded();
ConfigKey cKey = new ConfigKey(player, key); ConfigKey cKey = new ConfigKey(player, key);
ConfigEntry e = data.get(cKey); ConfigEntry e = data.get(cKey);
if (e != null && newValue == null) { // delete if (e != null && value == null) { // delete
data.remove(cKey); data.remove(cKey);
if (playerSortedData.containsKey(player)) if (playerSortedData.containsKey(player))
playerSortedData.get(player).remove(e); playerSortedData.get(player).remove(e);
@@ -121,50 +133,91 @@ public class PaperPlayerConfigStorage {
keySortedData.get(key).remove(e); keySortedData.get(key).remove(e);
changed = true; changed = true;
} }
else if (e == null && newValue != null) { // create else if (e == null && value != null) { // create
create(player, key, newValue); create(player, key, value);
changed = true; changed = true;
} }
else if (e != null && !newValue.equals(e.value)) { // update else if (e != null && !value.equals(e.value)) { // update
e.value = newValue; e.value = value;
changed = true; changed = true;
} }
} }
/**
* Gets the value of the provided configuration key of the player.
* @param player the player.
* @param key the configuration key.
* @return the value of the configuration, or null if the configuration is not set.
*/
public static synchronized String get(UUID player, String key) { public static synchronized String get(UUID player, String key) {
initIfNeeded(); initIfNeeded();
ConfigEntry e = data.get(new ConfigKey(player, key)); ConfigEntry e = data.get(new ConfigKey(player, key));
return e != null ? e.value : null; return e != null ? e.value : null;
} }
public static String get(UUID p, String k, String deflt) { /**
String value = get(p, k); * Gets the value of the provided configuration key of the player.
* @param player the player.
* @param key the configuration key.
* @param deflt the default value if the configuration is not set.
* @return the value of the configuration, or {@code deflt} if the configuration is not set.
*/
public static String get(UUID player, String key, String deflt) {
String value = get(player, key);
return value == null ? deflt : value; return value == null ? deflt : value;
} }
public static synchronized void update(UUID p, String k, String deflt, UnaryOperator<String> updater) { /**
String oldValue = get(p, k, deflt); * Updates the value of the provided configuration key for the player, using the provided updater.
set(p, k, updater.apply(oldValue)); * @param player the player.
* @param key the configuration key to update.
* @param deflt the default value to use if the configuration is not already set.
* @param updater the unary operator to use to update th value. The old value is used as the parameter of the updater,
* and it returns the new value of the configuration.
*/
public static synchronized void update(UUID player, String key, String deflt, UnaryOperator<String> updater) {
String oldValue = get(player, key, deflt);
set(player, key, updater.apply(oldValue));
} }
public static void unset(UUID p, String k) { /**
set(p, k, null); * Unsets the value of the provided configuration key for the player.
* @param player the player.
* @param key the configuration key to update.
*/
public static void unset(UUID player, String key) {
set(player, key, null);
} }
/**
public static LinkedHashSet<ConfigEntry> getAllFromPlayer(UUID p) { * Gets all the config key-value pairs of the provided player.
* @param player the player.
* @return all the config key-value pairs of the provided player.
*/
public static LinkedHashSet<ConfigEntry> getAllFromPlayer(UUID player) {
initIfNeeded(); initIfNeeded();
return new LinkedHashSet<>(playerSortedData.getOrDefault(p, new LinkedHashSet<>())); return new LinkedHashSet<>(playerSortedData.getOrDefault(player, new LinkedHashSet<>()));
} }
/**
* Gets all the config key-value pairs of all players that have the provided key.
* @param key the key.
* @return all the config key-value pairs of all players that have the provided key.
*/
public static LinkedHashSet<ConfigEntry> getAllWithKeys(String key) { public static LinkedHashSet<ConfigEntry> getAllWithKeys(String key) {
initIfNeeded(); initIfNeeded();
return new LinkedHashSet<>(keySortedData.getOrDefault(key, new LinkedHashSet<>())); return new LinkedHashSet<>(keySortedData.getOrDefault(key, new LinkedHashSet<>()));
} }
public static LinkedHashSet<ConfigEntry> getAllWithKeyValue(String k, String v) { /**
* Gets all the config key-value pairs of all players that have the provided key AND value.
* @param key the key.
* @param v the value.
* @return all the config key-value pairs of all players that have the provided key AND value.
*/
public static LinkedHashSet<ConfigEntry> getAllWithKeyValue(String key, String v) {
initIfNeeded(); initIfNeeded();
return getAllWithKeys(k).stream() return getAllWithKeys(key).stream()
.filter(c -> c.value.equals(v)) .filter(c -> c.value.equals(v))
.collect(Collectors.toCollection(LinkedHashSet::new)); .collect(Collectors.toCollection(LinkedHashSet::new));
} }
@@ -173,25 +226,46 @@ public class PaperPlayerConfigStorage {
private record ConfigKey(UUID playerId, String key) { } private record ConfigKey(UUID playerId, String key) { }
/**
* Class holding the playerId-key-value triplet.
*/
public static class ConfigEntry { public static class ConfigEntry {
private final UUID playerId; private final UUID playerId;
private final String key; private final String key;
private String value; private String value;
/**
* Creates a new {@link ConfigEntry}.
* @param playerId the player id.
* @param key the key.
* @param value the value.
*/
private ConfigEntry(UUID playerId, String key, String value) { private ConfigEntry(UUID playerId, String key, String value) {
this.playerId = playerId; this.playerId = playerId;
this.key = key; this.key = key;
this.value = value; this.value = value;
} }
/**
* Gets the player id.
* @return the player id.
*/
public UUID getPlayerId() { public UUID getPlayerId() {
return playerId; return playerId;
} }
/**
* Gets the config key.
* @return the config key.
*/
public String getKey() { public String getKey() {
return key; return key;
} }
/**
* Gets the config value.
* @return the config value.
*/
public String getValue() { public String getValue() {
return value; return value;
} }
@@ -208,4 +282,7 @@ public class PaperPlayerConfigStorage {
&& Objects.equals(key, o.key); && Objects.equals(key, o.key);
} }
} }
private PaperPlayerConfigStorage() {}
} }

View File

@@ -0,0 +1,237 @@
package fr.pandacube.lib.paper.players;
import fr.pandacube.lib.paper.inventory.DummyPlayerInventory;
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftItemStack;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
import fr.pandacube.lib.paper.util.ExperienceUtil;
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
import org.bukkit.Bukkit;
import org.bukkit.event.inventory.InventoryType;
import org.bukkit.inventory.Inventory;
import org.bukkit.inventory.ItemStack;
import org.bukkit.inventory.PlayerInventory;
import java.util.Map;
import java.util.Map.Entry;
import java.util.Optional;
import java.util.TreeMap;
import java.util.UUID;
import java.util.function.IntUnaryOperator;
/**
* A wrapper to easily manipulate the player data file.
*
* @param data The NBT data structure as it is stored in the player file.
*/
public record PlayerDataWrapper(CompoundTag data) {
/**
* Creates a new wrapper for the provided player data.
* @param data the NBT data to wrap.
*/
public PlayerDataWrapper(CompoundTag data) {
this.data = data == null ? new CompoundTag() : data;
}
/**
* Gets a snapshot of the inventory of this player.
* If the inventory is modified, the {@link #setInventory(PlayerInventory)} method should be called to update the
* data in this wrapper.
* @return the player inventory.
*/
public PlayerInventory getInventory() {
return new DummyPlayerInventory(
getBukkitInventory("Inventory", InventoryType.PLAYER, this::fromNBTtoBukkitInventorySlot),
getHeldItemSlot());
}
private int fromNBTtoBukkitInventorySlot(int nbtSlot) {
// cat nbEl NBTSlot bukkitSlot NBT->Bukkit
// items 36 0-35 ==
// armor 4 starts at 100 36-39 -100 + 36
// offhand 1 starts at 150 40 -150 + 40
if (nbtSlot >= 0 && nbtSlot < 36) { // regular inventory slots
return nbtSlot;
}
if (nbtSlot >= 100 && nbtSlot < 104) { // armor slots
return nbtSlot - 100 + 36;
}
if (nbtSlot == 150) { // second hand
return 40;
}
throw new IllegalArgumentException("Unrecognized NBT player inventory slot " + nbtSlot);
}
/**
* Sets the player inventory to the content of the provided one.
* The internal data of this wrapper will be updated.
* @param inv the inventory to store in this player data in place of the old one.
*/
public void setInventory(PlayerInventory inv) {
setBukkitInventory("Inventory", inv, this::fromBukkitToNBTInventorySlot);
setHeldItemSlot(inv.getHeldItemSlot());
}
private int fromBukkitToNBTInventorySlot(int bukkitSlot) {
if (bukkitSlot >= 0 && bukkitSlot < 36) { // regular inventory slots
return bukkitSlot;
}
if (bukkitSlot >= 36 && bukkitSlot < 40) { // armor slots
return bukkitSlot + 100 - 36;
}
if (bukkitSlot == 40) { // second hand
return 150;
}
throw new IllegalArgumentException("Unrecognized Bukkit player inventory slot " + bukkitSlot);
}
/**
* Gets a snapshot of the enderchest of this player.
* If the enderchest is modified, the {@link #setEnderChest(Inventory)} method should be called to update the
* data in this wrapper.
* @return the player enderchest.
*/
public Inventory getEnderChest() {
return getBukkitInventory("EnderItems", InventoryType.ENDER_CHEST, IntUnaryOperator.identity());
}
/**
* Sets the player enderchest to the content of the provided one.
* The internal data of this wrapper will be updated.
* @param inv the enderchest content to store in this player data in place of the old enderchest.
*/
public void setEnderChest(Inventory inv) {
setBukkitInventory("EnderItems", inv, IntUnaryOperator.identity());
}
private Inventory getBukkitInventory(String nbtKey, InventoryType bukkitType, IntUnaryOperator nbtToBukkitSlotConverter) {
Map<Integer, ItemStack> stacks = getRawInventoryContent(nbtKey);
Inventory inv = Bukkit.createInventory(null, bukkitType);
if (stacks.isEmpty())
return inv;
for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
inv.setItem(nbtToBukkitSlotConverter.applyAsInt(is.getKey()), is.getValue());
}
return inv;
}
private Map<Integer, ItemStack> getRawInventoryContent(String key) {
ValueInput vi = TagValueInput.createGlobal(ProblemReporter.DISCARDING(), data);
Iterable<?> listNMSItemStackWithSlot = ReflectWrapper.unwrap(vi.listOrEmpty(key, ItemStackWithSlot.CODEC()));
Map<Integer, ItemStack> stacks = new TreeMap<>();
for (Object nmsISWS : listNMSItemStackWithSlot) {
ItemStackWithSlot isws = ReflectWrapper.wrap(nmsISWS, ItemStackWithSlot.class);
int nbtSlot = isws.slot() & 255;
Optional.of(isws.stack())
.map(nms -> filterStack(CraftItemStack.asCraftMirror(nms)))
.ifPresent(is -> stacks.put(nbtSlot, is));
}
return stacks;
}
private void setBukkitInventory(String nbtKey, Inventory inv, IntUnaryOperator bukkitToNBTSlotConverter) {
Map<Integer, ItemStack> stacks = new TreeMap<>();
if (inv == null) {
setRawInventoryContent(nbtKey, stacks);
return;
}
for (int bukkitSlot = 0; bukkitSlot < inv.getSize(); bukkitSlot++) {
ItemStack is = filterStack(inv.getItem(bukkitSlot));
if (is == null)
continue;
int nbtSlot = bukkitToNBTSlotConverter.applyAsInt(bukkitSlot);
stacks.put(nbtSlot, is);
}
setRawInventoryContent(nbtKey, stacks);
}
private void setRawInventoryContent(String key, Map<Integer, ItemStack> stacks) {
TagValueOutput vo = TagValueOutput.createWrappingGlobal(ProblemReporter.DISCARDING(), data);
ValueOutputTypedOutputList listNMSItemStackWithSlot = vo.list(key, ItemStackWithSlot.CODEC());
for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
ItemStack stack = filterStack(is.getValue());
if (stack == null)
continue;
listNMSItemStackWithSlot.add(ReflectWrapper.unwrap(new ItemStackWithSlot(is.getKey(), CraftItemStack.asNMSCopy(is.getValue()))));
}
}
private ItemStack filterStack(ItemStack is) {
return is == null || is.isEmpty() || is.getAmount() <= 0 ? null : is;
}
private int getHeldItemSlot() {
return data.getInt("SelectedItemSlot").orElse(0);
}
private void setHeldItemSlot(int slot) {
data.putInt("SelectedItemSlot", slot);
}
/**
* Gets the score of the player, as stored in the data with the key {@code Score}.
* @return the value of Score.
*/
public int getScore() {
return data.getInt("Score").orElse(0);
}
/**
* Sets the score of the player, as stored in the data with the key {@code Score}.
* @param score the value of Score to set.
*/
public void setScore(int score) {
data.putInt("Score", score);
}
/**
* Gets the total experience of the player, as stored in the data with the key {@code XpTotal}.
* @return the value of XpTotal.
*/
public int getTotalExperience() {
return data.getInt("XpTotal").orElse(0);
}
/**
* Sets the total experience of the player, as stored in the data with the key {@code XpTotal}.
* @param xp the value of XpTotal to set.
*/
public void setTotalExperience(int xp) {
data.putInt("XpTotal", xp);
double levelAndExp = ExperienceUtil.getLevelFromExp(xp);
int level = (int) levelAndExp;
double expProgress = levelAndExp - level;
data.putInt("XpLevel", level);
data.putFloat("XpP", (float) expProgress);
}
/**
* Thrown to indicate that an error occurred while loading the data of the player from the file.
*/
public static class PlayerDataLoadException extends RuntimeException {
/* package */ PlayerDataLoadException(String playerName, UUID playerId, Throwable cause) {
super("Unable to load data of player " + playerName + " (" + playerId + ")", cause);
}
}
}

View File

@@ -12,6 +12,9 @@ import java.util.Map;
import java.util.Objects; import java.util.Objects;
import java.util.UUID; import java.util.UUID;
/**
* Handles the player related configuration that is not persisted to disk.
*/
public class PlayerNonPersistentConfig { public class PlayerNonPersistentConfig {
private static final Map<UUID, Map<String, ConfigEntry>> data = new HashMap<>(); private static final Map<UUID, Map<String, ConfigEntry>> data = new HashMap<>();
@@ -22,34 +25,58 @@ public class PlayerNonPersistentConfig {
} }
public static void setData(UUID playerId, String key, String value, Expiration expiration) { /**
data.computeIfAbsent(Objects.requireNonNull(playerId, "playerId"), pp -> new HashMap<>()) * Sets the value of the provided configuration key for the player.
* @param player the player.
* @param key the configuration key to set.
* @param value the new value.
* @param expirationPolicy the expiration policy for this config. If the config key already exists for this player. the expiration will be overridden.
*/
public static void setData(UUID player, String key, String value, ExpirationPolicy expirationPolicy) {
data.computeIfAbsent(Objects.requireNonNull(player, "playerId"), pp -> new HashMap<>())
.put(Objects.requireNonNull(key, "key"), .put(Objects.requireNonNull(key, "key"),
new ConfigEntry(Objects.requireNonNull(value, "value"), new ConfigEntry(Objects.requireNonNull(value, "value"),
Objects.requireNonNull(expiration, "expiration") Objects.requireNonNull(expirationPolicy, "expiration")
) )
); );
} }
public static void unsetData(UUID playerId, String key) { /**
data.getOrDefault(Objects.requireNonNull(playerId, "playerId"), new HashMap<>()) * Unsets the value of the provided configuration key for the player.
* @param player the player.
* @param key the configuration key to update.
*/
public static void unsetData(UUID player, String key) {
data.getOrDefault(Objects.requireNonNull(player, "playerId"), new HashMap<>())
.remove(Objects.requireNonNull(key, "key")); .remove(Objects.requireNonNull(key, "key"));
} }
public static String getData(UUID playerId, String key) { /**
Map<String, ConfigEntry> playerData = data.getOrDefault(Objects.requireNonNull(playerId, "playerId"), new HashMap<>()); * Gets the value of the provided configuration key of the player.
* @param player the player.
* @param key the configuration key.
* @return the value of the configuration, or {@code deflt} if the configuration is not set.
*/
public static String getData(UUID player, String key) {
Map<String, ConfigEntry> playerData = data.getOrDefault(Objects.requireNonNull(player, "playerId"), new HashMap<>());
ConfigEntry ce = playerData.get(Objects.requireNonNull(key, "key")); ConfigEntry ce = playerData.get(Objects.requireNonNull(key, "key"));
if (ce == null) if (ce == null)
return null; return null;
if (!ce.expiration.valid(playerId, key)) { if (!ce.expirationPolicy.valid(player, key)) {
playerData.remove(key); playerData.remove(key);
return null; return null;
} }
return ce.value; return ce.value;
} }
public static boolean isDataSet(UUID playerId, String key) { /**
return getData(playerId, key) != null; * Tells if the provided config key is set for the player.
* @param player the player.
* @param key the configuration key.
* @return true if the value is set, false otherwise.
*/
public static boolean isDataSet(UUID player, String key) {
return getData(player, key) != null;
} }
@@ -63,34 +90,76 @@ public class PlayerNonPersistentConfig {
private record ConfigEntry(String value, Expiration expiration) { } private record ConfigEntry(String value, ExpirationPolicy expirationPolicy) { }
/**
* Super class for all expiration policies.
*/
public static abstract class ExpirationPolicy {
/**
* Creates an expiration policy.
*/
public ExpirationPolicy() {}
/**
public static abstract class Expiration { * Tests if the associated configuration is still valid (not expired).
* @param player the player.
* @param key the configuration key.
* @return true if the associated configuration is still valid, false otherwise.
*/
abstract boolean valid(UUID player, String key); abstract boolean valid(UUID player, String key);
} }
public static class ExpiresLogout extends Expiration { /**
* Expiration policy for a config that expires when the player logs out.
*/
public static class ExpiresLogout extends ExpirationPolicy {
/**
* Creates a logout expiration policy.
*/
public ExpiresLogout() {
super();
}
@Override
protected boolean valid(UUID player, String key) { protected boolean valid(UUID player, String key) {
return Bukkit.getPlayer(player) != null; // should not be call if player reconnects because it is removed on player quit return Bukkit.getPlayer(player) != null; // should not be call if player reconnects because it is removed on player quit
} }
} }
public static class ExpiresTick extends Expiration { /**
* Expiration policy for a config that expires after a certain amount of game tick.
*/
public static class ExpiresTick extends ExpirationPolicy {
final long expirationTick; final long expirationTick;
/**
* Creates a delay expiration policy.
* @param expirationDelayTick the number of tick after which the config will expire. If 0, will expire immediately ; 1 to expire on the next tick.
*/
public ExpiresTick(long expirationDelayTick) { public ExpiresTick(long expirationDelayTick) {
expirationTick = tick + expirationDelayTick; expirationTick = tick + expirationDelayTick;
} }
@Override
protected boolean valid(UUID player, String key) { protected boolean valid(UUID player, String key) {
return tick < expirationTick; return tick < expirationTick;
} }
} }
public static class ExpiresServerStop extends Expiration { /**
* Expiration policy for a config that expires when the server stops.
*/
public static class ExpiresServerStop extends ExpirationPolicy {
/**
* Creates a server stop expiration policy.
*/
public ExpiresServerStop() {
super();
}
@Override
protected boolean valid(UUID player, String key) { protected boolean valid(UUID player, String key) {
return true; return true;
} }
@@ -103,7 +172,7 @@ public class PlayerNonPersistentConfig {
private static class ConfigListeners implements Listener { private static class ConfigListeners implements Listener {
public ConfigListeners() { private ConfigListeners() {
Bukkit.getPluginManager().registerEvents(this, PandaLibPaper.getPlugin()); Bukkit.getPluginManager().registerEvents(this, PandaLibPaper.getPlugin());
} }
@@ -111,7 +180,7 @@ public class PlayerNonPersistentConfig {
public void onPlayerQuit(PlayerQuitEvent event) { public void onPlayerQuit(PlayerQuitEvent event) {
data.getOrDefault(event.getPlayer().getUniqueId(), new HashMap<>()) data.getOrDefault(event.getPlayer().getUniqueId(), new HashMap<>())
.entrySet() .entrySet()
.removeIf(e -> e.getValue().expiration instanceof ExpiresLogout); .removeIf(e -> e.getValue().expirationPolicy instanceof ExpiresLogout);
} }
@EventHandler @EventHandler
@@ -119,4 +188,9 @@ public class PlayerNonPersistentConfig {
tick++; tick++;
} }
} }
private PlayerNonPersistentConfig() {}
} }

View File

@@ -1,716 +0,0 @@
package fr.pandacube.lib.paper.reflect;
import java.io.IOException;
import java.io.InputStream;
import java.io.InputStreamReader;
import java.io.PrintStream;
import java.io.StringReader;
import java.lang.reflect.Constructor;
import java.lang.reflect.Modifier;
import java.nio.charset.StandardCharsets;
import java.util.ArrayList;
import java.util.Arrays;
import java.util.Collections;
import java.util.List;
import java.util.Map;
import java.util.Objects;
import java.util.TreeMap;
import java.util.stream.Collectors;
import org.bukkit.Bukkit;
import fr.pandacube.lib.util.log.Log;
import fr.pandacube.lib.reflect.Reflect;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.reflect.ReflectField;
import fr.pandacube.lib.reflect.ReflectMember;
import fr.pandacube.lib.reflect.ReflectMethod;
import net.fabricmc.mappingio.MappingReader;
import net.fabricmc.mappingio.format.MappingFormat;
import net.fabricmc.mappingio.tree.MappingTree;
import net.fabricmc.mappingio.tree.MemoryMappingTree;
/**
* Provides reflection tools related to Minecraft servers internals.
* It automatically deals with the obfuscated classes and methods.
*/
public class NMSReflect {
private static String OBF_NAMESPACE;
private static String MOJ_NAMESPACE;
/* package */ static final Map<String, ClassMapping> CLASSES_BY_OBF = new TreeMap<>();
/* package */ static final Map<String, ClassMapping> CLASSES_BY_MOJ = new TreeMap<>();
private static Boolean IS_SERVER_OBFUSCATED;
private static boolean isInit = false;
/**
* Initialize all the obfuscation mapping data.
*/
public static void init() {
synchronized (NMSReflect.class) {
if (isInit)
return;
isInit = true;
}
Log.info("[NMSReflect] Initializing NMS obfuscation mapping...");
try {
ReflectClass<?> obfHelperClass;
try {
obfHelperClass = Reflect.ofClass("io.papermc.paper.util.ObfHelper");
OBF_NAMESPACE = (String) obfHelperClass.field("SPIGOT_NAMESPACE").getStaticValue();
MOJ_NAMESPACE = (String) obfHelperClass.field("MOJANG_PLUS_YARN_NAMESPACE").getStaticValue();
} catch (ReflectiveOperationException e) {
throw new ReflectiveOperationException("Unable to find the Paper obfuscation mapping class or class members.", e);
}
List<ClassMapping> mappings = loadMappings(obfHelperClass);
for (ClassMapping clazz : mappings) {
CLASSES_BY_OBF.put(clazz.obfName, clazz);
CLASSES_BY_MOJ.put(clazz.mojName, clazz);
}
// determine if the runtime server is obfuscated
ClassNotFoundException exIfUnableToDetermine = null;
for (ClassMapping clazz : CLASSES_BY_OBF.values()) {
if (clazz.obfName.equals(clazz.mojName) // avoid direct collision between obf and unobf class names
|| CLASSES_BY_MOJ.containsKey(clazz.obfName) // avoid indirect collision
|| CLASSES_BY_OBF.containsKey(clazz.mojName))// avoid indirect collision
continue;
try {
Class.forName(clazz.obfName);
IS_SERVER_OBFUSCATED = true;
break;
} catch (ClassNotFoundException e) {
try {
Class.forName(clazz.mojName);
IS_SERVER_OBFUSCATED = false;
break;
} catch (ClassNotFoundException ee) {
ee.addSuppressed(e);
if (exIfUnableToDetermine == null)
exIfUnableToDetermine = ee;
}
}
}
if (IS_SERVER_OBFUSCATED == null) {
throw new IllegalStateException("Unable to determine if this server is obfuscated or not", exIfUnableToDetermine);
}
if (IS_SERVER_OBFUSCATED) {
Log.info("[NMSReflect] NMS runtime classes are obfuscated.");
}
else {
Log.info("[NMSReflect] NMS runtime classes are mojang mapped.");
}
int missingRuntimeClasses = 0;
for (ClassMapping clazz : mappings) {
try {
clazz.cacheReflectClass();
} catch (Throwable e) {
missingRuntimeClasses++;
if (e instanceof ClassNotFoundException cnfe) {
Log.warning("[NMSReflect] Missing runtime class " + cnfe.getMessage() + (IS_SERVER_OBFUSCATED ? (" (moj class: " + clazz.mojName + ")") : ""));
}
else {
Log.warning("[NMSReflect] Unable to load runtime class " + (IS_SERVER_OBFUSCATED ? (clazz.obfName + " (moj class: " + clazz.mojName + ")") : clazz.mojName));
Log.warning(e); // throwable on separate log message due to sometimes the message not showing at all because of this exception
}
CLASSES_BY_OBF.remove(clazz.obfName);
CLASSES_BY_MOJ.remove(clazz.mojName);
}
}
if (missingRuntimeClasses > 0) {
Log.warning("[NMSReflect] " + missingRuntimeClasses + " class have been removed from the mapping data due to the previously stated errors.");
}
} catch (Throwable t) {
CLASSES_BY_OBF.clear();
CLASSES_BY_MOJ.clear();
Log.severe("[NMSReflect] The plugin will not have access to NMS stuff due to an error while loading the obfuscation mapping.", t);
}
Log.info("[NMSReflect] Obfuscation mapping loaded for " + CLASSES_BY_OBF.size() + " classes.");
}
/**
* Returns the class mapping instance for the provided class.
* @param mojName the binary name of the desired class, on the mojang mapping.
* @return the class mapping instance for the provided class.
* @throws NullPointerException if there is no mapping for the provided Mojang mapped class.
*/
public static ClassMapping mojClass(String mojName) {
return Objects.requireNonNull(CLASSES_BY_MOJ.get(mojName), "Unable to find the Mojang mapped class '" + mojName + "'");
}
private static List<ClassMapping> loadMappings(ReflectClass<?> obfHelperClass) throws IOException {
try (final InputStream mappingsInputStream = obfHelperClass.get().getClassLoader().getResourceAsStream("META-INF/mappings/reobf.tiny")) {
if (mappingsInputStream == null) {
throw new RuntimeException("Unable to find the obfuscation mapping file in the Paper jar.");
}
MemoryMappingTree tree = new MemoryMappingTree();
MappingReader.read(new InputStreamReader(mappingsInputStream, StandardCharsets.UTF_8), MappingFormat.TINY_2_FILE, tree);
List<ClassMapping> classes = new ArrayList<>();
for (MappingTree.ClassMapping cls : tree.getClasses()) {
classes.add(new ClassMapping(cls));
}
return classes;
}
}
/**
* Prints an HTML rendering of the currently loaded obfuscation mapping, into the provided {@link PrintStream}.
* @param out the stream in which to print the HTML content.
*/
public static void printHTMLMapping(PrintStream out) {
String title = "Obfuscation mapping - " + Bukkit.getName() + " version " + Bukkit.getVersion();
out.println("<!DOCTYPE html><html><head>\n"
+ "<title>" + title + "</title>\n"
+ """
<style>
html {
background-color: #2F2F2F;
color: white;
font-size: 14px;
font-family: Consolas, monospace;
}
a:not(.cl) {
color: #1290C3;
}
table {
border-collapse: collapse;
width: 100%;
margin: auto;
}
tr:nth-child(2n) {
background-color: #373737;
}
tr:hover {
background-color: #555;
}
tr > *:first-child {
padding-right: .5em;
white-space: nowrap;
}
b.pu {
color: #0C0;
}
b.pt {
color: #FC0;
}
b.pv {
color: #F00;
}
b.pk {
color: #66F;
}
td {
padding-top: 0;
padding-bottom: 0;
}
th {
text-align: left;
font-size: 1.1em;
border-top: solid 1px white;
}
.kw {
color: #CC6C1D;
}
.cl {
color: #1290C3;
}
.mtd {
color: #1EB540;
}
.fld {
color: #8DDAF8;
}
.st {
font-style: italic;
}
.st.fn {
font-weight: bold;
}
</style>
</head><body>
"""
+ "<h1>" + title + "</h1>\n"
+ """
<p>
<b>C</b>: <span class='kw'>class</span>&nbsp;&nbsp;
<b>E</b>: <span class='kw'>enum</span>&nbsp;&nbsp;
<b>I</b>: <span class='kw'>interface</span>&nbsp;&nbsp;
<b>@</b>: <span class='kw'>@interface</span>&nbsp;&nbsp;
<b>R</b>: <span class='kw'>record</span><br>
<b>●</b>: field&nbsp;&nbsp;
<b>c</b>: constructor&nbsp;&nbsp;
<b>⬤</b>: method<br>
<b class='pu'>⬤</b>: <span class='kw'>public</span>&nbsp;&nbsp;
<b class='pt'>⬤</b>: <span class='kw'>protected</span>&nbsp;&nbsp;
<b class='pk'>⬤</b>: package&nbsp;&nbsp;
<b class='pv'>⬤</b>: <span class='kw'>private</span><br>
<sup>S</sup>: <span class='kw'>static</span>&nbsp;&nbsp;
<sup>A</sup>: <span class='kw'>abstract</span>&nbsp;&nbsp;
<sup>F</sup>: <span class='kw'>final</span>
</p>
<table>
""");
out.println("<tr><th>ns</th><th>" + OBF_NAMESPACE + "</th><th>" + MOJ_NAMESPACE + "</th></tr>");
for (ClassMapping clazz : CLASSES_BY_OBF.values()) {
clazz.printHTML(out);
}
out.println("</table><p>Generated by <a href='https://github.com/marcbal'>marcbal</a>"
+ " using <a href='https://github.com/PandacubeFr/PandaLib/blob/master/Paper/src/main/java/fr/pandacube/lib/paper/reflect/NMSReflect.java'>this tool</a>"
+ " running on <a href='https://papermc.io/'>" + Bukkit.getName() + "</a> version " + Bukkit.getVersion() + "</p>"
+ "</body></html>");
}
/**
* Represents the mapping between the obfuscated and Mojang names of a class and all its members.
*/
public static class ClassMapping {
private static int nextID = 0;
/* package */ final int id = nextID++;
/* package */ final String obfName;
/* package */ final String mojName;
private final Map<MethodId, MemberMapping<MethodId, ReflectMethod<?>>> methodsByObf = new TreeMap<>();
private final Map<MethodId, MemberMapping<MethodId, ReflectMethod<?>>> methodsByMoj = new TreeMap<>();
private final Map<String, MemberMapping<String, ReflectField<?>>> fieldsByObf = new TreeMap<>();
private final Map<String, MemberMapping<String, ReflectField<?>>> fieldsByMoj = new TreeMap<>();
private ReflectClass<?> runtimeReflectClass = null;
private ClassMapping(MappingTree.ClassMapping cls) {
obfName = binaryClassName(cls.getName(OBF_NAMESPACE));
mojName = binaryClassName(cls.getName(MOJ_NAMESPACE));
cls.getMethods().stream().map(MemberMapping::of).forEach(method -> {
method.declaringClass = this;
methodsByObf.put(method.obfDesc.identifier, method);
methodsByMoj.put(method.mojDesc.identifier, method);
});
cls.getFields().stream().map(MemberMapping::of).forEach(field -> {
field.declaringClass = this;
fieldsByObf.put(field.obfDesc.identifier, field);
fieldsByMoj.put(field.mojDesc.identifier, field);
});
}
private synchronized void cacheReflectClass() throws ClassNotFoundException {
if (runtimeReflectClass == null)
runtimeReflectClass = Reflect.ofClass(IS_SERVER_OBFUSCATED ? obfName : mojName);
}
/**
* Returns the actual runtime {@link Class} represented by this {@link ClassMapping}, wrapped into a
* {@link ReflectClass}.
* @return the actual runtime {@link Class} represented by this {@link ClassMapping}, wrapped into a
* * {@link ReflectClass}.
*/
public ReflectClass<?> runtimeReflect() {
return runtimeReflectClass;
}
/**
* Returns the actual runtime Class represented by this {@link ClassMapping}.
* @return the actual runtime Class represented by this {@link ClassMapping}.
*/
public Class<?> runtimeClass() {
return runtimeReflectClass.get();
}
/**
* Returns the actual runtime Method that has the provided mojang name and parameter types, wrapped into a
* {@link ReflectMethod}.
* @param mojName the Mojang mapped name of the method.
* @param mojParametersType the list of parameters of the method.
* Each parameter type must be an instance of one of the following type:
* {@link NMSTypeWrapper}, {@link Class}, {@link ReflectClass} or {@link ClassMapping}.
* @return the actual runtime Method that has the provided mojang name and parameter types, wrapped into a
* {@link ReflectMethod}.
* @throws IllegalArgumentException if one of the parameter has an invalid type
* @throws NullPointerException if one of the parameter is null, or if there is no mapping for the provided Mojang mapped method.
* @throws ClassNotFoundException if there is no runtime class to represent one of the provided parametersType.
* @throws NoSuchMethodException if there is no runtime method to represent the provided method.
*/
public ReflectMethod<?> mojMethod(String mojName, Object... mojParametersType) throws ClassNotFoundException, NoSuchMethodException {
MethodId mId = new MethodId(mojName, NMSTypeWrapper.toTypeList(Arrays.asList(mojParametersType)));
MemberMapping<MethodId, ReflectMethod<?>> mm = methodsByMoj.get(mId);
Objects.requireNonNull(mm, "Unable to find the Mojang mapped method " + mId);
try {
return mm.getReflectMember();
} catch (ReflectiveOperationException e) {
if (e instanceof ClassNotFoundException cnfe)
throw cnfe;
if (e instanceof NoSuchMethodException nsme)
throw nsme;
// should not have another exception
throw new RuntimeException(e);
}
}
/**
* Returns the actual runtime Field that has the provided mojang name, wrapped into a {@link ReflectField}.
* @param mojName the Mojang mapped name of the field.
* @return the actual runtime Field that has the provided mojang name, wrapped into a {@link ReflectField}.
* @throws NullPointerException if there is no mapping for the provided Mojang mapped field.
* @throws NoSuchFieldException if there is no runtime field to represent the provided mojang field.
*/
public ReflectField<?> mojField(String mojName) throws NoSuchFieldException {
MemberMapping<String, ReflectField<?>> fm = fieldsByMoj.get(mojName);
Objects.requireNonNull(fm, "Unable to find the Mojang mapped field '" + mojName + "'");
try {
return fm.getReflectMember();
} catch (ReflectiveOperationException e) {
if (e instanceof NoSuchFieldException nsfe)
throw nsfe;
// should not have another exception
throw new RuntimeException(e);
}
}
/* package */ String toClickableHTML(boolean isObfClass) {
String classToPrint = isObfClass ? obfName : mojName;
String classSimpleName = classToPrint.substring(classToPrint.lastIndexOf('.') + 1);
String htmlTitle = classSimpleName.equals(classToPrint) ? "" : (" title='" + classToPrint + "'");
return "<a href='#c" + id + "'" + htmlTitle + " class='cl'>" + classSimpleName + "</a>";
}
/* package */ NMSTypeWrapper toType(boolean obf) {
return new NMSTypeWrapper(obf ? obfName : mojName, 0);
}
private void printHTML(PrintStream out) {
String modifiersHTML = classModifiersToHTML(runtimeClass());
out.println("<tr id='c" + id + "'><th>" + modifiersHTML + "</th><th>" + nameToHTML(true) + "</th><th>" + nameToHTML(false) + "</th></tr>");
fieldsByObf.values().stream().filter(MemberMapping::isStatic).forEach(f -> f.printHTML(out));
methodsByObf.values().stream().filter(MemberMapping::isStatic).forEach(m -> m.printHTML(out));
printConstructorsHTML(out);
fieldsByObf.values().stream().filter(mm -> !mm.isStatic()).forEach(f -> f.printHTML(out));
methodsByObf.values().stream().filter(mm -> !mm.isStatic()).forEach(m -> m.printHTML(out));
}
private String nameToHTML(boolean obf) {
String classToPrint = obf ? obfName : mojName;
int packageSep = classToPrint.lastIndexOf('.');
String classSimpleName = classToPrint.substring(packageSep + 1);
String classPackages = classToPrint.substring(0, Math.max(packageSep, 0));
String classHTML = (packageSep >= 0 ? (classPackages + ".") : "") + "<b class='cl'>" + classSimpleName + "</b>";
NMSTypeWrapper superClass = superClass(obf);
String superClassHTML = superClass == null ? "" : (" <span class='kw'>extends</span> " + superClass.toHTML(obf));
List<NMSTypeWrapper> superInterfaces = superInterfaces(obf);
String superInterfacesHTML = superInterfaces.isEmpty() ? ""
: (" <span class='kw'>implements</span> " + superInterfaces.stream().map(t -> t.toHTML(obf)).collect(Collectors.joining(", ")));
return classHTML + superClassHTML + superInterfacesHTML;
}
private NMSTypeWrapper superClass(boolean obf) {
Class<?> superClass = runtimeClass().getSuperclass();
if (superClass == null || superClass.equals(Object.class) || superClass.equals(Enum.class) || superClass.equals(Record.class))
return null;
ClassMapping cm = (IS_SERVER_OBFUSCATED ? CLASSES_BY_OBF : CLASSES_BY_MOJ).get(superClass.getName());
return (cm != null) ? cm.toType(obf) : NMSTypeWrapper.of(superClass);
}
private List<NMSTypeWrapper> superInterfaces(boolean obf) {
Class<?>[] interfaces = runtimeClass().getInterfaces();
List<NMSTypeWrapper> types = new ArrayList<>(interfaces.length);
for (Class<?> i : interfaces) {
ClassMapping cm = (IS_SERVER_OBFUSCATED ? CLASSES_BY_OBF : CLASSES_BY_MOJ).get(i.getName());
types.add((cm != null) ? cm.toType(obf) : NMSTypeWrapper.of(i));
}
return types;
}
private void printConstructorsHTML(PrintStream out) {
String classObfSimpleName = obfName.substring(obfName.lastIndexOf('.') + 1);
String classMojSimpleName = mojName.substring(mojName.lastIndexOf('.') + 1);
for (Constructor<?> ct : runtimeClass().getDeclaredConstructors()) {
List<NMSTypeWrapper> obfParams = new ArrayList<>();
List<NMSTypeWrapper> mojParams = new ArrayList<>();
for (Class<?> param : ct.getParameterTypes()) {
ClassMapping cm = (IS_SERVER_OBFUSCATED ? CLASSES_BY_OBF : CLASSES_BY_MOJ).get(param.getName());
if (cm == null) {
NMSTypeWrapper t = NMSTypeWrapper.of(param);
obfParams.add(t);
mojParams.add(t);
}
else {
obfParams.add(cm.toType(true));
mojParams.add(cm.toType(false));
}
}
out.println("<tr>"
+ "<td>" + elementModifiersToHTML("c", ct.getModifiers()) + "</td>"
+ "<td><b class='mtd'>" + classObfSimpleName + "</b>(" + obfParams.stream().map(t -> t.toHTML(true)).collect(Collectors.joining(", ")) + ")</td>"
+ "<td><b class='mtd'>" + classMojSimpleName + "</b>(" + mojParams.stream().map(t -> t.toHTML(false)).collect(Collectors.joining(", ")) + ")</td>"
+ "</tr>");
}
}
}
private record MethodId(String name, List<NMSTypeWrapper> parametersType) implements Comparable<MethodId> {
@Override
public int compareTo(MethodId o) {
int cmp = name.compareTo(o.name);
if (cmp != 0)
return cmp;
return toString().compareTo(o.toString());
}
private String toHTML(boolean isObfClass, boolean isStatic, boolean isFinal) {
String paramsHTML = parametersType.stream().map(p -> p.toHTML(isObfClass)).collect(Collectors.joining(", "));
String cl = "mtd";
if (isStatic)
cl += " st";
if (isFinal)
cl += " fn";
return "<span class='" + cl + "'>" + name + "</span>(" + paramsHTML + ")";
}
public String toString() {
String paramsStr = parametersType.stream().map(NMSTypeWrapper::toString).collect(Collectors.joining(", "));
return name + "(" + paramsStr + ")";
}
}
private record MemberDesc<I extends Comparable<I>>(I identifier, NMSTypeWrapper returnType) {
private String toHTML(boolean isObfClass, boolean isStatic, boolean isFinal) {
String identifierHTML = "";
if (identifier instanceof MethodId mId)
identifierHTML = mId.toHTML(isObfClass, isStatic, isFinal);
else if (identifier instanceof String n) {
String cl = "fld";
if (isStatic)
cl += " st";
if (isFinal)
cl += " fn";
identifierHTML = "<span class='" + cl + "'>" + n + "</span>";
}
return returnType.toHTML(isObfClass) + " " + identifierHTML;
}
private static MemberDesc<MethodId> of(MappingTree.MethodMapping member, String namespace) {
String desc = member.getDesc(namespace);
try (StringReader descReader = new StringReader(desc)) {
char r = (char) descReader.read();
if (r != '(')
throw new IllegalArgumentException("Invalid method description '" + desc + "'. Must start with '('.");
List<NMSTypeWrapper> paramsType = new ArrayList<>();
while (((char) descReader.read()) != ')') {
descReader.skip(-1);
paramsType.add(NMSTypeWrapper.parse(descReader));
}
NMSTypeWrapper retType = NMSTypeWrapper.parse(descReader);
return new MemberDesc<>(new MethodId(member.getName(namespace), Collections.unmodifiableList(paramsType)), retType);
} catch (IOException e) {
throw new RuntimeException("StringReader read error", e);
}
}
private static MemberDesc<String> of(MappingTree.FieldMapping member, String namespace) {
StringReader descReader = new StringReader(member.getDesc(namespace));
return new MemberDesc<>(member.getName(namespace), NMSTypeWrapper.parse(descReader));
}
}
private static abstract class MemberMapping<I extends Comparable<I>, R extends ReflectMember<?, ?, ?, ?>> {
private final String htmlTypeChar;
/* package */ final MemberDesc<I> obfDesc, mojDesc;
/* package */ ClassMapping declaringClass;
private MemberMapping(String htmlType, MemberDesc<I> obfDesc, MemberDesc<I> mojDesc) {
htmlTypeChar = htmlType;
this.obfDesc = obfDesc;
this.mojDesc = mojDesc;
}
/* package */ void printHTML(PrintStream out) {
int mod = 0;
try {
mod = getReflectMember().getModifiers();
} catch (ReflectiveOperationException e) {
// ignore
}
boolean isStatic = Modifier.isStatic(mod);
boolean isFinal = Modifier.isFinal(mod);
out.println("<tr>"
+ "<td>" + elementModifiersToHTML(htmlTypeChar, mod) + "</td>"
+ "<td>" + obfDesc.toHTML(true, isStatic, isFinal) + "</td>"
+ "<td>" + mojDesc.toHTML(false, isStatic, isFinal) + "</td>"
+ "</tr>");
}
/* package */ MemberDesc<I> getReflectDesc() {
return (IS_SERVER_OBFUSCATED ? obfDesc : mojDesc);
}
/* package */ abstract R getReflectMember() throws ReflectiveOperationException;
/* package */ boolean isStatic() {
try {
return Modifier.isStatic(getReflectMember().getModifiers());
} catch (ReflectiveOperationException e) {
Log.severe(e);
return false;
}
}
private static MemberMapping<MethodId, ReflectMethod<?>> of(MappingTree.MethodMapping mioMapping) {
return new MemberMapping<>("", MemberDesc.of(mioMapping, OBF_NAMESPACE), MemberDesc.of(mioMapping, MOJ_NAMESPACE)) {
@Override
ReflectMethod<?> getReflectMember() throws ClassNotFoundException, NoSuchMethodException {
MethodId id = getReflectDesc().identifier;
return declaringClass.runtimeReflectClass.method(id.name, NMSTypeWrapper.toClassArray(id.parametersType));
}
};
}
private static MemberMapping<String, ReflectField<?>> of(MappingTree.FieldMapping mioMapping) {
return new MemberMapping<>("", MemberDesc.of(mioMapping, OBF_NAMESPACE), MemberDesc.of(mioMapping, MOJ_NAMESPACE)) {
@Override
ReflectField<?> getReflectMember() throws NoSuchFieldException {
String id = getReflectDesc().identifier;
return declaringClass.runtimeReflectClass.field(id);
}
};
}
}
/* package */ static String binaryClassName(String cl) {
return cl.replace('/', '.');
}
private static String classModifiersToHTML(Class<?> clazz) {
String elementHTMLType;
if (clazz.isEnum())
elementHTMLType = "E";
else if (clazz.isAnnotation())
elementHTMLType = "@";
else if (clazz.isInterface())
elementHTMLType = "I";
else if (clazz.isRecord())
elementHTMLType = "R";
else if (clazz.isPrimitive())
elementHTMLType = "";
else
elementHTMLType = "C";
return elementModifiersToHTML(elementHTMLType, clazz.getModifiers());
}
private static String elementModifiersToHTML(String elementHTMLType, int elModifiers) {
String html = "<b class='";
if (Modifier.isPublic(elModifiers))
html += "pu";
else if (Modifier.isProtected(elModifiers))
html += "pt";
else if (Modifier.isPrivate(elModifiers))
html += "pv";
else
html += "pk";
html += "'>" + elementHTMLType + "</b>";
boolean isStatic = Modifier.isStatic(elModifiers);
boolean isAbstract = Modifier.isAbstract(elModifiers);
boolean isFinal = Modifier.isFinal(elModifiers);
if (isStatic || isAbstract || isFinal) {
html += "<sup>";
if (isStatic)
html += "S";
if (isAbstract)
html += "A";
if (isFinal)
html += "F";
html += "</sup>";
}
return html;
}
// ● (field)
// ⬤ (method)
}

View File

@@ -1,194 +0,0 @@
package fr.pandacube.lib.paper.reflect;
import java.io.IOException;
import java.io.StringReader;
import java.util.ArrayList;
import java.util.List;
import java.util.Objects;
import fr.pandacube.lib.reflect.ReflectClass;
import fr.pandacube.lib.paper.reflect.NMSReflect.ClassMapping;
/* package */ class NMSTypeWrapper implements Comparable<NMSTypeWrapper> {
private final String type;
private final int arrayDepth;
/* package */ NMSTypeWrapper(String type, int arrayDepth) {
this.type = type;
this.arrayDepth = arrayDepth;
}
@Override
public boolean equals(Object obj) {
return obj instanceof NMSTypeWrapper ot && type.equals(ot.type) && arrayDepth == ot.arrayDepth;
}
@Override
public int hashCode() {
return type.hashCode() ^ arrayDepth;
}
@Override
public int compareTo(NMSTypeWrapper o) {
return toString().compareTo(o.toString());
}
Class<?> toClass() throws ClassNotFoundException {
Class<?> cl = switch(type) {
case "boolean" -> boolean.class;
case "byte" -> byte.class;
case "char" -> char.class;
case "double" -> double.class;
case "float" -> float.class;
case "int" -> int.class;
case "long" -> long.class;
case "short" -> short.class;
case "void" -> void.class;
default -> Class.forName(type);
};
for (int i = 0; i < arrayDepth; i++) {
cl = cl.arrayType();
}
return cl;
}
/* package */ static NMSTypeWrapper of(Class<?> cl) {
int arrayDepth = 0;
while (cl.isArray()) {
cl = cl.getComponentType();
arrayDepth++;
}
return new NMSTypeWrapper(cl.getName(), arrayDepth);
}
public static NMSTypeWrapper of(ReflectClass<?> rc) {
return arrayOf(rc, 0);
}
public static NMSTypeWrapper arrayOf(ReflectClass<?> rc, int arrayDepth) {
return new NMSTypeWrapper(rc.get().getName(), arrayDepth);
}
public static NMSTypeWrapper mojOf(ClassMapping cm) {
return arrayMojOf(cm, 0);
}
public static NMSTypeWrapper arrayMojOf(ClassMapping cm, int arrayDepth) {
return new NMSTypeWrapper(cm.mojName, arrayDepth);
}
/* package */ static NMSTypeWrapper toType(Object typeObj) {
Objects.requireNonNull(typeObj, "typeObj cannot be null");
if (typeObj instanceof Class<?> cl) {
return of(cl);
}
else if (typeObj instanceof ClassMapping cm) {
return mojOf(cm);
}
else if (typeObj instanceof ReflectClass<?> rc) {
return of(rc);
}
else if (typeObj instanceof NMSTypeWrapper t) {
return t;
}
else
throw new IllegalArgumentException("Unsupported object of type " + typeObj.getClass());
}
/* package */ String toHTML(boolean isObfClass) {
ClassMapping clMapping = (isObfClass ? NMSReflect.CLASSES_BY_OBF : NMSReflect.CLASSES_BY_MOJ).get(type);
String typeHTML;
if (clMapping != null) {
typeHTML = clMapping.toClickableHTML(isObfClass);
}
else {
String classToPrint = type;
String classSimpleName = classToPrint.substring(classToPrint.lastIndexOf('.') + 1);
String htmlTitle = classSimpleName.equals(classToPrint) ? "" : (" title='" + classToPrint + "'");
if (!htmlTitle.isEmpty()) {
typeHTML = "<span" + htmlTitle + " class='cl'>" + classSimpleName + "</span>";
}
else {
typeHTML = "<span class='" + (isPrimitive() ? "kw" : "cl") + "'>" + classSimpleName + "</span>";
}
}
return typeHTML + "[]".repeat(arrayDepth);
}
public String toString() {
return type + "[]".repeat(arrayDepth);
}
public boolean isPrimitive() {
try {
return toClass().isPrimitive();
} catch (ClassNotFoundException e) {
return false;
}
}
/* package */ static NMSTypeWrapper parse(StringReader desc) {
try {
int arrayDepth = 0;
char c;
while ((c = (char) desc.read()) == '[') {
arrayDepth++;
}
String type = switch(c) {
case 'Z' -> "boolean";
case 'B' -> "byte";
case 'C' -> "char";
case 'D' -> "double";
case 'F' -> "float";
case 'I' -> "int";
case 'J' -> "long";
case 'S' -> "short";
case 'L' -> {
StringBuilder sbClass = new StringBuilder();
char r;
while ((r = (char) desc.read()) != ';') {
sbClass.append(r);
}
yield NMSReflect.binaryClassName(sbClass.toString());
}
default -> "void";
};
return new NMSTypeWrapper(type, arrayDepth);
} catch (IOException e) {
throw new RuntimeException("StringReader read error", e);
}
}
/* package */ static List<NMSTypeWrapper> toTypeList(List<Object> paramsType) {
List<NMSTypeWrapper> types = new ArrayList<>(paramsType.size());
for (int i = 0; i < paramsType.size(); i++) {
Object param = paramsType.get(i);
try {
types.add(NMSTypeWrapper.toType(param));
} catch (NullPointerException|IllegalArgumentException e) {
throw new IllegalArgumentException("Invalid parameterType at index " + i, e);
}
}
return types;
}
/* package */ static Class<?>[] toClassArray(List<NMSTypeWrapper> types) throws ClassNotFoundException {
Class<?>[] classes = new Class<?>[types.size()];
for (int i = 0; i < types.size(); i++) {
classes[i] = types.get(i).toClass();
}
return classes;
}
}

View File

@@ -23,4 +23,6 @@ public class OBCReflect {
return Reflect.ofClass(CRAFTBUKKIT_PACKAGE + "." + obcClass); return Reflect.ofClass(CRAFTBUKKIT_PACKAGE + "." + obcClass);
} }
private OBCReflect() { }
} }

View File

@@ -14,20 +14,16 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter; import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType; import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType;
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry; import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.DetectedVersion;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.WorldVersion;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.BlockPosArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.ComponentArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.EntityArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.EntitySelector;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.GameProfileArgument; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.GameProfileArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.ResourceLocationArgument; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.ResourceLocationArgument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.BlockPos; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.BlockPos;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.HolderLookupProvider;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.RegistryAccess;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.Vec3i; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.Vec3i;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CollectionTag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CollectionTag;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
@@ -56,17 +52,25 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerGamePacketL
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.RegionFileStorage;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInputTypedInputList;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutput;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape;
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock; import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock;
@@ -74,9 +78,14 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.Block;
import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf; import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf;
import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled; import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled;
import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure; import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure;
import fr.pandacube.lib.paper.reflect.wrapper.paper.QueuedChangesMapLong2Object; import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PaperBrigadier;
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.ShadowBrigNode;
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int; import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int;
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration; import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration;
import fr.pandacube.lib.paper.reflect.wrapper.spottedleaf.moonrise.ChunkSystemChunkStorage;
import fr.pandacube.lib.reflect.ReflectionWrapperBypass;
import fr.pandacube.lib.util.ThrowableAccumulator; import fr.pandacube.lib.util.ThrowableAccumulator;
import static fr.pandacube.lib.reflect.wrapper.WrapperRegistry.initWrapper; import static fr.pandacube.lib.reflect.wrapper.WrapperRegistry.initWrapper;
@@ -93,12 +102,14 @@ public class PandalibPaperReflect {
* @throws Exception if a problem occurs when initializing wrapper classes. * @throws Exception if a problem occurs when initializing wrapper classes.
*/ */
public static void init() throws Exception { public static void init() throws Exception {
NMSReflect.init();
synchronized (PandalibPaperReflect.class) { synchronized (PandalibPaperReflect.class) {
if (isInit) if (isInit)
return; return;
isInit = true; isInit = true;
} }
ReflectionWrapperBypass.enable();
initWrapperClasses(); initWrapperClasses();
} }
@@ -127,91 +138,104 @@ public class PandalibPaperReflect {
thAcc.catchThrowable(() -> initWrapper(MCTypeRegistry.class, MCTypeRegistry.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(MCTypeRegistry.class, MCTypeRegistry.REFLECT.get()));
// minecraft.commands // minecraft.commands
thAcc.catchThrowable(() -> initWrapper(BlockPosArgument.class, BlockPosArgument.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Commands.class, Commands.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Commands.class, Commands.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(CommandSourceStack.class, CommandSourceStack.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(CommandSourceStack.class, CommandSourceStack.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Coordinates.class, Coordinates.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ComponentArgument.class, ComponentArgument.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(GameProfileArgument.class, GameProfileArgument.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Coordinates.class, Coordinates.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ResourceLocationArgument.class, ResourceLocationArgument.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(EntityArgument.class, EntityArgument.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Vec3Argument.class, Vec3Argument.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(EntitySelector.class, EntitySelector.MAPPING.runtimeClass()));
thAcc.catchThrowable(() -> initWrapper(GameProfileArgument.class, GameProfileArgument.MAPPING.runtimeClass()));
thAcc.catchThrowable(() -> initWrapper(ResourceLocationArgument.class, ResourceLocationArgument.MAPPING.runtimeClass()));
thAcc.catchThrowable(() -> initWrapper(Vec3Argument.class, Vec3Argument.MAPPING.runtimeClass()));
// minecraft.core // minecraft.core
thAcc.catchThrowable(() -> initWrapper(BlockPos.class, BlockPos.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(BlockPos.class, BlockPos.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Vec3i.class, Vec3i.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(HolderLookupProvider.class, HolderLookupProvider.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(RegistryAccess.class, RegistryAccess.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Vec3i.class, Vec3i.REFLECT.get()));
// minecraft.nbt // minecraft.nbt
thAcc.catchThrowable(() -> initWrapper(CollectionTag.class, CollectionTag.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(CollectionTag.class, CollectionTag.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(CompoundTag.class, CompoundTag.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(CompoundTag.class, CompoundTag.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ListTag.class, ListTag.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ListTag.class, ListTag.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(NbtAccounter.class, NbtAccounter.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(NbtAccounter.class, NbtAccounter.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(NbtIo.class, NbtIo.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(NbtIo.class, NbtIo.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(StringTag.class, StringTag.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(StringTag.class, StringTag.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Tag.class, Tag.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Tag.class, Tag.REFLECT.get()));
// minecraft.network.chat // minecraft.network.chat
thAcc.catchThrowable(() -> initWrapper(Component.class, Component.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Component.class, Component.REFLECT.get()));
// minecraft.network.protocol.custom // minecraft.network.protocol.custom
thAcc.catchThrowable(() -> initWrapper(BrandPayload.class, BrandPayload.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(BrandPayload.class, BrandPayload.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(CustomPacketPayload.class, CustomPacketPayload.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(CustomPacketPayload.class, CustomPacketPayload.REFLECT.get()));
// minecraft.network.protocol // minecraft.network.protocol
thAcc.catchThrowable(() -> initWrapper(ClientboundCustomPayloadPacket.class, ClientboundCustomPayloadPacket.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ClientboundCustomPayloadPacket.class, ClientboundCustomPayloadPacket.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ClientboundGameEventPacket.class, ClientboundGameEventPacket.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ClientboundGameEventPacket.class, ClientboundGameEventPacket.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ClientboundGameEventPacket.Type.class, ClientboundGameEventPacket.Type.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ClientboundGameEventPacket.Type.class, ClientboundGameEventPacket.Type.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Packet.class, Packet.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Packet.class, Packet.REFLECT.get()));
// minecraft.network // minecraft.network
thAcc.catchThrowable(() -> initWrapper(FriendlyByteBuf.class, FriendlyByteBuf.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(FriendlyByteBuf.class, FriendlyByteBuf.REFLECT.get()));
// minecraft.resources // minecraft.resources
thAcc.catchThrowable(() -> initWrapper(ResourceLocation.class, ResourceLocation.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ResourceLocation.class, ResourceLocation.REFLECT.get()));
// minecraft.server // minecraft.server
thAcc.catchThrowable(() -> initWrapper(ChunkMap.class, ChunkMap.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ChunkMap.class, ChunkMap.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(DedicatedPlayerList.class, DedicatedPlayerList.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(DedicatedPlayerList.class, DedicatedPlayerList.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(DedicatedServer.class, DedicatedServer.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(DedicatedServer.class, DedicatedServer.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(DedicatedServerProperties.class, DedicatedServerProperties.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(DedicatedServerProperties.class, DedicatedServerProperties.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(MinecraftServer.class, MinecraftServer.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(MinecraftServer.class, MinecraftServer.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(PlayerList.class, PlayerList.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(PlayerList.class, PlayerList.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ServerChunkCache.class, ServerChunkCache.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ServerChunkCache.class, ServerChunkCache.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ServerCommonPacketListenerImpl.class, ServerCommonPacketListenerImpl.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ServerCommonPacketListenerImpl.class, ServerCommonPacketListenerImpl.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ServerGamePacketListenerImpl.class, ServerGamePacketListenerImpl.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ServerGamePacketListenerImpl.class, ServerGamePacketListenerImpl.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ServerLevel.class, ServerLevel.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ServerLevel.class, ServerLevel.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.REFLECT.get()));
// minecraft.util // minecraft.util
thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ProblemReporter.class, ProblemReporter.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.REFLECT.get()));
// minecraft.world.block // minecraft.world.block
thAcc.catchThrowable(() -> initWrapper(Block.class, Block.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Block.class, Block.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(BambooStalkBlock.class, BambooStalkBlock.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(BambooStalkBlock.class, BambooStalkBlock.REFLECT.get()));
// minecraft.world // minecraft.world
thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(DataVersion.class, DataVersion.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(ItemStackWithSlot.class, ItemStackWithSlot.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Level.class, Level.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(Level.class, Level.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(RegionFileStorage.class, RegionFileStorage.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(TagValueInput.class, TagValueInput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(TagValueOutput.class, TagValueOutput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueInput.class, ValueInput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueInputTypedInputList.class, ValueInputTypedInputList.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueOutput.class, ValueOutput.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ValueOutputTypedOutputList.class, ValueOutputTypedOutputList.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.REFLECT.get()));
// minecraft // minecraft
thAcc.catchThrowable(() -> initWrapper(DetectedVersion.class, DetectedVersion.MAPPING.runtimeClass())); thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.MAPPING.runtimeClass()));
thAcc.catchThrowable(() -> initWrapper(WorldVersion.class, WorldVersion.MAPPING.runtimeClass()));
// netty // netty
thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get()));
// paper.commands
thAcc.catchThrowable(() -> initWrapper(APICommandMeta.class, APICommandMeta.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(BukkitCommandNode.class, BukkitCommandNode.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(PaperBrigadier.class, PaperBrigadier.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(ShadowBrigNode.class, ShadowBrigNode.REFLECT.get()));
// paper.configuration // paper.configuration
thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(WorldConfiguration.class, WorldConfiguration.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(WorldConfiguration.class, WorldConfiguration.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(WorldConfiguration.Chunks.class, WorldConfiguration.Chunks.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(WorldConfiguration.Chunks.class, WorldConfiguration.Chunks.REFLECT.get()));
// paper // paper
thAcc.catchThrowable(() -> initWrapper(PaperAdventure.class, PaperAdventure.REFLECT.get())); thAcc.catchThrowable(() -> initWrapper(PaperAdventure.class, PaperAdventure.REFLECT.get()));
thAcc.catchThrowable(() -> initWrapper(QueuedChangesMapLong2Object.class, QueuedChangesMapLong2Object.REFLECT.get()));
// spottedleaf
thAcc.catchThrowable(() -> initWrapper(ChunkSystemChunkStorage.class, ChunkSystemChunkStorage.REFLECT.get()));
thAcc.throwCaught(); thAcc.throwCaught();
} }
private PandalibPaperReflect() {}
} }

Some files were not shown because too many files have changed in this diff Show More