Compare commits
61 Commits
fcac9af7d1
...
master
Author | SHA1 | Date | |
---|---|---|---|
b42bbb4887 | |||
34809d4618 | |||
843d9c3509 | |||
1716e0b5a8 | |||
254b885648 | |||
e2c0098eb9 | |||
2fc3eb50f5 | |||
fc44151f2b | |||
f8a7c5f1e7 | |||
a9ea8c3038 | |||
e611d06987 | |||
638e57bb7f | |||
0009dd22cd | |||
79474b14d2 | |||
ee4812bdbb | |||
7d2a5e7862 | |||
c09362c75e | |||
457262049d | |||
ebbbc3a1f0 | |||
8c0db895da | |||
5943b10d16 | |||
cda7ebadcc | |||
dbdf1eeb7c | |||
500163d8f4 | |||
9374f8d280 | |||
f5194334de | |||
21777d4b9e | |||
3b4cf63c48 | |||
e2b2ab466d | |||
50e21896ba | |||
07af67b33f | |||
f4d0ccca51 | |||
51bc0bd6e8 | |||
c229b14779 | |||
49942b35da | |||
0ffe3198e6 | |||
ace34fc0e8 | |||
27c444f3b4 | |||
c589da2a14 | |||
3fe4a1b244 | |||
1925dd9b36 | |||
d637b92f6c | |||
af4bab0d12 | |||
44dc690736 | |||
c9af5ad308 | |||
27403a6e20 | |||
38a42dcca0 | |||
5782046b7a | |||
2b407d7f27 | |||
8f5f880754 | |||
3d92c3afb6 | |||
5e1f98ab70 | |||
276f5b2dc1 | |||
9c72b8cda4 | |||
ee023b5d2c | |||
974347cbde | |||
e6b77bcad6 | |||
36eb1227cf | |||
4be37945cb | |||
3e6cf96040 | |||
d1a04a7a66 |
2
.gitignore
vendored
2
.gitignore
vendored
@@ -1,3 +1,5 @@
|
|||||||
/.idea
|
/.idea
|
||||||
/*/target
|
/*/target
|
||||||
dependency-reduced-pom.xml
|
dependency-reduced-pom.xml
|
||||||
|
|
||||||
|
*.iml
|
@@ -9,17 +9,18 @@ that are detailed in their respective Readme file (if any).
|
|||||||
- `pandalib-util` General purpose utility and helper classes;
|
- `pandalib-util` General purpose utility and helper classes;
|
||||||
- `pandalib-chat` A chat API working on top of the Adventure API;
|
- `pandalib-chat` A chat API working on top of the Adventure API;
|
||||||
- `pandalib-db` An ORM working with a MySQL server through JDBC;
|
- `pandalib-db` An ORM working with a MySQL server through JDBC;
|
||||||
- `pandalib-bungee` Utility and helper classes to use in Bungeecord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
|
- `pandalib-bungee` Utility and helper classes to use in BungeeCord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
|
||||||
- `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
|
- `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
|
||||||
- `pandalib-reflect` A reflection wrapper to make reflective operation easier;
|
- `pandalib-reflect` A reflection wrapper to make reflective operation easier;
|
||||||
- `pandalib-permissions` A general purpose permission system;
|
- `pandalib-permissions` A general purpose permission system;
|
||||||
- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into Bungeecord;
|
- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into BungeeCord;
|
||||||
- `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems;
|
- `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems;
|
||||||
- `pandalib-players` A library to handle classes representing online or offline players;
|
- `pandalib-players` A library to handle classes representing online or offline players;
|
||||||
- `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`;
|
- `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`;
|
||||||
- `pandalib-netapi` A poorly designed, but working TCP network library;
|
- `pandalib-netapi` A poorly designed, but working TCP network library;
|
||||||
|
- `pandalib-config` Utility and helper classes to handle configuration related files and folders;
|
||||||
- `pandalib-commands` An abstract command manager working on top of [Brigadier](https://github.com/Mojang/brigadier);
|
- `pandalib-commands` An abstract command manager working on top of [Brigadier](https://github.com/Mojang/brigadier);
|
||||||
- `pandalib-cli` Utility and helper classes for a standalone CLI Java application.
|
- `pandalib-cli` Utility and helper classes for a standalone CLI Java application;
|
||||||
- `pandalib-core` A catch-all module for some helper classes that didn't have their own module yet;
|
- `pandalib-core` A catch-all module for some helper classes that didn't have their own module yet;
|
||||||
|
|
||||||
### Use in your projects
|
### Use in your projects
|
||||||
|
1
pandalib-bungee-chat/.gitignore
vendored
Normal file
1
pandalib-bungee-chat/.gitignore
vendored
Normal file
@@ -0,0 +1 @@
|
|||||||
|
/target/
|
44
pandalib-bungee-chat/pom.xml
Normal file
44
pandalib-bungee-chat/pom.xml
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
|
<project xmlns="http://maven.apache.org/POM/4.0.0"
|
||||||
|
xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
|
||||||
|
xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 https://maven.apache.org/xsd/maven-4.0.0.xsd">
|
||||||
|
<parent>
|
||||||
|
<artifactId>pandalib-parent</artifactId>
|
||||||
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
|
<version>1.0-SNAPSHOT</version>
|
||||||
|
<relativePath>../pom.xml</relativePath>
|
||||||
|
</parent>
|
||||||
|
<modelVersion>4.0.0</modelVersion>
|
||||||
|
|
||||||
|
<artifactId>pandalib-bungee-chat</artifactId>
|
||||||
|
<packaging>jar</packaging>
|
||||||
|
|
||||||
|
<repositories>
|
||||||
|
<repository>
|
||||||
|
<id>bungeecord-repo</id>
|
||||||
|
<url>https://oss.sonatype.org/content/repositories/snapshots</url>
|
||||||
|
</repository>
|
||||||
|
</repositories>
|
||||||
|
|
||||||
|
<dependencies>
|
||||||
|
<dependency>
|
||||||
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
|
<artifactId>pandalib-chat</artifactId>
|
||||||
|
<version>${project.version}</version>
|
||||||
|
</dependency>
|
||||||
|
|
||||||
|
<dependency>
|
||||||
|
<groupId>net.md-5</groupId>
|
||||||
|
<artifactId>bungeecord-chat</artifactId>
|
||||||
|
<version>${bungeecord.version}</version>
|
||||||
|
<scope>provided</scope>
|
||||||
|
</dependency>
|
||||||
|
|
||||||
|
<dependency>
|
||||||
|
<groupId>net.kyori</groupId>
|
||||||
|
<artifactId>adventure-platform-bungeecord</artifactId>
|
||||||
|
<version>4.3.0</version>
|
||||||
|
</dependency>
|
||||||
|
</dependencies>
|
||||||
|
|
||||||
|
</project>
|
@@ -0,0 +1,77 @@
|
|||||||
|
package fr.pandacube.lib.bungee.chat;
|
||||||
|
|
||||||
|
import fr.pandacube.lib.chat.Chat;
|
||||||
|
import fr.pandacube.lib.chat.Chat.FormattableChat;
|
||||||
|
import net.kyori.adventure.text.Component;
|
||||||
|
import net.kyori.adventure.text.ComponentLike;
|
||||||
|
import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
|
||||||
|
import net.md_5.bungee.api.chat.BaseComponent;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Utility class to ease conversion between our Adventure backed Chat API and BungeeCord chat API.
|
||||||
|
*/
|
||||||
|
public class ChatBungee {
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent}.
|
||||||
|
* @param c the {@link BaseComponent}.
|
||||||
|
* @return a new {@link FormattableChat}.
|
||||||
|
*/
|
||||||
|
public static FormattableChat chatComponent(BaseComponent c) {
|
||||||
|
return Chat.chatComponent(toAdventure(c));
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
|
||||||
|
* @param c the array of {@link BaseComponent}.
|
||||||
|
* @return a new {@link FormattableChat}.
|
||||||
|
*/
|
||||||
|
public static FormattableChat chatComponent(BaseComponent[] c) {
|
||||||
|
return Chat.chatComponent(toAdventure(c));
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Converts the Bungee {@link BaseComponent} array into Adventure {@link Component}.
|
||||||
|
* @param components the Bungee {@link BaseComponent} array.
|
||||||
|
* @return a {@link Component}.
|
||||||
|
*/
|
||||||
|
public static Component toAdventure(BaseComponent[] components) {
|
||||||
|
return BungeeComponentSerializer.get().deserialize(components);
|
||||||
|
}
|
||||||
|
/**
|
||||||
|
* Converts the Bungee {@link BaseComponent} into Adventure {@link Component}.
|
||||||
|
* @param component the Bungee {@link BaseComponent}.
|
||||||
|
* @return a {@link Component}.
|
||||||
|
*/
|
||||||
|
public static Component toAdventure(BaseComponent component) {
|
||||||
|
return toAdventure(new BaseComponent[] { component });
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent} array.
|
||||||
|
* @param component the Adventure {@link Component}.
|
||||||
|
* @return a {@link BaseComponent} array.
|
||||||
|
*/
|
||||||
|
public static BaseComponent[] toBungeeArray(ComponentLike component) {
|
||||||
|
return BungeeComponentSerializer.get().serialize(component.asComponent());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent}.
|
||||||
|
* @param component the Adventure {@link Component}.
|
||||||
|
* @return a {@link BaseComponent}.
|
||||||
|
*/
|
||||||
|
public static BaseComponent toBungee(ComponentLike component) {
|
||||||
|
BaseComponent[] arr = toBungeeArray(component);
|
||||||
|
return arr.length == 1 ? arr[0] : new net.md_5.bungee.api.chat.TextComponent(arr);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private ChatBungee() {}
|
||||||
|
}
|
@@ -33,7 +33,7 @@
|
|||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>fr.pandacube.lib</groupId>
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
<artifactId>pandalib-chat</artifactId>
|
<artifactId>pandalib-bungee-chat</artifactId>
|
||||||
<version>${project.version}</version>
|
<version>${project.version}</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
|
@@ -1,7 +1,7 @@
|
|||||||
package fr.pandacube.lib.bungee;
|
package fr.pandacube.lib.bungee;
|
||||||
|
|
||||||
import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler;
|
import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler;
|
||||||
import fr.pandacube.lib.bungee.util.PluginMessagePassthrough;
|
import fr.pandacube.lib.bungee.util.PluginMessagePassThrough;
|
||||||
import net.md_5.bungee.api.plugin.Plugin;
|
import net.md_5.bungee.api.plugin.Plugin;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -24,7 +24,7 @@ public class PandaLibBungee {
|
|||||||
* Method to be called in {@link Plugin#onEnable()} method.
|
* Method to be called in {@link Plugin#onEnable()} method.
|
||||||
*/
|
*/
|
||||||
public static void onEnable() {
|
public static void onEnable() {
|
||||||
PluginMessagePassthrough.init(plugin);
|
PluginMessagePassThrough.init(plugin);
|
||||||
BungeeDailyLogRotateFileHandler.init(true);
|
BungeeDailyLogRotateFileHandler.init(true);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -7,7 +7,7 @@ import java.util.ArrayList;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Class that holds the configuration varables for {@link BungeeBackupManager}.
|
* Class that holds the configuration variables for {@link BungeeBackupManager}.
|
||||||
*/
|
*/
|
||||||
@SuppressWarnings("CanBeFinal")
|
@SuppressWarnings("CanBeFinal")
|
||||||
public class BungeeBackupConfig {
|
public class BungeeBackupConfig {
|
||||||
|
@@ -7,14 +7,14 @@ import fr.pandacube.lib.core.backup.RotatedLogsBackupProcess;
|
|||||||
import java.io.File;
|
import java.io.File;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Handles the backup processes for a Bungeecord instance.
|
* Handles the backup processes for a BungeeCord instance.
|
||||||
*/
|
*/
|
||||||
public class BungeeBackupManager extends BackupManager {
|
public class BungeeBackupManager extends BackupManager {
|
||||||
|
|
||||||
BungeeBackupConfig config;
|
BungeeBackupConfig config;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Instanciate a new {@link BungeeBackupManager}.
|
* Creates a new {@link BungeeBackupManager}.
|
||||||
* @param config the configuration.
|
* @param config the configuration.
|
||||||
*/
|
*/
|
||||||
public BungeeBackupManager(BungeeBackupConfig config) {
|
public BungeeBackupManager(BungeeBackupConfig config) {
|
||||||
|
@@ -6,7 +6,7 @@ import java.io.File;
|
|||||||
import java.util.function.BiPredicate;
|
import java.util.function.BiPredicate;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The backup process responsible for the working directory of the current Bungeecord instance.
|
* The backup process responsible for the working directory of the current BungeeCord instance.
|
||||||
*/
|
*/
|
||||||
public class BungeeWorkdirProcess extends BackupProcess {
|
public class BungeeWorkdirProcess extends BackupProcess {
|
||||||
|
|
||||||
|
@@ -1,6 +1,6 @@
|
|||||||
package fr.pandacube.lib.bungee.commands;
|
package fr.pandacube.lib.bungee.commands;
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.Chat;
|
import fr.pandacube.lib.bungee.chat.ChatBungee;
|
||||||
import fr.pandacube.lib.commands.BrigadierDispatcher;
|
import fr.pandacube.lib.commands.BrigadierDispatcher;
|
||||||
import net.kyori.adventure.text.ComponentLike;
|
import net.kyori.adventure.text.ComponentLike;
|
||||||
import net.md_5.bungee.api.CommandSender;
|
import net.md_5.bungee.api.CommandSender;
|
||||||
@@ -71,6 +71,6 @@ public class BungeeBrigadierDispatcher extends BrigadierDispatcher<CommandSender
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
protected void sendSenderMessage(CommandSender sender, ComponentLike message) {
|
protected void sendSenderMessage(CommandSender sender, ComponentLike message) {
|
||||||
sender.sendMessage(Chat.toBungee(message.asComponent()));
|
sender.sendMessage(ChatBungee.toBungee(message.asComponent()));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -6,7 +6,7 @@ import net.md_5.bungee.api.connection.ProxiedPlayer;
|
|||||||
import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
|
import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents any player on a Bungeecord proxy, either offline or online.
|
* Represents any player on a BungeeCord proxy, either offline or online.
|
||||||
*/
|
*/
|
||||||
public interface BungeeOffPlayer extends AbstractOffPlayer {
|
public interface BungeeOffPlayer extends AbstractOffPlayer {
|
||||||
|
|
||||||
|
@@ -1,6 +1,6 @@
|
|||||||
package fr.pandacube.lib.bungee.players;
|
package fr.pandacube.lib.bungee.players;
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.Chat;
|
import fr.pandacube.lib.bungee.chat.ChatBungee;
|
||||||
import fr.pandacube.lib.core.mc_version.ProtocolVersion;
|
import fr.pandacube.lib.core.mc_version.ProtocolVersion;
|
||||||
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
|
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
|
||||||
import fr.pandacube.lib.reflect.Reflect;
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
@@ -20,7 +20,7 @@ import net.md_5.bungee.protocol.packet.PluginMessage;
|
|||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents any online player on a Bungeecord proxy.
|
* Represents any online player on a BungeeCord proxy.
|
||||||
*/
|
*/
|
||||||
public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer {
|
public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer {
|
||||||
|
|
||||||
@@ -84,13 +84,13 @@ public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlaye
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
default void sendMessage(Component message) {
|
default void sendMessage(Component message) {
|
||||||
getBungeeProxiedPlayer().sendMessage(Chat.toBungee(message));
|
getBungeeProxiedPlayer().sendMessage(ChatBungee.toBungee(message));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
default void sendTitle(Component title, Component subtitle, int fadeIn, int stay, int fadeOut) {
|
default void sendTitle(Component title, Component subtitle, int fadeIn, int stay, int fadeOut) {
|
||||||
ProxyServer.getInstance().createTitle()
|
ProxyServer.getInstance().createTitle()
|
||||||
.title(Chat.toBungee(title)).subTitle(Chat.toBungee(subtitle))
|
.title(ChatBungee.toBungee(title)).subTitle(ChatBungee.toBungee(subtitle))
|
||||||
.fadeIn(fadeIn).stay(stay).fadeOut(fadeOut)
|
.fadeIn(fadeIn).stay(stay).fadeOut(fadeOut)
|
||||||
.send(getBungeeProxiedPlayer());
|
.send(getBungeeProxiedPlayer());
|
||||||
}
|
}
|
||||||
|
@@ -19,16 +19,16 @@ import net.md_5.bungee.event.EventHandler;
|
|||||||
* <p>
|
* <p>
|
||||||
* Usage example, in your plugin init code:
|
* Usage example, in your plugin init code:
|
||||||
* <pre>{@code
|
* <pre>{@code
|
||||||
* PluginMessagePassthrough.init(yourPluginInstance);
|
* PluginMessagePassThrough.init(yourPluginInstance);
|
||||||
* PluginMessagePassthrough.register("worldedit:cui"); // plugin message used by WorldEdit
|
* PluginMessagePassThrough.register("worldedit:cui"); // plugin message used by WorldEdit
|
||||||
* }</pre>
|
* }</pre>
|
||||||
*/
|
*/
|
||||||
public class PluginMessagePassthrough implements Listener {
|
public class PluginMessagePassThrough implements Listener {
|
||||||
private static final List<String> channels = Collections.synchronizedList(new ArrayList<>());
|
private static final List<String> channels = Collections.synchronizedList(new ArrayList<>());
|
||||||
private static final PluginMessagePassthrough instance = new PluginMessagePassthrough();
|
private static final PluginMessagePassThrough instance = new PluginMessagePassThrough();
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Initialize the {@link PluginMessagePassthrough}.
|
* Initialize the {@link PluginMessagePassThrough}.
|
||||||
* It registers the required event listener.
|
* It registers the required event listener.
|
||||||
* @param plugin the plugin instance.
|
* @param plugin the plugin instance.
|
||||||
*/
|
*/
|
||||||
@@ -92,7 +92,7 @@ public class PluginMessagePassthrough implements Listener {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
private PluginMessagePassthrough() { }
|
private PluginMessagePassThrough() { }
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
@@ -30,8 +30,13 @@
|
|||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>net.kyori</groupId>
|
<groupId>net.kyori</groupId>
|
||||||
<artifactId>adventure-platform-bungeecord</artifactId>
|
<artifactId>adventure-text-serializer-gson</artifactId>
|
||||||
<version>4.3.0</version>
|
<version>4.13.0</version>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>net.kyori</groupId>
|
||||||
|
<artifactId>adventure-text-serializer-legacy</artifactId>
|
||||||
|
<version>4.13.0</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>net.kyori</groupId>
|
<groupId>net.kyori</groupId>
|
||||||
@@ -46,17 +51,10 @@
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
<dependency>
|
|
||||||
<groupId>net.md-5</groupId>
|
|
||||||
<artifactId>bungeecord-chat</artifactId>
|
|
||||||
<version>${bungeecord.version}</version>
|
|
||||||
<scope>compile</scope>
|
|
||||||
</dependency>
|
|
||||||
|
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.google.code.gson</groupId>
|
<groupId>com.google.code.gson</groupId>
|
||||||
<artifactId>gson</artifactId>
|
<artifactId>gson</artifactId>
|
||||||
<version>2.10.1</version>
|
<version>${gson.version}</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
|
|
||||||
|
@@ -16,15 +16,13 @@ import net.kyori.adventure.text.format.TextColor;
|
|||||||
import net.kyori.adventure.text.format.TextDecoration;
|
import net.kyori.adventure.text.format.TextDecoration;
|
||||||
import net.kyori.adventure.text.format.TextDecoration.State;
|
import net.kyori.adventure.text.format.TextDecoration.State;
|
||||||
import net.kyori.adventure.text.minimessage.MiniMessage;
|
import net.kyori.adventure.text.minimessage.MiniMessage;
|
||||||
import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
|
|
||||||
import net.kyori.adventure.text.serializer.gson.GsonComponentSerializer;
|
import net.kyori.adventure.text.serializer.gson.GsonComponentSerializer;
|
||||||
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
|
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
|
||||||
import net.kyori.adventure.text.serializer.plain.PlainTextComponentSerializer;
|
import net.kyori.adventure.text.serializer.plain.PlainTextComponentSerializer;
|
||||||
import net.md_5.bungee.api.ChatColor;
|
|
||||||
import net.md_5.bungee.api.chat.BaseComponent;
|
|
||||||
import org.jetbrains.annotations.NotNull;
|
import org.jetbrains.annotations.NotNull;
|
||||||
|
|
||||||
import java.awt.*;
|
import java.awt.*;
|
||||||
|
import java.util.Locale;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
import java.util.function.Consumer;
|
import java.util.function.Consumer;
|
||||||
import java.util.function.UnaryOperator;
|
import java.util.function.UnaryOperator;
|
||||||
@@ -37,8 +35,8 @@ import java.util.function.UnaryOperator;
|
|||||||
* This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
|
* This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
|
||||||
* Adventure API and its implementation without using the final methods of this builder.
|
* Adventure API and its implementation without using the final methods of this builder.
|
||||||
* <p>
|
* <p>
|
||||||
* The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the
|
* The unique possible concrete subclass of this class, {@link FormattableChat}, takes care of the formatting of the
|
||||||
* built component. The rationale for this design is explained in the documentation of {@link FormatableChat}.
|
* built component. The rationale for this design is explained in the documentation of {@link FormattableChat}.
|
||||||
*/
|
*/
|
||||||
public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
|
public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
|
||||||
|
|
||||||
@@ -67,26 +65,10 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* Builds the component into Adventure Component instance.
|
* Builds the component into Adventure Component instance.
|
||||||
* @return the {@link Component} built from this {@link Chat} component.
|
* @return the {@link Component} built from this {@link Chat} component.
|
||||||
*/
|
*/
|
||||||
public Component getAdv() {
|
public Component get() {
|
||||||
return builder.build();
|
return builder.build();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Builds the component into BungeeCord {@link BaseComponent} instance.
|
|
||||||
* @return the {@link BaseComponent} built from this {@link Chat} component.
|
|
||||||
*/
|
|
||||||
public BaseComponent get() {
|
|
||||||
return toBungee(getAdv());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Builds the component into BungeeCord {@link BaseComponent} array.
|
|
||||||
* @return the {@link BaseComponent} array built from this {@link Chat} component.
|
|
||||||
*/
|
|
||||||
public BaseComponent[] getAsArray() {
|
|
||||||
return toBungeeArray(getAdv());
|
|
||||||
}
|
|
||||||
|
|
||||||
private static final LegacyComponentSerializer LEGACY_SERIALIZER_BUNGEE_FRIENDLY = LegacyComponentSerializer.builder()
|
private static final LegacyComponentSerializer LEGACY_SERIALIZER_BUNGEE_FRIENDLY = LegacyComponentSerializer.builder()
|
||||||
.hexColors()
|
.hexColors()
|
||||||
.useUnusualXRepeatedCharacterHexFormat()
|
.useUnusualXRepeatedCharacterHexFormat()
|
||||||
@@ -97,7 +79,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @return the legacy text. RGB colors are in BungeeCord format.
|
* @return the legacy text. RGB colors are in BungeeCord format.
|
||||||
*/
|
*/
|
||||||
public String getLegacyText() {
|
public String getLegacyText() {
|
||||||
return LEGACY_SERIALIZER_BUNGEE_FRIENDLY.serialize(getAdv());
|
return LEGACY_SERIALIZER_BUNGEE_FRIENDLY.serialize(get());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -105,12 +87,12 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @return the plain text of this component.
|
* @return the plain text of this component.
|
||||||
*/
|
*/
|
||||||
public String getPlainText() {
|
public String getPlainText() {
|
||||||
return PlainTextComponentSerializer.plainText().serializeOr(getAdv(), "");
|
return PlainTextComponentSerializer.plainText().serializeOr(get(), "");
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public @NotNull HoverEvent<Component> asHoverEvent(@NotNull UnaryOperator<Component> op) {
|
public @NotNull HoverEvent<Component> asHoverEvent(@NotNull UnaryOperator<Component> op) {
|
||||||
return HoverEvent.showText(op.apply(getAdv()));
|
return HoverEvent.showText(op.apply(get()));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -119,7 +101,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
*/
|
*/
|
||||||
@Override
|
@Override
|
||||||
public @NotNull Component asComponent() {
|
public @NotNull Component asComponent() {
|
||||||
return getAdv();
|
return get();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -127,7 +109,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @return the {@link Component} built from this {@link Chat} component, with down-sampled colors.
|
* @return the {@link Component} built from this {@link Chat} component, with down-sampled colors.
|
||||||
*/
|
*/
|
||||||
public Component getAsDownSampledColorsComponent() {
|
public Component getAsDownSampledColorsComponent() {
|
||||||
String json = GsonComponentSerializer.colorDownsamplingGson().serialize(getAdv());
|
String json = GsonComponentSerializer.colorDownsamplingGson().serialize(get());
|
||||||
return GsonComponentSerializer.gson().deserialize(json);
|
return GsonComponentSerializer.gson().deserialize(json);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -144,7 +126,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @return the MiniMessage representation if this {@link Chat} component.
|
* @return the MiniMessage representation if this {@link Chat} component.
|
||||||
*/
|
*/
|
||||||
public String getMiniMessage() {
|
public String getMiniMessage() {
|
||||||
return MiniMessage.miniMessage().serialize(getAdv());
|
return MiniMessage.miniMessage().serialize(get());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -184,15 +166,6 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Appends a BungeeCord {@link BaseComponent} to this component.
|
|
||||||
* @param comp the component to append.
|
|
||||||
* @return this.
|
|
||||||
*/
|
|
||||||
public Chat then(BaseComponent comp) {
|
|
||||||
return then(toAdventure(comp));
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Appends a component to this component.
|
* Appends a component to this component.
|
||||||
* @param comp the component to append.
|
* @param comp the component to append.
|
||||||
@@ -207,15 +180,6 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
return then(comp.asComponent());
|
return then(comp.asComponent());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Appends a BungeeCord {@link BaseComponent} array to this component.
|
|
||||||
* @param comp the components to append.
|
|
||||||
* @return this.
|
|
||||||
*/
|
|
||||||
public Chat then(BaseComponent[] comp) {
|
|
||||||
return then(toAdventure(comp));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
@@ -332,7 +296,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @param key the keybinding to display.
|
* @param key the keybinding to display.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public Chat thenKeyBind(String key) { return then(keybind(key)); }
|
public Chat thenKeyBind(String key) { return then(keyBind(key)); }
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Appends a component with the provided score name and objective.
|
* Appends a component with the provided score name and objective.
|
||||||
@@ -490,69 +454,34 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* Appends a component filling a chat line with the configured decoration character and
|
* Appends a component filling a chat line with the configured decoration character and
|
||||||
* color and a left-aligned text.
|
* color and a left-aligned text.
|
||||||
* @param leftText the text aligned to the left.
|
* @param leftText the text aligned to the left.
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
* @return a new {@link FormattableChat} filling a chat line with the configured decoration character
|
||||||
* and color and a left-aligned text.
|
* and color and a left-aligned text.
|
||||||
*/
|
*/
|
||||||
public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
|
public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
|
||||||
|
|
||||||
/**
|
|
||||||
* Appends a component filling a chat line with the configured decoration character and
|
|
||||||
* color and a left-aligned text.
|
|
||||||
* @param leftText the text aligned to the left.
|
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
|
||||||
* and color and a left-aligned text.
|
|
||||||
* @deprecated uses Bungeecord chat API.
|
|
||||||
*/
|
|
||||||
@Deprecated
|
|
||||||
public Chat thenLeftText(BaseComponent leftText) { return thenLeftText(chatComponent(leftText)); }
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Appends a component filling a chat line with the configured decoration character and
|
* Appends a component filling a chat line with the configured decoration character and
|
||||||
* color and a right-aligned text.
|
* color and a right-aligned text.
|
||||||
* @param rightText the text aligned to the right.
|
* @param rightText the text aligned to the right.
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
* @return a new {@link FormattableChat} filling a chat line with the configured decoration character
|
||||||
* and color and a right-aligned text.
|
* and color and a right-aligned text.
|
||||||
*/
|
*/
|
||||||
public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
|
public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
|
||||||
|
|
||||||
/**
|
|
||||||
* Appends a component filling a chat line with the configured decoration character and
|
|
||||||
* color and a right-aligned text.
|
|
||||||
* @param rightText the text aligned to the right.
|
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
|
||||||
* and color and a right-aligned text.
|
|
||||||
* @deprecated uses Bungeecord chat API.
|
|
||||||
*/
|
|
||||||
@Deprecated
|
|
||||||
public Chat thenRightText(BaseComponent rightText) { return thenRightText(chatComponent(rightText)); }
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Appends a component filling a chat line with the configured decoration character and
|
* Appends a component filling a chat line with the configured decoration character and
|
||||||
* color and a centered text.
|
* color and a centered text.
|
||||||
* @param centerText the text aligned to the center.
|
* @param centerText the text aligned to the center.
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
* @return a new {@link FormattableChat} filling a chat line with the configured decoration character
|
||||||
* and color and a centered text.
|
* and color and a centered text.
|
||||||
*/
|
*/
|
||||||
public Chat thenCenterText(ComponentLike centerText) {
|
public Chat thenCenterText(ComponentLike centerText) {
|
||||||
return then(centerText(centerText, console));
|
return then(centerText(centerText, console));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Appends a component filling a chat line with the configured decoration character and
|
|
||||||
* color and a centered text.
|
|
||||||
* @param centerText the text aligned to the center.
|
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
|
||||||
* and color and a centered text.
|
|
||||||
* @deprecated uses Bungeecord chat API.
|
|
||||||
*/
|
|
||||||
@Deprecated
|
|
||||||
public Chat thenCenterText(BaseComponent centerText) {
|
|
||||||
return thenCenterText(chatComponent(centerText));
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Appends a component filling a chat line with the configured decoration character and color.
|
* Appends a component filling a chat line with the configured decoration character and color.
|
||||||
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
|
* @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
|
||||||
*/
|
*/
|
||||||
public Chat thenFilledLine() { return then(filledLine(console)); }
|
public Chat thenFilledLine() { return then(filledLine(console)); }
|
||||||
|
|
||||||
@@ -591,10 +520,10 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* .thenText("!"); // short for .then(Chat.text("!"))
|
* .thenText("!"); // short for .then(Chat.text("!"))
|
||||||
* // the red color for "!" is not needed because the parent component is already red.
|
* // the red color for "!" is not needed because the parent component is already red.
|
||||||
* }</pre>
|
* }</pre>
|
||||||
* When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast
|
* When calling {@link #then(Component) #then(...)} on a {@link FormattableChat}, the method returns itself, cast
|
||||||
* to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
|
* to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
|
||||||
* subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
|
* subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
|
||||||
* class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again.
|
* class which only subclass is {@link FormattableChat}, you can cast the builder, and use the format methods again.
|
||||||
* <pre>{@code
|
* <pre>{@code
|
||||||
* Chat component = Chat.text("Hello ").red()
|
* Chat component = Chat.text("Hello ").red()
|
||||||
* .then(Chat.text("world").darkRed().bold())
|
* .then(Chat.text("world").darkRed().bold())
|
||||||
@@ -603,8 +532,8 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* ((FormatableChat)component).underlined(); // this will not format only the last appended text.
|
* ((FormatableChat)component).underlined(); // this will not format only the last appended text.
|
||||||
* }</pre>
|
* }</pre>
|
||||||
*/
|
*/
|
||||||
public static final class FormatableChat extends Chat {
|
public static final class FormattableChat extends Chat {
|
||||||
/* package */ FormatableChat(ComponentBuilder<?, ?> c) {
|
/* package */ FormattableChat(ComponentBuilder<?, ?> c) {
|
||||||
super(c);
|
super(c);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -614,177 +543,180 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @param c true for console, false for game UI.
|
* @param c true for console, false for game UI.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat console(boolean c) { console = c; return this; }
|
public FormattableChat console(boolean c) { console = c; return this; }
|
||||||
/**
|
/**
|
||||||
* Configure the width of the line.
|
* Configure the width of the line.
|
||||||
* @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
|
* @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
|
||||||
* console rendering.
|
* console rendering.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat maxWidth(int w) { maxWidth = w; return this; }
|
public FormattableChat maxWidth(int w) { maxWidth = w; return this; }
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component.
|
* Sets the color of this component.
|
||||||
* @param c the color.
|
* @param c the color.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat color(TextColor c) { builder.color(c); return this; }
|
public FormattableChat color(TextColor c) { builder.color(c); return this; }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component.
|
* Sets the color of this component.
|
||||||
* @param c the color.
|
* @param c the color.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat color(ChatColor c) { return color(c == null ? null : TextColor.color(c.getColor().getRGB())); }
|
public FormattableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component.
|
* Sets the color of this component.
|
||||||
* @param c the color.
|
* @param c the color.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
|
public FormattableChat color(String c) {
|
||||||
/**
|
if (c == null)
|
||||||
* Sets the color of this component.
|
return color((TextColor) null);
|
||||||
* @param c the color.
|
TextColor tc = c.startsWith("#")
|
||||||
* @return this.
|
? TextColor.fromCSSHexString(c)
|
||||||
*/
|
: NamedTextColor.NAMES.value(c.toLowerCase(Locale.ROOT));
|
||||||
public FormatableChat color(String c) { return color(c == null ? null : ChatColor.of(c)); }
|
if (tc == null)
|
||||||
|
throw new IllegalArgumentException("Invalid color string '" + c + "'.");
|
||||||
|
return color(tc);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#BLACK}.
|
* Sets the color of this component to {@link NamedTextColor#BLACK}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat black() { return color(NamedTextColor.BLACK); }
|
public FormattableChat black() { return color(NamedTextColor.BLACK); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
|
* Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
|
public FormattableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
|
* Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
|
public FormattableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
|
* Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
|
public FormattableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#DARK_RED}.
|
* Sets the color of this component to {@link NamedTextColor#DARK_RED}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); }
|
public FormattableChat darkRed() { return color(NamedTextColor.DARK_RED); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
|
* Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
|
public FormattableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#GOLD}.
|
* Sets the color of this component to {@link NamedTextColor#GOLD}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat gold() { return color(NamedTextColor.GOLD); }
|
public FormattableChat gold() { return color(NamedTextColor.GOLD); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#GRAY}.
|
* Sets the color of this component to {@link NamedTextColor#GRAY}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat gray() { return color(NamedTextColor.GRAY); }
|
public FormattableChat gray() { return color(NamedTextColor.GRAY); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
|
* Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
|
public FormattableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#BLUE}.
|
* Sets the color of this component to {@link NamedTextColor#BLUE}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat blue() { return color(NamedTextColor.BLUE); }
|
public FormattableChat blue() { return color(NamedTextColor.BLUE); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#GREEN}.
|
* Sets the color of this component to {@link NamedTextColor#GREEN}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat green() { return color(NamedTextColor.GREEN); }
|
public FormattableChat green() { return color(NamedTextColor.GREEN); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#AQUA}.
|
* Sets the color of this component to {@link NamedTextColor#AQUA}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat aqua() { return color(NamedTextColor.AQUA); }
|
public FormattableChat aqua() { return color(NamedTextColor.AQUA); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#RED}.
|
* Sets the color of this component to {@link NamedTextColor#RED}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat red() { return color(NamedTextColor.RED); }
|
public FormattableChat red() { return color(NamedTextColor.RED); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
|
* Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
|
public FormattableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#YELLOW}.
|
* Sets the color of this component to {@link NamedTextColor#YELLOW}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat yellow() { return color(NamedTextColor.YELLOW); }
|
public FormattableChat yellow() { return color(NamedTextColor.YELLOW); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link NamedTextColor#WHITE}.
|
* Sets the color of this component to {@link NamedTextColor#WHITE}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat white() { return color(NamedTextColor.WHITE); }
|
public FormattableChat white() { return color(NamedTextColor.WHITE); }
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#successColor}.
|
* Sets the color of this component to {@link ChatConfig#successColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat successColor() { return color(ChatConfig.successColor); }
|
public FormattableChat successColor() { return color(ChatConfig.successColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#failureColor}.
|
* Sets the color of this component to {@link ChatConfig#failureColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat failureColor() { return color(ChatConfig.failureColor); }
|
public FormattableChat failureColor() { return color(ChatConfig.failureColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#infoColor}.
|
* Sets the color of this component to {@link ChatConfig#infoColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat infoColor() { return color(ChatConfig.infoColor); }
|
public FormattableChat infoColor() { return color(ChatConfig.infoColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#warningColor}.
|
* Sets the color of this component to {@link ChatConfig#warningColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat warningColor() { return color(ChatConfig.warningColor); }
|
public FormattableChat warningColor() { return color(ChatConfig.warningColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#dataColor}.
|
* Sets the color of this component to {@link ChatConfig#dataColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat dataColor() { return color(ChatConfig.dataColor); }
|
public FormattableChat dataColor() { return color(ChatConfig.dataColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#decorationColor}.
|
* Sets the color of this component to {@link ChatConfig#decorationColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); }
|
public FormattableChat decorationColor() { return color(ChatConfig.decorationColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#urlColor}.
|
* Sets the color of this component to {@link ChatConfig#urlColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat urlColor() { return color(ChatConfig.urlColor); }
|
public FormattableChat urlColor() { return color(ChatConfig.urlColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#commandColor}.
|
* Sets the color of this component to {@link ChatConfig#commandColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat commandColor() { return color(ChatConfig.commandColor); }
|
public FormattableChat commandColor() { return color(ChatConfig.commandColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
|
* Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
|
public FormattableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
|
||||||
/**
|
/**
|
||||||
* Sets the color of this component to {@link ChatConfig#broadcastColor}.
|
* Sets the color of this component to {@link ChatConfig#broadcastColor}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
|
public FormattableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
|
||||||
|
|
||||||
|
|
||||||
private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
|
private FormattableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
|
||||||
private FormatableChat setDecoration(TextDecoration deco, Boolean state) {
|
private FormattableChat setDecoration(TextDecoration deco, Boolean state) {
|
||||||
return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
|
return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -794,56 +726,56 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @param b true to enable, false to disable, or null to inherit from parent.
|
* @param b true to enable, false to disable, or null to inherit from parent.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
|
public FormattableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
|
||||||
/**
|
/**
|
||||||
* Enables the bold status of this component.
|
* Enables the bold status of this component.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat bold() { return bold(true); }
|
public FormattableChat bold() { return bold(true); }
|
||||||
/**
|
/**
|
||||||
* Sets the italic status of this component.
|
* Sets the italic status of this component.
|
||||||
* @param i true to enable, false to disable, or null to inherit from parent.
|
* @param i true to enable, false to disable, or null to inherit from parent.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
|
public FormattableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
|
||||||
/**
|
/**
|
||||||
* Enables the italic status of this component.
|
* Enables the italic status of this component.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat italic() { return italic(true); }
|
public FormattableChat italic() { return italic(true); }
|
||||||
/**
|
/**
|
||||||
* Sets the underlined status of this component.
|
* Sets the underlined status of this component.
|
||||||
* @param u true to enable, false to disable, or null to inherit from parent.
|
* @param u true to enable, false to disable, or null to inherit from parent.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
|
public FormattableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
|
||||||
/**
|
/**
|
||||||
* Enables the underlined status of this component.
|
* Enables the underlined status of this component.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat underlined() { return underlined(true); }
|
public FormattableChat underlined() { return underlined(true); }
|
||||||
/**
|
/**
|
||||||
* Sets the strikethrough status of this component.
|
* Sets the strikethrough status of this component.
|
||||||
* @param s true to enable, false to disable, or null to inherit from parent.
|
* @param s true to enable, false to disable, or null to inherit from parent.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
|
public FormattableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
|
||||||
/**
|
/**
|
||||||
* Enables the strikethrough status of this component.
|
* Enables the strikethrough status of this component.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat strikethrough() { return strikethrough(true); }
|
public FormattableChat strikethrough() { return strikethrough(true); }
|
||||||
/**
|
/**
|
||||||
* Sets the obfuscated status of this component.
|
* Sets the obfuscated status of this component.
|
||||||
* @param o true to enable, false to disable, or null to inherit from parent.
|
* @param o true to enable, false to disable, or null to inherit from parent.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
|
public FormattableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
|
||||||
/**
|
/**
|
||||||
* Enables the obfuscated status of this component.
|
* Enables the obfuscated status of this component.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat obfuscated() { return obfuscated(true); }
|
public FormattableChat obfuscated() { return obfuscated(true); }
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -851,7 +783,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @param f the font namespaced key.
|
* @param f the font namespaced key.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); }
|
public FormattableChat font(Key f) { return setStyle(s -> s.font(f)); }
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -859,7 +791,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @param i the text to insert.
|
* @param i the text to insert.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
|
public FormattableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -867,37 +799,37 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @param e the {@link ClickEvent}.
|
* @param e the {@link ClickEvent}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
|
private FormattableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
|
||||||
/**
|
/**
|
||||||
* Configure this component to execute the specified command when clicked.
|
* Configure this component to execute the specified command when clicked.
|
||||||
* @param cmdWithSlash the command to execute.
|
* @param cmdWithSlash the command to execute.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
|
public FormattableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
|
||||||
/**
|
/**
|
||||||
* Configure this component to insert in the chat-box the specified command when clicked.
|
* Configure this component to insert in the chat-box the specified command when clicked.
|
||||||
* @param cmdWithSlash the command to suggest.
|
* @param cmdWithSlash the command to suggest.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
|
public FormattableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
|
||||||
/**
|
/**
|
||||||
* Configure this component to copy into clipboard the specified text when clicked.
|
* Configure this component to copy into clipboard the specified text when clicked.
|
||||||
* @param value the text to copy.
|
* @param value the text to copy.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
|
public FormattableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
|
||||||
/**
|
/**
|
||||||
* Configure this component to open the specified URL when clicked.
|
* Configure this component to open the specified URL when clicked.
|
||||||
* @param url the URL to open.
|
* @param url the URL to open.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
|
public FormattableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
|
||||||
/**
|
/**
|
||||||
* Configure this component to change the page of the opened book when clicked.
|
* Configure this component to change the page of the opened book when clicked.
|
||||||
* @param page the page to go to.
|
* @param page the page to go to.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
|
public FormattableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -905,43 +837,31 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
* @param e the {@link HoverEventSource}.
|
* @param e the {@link HoverEventSource}.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
|
public FormattableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
|
||||||
/**
|
/**
|
||||||
* Configure this component to show the provided component when hovered.
|
* Configure this component to show the provided component when hovered.
|
||||||
* @param v the component to show.
|
* @param v the component to show.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
|
public FormattableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
|
||||||
/**
|
/**
|
||||||
* Configure this component to show the provided component when hovered.
|
* Configure this component to show the provided component when hovered.
|
||||||
* @param v the component to show.
|
* @param v the component to show.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
|
public FormattableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
|
||||||
/**
|
/**
|
||||||
* Configure this component to show the provided component when hovered.
|
* Configure this component to show the provided component when hovered.
|
||||||
* @param v the component to show.
|
* @param v the component to show.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); }
|
public FormattableChat hover(ComponentLike v) { return hover(v.asComponent()); }
|
||||||
/**
|
|
||||||
* Configure this component to show the provided component when hovered.
|
|
||||||
* @param v the component to show.
|
|
||||||
* @return this.
|
|
||||||
*/
|
|
||||||
public FormatableChat hover(BaseComponent v) { return hover(toAdventure(v)); }
|
|
||||||
/**
|
|
||||||
* Configure this component to show the provided component when hovered.
|
|
||||||
* @param v the component to show.
|
|
||||||
* @return this.
|
|
||||||
*/
|
|
||||||
public FormatableChat hover(BaseComponent[] v) { return hover(toAdventure(v)); }
|
|
||||||
/**
|
/**
|
||||||
* Configure this component to show the provided legacy text when hovered.
|
* Configure this component to show the provided legacy text when hovered.
|
||||||
* @param legacyText the legacy text to show.
|
* @param legacyText the legacy text to show.
|
||||||
* @return this.
|
* @return this.
|
||||||
*/
|
*/
|
||||||
public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
|
public FormattableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -963,7 +883,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return getAdv().hashCode();
|
return get().hashCode();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -976,8 +896,6 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
|
|
||||||
/* package */ static ComponentLike filterObjToComponentLike(Object v) {
|
/* package */ static ComponentLike filterObjToComponentLike(Object v) {
|
||||||
return switch (v) {
|
return switch (v) {
|
||||||
case BaseComponent[] baseComponents -> toAdventure(baseComponents);
|
|
||||||
case BaseComponent baseComponent -> toAdventure(baseComponent);
|
|
||||||
case ComponentLike componentLike -> componentLike;
|
case ComponentLike componentLike -> componentLike;
|
||||||
case null, default -> Component.text(Objects.toString(v));
|
case null, default -> Component.text(Objects.toString(v));
|
||||||
};
|
};
|
||||||
@@ -1011,51 +929,17 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Converts the Bungee {@link BaseComponent} array into Adventure {@link Component}.
|
|
||||||
* @param components the Bungee {@link BaseComponent} array.
|
|
||||||
* @return a {@link Component}.
|
|
||||||
*/
|
|
||||||
public static Component toAdventure(BaseComponent[] components) {
|
|
||||||
return BungeeComponentSerializer.get().deserialize(components);
|
|
||||||
}
|
|
||||||
/**
|
|
||||||
* Converts the Bungee {@link BaseComponent} into Adventure {@link Component}.
|
|
||||||
* @param component the Bungee {@link BaseComponent}.
|
|
||||||
* @return a {@link Component}.
|
|
||||||
*/
|
|
||||||
public static Component toAdventure(BaseComponent component) {
|
|
||||||
return toAdventure(new BaseComponent[] { component });
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent} array.
|
|
||||||
* @param component the Adventure {@link Component}.
|
|
||||||
* @return a {@link BaseComponent} array.
|
|
||||||
*/
|
|
||||||
public static BaseComponent[] toBungeeArray(Component component) {
|
|
||||||
return BungeeComponentSerializer.get().serialize(component);
|
|
||||||
}
|
|
||||||
/**
|
|
||||||
* Converts the Adventure {@link Component} into Bungee {@link BaseComponent}.
|
|
||||||
* @param component the Adventure {@link Component}.
|
|
||||||
* @return a {@link BaseComponent}.
|
|
||||||
*/
|
|
||||||
public static BaseComponent toBungee(Component component) {
|
|
||||||
BaseComponent[] arr = toBungeeArray(component);
|
|
||||||
return arr.length == 1 ? arr[0] : new net.md_5.bungee.api.chat.TextComponent(arr);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Force the italic formatting to be set to false if it is not explicitly set in the component.
|
* Force the italic formatting to be set to false if it is not explicitly set in the component.
|
||||||
* This is useful for item lores that defaults to italic in the game UI.
|
* This is useful for item lore that defaults to italic in the game UI.
|
||||||
* @param c the {@link Chat} in which to set the italic property if needed.
|
* @param c the {@link Chat} in which to set the italic property if needed.
|
||||||
* @return the provided {@link Chat} instance.
|
* @return the provided {@link Chat} instance.
|
||||||
*/
|
*/
|
||||||
public static Chat italicFalseIfNotSet(Chat c) {
|
public static Chat italicFalseIfNotSet(Chat c) {
|
||||||
c.builder.style(b -> {
|
c.builder.style(b -> {
|
||||||
if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
|
if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
|
||||||
((FormatableChat) c).italic(false);
|
((FormattableChat) c).italic(false);
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
return c;
|
return c;
|
||||||
|
@@ -1,14 +1,14 @@
|
|||||||
package fr.pandacube.lib.chat;
|
package fr.pandacube.lib.chat;
|
||||||
|
|
||||||
|
import net.kyori.adventure.text.format.TextColor;
|
||||||
|
import net.kyori.adventure.text.format.TextDecoration;
|
||||||
|
import net.kyori.adventure.text.format.TextFormat;
|
||||||
|
import net.kyori.adventure.util.RGBLike;
|
||||||
|
|
||||||
import java.util.regex.Pattern;
|
import java.util.regex.Pattern;
|
||||||
|
|
||||||
import net.kyori.adventure.text.format.NamedTextColor;
|
|
||||||
import net.kyori.adventure.text.format.TextColor;
|
|
||||||
import net.kyori.adventure.util.RGBLike;
|
|
||||||
import net.md_5.bungee.api.ChatColor;
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Provides methods to manipulate legacy colors and {@link ChatColor} class.
|
* Provides methods to manipulate legacy colors.
|
||||||
*/
|
*/
|
||||||
public class ChatColorUtil {
|
public class ChatColorUtil {
|
||||||
|
|
||||||
@@ -38,12 +38,12 @@ public class ChatColorUtil {
|
|||||||
int length = legacyText.length();
|
int length = legacyText.length();
|
||||||
|
|
||||||
for (int index = length - 2; index >= 0; index--) {
|
for (int index = length - 2; index >= 0; index--) {
|
||||||
if (legacyText.charAt(index) == ChatColor.COLOR_CHAR) {
|
if (legacyText.charAt(index) == LegacyChatFormat.COLOR_CHAR) {
|
||||||
|
|
||||||
// detection of rgb color §x§0§1§2§3§4§5
|
// detection of rgb color §x§0§1§2§3§4§5
|
||||||
String rgb;
|
String rgb;
|
||||||
if (index > 11
|
if (index > 11
|
||||||
&& legacyText.charAt(index - 12) == ChatColor.COLOR_CHAR
|
&& legacyText.charAt(index - 12) == LegacyChatFormat.COLOR_CHAR
|
||||||
&& (legacyText.charAt(index - 11) == 'x'
|
&& (legacyText.charAt(index - 11) == 'x'
|
||||||
|| legacyText.charAt(index - 11) == 'X')
|
|| legacyText.charAt(index - 11) == 'X')
|
||||||
&& HEX_COLOR_PATTERN.matcher(rgb = legacyText.substring(index - 12, index + 2)).matches()) {
|
&& HEX_COLOR_PATTERN.matcher(rgb = legacyText.substring(index - 12, index + 2)).matches()) {
|
||||||
@@ -64,7 +64,7 @@ public class ChatColorUtil {
|
|||||||
|
|
||||||
// try detect non-rgb format
|
// try detect non-rgb format
|
||||||
char colorChar = legacyText.charAt(index + 1);
|
char colorChar = legacyText.charAt(index + 1);
|
||||||
ChatColor legacyColor = getChatColorByChar(colorChar);
|
LegacyChatFormat legacyColor = LegacyChatFormat.of(colorChar);
|
||||||
|
|
||||||
if (legacyColor != null) {
|
if (legacyColor != null) {
|
||||||
result.insert(0, legacyColor);
|
result.insert(0, legacyColor);
|
||||||
@@ -83,15 +83,6 @@ public class ChatColorUtil {
|
|||||||
return result.toString();
|
return result.toString();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Returns the {@link ChatColor} associated with the provided char, case-insensitive.
|
|
||||||
* @param code the case-insensitive char code.
|
|
||||||
* @return the corresponding {@link ChatColor}.
|
|
||||||
*/
|
|
||||||
public static ChatColor getChatColorByChar(char code) {
|
|
||||||
return ChatColor.getByChar(Character.toLowerCase(code));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
@@ -99,7 +90,7 @@ public class ChatColorUtil {
|
|||||||
* Translate the color code of the provided string, that uses the alt color char, to the {@code §} color code
|
* Translate the color code of the provided string, that uses the alt color char, to the {@code §} color code
|
||||||
* format.
|
* format.
|
||||||
* <p>
|
* <p>
|
||||||
* This method is the improved version of {@link ChatColor#translateAlternateColorCodes(char, String)},
|
* This method is the improved version of Bukkit’s {@code ChatColor.translateAlternateColorCodes(char, String)},
|
||||||
* because it takes into account essentials RGB color code, and {@code altColorChar} escaping (by doubling it).
|
* because it takes into account essentials RGB color code, and {@code altColorChar} escaping (by doubling it).
|
||||||
* Essentials RGB color code are converted to Bungee chat RGB format, so the returned string can be converted
|
* Essentials RGB color code are converted to Bungee chat RGB format, so the returned string can be converted
|
||||||
* to component (see {@link Chat#legacyText(Object)}).
|
* to component (see {@link Chat#legacyText(Object)}).
|
||||||
@@ -112,7 +103,7 @@ public class ChatColorUtil {
|
|||||||
*/
|
*/
|
||||||
public static String translateAlternateColorCodes(char altColorChar, String textToTranslate)
|
public static String translateAlternateColorCodes(char altColorChar, String textToTranslate)
|
||||||
{
|
{
|
||||||
char colorChar = ChatColor.COLOR_CHAR;
|
char colorChar = LegacyChatFormat.COLOR_CHAR;
|
||||||
StringBuilder acc = new StringBuilder();
|
StringBuilder acc = new StringBuilder();
|
||||||
char[] b = textToTranslate.toCharArray();
|
char[] b = textToTranslate.toCharArray();
|
||||||
for ( int i = 0; i < b.length; i++ )
|
for ( int i = 0; i < b.length; i++ )
|
||||||
@@ -180,7 +171,7 @@ public class ChatColorUtil {
|
|||||||
* @return the text fully italic.
|
* @return the text fully italic.
|
||||||
*/
|
*/
|
||||||
public static String forceItalic(String legacyText) {
|
public static String forceItalic(String legacyText) {
|
||||||
return forceFormat(legacyText, ChatColor.ITALIC);
|
return forceFormat(legacyText, TextDecoration.ITALIC);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -190,7 +181,7 @@ public class ChatColorUtil {
|
|||||||
* @return the text fully bold.
|
* @return the text fully bold.
|
||||||
*/
|
*/
|
||||||
public static String forceBold(String legacyText) {
|
public static String forceBold(String legacyText) {
|
||||||
return forceFormat(legacyText, ChatColor.BOLD);
|
return forceFormat(legacyText, TextDecoration.BOLD);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -200,7 +191,7 @@ public class ChatColorUtil {
|
|||||||
* @return the text fully underlined.
|
* @return the text fully underlined.
|
||||||
*/
|
*/
|
||||||
public static String forceUnderline(String legacyText) {
|
public static String forceUnderline(String legacyText) {
|
||||||
return forceFormat(legacyText, ChatColor.UNDERLINE);
|
return forceFormat(legacyText, TextDecoration.UNDERLINED);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -210,7 +201,7 @@ public class ChatColorUtil {
|
|||||||
* @return the text fully stroked through.
|
* @return the text fully stroked through.
|
||||||
*/
|
*/
|
||||||
public static String forceStrikethrough(String legacyText) {
|
public static String forceStrikethrough(String legacyText) {
|
||||||
return forceFormat(legacyText, ChatColor.STRIKETHROUGH);
|
return forceFormat(legacyText, TextDecoration.STRIKETHROUGH);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -220,15 +211,16 @@ public class ChatColorUtil {
|
|||||||
* @return the text fully obfuscated.
|
* @return the text fully obfuscated.
|
||||||
*/
|
*/
|
||||||
public static String forceObfuscated(String legacyText) {
|
public static String forceObfuscated(String legacyText) {
|
||||||
return forceFormat(legacyText, ChatColor.MAGIC);
|
return forceFormat(legacyText, TextDecoration.OBFUSCATED);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
private static String forceFormat(String legacyText, ChatColor format) {
|
private static String forceFormat(String legacyText, TextFormat format) {
|
||||||
|
String formatStr = LegacyChatFormat.of(format).toString();
|
||||||
return format + legacyText
|
return format + legacyText
|
||||||
.replace(format.toString(), "") // remove previous tag to make the result cleaner
|
.replace(formatStr, "") // remove previous tag to make the result cleaner
|
||||||
.replaceAll("§([a-frA-FR\\d])", "§$1" + format);
|
.replaceAll("§([a-frA-FR\\d])", "§$1" + formatStr);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -243,40 +235,12 @@ public class ChatColorUtil {
|
|||||||
* @return the resulting text.
|
* @return the resulting text.
|
||||||
*/
|
*/
|
||||||
public static String resetToColor(String legacyText, String color) {
|
public static String resetToColor(String legacyText, String color) {
|
||||||
return legacyText.replace(ChatColor.RESET.toString(), color);
|
return legacyText.replace(LegacyChatFormat.RESET.toString(), color);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Converts the provided {@link ChatColor} to its Adventure counterpart.
|
|
||||||
* @param bungee a BungeeCord {@link ChatColor} instance.
|
|
||||||
* @return the {@link TextColor} equivalent to the provided {@link ChatColor}.
|
|
||||||
*/
|
|
||||||
public static TextColor toAdventure(ChatColor bungee) {
|
|
||||||
if (bungee == null)
|
|
||||||
return null;
|
|
||||||
if (bungee.getColor() == null)
|
|
||||||
throw new IllegalArgumentException("The provided Bungee ChatColor must be an actual color (not format nor reset).");
|
|
||||||
return TextColor.color(bungee.getColor().getRGB());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Converts the provided {@link TextColor} to its BungeeCord counterpart.
|
|
||||||
* @param col a Adventure {@link TextColor} instance.
|
|
||||||
* @return the {@link ChatColor} equivalent to the provided {@link TextColor}.
|
|
||||||
*/
|
|
||||||
public static ChatColor toBungee(TextColor col) {
|
|
||||||
if (col == null)
|
|
||||||
return null;
|
|
||||||
if (col instanceof NamedTextColor) {
|
|
||||||
return ChatColor.of(((NamedTextColor) col).toString());
|
|
||||||
}
|
|
||||||
return ChatColor.of(col.asHexString());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Create a color, interpolating between 2 colors.
|
* Create a color, interpolating between 2 colors.
|
||||||
* @param v0 the value corresponding to color {@code cc0}.
|
* @param v0 the value corresponding to color {@code cc0}.
|
||||||
|
@@ -87,7 +87,7 @@ public class ChatConfig {
|
|||||||
*/
|
*/
|
||||||
public static int getPrefixWidth(boolean console) {
|
public static int getPrefixWidth(boolean console) {
|
||||||
Chat c;
|
Chat c;
|
||||||
return prefix == null ? 0 : (c = prefix.get()) == null ? 0 : ChatUtil.componentWidth(c.getAdv(), console);
|
return prefix == null ? 0 : (c = prefix.get()) == null ? 0 : ChatUtil.componentWidth(c.get(), console);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@@ -5,7 +5,7 @@ import net.kyori.adventure.text.ComponentLike;
|
|||||||
import net.kyori.adventure.text.format.TextColor;
|
import net.kyori.adventure.text.format.TextColor;
|
||||||
import org.jetbrains.annotations.NotNull;
|
import org.jetbrains.annotations.NotNull;
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.Chat.FormatableChat;
|
import fr.pandacube.lib.chat.Chat.FormattableChat;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text.
|
* Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text.
|
||||||
@@ -150,10 +150,10 @@ public class ChatFilledLine implements ComponentLike {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Renders this line to a {@link FormatableChat}.
|
* Renders this line to a {@link FormattableChat}.
|
||||||
* @return a new {@link FormatableChat} built by this {@link ChatFilledLine}.
|
* @return a new {@link FormattableChat} built by this {@link ChatFilledLine}.
|
||||||
*/
|
*/
|
||||||
public FormatableChat toChat() {
|
public FormattableChat toChat() {
|
||||||
int maxWidth = (this.maxWidth != null)
|
int maxWidth = (this.maxWidth != null)
|
||||||
? this.maxWidth
|
? this.maxWidth
|
||||||
: console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH;
|
: console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH;
|
||||||
@@ -170,7 +170,7 @@ public class ChatFilledLine implements ComponentLike {
|
|||||||
int textWidth = ChatUtil.componentWidth(text.asComponent(), console);
|
int textWidth = ChatUtil.componentWidth(text.asComponent(), console);
|
||||||
|
|
||||||
if (textWidth > maxWidth)
|
if (textWidth > maxWidth)
|
||||||
return (FormatableChat) text;
|
return (FormattableChat) text;
|
||||||
|
|
||||||
int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold);
|
int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold);
|
||||||
int nbCharLeft = 0, nbCharRight = 0;
|
int nbCharLeft = 0, nbCharRight = 0;
|
||||||
@@ -179,12 +179,12 @@ public class ChatFilledLine implements ComponentLike {
|
|||||||
case CENTER -> {
|
case CENTER -> {
|
||||||
nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth;
|
nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth;
|
||||||
if (nbCharLeft == 0)
|
if (nbCharLeft == 0)
|
||||||
return (FormatableChat) text;
|
return (FormattableChat) text;
|
||||||
}
|
}
|
||||||
case LEFT, RIGHT -> {
|
case LEFT, RIGHT -> {
|
||||||
int remWidth = textWidth + nbSide * repeatedCharWidth;
|
int remWidth = textWidth + nbSide * repeatedCharWidth;
|
||||||
if (remWidth > maxWidth)
|
if (remWidth > maxWidth)
|
||||||
return (FormatableChat) text;
|
return (FormattableChat) text;
|
||||||
boolean left = alignment == Alignment.LEFT;
|
boolean left = alignment == Alignment.LEFT;
|
||||||
int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth;
|
int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth;
|
||||||
nbCharLeft = left ? nbSide : nbOtherSide;
|
nbCharLeft = left ? nbSide : nbOtherSide;
|
||||||
@@ -197,7 +197,7 @@ public class ChatFilledLine implements ComponentLike {
|
|||||||
.then(text);
|
.then(text);
|
||||||
if (decorationChar != ' ' || spacesDecorationRightSide)
|
if (decorationChar != ' ' || spacesDecorationRightSide)
|
||||||
d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold));
|
d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold));
|
||||||
return (FormatableChat) d;
|
return (FormattableChat) d;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@@ -1,7 +1,6 @@
|
|||||||
package fr.pandacube.lib.chat;
|
package fr.pandacube.lib.chat;
|
||||||
|
|
||||||
import java.util.Objects;
|
import fr.pandacube.lib.chat.Chat.FormattableChat;
|
||||||
|
|
||||||
import net.kyori.adventure.text.BlockNBTComponent;
|
import net.kyori.adventure.text.BlockNBTComponent;
|
||||||
import net.kyori.adventure.text.Component;
|
import net.kyori.adventure.text.Component;
|
||||||
import net.kyori.adventure.text.ComponentBuilder;
|
import net.kyori.adventure.text.ComponentBuilder;
|
||||||
@@ -18,9 +17,8 @@ import net.kyori.adventure.text.format.NamedTextColor;
|
|||||||
import net.kyori.adventure.text.format.TextColor;
|
import net.kyori.adventure.text.format.TextColor;
|
||||||
import net.kyori.adventure.text.minimessage.MiniMessage;
|
import net.kyori.adventure.text.minimessage.MiniMessage;
|
||||||
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
|
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
|
||||||
import net.md_5.bungee.api.chat.BaseComponent;
|
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.Chat.FormatableChat;
|
import java.util.Objects;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Abstract class holding the publicly accessible methods to create an instance of {@link Chat} component.
|
* Abstract class holding the publicly accessible methods to create an instance of {@link Chat} component.
|
||||||
@@ -29,45 +27,27 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
private static FormatableChat chatComponent(Component c) {
|
private static FormattableChat chatComponent(Component c) {
|
||||||
return new FormatableChat(componentToBuilder(c));
|
return new FormattableChat(componentToBuilder(c));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent}.
|
* Creates a {@link FormattableChat} from the provided {@link ComponentLike}.
|
||||||
* @param c the {@link BaseComponent}.
|
|
||||||
* @return a new {@link FormatableChat}.
|
|
||||||
*/
|
|
||||||
public static FormatableChat chatComponent(BaseComponent c) {
|
|
||||||
return new FormatableChat(componentToBuilder(Chat.toAdventure(c)));
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Creates a {@link FormatableChat} from the provided {@link ComponentLike}.
|
|
||||||
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
|
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
|
||||||
* will be untouched.
|
* will be untouched.
|
||||||
* @param c the {@link ComponentLike}.
|
* @param c the {@link ComponentLike}.
|
||||||
* @return a new {@link FormatableChat}.
|
* @return a new {@link FormattableChat}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat chatComponent(ComponentLike c) {
|
public static FormattableChat chatComponent(ComponentLike c) {
|
||||||
return chatComponent(c.asComponent());
|
return chatComponent(c.asComponent());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with an empty main text content.
|
* Creates a {@link FormattableChat} with an empty main text content.
|
||||||
* @return a new empty {@link FormatableChat}.
|
* @return a new empty {@link FormattableChat}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat chat() {
|
public static FormattableChat chat() {
|
||||||
return new FormatableChat(Component.text());
|
return new FormattableChat(Component.text());
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
|
|
||||||
* @param c the array of {@link BaseComponent}.
|
|
||||||
* @return a new {@link FormatableChat}.
|
|
||||||
*/
|
|
||||||
public static FormatableChat chatComponent(BaseComponent[] c) {
|
|
||||||
return chatComponent(Chat.toAdventure(c));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -76,60 +56,60 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided plain text as its main text content.
|
* Creates a {@link FormattableChat} with the provided plain text as its main text content.
|
||||||
* @param plainText the text to use as the content.
|
* @param plainText the text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content.
|
* @return a new {@link FormattableChat} with the provided text as its main text content.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
||||||
* instead.
|
* instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat text(Object plainText) {
|
public static FormattableChat text(Object plainText) {
|
||||||
if (plainText instanceof ComponentLike) {
|
if (plainText instanceof ComponentLike) {
|
||||||
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
|
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
|
||||||
}
|
}
|
||||||
return new FormatableChat(Component.text().content(Objects.toString(plainText)));
|
return new FormattableChat(Component.text().content(Objects.toString(plainText)));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the section {@code "§"}
|
* Creates a {@link FormattableChat} with the provided legacy text as its content, using the section {@code "§"}
|
||||||
* character.
|
* character.
|
||||||
* @param legacyText the legacy text to use as the content, that uses the {@code "§"} character.
|
* @param legacyText the legacy text to use as the content, that uses the {@code "§"} character.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its content.
|
* @return a new {@link FormattableChat} with the provided text as its content.
|
||||||
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
||||||
* instead.
|
* instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat legacyText(Object legacyText) {
|
public static FormattableChat legacyText(Object legacyText) {
|
||||||
return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR);
|
return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
|
* Creates a {@link FormattableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
|
||||||
* character.
|
* character.
|
||||||
* @param legacyText the legacy text to use as the content, that uses the {@code "&"} character.
|
* @param legacyText the legacy text to use as the content, that uses the {@code "&"} character.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its content.
|
* @return a new {@link FormattableChat} with the provided text as its content.
|
||||||
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
||||||
* instead.
|
* instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat legacyAmpersandText(Object legacyText) {
|
public static FormattableChat legacyAmpersandText(Object legacyText) {
|
||||||
return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR);
|
return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided legacy text as its content, using the specified
|
* Creates a {@link FormattableChat} with the provided legacy text as its content, using the specified
|
||||||
* legacyCharacter.
|
* legacyCharacter.
|
||||||
* @param legacyText the legacy text to use as the content.
|
* @param legacyText the legacy text to use as the content.
|
||||||
* @param legacyCharacter the character used in the provided text to prefix color and format code.
|
* @param legacyCharacter the character used in the provided text to prefix color and format code.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its content.
|
* @return a new {@link FormattableChat} with the provided text as its content.
|
||||||
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
|
||||||
* instead.
|
* instead.
|
||||||
*/
|
*/
|
||||||
private static FormatableChat legacyText(Object legacyText, char legacyCharacter) {
|
private static FormattableChat legacyText(Object legacyText, char legacyCharacter) {
|
||||||
if (legacyText instanceof ComponentLike) {
|
if (legacyText instanceof ComponentLike) {
|
||||||
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
|
throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
|
||||||
}
|
}
|
||||||
@@ -138,118 +118,118 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided MiniMessage text as its content.
|
* Creates a {@link FormattableChat} with the provided MiniMessage text as its content.
|
||||||
* @param miniMessageText the MiniMessage text to use as the content.
|
* @param miniMessageText the MiniMessage text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its content.
|
* @return a new {@link FormattableChat} with the provided text as its content.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat miniMessageText(String miniMessageText) {
|
public static FormattableChat miniMessageText(String miniMessageText) {
|
||||||
return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText));
|
return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
|
* Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
|
||||||
* {@link ChatConfig#infoColor configured info color}.
|
* {@link ChatConfig#infoColor configured info color}.
|
||||||
* @param plainText the text to use as the content.
|
* @param plainText the text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
|
* @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
||||||
* {@link FormatableChat#infoColor()} instead.
|
* {@link FormattableChat#infoColor()} instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat infoText(Object plainText) {
|
public static FormattableChat infoText(Object plainText) {
|
||||||
return text(plainText).infoColor();
|
return text(plainText).infoColor();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
|
* Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
|
||||||
* {@link ChatConfig#warningColor configured warning color}.
|
* {@link ChatConfig#warningColor configured warning color}.
|
||||||
* @param plainText the text to use as the content.
|
* @param plainText the text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
|
* @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
||||||
* {@link FormatableChat#warningColor()} instead.
|
* {@link FormattableChat#warningColor()} instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat warningText(Object plainText) {
|
public static FormattableChat warningText(Object plainText) {
|
||||||
return text(plainText).warningColor();
|
return text(plainText).warningColor();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
|
* Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
|
||||||
* {@link ChatConfig#dataColor configured data color}.
|
* {@link ChatConfig#dataColor configured data color}.
|
||||||
* @param plainText the text to use as the content.
|
* @param plainText the text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
|
* @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
||||||
* {@link FormatableChat#dataColor()} instead.
|
* {@link FormattableChat#dataColor()} instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat dataText(Object plainText) {
|
public static FormattableChat dataText(Object plainText) {
|
||||||
return text(plainText).dataColor();
|
return text(plainText).dataColor();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
|
* Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
|
||||||
* {@link ChatConfig#decorationColor configured decorationColor color}.
|
* {@link ChatConfig#decorationColor configured decorationColor color}.
|
||||||
* @param plainText the text to use as the content.
|
* @param plainText the text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
|
* @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
||||||
* {@link FormatableChat#decorationColor()} instead.
|
* {@link FormattableChat#decorationColor()} instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat decorationText(Object plainText) {
|
public static FormattableChat decorationText(Object plainText) {
|
||||||
return text(plainText).decorationColor();
|
return text(plainText).decorationColor();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
|
* Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
|
||||||
* {@link ChatConfig#successColor configured success color}.
|
* {@link ChatConfig#successColor configured success color}.
|
||||||
* @param plainText the text to use as the content.
|
* @param plainText the text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
|
* @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
||||||
* {@link FormatableChat#successColor()} instead.
|
* {@link FormattableChat#successColor()} instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat successText(Object plainText) {
|
public static FormattableChat successText(Object plainText) {
|
||||||
return text(plainText).successColor();
|
return text(plainText).successColor();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
|
* Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
|
||||||
* {@link ChatConfig#failureColor configured failure color}.
|
* {@link ChatConfig#failureColor configured failure color}.
|
||||||
* @param plainText the text to use as the content.
|
* @param plainText the text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
|
* @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
||||||
* {@link FormatableChat#failureColor()} instead.
|
* {@link FormattableChat#failureColor()} instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat failureText(Object plainText) {
|
public static FormattableChat failureText(Object plainText) {
|
||||||
return text(plainText).failureColor();
|
return text(plainText).failureColor();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided legacy text as its main text content, and colored in white in
|
* Creates a {@link FormattableChat} with the provided legacy text as its main text content, and colored in white in
|
||||||
* case there is no color on the generated parent component.
|
* case there is no color on the generated parent component.
|
||||||
* @param legacyText the legacy text to use as the content.
|
* @param legacyText the legacy text to use as the content.
|
||||||
* @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
|
* @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
|
||||||
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
* @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
|
||||||
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
* {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
|
||||||
* {@link FormatableChat#failureColor()} instead.
|
* {@link FormattableChat#failureColor()} instead.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat playerNameText(String legacyText) {
|
public static FormattableChat playerNameText(String legacyText) {
|
||||||
FormatableChat fc = legacyText(legacyText);
|
FormattableChat fc = legacyText(legacyText);
|
||||||
fc.builder.colorIfAbsent(NamedTextColor.WHITE);
|
fc.builder.colorIfAbsent(NamedTextColor.WHITE);
|
||||||
return fc;
|
return fc;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} from the provided {@link Component}, coloring in white the generated parent
|
* Creates a {@link FormattableChat} from the provided {@link Component}, coloring in white the generated parent
|
||||||
* component in case there is no color defined.
|
* component in case there is no color defined.
|
||||||
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
|
* If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
|
||||||
* will be untouched.
|
* will be untouched.
|
||||||
* @param c the {@link Component}.
|
* @param c the {@link Component}.
|
||||||
* @return a new {@link FormatableChat}.
|
* @return a new {@link FormattableChat}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat playerNameComponent(ComponentLike c) {
|
public static FormattableChat playerNameComponent(ComponentLike c) {
|
||||||
FormatableChat fc = chatComponent(c);
|
FormattableChat fc = chatComponent(c);
|
||||||
fc.builder.colorIfAbsent(NamedTextColor.WHITE);
|
fc.builder.colorIfAbsent(NamedTextColor.WHITE);
|
||||||
return fc;
|
return fc;
|
||||||
}
|
}
|
||||||
@@ -258,32 +238,32 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided translation key and parameters.
|
* Creates a {@link FormattableChat} with the provided translation key and parameters.
|
||||||
* @param key the translation key.
|
* @param key the translation key.
|
||||||
* @param with the translation parameters.
|
* @param with the translation parameters.
|
||||||
* @return a new {@link FormatableChat} with the provided translation key and parameters.
|
* @return a new {@link FormattableChat} with the provided translation key and parameters.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat translation(String key, Object... with) {
|
public static FormattableChat translation(String key, Object... with) {
|
||||||
return new FormatableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
|
return new FormattableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided keybinding.
|
* Creates a {@link FormattableChat} with the provided keybinding.
|
||||||
* @param key the keybinding to display.
|
* @param key the keybinding to display.
|
||||||
* @return a new {@link FormatableChat} with the provided keybinding.
|
* @return a new {@link FormattableChat} with the provided keybinding.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat keybind(String key) {
|
public static FormattableChat keyBind(String key) {
|
||||||
return new FormatableChat(Component.keybind().keybind(key));
|
return new FormattableChat(Component.keybind().keybind(key));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} with the provided score name and objective.
|
* Creates a {@link FormattableChat} with the provided score name and objective.
|
||||||
* @param name the score name.
|
* @param name the score name.
|
||||||
* @param objective the score objective.
|
* @param objective the score objective.
|
||||||
* @return a new {@link FormatableChat} with the provided score name and objective.
|
* @return a new {@link FormattableChat} with the provided score name and objective.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat score(String name, String objective) {
|
public static FormattableChat score(String name, String objective) {
|
||||||
return new FormatableChat(Component.score().name(name).objective(objective));
|
return new FormattableChat(Component.score().name(name).objective(objective));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -292,49 +272,49 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that leads to a URL when clicked.
|
* Creates a {@link FormattableChat} that leads to a URL when clicked.
|
||||||
* @param inner the component to make clickable.
|
* @param inner the component to make clickable.
|
||||||
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
||||||
* @param hover the content to display when hovering the component.
|
* @param hover the content to display when hovering the component.
|
||||||
* @return a new {@link FormatableChat} that leads to a URL when clicked.
|
* @return a new {@link FormattableChat} that leads to a URL when clicked.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
|
public static FormattableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
|
||||||
Objects.requireNonNull(url, "url");
|
Objects.requireNonNull(url, "url");
|
||||||
if (inner == null)
|
if (inner == null)
|
||||||
inner = text(url);
|
inner = text(url);
|
||||||
if (hover == null)
|
if (hover == null)
|
||||||
hover = text(ChatUtil.wrapInLimitedPixels(url, 240));
|
hover = text(ChatUtil.wrapInLimitedPixels(url, 240));
|
||||||
return (FormatableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
|
return (FormattableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that leads to a URL when clicked.
|
* Creates a {@link FormattableChat} that leads to a URL when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* When hovered, the component will display the url. To customize the hover content, use
|
* When hovered, the component will display the url. To customize the hover content, use
|
||||||
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
|
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
|
||||||
* @param inner the component to make clickable.
|
* @param inner the component to make clickable.
|
||||||
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
||||||
* @return a new {@link FormatableChat} that leads to a URL when clicked.
|
* @return a new {@link FormattableChat} that leads to a URL when clicked.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableURL(ComponentLike inner, String url) {
|
public static FormattableChat clickableURL(ComponentLike inner, String url) {
|
||||||
return clickableURL(inner, url, null);
|
return clickableURL(inner, url, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that leads to a URL when clicked.
|
* Creates a {@link FormattableChat} that leads to a URL when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* The text on which to click will be the URL itself. To configure the clicked text, use
|
* The text on which to click will be the URL itself. To configure the clicked text, use
|
||||||
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
|
* {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
|
||||||
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
||||||
* @param hover the content to display when hovering the component.
|
* @param hover the content to display when hovering the component.
|
||||||
* @return a new {@link FormatableChat} that leads to a URL when clicked.
|
* @return a new {@link FormattableChat} that leads to a URL when clicked.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableURL(String url, HoverEventSource<?> hover) {
|
public static FormattableChat clickableURL(String url, HoverEventSource<?> hover) {
|
||||||
return clickableURL(null, url, hover);
|
return clickableURL(null, url, hover);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that leads to a URL when clicked.
|
* Creates a {@link FormattableChat} that leads to a URL when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* The text on which to click will be the URL itself. To configure the clicked text, use
|
* The text on which to click will be the URL itself. To configure the clicked text, use
|
||||||
* {@link #clickableURL(ComponentLike, String)}.
|
* {@link #clickableURL(ComponentLike, String)}.
|
||||||
@@ -342,9 +322,9 @@ public abstract class ChatStatic {
|
|||||||
* When hovered, the component will display the url. To customize the hover content, use
|
* When hovered, the component will display the url. To customize the hover content, use
|
||||||
* {@link #clickableURL(String, HoverEventSource)}.
|
* {@link #clickableURL(String, HoverEventSource)}.
|
||||||
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
* @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
|
||||||
* @return a new {@link FormatableChat} that leads to a URL when clicked.
|
* @return a new {@link FormattableChat} that leads to a URL when clicked.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableURL(String url) {
|
public static FormattableChat clickableURL(String url) {
|
||||||
return clickableURL(null, url, null);
|
return clickableURL(null, url, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -354,14 +334,14 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that runs a command when clicked.
|
* Creates a {@link FormattableChat} that runs a command when clicked.
|
||||||
* @param inner the component to make clickable.
|
* @param inner the component to make clickable.
|
||||||
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
||||||
* @param hover the content to display when hovering the component.
|
* @param hover the content to display when hovering the component.
|
||||||
* @return a new {@link FormatableChat} that runs a command when clicked.
|
* @return a new {@link FormattableChat} that runs a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
|
public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
|
||||||
Objects.requireNonNull(commandWithSlash, "commandWithSlash");
|
Objects.requireNonNull(commandWithSlash, "commandWithSlash");
|
||||||
if (!commandWithSlash.startsWith("/"))
|
if (!commandWithSlash.startsWith("/"))
|
||||||
throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
|
throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
|
||||||
@@ -369,39 +349,39 @@ public abstract class ChatStatic {
|
|||||||
inner = text(commandWithSlash);
|
inner = text(commandWithSlash);
|
||||||
if (hover == null)
|
if (hover == null)
|
||||||
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
|
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
|
||||||
return (FormatableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
|
return (FormattableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that runs a command when clicked.
|
* Creates a {@link FormattableChat} that runs a command when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* When hovered, the component will display the command itself. To customize the hover content, use
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
||||||
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
|
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
|
||||||
* @param inner the component to make clickable.
|
* @param inner the component to make clickable.
|
||||||
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
||||||
* @return a new {@link FormatableChat} that runs a command when clicked.
|
* @return a new {@link FormattableChat} that runs a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
|
public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
|
||||||
return clickableCommand(inner, commandWithSlash, null);
|
return clickableCommand(inner, commandWithSlash, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that runs a command when clicked.
|
* Creates a {@link FormattableChat} that runs a command when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* The text on which to click will be the command itself. To configure the clicked text, use
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
||||||
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
|
* {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
|
||||||
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
||||||
* @param hover the content to display when hovering the component.
|
* @param hover the content to display when hovering the component.
|
||||||
* @return a new {@link FormatableChat} that runs a command when clicked.
|
* @return a new {@link FormattableChat} that runs a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
|
public static FormattableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
|
||||||
return clickableCommand(null, commandWithSlash, hover);
|
return clickableCommand(null, commandWithSlash, hover);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that runs a command when clicked.
|
* Creates a {@link FormattableChat} that runs a command when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* The text on which to click will be the command itself. To configure the clicked text, use
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
||||||
* {@link #clickableCommand(ComponentLike, String)}.
|
* {@link #clickableCommand(ComponentLike, String)}.
|
||||||
@@ -409,10 +389,10 @@ public abstract class ChatStatic {
|
|||||||
* When hovered, the component will display the command itself. To customize the hover content, use
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
||||||
* {@link #clickableCommand(String, HoverEventSource)}.
|
* {@link #clickableCommand(String, HoverEventSource)}.
|
||||||
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
* @param commandWithSlash the command to run. Must start with {@code "/"}.
|
||||||
* @return a new {@link FormatableChat} that runs a command when clicked.
|
* @return a new {@link FormattableChat} that runs a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableCommand(String commandWithSlash) {
|
public static FormattableChat clickableCommand(String commandWithSlash) {
|
||||||
return clickableCommand(null, commandWithSlash, null);
|
return clickableCommand(null, commandWithSlash, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -422,14 +402,14 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* @param inner the component to make clickable.
|
* @param inner the component to make clickable.
|
||||||
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
||||||
* @param hover the content to display when hovering the component.
|
* @param hover the content to display when hovering the component.
|
||||||
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
|
public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
|
||||||
Objects.requireNonNull(commandWithSlash, "commandWithSlash");
|
Objects.requireNonNull(commandWithSlash, "commandWithSlash");
|
||||||
if (!commandWithSlash.startsWith("/"))
|
if (!commandWithSlash.startsWith("/"))
|
||||||
throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
|
throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
|
||||||
@@ -437,39 +417,39 @@ public abstract class ChatStatic {
|
|||||||
inner = text(commandWithSlash);
|
inner = text(commandWithSlash);
|
||||||
if (hover == null)
|
if (hover == null)
|
||||||
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
|
hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
|
||||||
return (FormatableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
|
return (FormattableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* When hovered, the component will display the command itself. To customize the hover content, use
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
||||||
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
|
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
|
||||||
* @param inner the component to make clickable.
|
* @param inner the component to make clickable.
|
||||||
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
||||||
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
|
public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
|
||||||
return clickableSuggest(inner, commandWithSlash, null);
|
return clickableSuggest(inner, commandWithSlash, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* The text on which to click will be the command itself. To configure the clicked text, use
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
||||||
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
|
* {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
|
||||||
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
||||||
* @param hover the content to display when hovering the component.
|
* @param hover the content to display when hovering the component.
|
||||||
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
|
public static FormattableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
|
||||||
return clickableSuggest(null, commandWithSlash, hover);
|
return clickableSuggest(null, commandWithSlash, hover);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* <p>
|
* <p>
|
||||||
* The text on which to click will be the command itself. To configure the clicked text, use
|
* The text on which to click will be the command itself. To configure the clicked text, use
|
||||||
* {@link #clickableSuggest(ComponentLike, String)}.
|
* {@link #clickableSuggest(ComponentLike, String)}.
|
||||||
@@ -477,10 +457,10 @@ public abstract class ChatStatic {
|
|||||||
* When hovered, the component will display the command itself. To customize the hover content, use
|
* When hovered, the component will display the command itself. To customize the hover content, use
|
||||||
* {@link #clickableSuggest(String, HoverEventSource)}.
|
* {@link #clickableSuggest(String, HoverEventSource)}.
|
||||||
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
* @param commandWithSlash the command to suggest. Must start with {@code "/"}.
|
||||||
* @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
|
* @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
|
||||||
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
* @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat clickableSuggest(String commandWithSlash) {
|
public static FormattableChat clickableSuggest(String commandWithSlash) {
|
||||||
return clickableSuggest(null, commandWithSlash, null);
|
return clickableSuggest(null, commandWithSlash, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -492,112 +472,112 @@ public abstract class ChatStatic {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with decoration and a left-aligned text.
|
* Creates a {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
|
||||||
* @param text the text aligned to the left.
|
* @param text the text aligned to the left.
|
||||||
* @param decorationChar the character used for decoration around the text.
|
* @param decorationChar the character used for decoration around the text.
|
||||||
* @param decorationColor the color used for the decoration characters.
|
* @param decorationColor the color used for the decoration characters.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with decoration and a left-aligned text.
|
* @return a new {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
|
||||||
* @see ChatFilledLine#leftText(ComponentLike)
|
* @see ChatFilledLine#leftText(ComponentLike)
|
||||||
*/
|
*/
|
||||||
public static FormatableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
|
public static FormattableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
|
||||||
return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
|
return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
|
* Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
|
||||||
* color and a left-aligned text.
|
* color and a left-aligned text.
|
||||||
* @param text the text aligned to the left.
|
* @param text the text aligned to the left.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
* @return a new {@link FormattableChat} filling a chat line with the configured decoration character
|
||||||
* and color and a left-aligned text.
|
* and color and a left-aligned text.
|
||||||
* @see ChatFilledLine#leftText(ComponentLike)
|
* @see ChatFilledLine#leftText(ComponentLike)
|
||||||
* @see ChatConfig#decorationChar
|
* @see ChatConfig#decorationChar
|
||||||
* @see ChatConfig#decorationColor
|
* @see ChatConfig#decorationColor
|
||||||
*/
|
*/
|
||||||
public static FormatableChat leftText(ComponentLike text, boolean console) {
|
public static FormattableChat leftText(ComponentLike text, boolean console) {
|
||||||
return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat();
|
return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with decoration and a right-aligned text.
|
* Creates a {@link FormattableChat} filling a chat line with decoration and a right-aligned text.
|
||||||
* @param text the text aligned to the right.
|
* @param text the text aligned to the right.
|
||||||
* @param decorationChar the character used for decoration around the text.
|
* @param decorationChar the character used for decoration around the text.
|
||||||
* @param decorationColor the color used for the decoration characters.
|
* @param decorationColor the color used for the decoration characters.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with decoration and a right-aligned
|
* @return a new {@link FormattableChat} filling a chat line with decoration and a right-aligned
|
||||||
* text.
|
* text.
|
||||||
* @see ChatFilledLine#rightText(ComponentLike)
|
* @see ChatFilledLine#rightText(ComponentLike)
|
||||||
*/
|
*/
|
||||||
public static FormatableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
|
public static FormattableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
|
||||||
return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
|
return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
|
* Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
|
||||||
* color and a right-aligned text.
|
* color and a right-aligned text.
|
||||||
* @param text the text aligned to the right.
|
* @param text the text aligned to the right.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
* @return a new {@link FormattableChat} filling a chat line with the configured decoration character
|
||||||
* and color and a right-aligned text.
|
* and color and a right-aligned text.
|
||||||
* @see ChatFilledLine#rightText(ComponentLike)
|
* @see ChatFilledLine#rightText(ComponentLike)
|
||||||
* @see ChatConfig#decorationChar
|
* @see ChatConfig#decorationChar
|
||||||
* @see ChatConfig#decorationColor
|
* @see ChatConfig#decorationColor
|
||||||
*/
|
*/
|
||||||
public static FormatableChat rightText(ComponentLike text, boolean console) {
|
public static FormattableChat rightText(ComponentLike text, boolean console) {
|
||||||
return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat();
|
return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with decoration and a centered text.
|
* Creates a {@link FormattableChat} filling a chat line with decoration and a centered text.
|
||||||
* @param text the text aligned to the center.
|
* @param text the text aligned to the center.
|
||||||
* @param decorationChar the character used for decoration around the text.
|
* @param decorationChar the character used for decoration around the text.
|
||||||
* @param decorationColor the color used for the decoration characters.
|
* @param decorationColor the color used for the decoration characters.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with decoration and a centered text.
|
* @return a new {@link FormattableChat} filling a chat line with decoration and a centered text.
|
||||||
* @see ChatFilledLine#centerText(ComponentLike)
|
* @see ChatFilledLine#centerText(ComponentLike)
|
||||||
*/
|
*/
|
||||||
public static FormatableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
|
public static FormattableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
|
||||||
return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
|
return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
|
* Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
|
||||||
* color and a centered text.
|
* color and a centered text.
|
||||||
* @param text the text aligned to the center.
|
* @param text the text aligned to the center.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with the configured decoration character
|
* @return a new {@link FormattableChat} filling a chat line with the configured decoration character
|
||||||
* and color and a centered text.
|
* and color and a centered text.
|
||||||
* @see ChatFilledLine#centerText(ComponentLike)
|
* @see ChatFilledLine#centerText(ComponentLike)
|
||||||
* @see ChatConfig#decorationChar
|
* @see ChatConfig#decorationChar
|
||||||
* @see ChatConfig#decorationColor
|
* @see ChatConfig#decorationColor
|
||||||
*/
|
*/
|
||||||
public static FormatableChat centerText(ComponentLike text, boolean console) {
|
public static FormattableChat centerText(ComponentLike text, boolean console) {
|
||||||
return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat();
|
return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with a decoration character and color.
|
* Creates a {@link FormattableChat} filling a chat line with a decoration character and color.
|
||||||
* @param decorationChar the character used for decoration.
|
* @param decorationChar the character used for decoration.
|
||||||
* @param decorationColor the color used for the decoration characters.
|
* @param decorationColor the color used for the decoration characters.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
|
* @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
|
||||||
* @see ChatFilledLine#filled()
|
* @see ChatFilledLine#filled()
|
||||||
*/
|
*/
|
||||||
public static FormatableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
|
public static FormattableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
|
||||||
return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat();
|
return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
|
* Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
|
||||||
* color.
|
* color.
|
||||||
* @param console if the line is rendered on console (true) or IG (false).
|
* @param console if the line is rendered on console (true) or IG (false).
|
||||||
* @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
|
* @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
|
||||||
* @see ChatFilledLine#filled()
|
* @see ChatFilledLine#filled()
|
||||||
* @see ChatConfig#decorationChar
|
* @see ChatConfig#decorationChar
|
||||||
* @see ChatConfig#decorationColor
|
* @see ChatConfig#decorationColor
|
||||||
*/
|
*/
|
||||||
public static FormatableChat filledLine(boolean console) {
|
public static FormattableChat filledLine(boolean console) {
|
||||||
return ChatFilledLine.filled().console(console).toChat();
|
return ChatFilledLine.filled().console(console).toChat();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -1,5 +1,17 @@
|
|||||||
package fr.pandacube.lib.chat;
|
package fr.pandacube.lib.chat;
|
||||||
|
|
||||||
|
import fr.pandacube.lib.chat.Chat.FormattableChat;
|
||||||
|
import net.kyori.adventure.text.Component;
|
||||||
|
import net.kyori.adventure.text.ComponentLike;
|
||||||
|
import net.kyori.adventure.text.TextComponent;
|
||||||
|
import net.kyori.adventure.text.TranslatableComponent;
|
||||||
|
import net.kyori.adventure.text.TranslationArgument;
|
||||||
|
import net.kyori.adventure.text.format.NamedTextColor;
|
||||||
|
import net.kyori.adventure.text.format.TextColor;
|
||||||
|
import net.kyori.adventure.text.format.TextDecoration;
|
||||||
|
import net.kyori.adventure.text.format.TextDecoration.State;
|
||||||
|
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
|
||||||
|
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
@@ -10,19 +22,6 @@ import java.util.Set;
|
|||||||
import java.util.TreeSet;
|
import java.util.TreeSet;
|
||||||
import java.util.stream.Collectors;
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
import net.kyori.adventure.text.Component;
|
|
||||||
import net.kyori.adventure.text.ComponentLike;
|
|
||||||
import net.kyori.adventure.text.TextComponent;
|
|
||||||
import net.kyori.adventure.text.TranslatableComponent;
|
|
||||||
import net.kyori.adventure.text.TranslationArgument;
|
|
||||||
import net.kyori.adventure.text.format.NamedTextColor;
|
|
||||||
import net.kyori.adventure.text.format.TextColor;
|
|
||||||
import net.kyori.adventure.text.format.TextDecoration;
|
|
||||||
import net.kyori.adventure.text.format.TextDecoration.State;
|
|
||||||
import net.md_5.bungee.api.ChatColor;
|
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.Chat.FormatableChat;
|
|
||||||
|
|
||||||
import static fr.pandacube.lib.chat.ChatStatic.chat;
|
import static fr.pandacube.lib.chat.ChatStatic.chat;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -153,7 +152,7 @@ public class ChatUtil {
|
|||||||
else
|
else
|
||||||
first = false;
|
first = false;
|
||||||
|
|
||||||
FormatableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
|
FormattableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
|
||||||
if (page == currentPage) {
|
if (page == currentPage) {
|
||||||
pDisplay.highlightedCommandColor();
|
pDisplay.highlightedCommandColor();
|
||||||
}
|
}
|
||||||
@@ -181,12 +180,12 @@ public class ChatUtil {
|
|||||||
* @param elements the components to join.
|
* @param elements the components to join.
|
||||||
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
|
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
|
public static FormattableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
|
||||||
int size = elements == null ? 0 : elements.size();
|
int size = elements == null ? 0 : elements.size();
|
||||||
int last = size - 1;
|
int last = size - 1;
|
||||||
return switch (size) {
|
return switch (size) {
|
||||||
case 0, 1, 2 -> join(finalSeparator, elements);
|
case 0, 1, 2 -> join(finalSeparator, elements);
|
||||||
default -> (FormatableChat) join(regularSeparator, elements.subList(0, last))
|
default -> (FormattableChat) join(regularSeparator, elements.subList(0, last))
|
||||||
.then(finalSeparator)
|
.then(finalSeparator)
|
||||||
.then(elements.get(last));
|
.then(elements.get(last));
|
||||||
};
|
};
|
||||||
@@ -203,8 +202,8 @@ public class ChatUtil {
|
|||||||
* @param elements the components to join.
|
* @param elements the components to join.
|
||||||
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
|
* @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
|
||||||
*/
|
*/
|
||||||
public static FormatableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
|
public static FormattableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
|
||||||
FormatableChat c = chat();
|
FormattableChat c = chat();
|
||||||
if (elements == null)
|
if (elements == null)
|
||||||
return c;
|
return c;
|
||||||
boolean first = true;
|
boolean first = true;
|
||||||
@@ -351,7 +350,7 @@ public class ChatUtil {
|
|||||||
|
|
||||||
do {
|
do {
|
||||||
char c = legacyText.charAt(index);
|
char c = legacyText.charAt(index);
|
||||||
if (c == ChatColor.COLOR_CHAR && index < legacyText.length() - 1) {
|
if (c == LegacyComponentSerializer.SECTION_CHAR && index < legacyText.length() - 1) {
|
||||||
currentWord.append(c);
|
currentWord.append(c);
|
||||||
c = legacyText.charAt(++index);
|
c = legacyText.charAt(++index);
|
||||||
currentWord.append(c);
|
currentWord.append(c);
|
||||||
@@ -482,7 +481,7 @@ public class ChatUtil {
|
|||||||
}
|
}
|
||||||
if (!row.isEmpty())
|
if (!row.isEmpty())
|
||||||
spacedRow.then(row.getLast());
|
spacedRow.then(row.getLast());
|
||||||
spacedRows.add(spacedRow.getAdv());
|
spacedRows.add(spacedRow.get());
|
||||||
}
|
}
|
||||||
|
|
||||||
return spacedRows;
|
return spacedRows;
|
||||||
@@ -504,14 +503,14 @@ public class ChatUtil {
|
|||||||
*/
|
*/
|
||||||
public static Component customWidthSpace(int width, boolean console) {
|
public static Component customWidthSpace(int width, boolean console) {
|
||||||
if (console)
|
if (console)
|
||||||
return Chat.text(" ".repeat(width)).getAdv();
|
return Chat.text(" ".repeat(width)).get();
|
||||||
return switch (width) {
|
return switch (width) {
|
||||||
case 0, 1 -> Component.empty();
|
case 0, 1 -> Component.empty();
|
||||||
case 2 -> Chat.text(".").black().getAdv();
|
case 2 -> Chat.text(".").black().get();
|
||||||
case 3 -> Chat.text("`").black().getAdv();
|
case 3 -> Chat.text("`").black().get();
|
||||||
case 6 -> Chat.text(". ").black().getAdv();
|
case 6 -> Chat.text(". ").black().get();
|
||||||
case 7 -> Chat.text("` ").black().getAdv();
|
case 7 -> Chat.text("` ").black().get();
|
||||||
case 11 -> Chat.text("` ").black().getAdv();
|
case 11 -> Chat.text("` ").black().get();
|
||||||
default -> {
|
default -> {
|
||||||
int nbSpace = width / 4;
|
int nbSpace = width / 4;
|
||||||
int nbBold = width % 4;
|
int nbBold = width % 4;
|
||||||
@@ -520,13 +519,13 @@ public class ChatUtil {
|
|||||||
if (nbBold > 0) {
|
if (nbBold > 0) {
|
||||||
yield Chat.text(" ".repeat(nbNotBold)).bold(false)
|
yield Chat.text(" ".repeat(nbNotBold)).bold(false)
|
||||||
.then(Chat.text(" ".repeat(nbBold)).bold(true))
|
.then(Chat.text(" ".repeat(nbBold)).bold(true))
|
||||||
.getAdv();
|
.get();
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
yield Chat.text(" ".repeat(nbNotBold)).bold(false).getAdv();
|
yield Chat.text(" ".repeat(nbNotBold)).bold(false).get();
|
||||||
}
|
}
|
||||||
else if (nbBold > 0) {
|
else if (nbBold > 0) {
|
||||||
yield Chat.text(" ".repeat(nbBold)).bold(true).getAdv();
|
yield Chat.text(" ".repeat(nbBold)).bold(true).get();
|
||||||
}
|
}
|
||||||
throw new IllegalStateException("Should not be here (width=" + width + "; nbSpace=" + nbSpace + "; nbBold=" + nbBold + "; nbNotBold=" + nbNotBold + ")");
|
throw new IllegalStateException("Should not be here (width=" + width + "; nbSpace=" + nbSpace + "; nbBold=" + nbBold + "; nbNotBold=" + nbNotBold + ")");
|
||||||
}
|
}
|
||||||
@@ -597,7 +596,7 @@ public class ChatUtil {
|
|||||||
for (int i = 0; i < sizes.length; i++) {
|
for (int i = 0; i < sizes.length; i++) {
|
||||||
sumSizes += sizes[i];
|
sumSizes += sizes[i];
|
||||||
|
|
||||||
FormatableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
|
FormattableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
|
||||||
|
|
||||||
if (colors != null && i < colors.length && colors[i] != null)
|
if (colors != null && i < colors.length && colors[i] != null)
|
||||||
subC.color(colors[i]);
|
subC.color(colors[i]);
|
||||||
|
@@ -0,0 +1,230 @@
|
|||||||
|
package fr.pandacube.lib.chat;
|
||||||
|
|
||||||
|
import net.kyori.adventure.text.format.TextColor;
|
||||||
|
import net.kyori.adventure.text.format.TextDecoration;
|
||||||
|
import net.kyori.adventure.text.format.TextFormat;
|
||||||
|
import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
|
||||||
|
import net.kyori.adventure.text.serializer.legacy.LegacyFormat;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Convenient enum to uses legacy format while keeping compatibility with modern chat format and API (Adventure, ...)
|
||||||
|
*/
|
||||||
|
public enum LegacyChatFormat {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Black (0) color format code.
|
||||||
|
*/
|
||||||
|
BLACK('0'),
|
||||||
|
/**
|
||||||
|
* Dark blue (1) color format code.
|
||||||
|
*/
|
||||||
|
DARK_BLUE('1'),
|
||||||
|
/**
|
||||||
|
* Dark green (2) color format code.
|
||||||
|
*/
|
||||||
|
DARK_GREEN('2'),
|
||||||
|
/**
|
||||||
|
* Dark aqua (3) color format code.
|
||||||
|
*/
|
||||||
|
DARK_AQUA('3'),
|
||||||
|
/**
|
||||||
|
* Dark red (4) color format code.
|
||||||
|
*/
|
||||||
|
DARK_RED('4'),
|
||||||
|
/**
|
||||||
|
* Dark purple (5) color format code.
|
||||||
|
*/
|
||||||
|
DARK_PURPLE('5'),
|
||||||
|
/**
|
||||||
|
* Gold (6) color format code.
|
||||||
|
*/
|
||||||
|
GOLD('6'),
|
||||||
|
/**
|
||||||
|
* Gray (7) color format code.
|
||||||
|
*/
|
||||||
|
GRAY('7'),
|
||||||
|
/**
|
||||||
|
* Dark gray (8) color format code.
|
||||||
|
*/
|
||||||
|
DARK_GRAY('8'),
|
||||||
|
/**
|
||||||
|
* Blue (9) color format code.
|
||||||
|
*/
|
||||||
|
BLUE('9'),
|
||||||
|
/**
|
||||||
|
* Green (A) color format code.
|
||||||
|
*/
|
||||||
|
GREEN('a'),
|
||||||
|
/**
|
||||||
|
* Aqua (B) color format code.
|
||||||
|
*/
|
||||||
|
AQUA('b'),
|
||||||
|
/**
|
||||||
|
* Red (C) color format code.
|
||||||
|
*/
|
||||||
|
RED('c'),
|
||||||
|
/**
|
||||||
|
* Light purple (D) color format code.
|
||||||
|
*/
|
||||||
|
LIGHT_PURPLE('d'),
|
||||||
|
/**
|
||||||
|
* Yellow (E) color format code.
|
||||||
|
*/
|
||||||
|
YELLOW('e'),
|
||||||
|
/**
|
||||||
|
* White (F) color format code.
|
||||||
|
*/
|
||||||
|
WHITE('f'),
|
||||||
|
/**
|
||||||
|
* Obfuscated (K) decoration format code.
|
||||||
|
*/
|
||||||
|
OBFUSCATED('k'),
|
||||||
|
/**
|
||||||
|
* Bold (L) decoration format code.
|
||||||
|
*/
|
||||||
|
BOLD('l'),
|
||||||
|
/**
|
||||||
|
* Strikethrough (M) decoration format code.
|
||||||
|
*/
|
||||||
|
STRIKETHROUGH('m'),
|
||||||
|
/**
|
||||||
|
* Underlined (N) decoration format code.
|
||||||
|
*/
|
||||||
|
UNDERLINED('n'),
|
||||||
|
/**
|
||||||
|
* Italic (O) decoration format code.
|
||||||
|
*/
|
||||||
|
ITALIC('o'),
|
||||||
|
/**
|
||||||
|
* Reset (R) format code.
|
||||||
|
*/
|
||||||
|
RESET('r');
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The character used by Minecraft for legacy chat format.
|
||||||
|
*/
|
||||||
|
public static final char COLOR_CHAR = LegacyComponentSerializer.SECTION_CHAR;
|
||||||
|
|
||||||
|
/** {@link #COLOR_CHAR} but as a String! */
|
||||||
|
public static final String COLOR_STR_PREFIX = Character.toString(COLOR_CHAR);
|
||||||
|
|
||||||
|
private static final Map<Character, LegacyChatFormat> BY_CHAR;
|
||||||
|
private static final Map<TextFormat, LegacyChatFormat> BY_FORMAT;
|
||||||
|
private static final Map<LegacyFormat, LegacyChatFormat> BY_LEGACY;
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the {@link LegacyChatFormat} from the provided chat color code.
|
||||||
|
* @param code the character code from [0-9A-Fa-fK-Ok-oRr].
|
||||||
|
* @return the {@link LegacyChatFormat} related to the provided code.
|
||||||
|
*/
|
||||||
|
public static LegacyChatFormat of(char code) {
|
||||||
|
return BY_CHAR.get(Character.toLowerCase(code));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the {@link LegacyChatFormat} from the provided {@link TextFormat} instance.
|
||||||
|
* @param format the {@link TextFormat} instance.
|
||||||
|
* @return the {@link LegacyChatFormat} related to the provided format.
|
||||||
|
*/
|
||||||
|
public static LegacyChatFormat of(TextFormat format) {
|
||||||
|
LegacyChatFormat colorOrDecoration = BY_FORMAT.get(format);
|
||||||
|
if (colorOrDecoration != null)
|
||||||
|
return colorOrDecoration;
|
||||||
|
if (format.getClass().getSimpleName().equals("Reset")) // an internal class of legacy serializer library
|
||||||
|
return RESET;
|
||||||
|
throw new IllegalArgumentException("Unsupported format of type " + format.getClass());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the {@link LegacyChatFormat} from the provided {@link LegacyFormat} instance.
|
||||||
|
* @param advLegacy the {@link LegacyFormat} instance.
|
||||||
|
* @return the {@link LegacyChatFormat} related to the provided format.
|
||||||
|
*/
|
||||||
|
public static LegacyChatFormat of(LegacyFormat advLegacy) {
|
||||||
|
return BY_LEGACY.get(advLegacy);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The format code of this chat format.
|
||||||
|
*/
|
||||||
|
public final char code;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The Adventure legacy format instance related to this chat format.
|
||||||
|
*/
|
||||||
|
public final LegacyFormat advLegacyFormat;
|
||||||
|
|
||||||
|
LegacyChatFormat(char code) {
|
||||||
|
this.code = code;
|
||||||
|
advLegacyFormat = LegacyComponentSerializer.parseChar(code);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the related {@link TextColor}, or null if it's not a color.
|
||||||
|
* @return the related {@link TextColor}, or null if it's not a color.
|
||||||
|
*/
|
||||||
|
public TextColor getTextColor() {
|
||||||
|
return advLegacyFormat.color();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if this format is a color.
|
||||||
|
* @return true if this format is a color, false otherwise.
|
||||||
|
*/
|
||||||
|
public boolean isColor() {
|
||||||
|
return getTextColor() != null;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the related {@link TextDecoration}, or null if it's not a decoration.
|
||||||
|
* @return the related {@link TextDecoration}, or null if it's not a decoration.
|
||||||
|
*/
|
||||||
|
public TextDecoration getTextDecoration() {
|
||||||
|
return advLegacyFormat.decoration();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if this format is a decoration (bold, italic, ...).
|
||||||
|
* @return true if this format is a decoration, false otherwise.
|
||||||
|
*/
|
||||||
|
public boolean isDecoration() {
|
||||||
|
return getTextDecoration() != null;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if this format is the reset.
|
||||||
|
* @return true if this format is the reset, false otherwise.
|
||||||
|
*/
|
||||||
|
public boolean isReset() {
|
||||||
|
return this == RESET;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return COLOR_STR_PREFIX + code;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
static {
|
||||||
|
BY_CHAR = Arrays.stream(values()).sequential()
|
||||||
|
.collect(Collectors.toMap(e -> e.code, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
|
||||||
|
BY_FORMAT = Arrays.stream(values()).sequential()
|
||||||
|
.filter(e -> e.isColor() || e.isDecoration())
|
||||||
|
.collect(Collectors.toMap(e -> {
|
||||||
|
if (e.isColor())
|
||||||
|
return e.getTextColor();
|
||||||
|
return e.getTextDecoration();
|
||||||
|
}, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
|
||||||
|
BY_LEGACY = Arrays.stream(values()).sequential()
|
||||||
|
.collect(Collectors.toMap(e -> e.advLegacyFormat, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
|
||||||
|
}
|
||||||
|
}
|
@@ -15,42 +15,26 @@
|
|||||||
<packaging>jar</packaging>
|
<packaging>jar</packaging>
|
||||||
|
|
||||||
<repositories>
|
<repositories>
|
||||||
<repository>
|
|
||||||
<id>minecraft-libraries</id>
|
|
||||||
<name>Minecraft Libraries</name>
|
|
||||||
<url>https://libraries.minecraft.net</url>
|
|
||||||
</repository>
|
|
||||||
<repository>
|
<repository>
|
||||||
<id>bungeecord-repo</id>
|
<id>bungeecord-repo</id>
|
||||||
<url>https://oss.sonatype.org/content/repositories/snapshots</url>
|
<url>https://oss.sonatype.org/content/repositories/snapshots</url>
|
||||||
</repository>
|
</repository>
|
||||||
</repositories>
|
</repositories>
|
||||||
|
|
||||||
<dependencies>
|
<dependencies>
|
||||||
<dependency>
|
|
||||||
<groupId>fr.pandacube.lib</groupId>
|
|
||||||
<artifactId>pandalib-core</artifactId>
|
|
||||||
<version>${project.version}</version>
|
|
||||||
</dependency>
|
|
||||||
<dependency>
|
|
||||||
<groupId>fr.pandacube.lib</groupId>
|
|
||||||
<artifactId>pandalib-reflect</artifactId>
|
|
||||||
<version>${project.version}</version>
|
|
||||||
</dependency>
|
|
||||||
<dependency>
|
|
||||||
<groupId>fr.pandacube.lib</groupId>
|
|
||||||
<artifactId>pandalib-commands</artifactId>
|
|
||||||
<version>${project.version}</version>
|
|
||||||
</dependency>
|
|
||||||
|
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>net.md-5</groupId>
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
<artifactId>bungeecord-log</artifactId>
|
<artifactId>pandalib-core</artifactId>
|
||||||
<version>${bungeecord.version}</version>
|
<version>${project.version}</version>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
|
<artifactId>pandalib-commands</artifactId>
|
||||||
|
<version>${project.version}</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>net.md-5</groupId>
|
<groupId>net.md-5</groupId>
|
||||||
<artifactId>bungeecord-config</artifactId>
|
<artifactId>bungeecord-log</artifactId>
|
||||||
<version>${bungeecord.version}</version>
|
<version>${bungeecord.version}</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
|
||||||
|
@@ -1,22 +1,25 @@
|
|||||||
package fr.pandacube.lib.cli;
|
package fr.pandacube.lib.cli;
|
||||||
|
|
||||||
|
import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
|
||||||
|
import fr.pandacube.lib.cli.log.CLILogger;
|
||||||
|
import fr.pandacube.lib.util.log.Log;
|
||||||
|
import org.jline.reader.EndOfFileException;
|
||||||
|
import org.jline.reader.LineReader;
|
||||||
|
import org.jline.reader.LineReaderBuilder;
|
||||||
|
import org.jline.reader.UserInterruptException;
|
||||||
|
import org.jline.terminal.Terminal;
|
||||||
|
import org.jline.terminal.TerminalBuilder;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.logging.Logger;
|
import java.util.logging.Logger;
|
||||||
|
|
||||||
import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
|
|
||||||
import fr.pandacube.lib.cli.log.CLILogger;
|
|
||||||
import jline.console.ConsoleReader;
|
|
||||||
import org.fusesource.jansi.AnsiConsole;
|
|
||||||
|
|
||||||
import fr.pandacube.lib.util.log.Log;
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Class to handle general standard IO operation for a CLI application. It uses Jline’s {@link ConsoleReader} for the
|
* Class to handle general standard IO operation for a CLI application. It uses Jline’s {@link LineReader} for the
|
||||||
* console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands.
|
* console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands.
|
||||||
*/
|
*/
|
||||||
public class CLI extends Thread {
|
public class CLI extends Thread {
|
||||||
|
|
||||||
private final ConsoleReader reader;
|
private final LineReader reader;
|
||||||
private final Logger logger;
|
private final Logger logger;
|
||||||
|
|
||||||
|
|
||||||
@@ -28,10 +31,11 @@ public class CLI extends Thread {
|
|||||||
super("Console Thread");
|
super("Console Thread");
|
||||||
setDaemon(true);
|
setDaemon(true);
|
||||||
|
|
||||||
AnsiConsole.systemInstall();
|
Terminal terminal = TerminalBuilder.builder().build();
|
||||||
reader = new ConsoleReader();
|
reader = LineReaderBuilder.builder().terminal(terminal)
|
||||||
reader.setPrompt(">");
|
.completer(CLIBrigadierDispatcher.instance)
|
||||||
reader.addCompleter(CLIBrigadierDispatcher.instance);
|
.build()
|
||||||
|
;
|
||||||
|
|
||||||
// configure logger's formatter
|
// configure logger's formatter
|
||||||
System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss");
|
System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss");
|
||||||
@@ -40,10 +44,10 @@ public class CLI extends Thread {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the Jline {@link ConsoleReader} of this CLI instance.
|
* Gets the Jline {@link LineReader} of this CLI instance.
|
||||||
* @return the Jline {@link ConsoleReader} of this CLI instance.
|
* @return the Jline {@link LineReader} of this CLI instance.
|
||||||
*/
|
*/
|
||||||
public ConsoleReader getConsoleReader() {
|
public LineReader getConsoleReader() {
|
||||||
return reader;
|
return reader;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -65,15 +69,14 @@ public class CLI extends Thread {
|
|||||||
int i = 0;
|
int i = 0;
|
||||||
String line;
|
String line;
|
||||||
try {
|
try {
|
||||||
while((line = reader.readLine()) != null) {
|
while((line = reader.readLine(">")) != null) {
|
||||||
if (line.trim().equals(""))
|
if (line.trim().isEmpty())
|
||||||
continue;
|
continue;
|
||||||
String cmdLine = line;
|
String cmdLine = line;
|
||||||
new Thread(() -> CLIBrigadierDispatcher.instance.execute(cmdLine), "CLICmdThread #"+(i++)).start();
|
Thread.ofVirtual().name("CLICmdThread #"+(i++))
|
||||||
|
.start(() -> CLIBrigadierDispatcher.instance.execute(cmdLine));
|
||||||
}
|
}
|
||||||
} catch (IOException e) {
|
} catch (UserInterruptException | EndOfFileException ignore) { }
|
||||||
Log.severe(e);
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -32,6 +32,7 @@ public abstract class CLIApplication {
|
|||||||
/**
|
/**
|
||||||
* Creates a new application instance.
|
* Creates a new application instance.
|
||||||
*/
|
*/
|
||||||
|
@SuppressWarnings("CallToPrintStackTrace")
|
||||||
protected CLIApplication() {
|
protected CLIApplication() {
|
||||||
instance = this;
|
instance = this;
|
||||||
CLI tmpCLI = null;
|
CLI tmpCLI = null;
|
||||||
|
@@ -39,15 +39,8 @@ public abstract class CLIBrigadierCommand extends BrigadierCommand<CLICommandSen
|
|||||||
|
|
||||||
protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand();
|
protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand();
|
||||||
|
|
||||||
protected String[] getAliases() {
|
|
||||||
return new String[0];
|
|
||||||
}
|
|
||||||
|
|
||||||
|
public boolean isPlayer(CLICommandSender sender) {
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
public boolean isPlayer(CLICommandSender sender) {
|
|
||||||
return sender.isPlayer();
|
return sender.isPlayer();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -3,8 +3,11 @@ package fr.pandacube.lib.cli.commands;
|
|||||||
import com.mojang.brigadier.suggestion.Suggestion;
|
import com.mojang.brigadier.suggestion.Suggestion;
|
||||||
import com.mojang.brigadier.suggestion.Suggestions;
|
import com.mojang.brigadier.suggestion.Suggestions;
|
||||||
import fr.pandacube.lib.commands.BrigadierDispatcher;
|
import fr.pandacube.lib.commands.BrigadierDispatcher;
|
||||||
import jline.console.completer.Completer;
|
|
||||||
import net.kyori.adventure.text.ComponentLike;
|
import net.kyori.adventure.text.ComponentLike;
|
||||||
|
import org.jline.reader.Candidate;
|
||||||
|
import org.jline.reader.Completer;
|
||||||
|
import org.jline.reader.LineReader;
|
||||||
|
import org.jline.reader.ParsedLine;
|
||||||
|
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -39,17 +42,15 @@ public class CLIBrigadierDispatcher extends BrigadierDispatcher<CLICommandSender
|
|||||||
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public int complete(String buffer, int cursor, List<CharSequence> candidates) {
|
public void complete(LineReader lineReader, ParsedLine parsedLine, List<Candidate> candidates) {
|
||||||
|
String bufferBeforeCursor = parsedLine.line().substring(0, parsedLine.cursor());
|
||||||
String bufferBeforeCursor = buffer.substring(0, cursor);
|
|
||||||
|
|
||||||
Suggestions completeResult = getSuggestions(bufferBeforeCursor);
|
Suggestions completeResult = getSuggestions(bufferBeforeCursor);
|
||||||
|
|
||||||
completeResult.getList().stream()
|
completeResult.getList().stream()
|
||||||
.map(Suggestion::getText)
|
.map(Suggestion::getText)
|
||||||
|
.map(Candidate::new)
|
||||||
.forEach(candidates::add);
|
.forEach(candidates::add);
|
||||||
|
|
||||||
return completeResult.getRange().getStart();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@@ -41,6 +41,9 @@ public interface CLICommandSender extends Audience {
|
|||||||
*/
|
*/
|
||||||
void sendMessage(String message);
|
void sendMessage(String message);
|
||||||
|
|
||||||
|
@SuppressWarnings({"UnstableApiUsage", "deprecation"})
|
||||||
@Override // force implementation of super-interface default method
|
@Override // force implementation of super-interface default method
|
||||||
void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type);
|
void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type);
|
||||||
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -38,7 +38,7 @@ public class CLIConsoleCommandSender implements CLICommandSender {
|
|||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type) {
|
public void sendMessage(@NotNull Identity source, @NotNull Component message, @SuppressWarnings({"UnstableApiUsage", "deprecation"}) @NotNull MessageType type) {
|
||||||
sendMessage(Chat.chatComponent(message).getLegacyText());
|
sendMessage(Chat.chatComponent(message).getLegacyText());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -14,11 +14,11 @@ import com.mojang.brigadier.tree.CommandNode;
|
|||||||
import com.mojang.brigadier.tree.LiteralCommandNode;
|
import com.mojang.brigadier.tree.LiteralCommandNode;
|
||||||
import com.mojang.brigadier.tree.RootCommandNode;
|
import com.mojang.brigadier.tree.RootCommandNode;
|
||||||
import fr.pandacube.lib.chat.Chat;
|
import fr.pandacube.lib.chat.Chat;
|
||||||
import fr.pandacube.lib.chat.Chat.FormatableChat;
|
import fr.pandacube.lib.chat.Chat.FormattableChat;
|
||||||
import fr.pandacube.lib.chat.ChatTreeNode;
|
import fr.pandacube.lib.chat.ChatTreeNode;
|
||||||
import fr.pandacube.lib.cli.CLIApplication;
|
import fr.pandacube.lib.cli.CLIApplication;
|
||||||
import fr.pandacube.lib.util.log.Log;
|
import fr.pandacube.lib.util.log.Log;
|
||||||
import net.md_5.bungee.api.chat.BaseComponent;
|
import net.kyori.adventure.text.Component;
|
||||||
|
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
@@ -192,16 +192,16 @@ public class CommandAdmin extends CLIBrigadierCommand {
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
private BaseComponent displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) {
|
private Component displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) {
|
||||||
if (node == null)
|
if (node == null)
|
||||||
throw new IllegalArgumentException("node must not be null");
|
throw new IllegalArgumentException("node must not be null");
|
||||||
FormatableChat d;
|
FormattableChat d;
|
||||||
if (node instanceof RootCommandNode) {
|
if (node instanceof RootCommandNode) {
|
||||||
d = text("(root)").italic()
|
d = text("(root)").italic()
|
||||||
.hover("Root command node");
|
.hover("Root command node");
|
||||||
}
|
}
|
||||||
else if (node instanceof ArgumentCommandNode) {
|
else if (node instanceof ArgumentCommandNode<?, ?> argNode) {
|
||||||
ArgumentType<?> type = ((ArgumentCommandNode<?, ?>) node).getType();
|
ArgumentType<?> type = argNode.getType();
|
||||||
String typeStr = type.getClass().getSimpleName();
|
String typeStr = type.getClass().getSimpleName();
|
||||||
if (type instanceof IntegerArgumentType
|
if (type instanceof IntegerArgumentType
|
||||||
|| type instanceof LongArgumentType
|
|| type instanceof LongArgumentType
|
||||||
|
@@ -45,7 +45,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.mojang</groupId>
|
<groupId>com.mojang</groupId>
|
||||||
<artifactId>brigadier</artifactId>
|
<artifactId>brigadier</artifactId>
|
||||||
<version>1.0.18</version>
|
<version>${brigadier.version}</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
|
||||||
</dependencies>
|
</dependencies>
|
||||||
|
@@ -3,35 +3,39 @@ package fr.pandacube.lib.commands;
|
|||||||
import java.util.logging.Logger;
|
import java.util.logging.Logger;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Throw an instance of this exception to indicate to the plugin command handler that the user has missused the command.
|
* Throw an instance of this exception to indicate to the plugin command handler that the user has badly used the command.
|
||||||
* The message, if provided, must indicate the reason of the mussusage of the command. It will be displayed on the
|
* The message, if provided, must indicate the reason of the bad usage of the command. It will be displayed on the
|
||||||
* screen with eventual indications of how to use the command (help command for example).
|
* screen with eventual indications of how to use the command (help command for example).
|
||||||
* If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}.
|
* If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}.
|
||||||
*
|
*
|
||||||
*/
|
*/
|
||||||
public class BadCommandUsage extends RuntimeException {
|
public class BadCommandUsage extends RuntimeException {
|
||||||
|
|
||||||
/** Constructs a new runtime exception with no message or cause.
|
/**
|
||||||
|
* Constructs a new runtime exception with no message or cause.
|
||||||
*/
|
*/
|
||||||
public BadCommandUsage() {
|
public BadCommandUsage() {
|
||||||
super();
|
super();
|
||||||
}
|
}
|
||||||
|
|
||||||
/** Constructs a new runtime exception with the specified cause.
|
/**
|
||||||
|
* Constructs a new runtime exception with the specified cause.
|
||||||
* @param cause the cause.
|
* @param cause the cause.
|
||||||
*/
|
*/
|
||||||
public BadCommandUsage(Throwable cause) {
|
public BadCommandUsage(Throwable cause) {
|
||||||
super(cause);
|
super(cause);
|
||||||
}
|
}
|
||||||
|
|
||||||
/** Constructs a new runtime exception with the specified message.
|
/**
|
||||||
|
* Constructs a new runtime exception with the specified message.
|
||||||
* @param message the message.
|
* @param message the message.
|
||||||
*/
|
*/
|
||||||
public BadCommandUsage(String message) {
|
public BadCommandUsage(String message) {
|
||||||
super(message);
|
super(message);
|
||||||
}
|
}
|
||||||
|
|
||||||
/** Constructs a new runtime exception with the specified message and cause.
|
/**
|
||||||
|
* Constructs a new runtime exception with the specified message and cause.
|
||||||
* @param message the message.
|
* @param message the message.
|
||||||
* @param cause the cause.
|
* @param cause the cause.
|
||||||
*/
|
*/
|
||||||
|
@@ -223,14 +223,14 @@ public abstract class BrigadierCommand<S> {
|
|||||||
/**
|
/**
|
||||||
* Wraps the provided {@link SuggestionsSupplier} into a Brigadier’s {@link SuggestionProvider}.
|
* Wraps the provided {@link SuggestionsSupplier} into a Brigadier’s {@link SuggestionProvider}.
|
||||||
* @param suggestions the suggestions to wrap.
|
* @param suggestions the suggestions to wrap.
|
||||||
* @param senderUnwrapper function to convert the command sender provided by brigadier into the command sender
|
* @param senderUnWrapper function to convert the command sender provided by brigadier into the command sender
|
||||||
* supported by {@link SuggestionsSupplier}.
|
* supported by {@link SuggestionsSupplier}.
|
||||||
* @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}.
|
* @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}.
|
||||||
* @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}.
|
* @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}.
|
||||||
*/
|
*/
|
||||||
protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnwrapper) {
|
protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnWrapper) {
|
||||||
return (context, builder) -> {
|
return (context, builder) -> {
|
||||||
AS sender = senderUnwrapper.apply(context.getSource());
|
AS sender = senderUnWrapper.apply(context.getSource());
|
||||||
String message = builder.getInput();
|
String message = builder.getInput();
|
||||||
try {
|
try {
|
||||||
int tokenStartPos = builder.getStart();
|
int tokenStartPos = builder.getStart();
|
||||||
|
@@ -241,7 +241,7 @@ public interface SuggestionsSupplier<S> {
|
|||||||
return (s, ti, token, a) -> {
|
return (s, ti, token, a) -> {
|
||||||
try {
|
try {
|
||||||
List<Long> proposedValues = new ArrayList<>();
|
List<Long> proposedValues = new ArrayList<>();
|
||||||
if (token.length() == 0) {
|
if (token.isEmpty()) {
|
||||||
long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9);
|
long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9);
|
||||||
long end = Math.min(Math.min(start + 9, max), 9);
|
long end = Math.min(Math.min(start + 9, max), 9);
|
||||||
ListUtil.addLongRangeToList(proposedValues, start, end);
|
ListUtil.addLongRangeToList(proposedValues, start, end);
|
||||||
@@ -399,7 +399,7 @@ public interface SuggestionsSupplier<S> {
|
|||||||
*/
|
*/
|
||||||
default SuggestionsSupplier<S> quotableString() {
|
default SuggestionsSupplier<S> quotableString() {
|
||||||
return (s, ti, token, a) -> {
|
return (s, ti, token, a) -> {
|
||||||
boolean startWithQuote = token.length() > 0 && (token.charAt(0) == '"' || token.charAt(0) == '\'');
|
boolean startWithQuote = !token.isEmpty() && (token.charAt(0) == '"' || token.charAt(0) == '\'');
|
||||||
String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token;
|
String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token;
|
||||||
String[] argsCopy = Arrays.copyOf(a, a.length);
|
String[] argsCopy = Arrays.copyOf(a, a.length);
|
||||||
argsCopy[a.length - 1] = realToken;
|
argsCopy[a.length - 1] = realToken;
|
||||||
|
33
pandalib-config/pom.xml
Normal file
33
pandalib-config/pom.xml
Normal file
@@ -0,0 +1,33 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
|
<project xmlns="http://maven.apache.org/POM/4.0.0"
|
||||||
|
xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
|
||||||
|
xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
|
||||||
|
<parent>
|
||||||
|
<artifactId>pandalib-parent</artifactId>
|
||||||
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
|
<version>1.0-SNAPSHOT</version>
|
||||||
|
<relativePath>../pom.xml</relativePath>
|
||||||
|
</parent>
|
||||||
|
<modelVersion>4.0.0</modelVersion>
|
||||||
|
|
||||||
|
<artifactId>pandalib-config</artifactId>
|
||||||
|
<packaging>jar</packaging>
|
||||||
|
|
||||||
|
<repositories>
|
||||||
|
<repository>
|
||||||
|
<id>bungeecord-repo</id>
|
||||||
|
<url>https://oss.sonatype.org/content/repositories/snapshots</url>
|
||||||
|
</repository>
|
||||||
|
</repositories>
|
||||||
|
|
||||||
|
<dependencies>
|
||||||
|
|
||||||
|
<dependency>
|
||||||
|
<groupId>net.md-5</groupId>
|
||||||
|
<artifactId>bungeecord-config</artifactId>
|
||||||
|
<version>${bungeecord.version}</version>
|
||||||
|
</dependency>
|
||||||
|
|
||||||
|
</dependencies>
|
||||||
|
|
||||||
|
</project>
|
@@ -1,7 +1,4 @@
|
|||||||
package fr.pandacube.lib.core.config;
|
package fr.pandacube.lib.config;
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.ChatColorUtil;
|
|
||||||
import fr.pandacube.lib.util.log.Log;
|
|
||||||
|
|
||||||
import java.io.BufferedReader;
|
import java.io.BufferedReader;
|
||||||
import java.io.File;
|
import java.io.File;
|
||||||
@@ -56,7 +53,7 @@ public abstract class AbstractConfig {
|
|||||||
while ((line = reader.readLine()) != null) {
|
while ((line = reader.readLine()) != null) {
|
||||||
String trimmedLine = line.trim();
|
String trimmedLine = line.trim();
|
||||||
|
|
||||||
if (ignoreEmpty && trimmedLine.equals(""))
|
if (ignoreEmpty && trimmedLine.isEmpty())
|
||||||
continue;
|
continue;
|
||||||
|
|
||||||
if (ignoreHashtagComment && trimmedLine.startsWith("#"))
|
if (ignoreHashtagComment && trimmedLine.startsWith("#"))
|
||||||
@@ -114,25 +111,6 @@ public abstract class AbstractConfig {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Utility method to that translate the {@code '&'} formatted string to the legacy format.
|
|
||||||
* @param string the string to convert.
|
|
||||||
* @return a legacy formatted string (using {@code '§'}).
|
|
||||||
*/
|
|
||||||
public static String getTranslatedColorCode(String string) {
|
|
||||||
return ChatColorUtil.translateAlternateColorCodes('&', string);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Logs the message as a warning into console, prefixed with the context of this config.
|
|
||||||
* @param message the message to log.
|
|
||||||
*/
|
|
||||||
protected void warning(String message) {
|
|
||||||
Log.warning("Error in configuration '"+configFile.getName()+"': " + message);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type of config.
|
* The type of config.
|
||||||
*/
|
*/
|
@@ -1,4 +1,4 @@
|
|||||||
package fr.pandacube.lib.core.config;
|
package fr.pandacube.lib.config;
|
||||||
|
|
||||||
import java.io.File;
|
import java.io.File;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
@@ -37,6 +37,12 @@
|
|||||||
<version>${project.version}</version>
|
<version>${project.version}</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
|
||||||
|
<dependency>
|
||||||
|
<groupId>com.google.guava</groupId>
|
||||||
|
<artifactId>guava</artifactId>
|
||||||
|
<version>${guava.version}</version>
|
||||||
|
</dependency>
|
||||||
|
|
||||||
<!-- Cron expression interpreter -->
|
<!-- Cron expression interpreter -->
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>ch.eitchnet</groupId>
|
<groupId>ch.eitchnet</groupId>
|
||||||
|
@@ -1,8 +1,8 @@
|
|||||||
package fr.pandacube.lib.core.backup;
|
package fr.pandacube.lib.core.backup;
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.Chat;
|
import fr.pandacube.lib.chat.Chat;
|
||||||
|
import fr.pandacube.lib.chat.LegacyChatFormat;
|
||||||
import fr.pandacube.lib.util.log.Log;
|
import fr.pandacube.lib.util.log.Log;
|
||||||
import net.md_5.bungee.api.ChatColor;
|
|
||||||
|
|
||||||
import java.io.File;
|
import java.io.File;
|
||||||
import java.time.LocalDateTime;
|
import java.time.LocalDateTime;
|
||||||
@@ -107,14 +107,14 @@ public abstract class BackupCleaner implements UnaryOperator<TreeSet<LocalDateTi
|
|||||||
if (files == null)
|
if (files == null)
|
||||||
return;
|
return;
|
||||||
|
|
||||||
Log.info("[Backup] Cleaning up backup directory " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + "...");
|
Log.info("[Backup] Cleaning up backup directory " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + "...");
|
||||||
|
|
||||||
TreeMap<LocalDateTime, File> datedFiles = new TreeMap<>();
|
TreeMap<LocalDateTime, File> datedFiles = new TreeMap<>();
|
||||||
|
|
||||||
for (String filename : files) {
|
for (String filename : files) {
|
||||||
File file = new File(archiveDir, filename);
|
File file = new File(archiveDir, filename);
|
||||||
if (!filename.matches("\\d{8}-\\d{6}\\.zip")) {
|
if (!filename.matches("\\d{8}-\\d{6}\\.zip")) {
|
||||||
Log.warning("[Backup] " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + " Invalid file in backup directory: " + filename);
|
Log.warning("[Backup] " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + " Invalid file in backup directory: " + filename);
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -123,7 +123,7 @@ public abstract class BackupCleaner implements UnaryOperator<TreeSet<LocalDateTi
|
|||||||
try {
|
try {
|
||||||
ldt = LocalDateTime.parse(dateTimeStr, BackupProcess.dateFileNameFormatter);
|
ldt = LocalDateTime.parse(dateTimeStr, BackupProcess.dateFileNameFormatter);
|
||||||
} catch (DateTimeParseException e) {
|
} catch (DateTimeParseException e) {
|
||||||
Log.warning("[Backup] " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + " Unable to parse file name to a date-time: " + filename, e);
|
Log.warning("[Backup] " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + " Unable to parse file name to a date-time: " + filename, e);
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -156,7 +156,7 @@ public abstract class BackupCleaner implements UnaryOperator<TreeSet<LocalDateTi
|
|||||||
if (testOnly || oneDeleted)
|
if (testOnly || oneDeleted)
|
||||||
Log.warning(c.getLegacyText());
|
Log.warning(c.getLegacyText());
|
||||||
|
|
||||||
Log.info("[Backup] Backup directory " + ChatColor.GRAY + compressDisplayName + ChatColor.RESET + " cleaned.");
|
Log.info("[Backup] Backup directory " + LegacyChatFormat.GRAY + compressDisplayName + LegacyChatFormat.RESET + " cleaned.");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@@ -1,10 +1,10 @@
|
|||||||
package fr.pandacube.lib.core.backup;
|
package fr.pandacube.lib.core.backup;
|
||||||
|
|
||||||
import fc.cron.CronExpression;
|
import fc.cron.CronExpression;
|
||||||
|
import fr.pandacube.lib.chat.LegacyChatFormat;
|
||||||
import fr.pandacube.lib.core.cron.CronScheduler;
|
import fr.pandacube.lib.core.cron.CronScheduler;
|
||||||
import fr.pandacube.lib.util.FileUtils;
|
import fr.pandacube.lib.util.FileUtils;
|
||||||
import fr.pandacube.lib.util.log.Log;
|
import fr.pandacube.lib.util.log.Log;
|
||||||
import net.md_5.bungee.api.ChatColor;
|
|
||||||
|
|
||||||
import java.io.File;
|
import java.io.File;
|
||||||
import java.text.DateFormat;
|
import java.text.DateFormat;
|
||||||
@@ -209,7 +209,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
|
|||||||
File sourceDir = getSourceDir();
|
File sourceDir = getSourceDir();
|
||||||
|
|
||||||
if (!sourceDir.exists()) {
|
if (!sourceDir.exists()) {
|
||||||
Log.warning("[Backup] Unable to compress " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + ": source directory " + sourceDir + " doesn't exist");
|
Log.warning("[Backup] Unable to compress " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + ": source directory " + sourceDir + " doesn't exist");
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -219,7 +219,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
|
|||||||
onBackupStart();
|
onBackupStart();
|
||||||
|
|
||||||
new Thread(() -> {
|
new Thread(() -> {
|
||||||
Log.info("[Backup] Starting for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " ...");
|
Log.info("[Backup] Starting for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " ...");
|
||||||
|
|
||||||
compressor = new ZipCompressor(sourceDir, target, 9, filter);
|
compressor = new ZipCompressor(sourceDir, target, 9, filter);
|
||||||
|
|
||||||
@@ -229,7 +229,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
|
|||||||
|
|
||||||
success = true;
|
success = true;
|
||||||
|
|
||||||
Log.info("[Backup] Finished for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET);
|
Log.info("[Backup] Finished for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET);
|
||||||
|
|
||||||
try {
|
try {
|
||||||
BackupCleaner cleaner = getBackupCleaner();
|
BackupCleaner cleaner = getBackupCleaner();
|
||||||
@@ -267,7 +267,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
|
|||||||
* Logs the scheduling status of this backup process.
|
* Logs the scheduling status of this backup process.
|
||||||
*/
|
*/
|
||||||
public void displayNextSchedule() {
|
public void displayNextSchedule() {
|
||||||
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " next backup on "
|
Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " next backup on "
|
||||||
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext())));
|
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext())));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -297,7 +297,7 @@ public abstract class BackupProcess implements Comparable<BackupProcess>, Runnab
|
|||||||
public void logProgress() {
|
public void logProgress() {
|
||||||
if (compressor == null)
|
if (compressor == null)
|
||||||
return;
|
return;
|
||||||
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + ": " + compressor.getState().getLegacyText());
|
Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + ": " + compressor.getState().getLegacyText());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@@ -1,8 +1,8 @@
|
|||||||
package fr.pandacube.lib.core.backup;
|
package fr.pandacube.lib.core.backup;
|
||||||
|
|
||||||
import com.google.common.io.Files;
|
import com.google.common.io.Files;
|
||||||
|
import fr.pandacube.lib.chat.LegacyChatFormat;
|
||||||
import fr.pandacube.lib.util.log.Log;
|
import fr.pandacube.lib.util.log.Log;
|
||||||
import net.md_5.bungee.api.ChatColor;
|
|
||||||
|
|
||||||
import java.io.File;
|
import java.io.File;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -53,7 +53,7 @@ public class RotatedLogsBackupProcess extends BackupProcess {
|
|||||||
if (!getSourceDir().isDirectory())
|
if (!getSourceDir().isDirectory())
|
||||||
return;
|
return;
|
||||||
|
|
||||||
Log.info("[Backup] Starting for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " ...");
|
Log.info("[Backup] Starting for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " ...");
|
||||||
|
|
||||||
try {
|
try {
|
||||||
// wait a little after the log message above, in case the log file rotation has to be performed.
|
// wait a little after the log message above, in case the log file rotation has to be performed.
|
||||||
@@ -82,9 +82,9 @@ public class RotatedLogsBackupProcess extends BackupProcess {
|
|||||||
|
|
||||||
success = true;
|
success = true;
|
||||||
|
|
||||||
Log.info("[Backup] Finished for " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET);
|
Log.info("[Backup] Finished for " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET);
|
||||||
} catch (Exception e) {
|
} catch (Exception e) {
|
||||||
Log.severe("[Backup] Failed for : " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET, e);
|
Log.severe("[Backup] Failed for : " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET, e);
|
||||||
} finally {
|
} finally {
|
||||||
onBackupEnd(success);
|
onBackupEnd(success);
|
||||||
|
|
||||||
|
@@ -5,6 +5,7 @@ import java.io.File;
|
|||||||
import java.io.FileOutputStream;
|
import java.io.FileOutputStream;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.nio.file.Files;
|
import java.nio.file.Files;
|
||||||
|
import java.nio.file.NoSuchFileException;
|
||||||
import java.nio.file.attribute.BasicFileAttributes;
|
import java.nio.file.attribute.BasicFileAttributes;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
@@ -117,7 +118,11 @@ public class ZipCompressor {
|
|||||||
}
|
}
|
||||||
|
|
||||||
for (Entry entry : entriesToCompress) {
|
for (Entry entry : entriesToCompress) {
|
||||||
entry.zip();
|
try {
|
||||||
|
entry.zip();
|
||||||
|
} catch (NoSuchFileException ignored) {
|
||||||
|
// file has been deleted since
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
synchronized (stateLock) {
|
synchronized (stateLock) {
|
||||||
|
@@ -3,6 +3,7 @@ package fr.pandacube.lib.core.json;
|
|||||||
import com.google.gson.Gson;
|
import com.google.gson.Gson;
|
||||||
import com.google.gson.GsonBuilder;
|
import com.google.gson.GsonBuilder;
|
||||||
import com.google.gson.JsonParseException;
|
import com.google.gson.JsonParseException;
|
||||||
|
import com.google.gson.Strictness;
|
||||||
import com.google.gson.ToNumberStrategy;
|
import com.google.gson.ToNumberStrategy;
|
||||||
import com.google.gson.TypeAdapter;
|
import com.google.gson.TypeAdapter;
|
||||||
import com.google.gson.TypeAdapterFactory;
|
import com.google.gson.TypeAdapterFactory;
|
||||||
@@ -32,7 +33,7 @@ public class Json {
|
|||||||
boolean isFloat = value.contains(".");
|
boolean isFloat = value.contains(".");
|
||||||
|
|
||||||
if (isFloat) {
|
if (isFloat) {
|
||||||
// if float, will only parse to Double
|
// if is float, will only parse to Double
|
||||||
// (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat)
|
// (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat)
|
||||||
try {
|
try {
|
||||||
Double d = Double.valueOf(value);
|
Double d = Double.valueOf(value);
|
||||||
@@ -74,21 +75,21 @@ public class Json {
|
|||||||
public static final Gson gson = build(Function.identity());
|
public static final Gson gson = build(Function.identity());
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#setPrettyPrinting()} and support
|
* {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#setPrettyPrinting()} and support
|
||||||
* for Java records and additional {@link TypeAdapterFactory} provided with
|
* for Java records and additional {@link TypeAdapterFactory} provided with
|
||||||
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
|
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
|
||||||
*/
|
*/
|
||||||
public static final Gson gsonPrettyPrinting = build(GsonBuilder::setPrettyPrinting);
|
public static final Gson gsonPrettyPrinting = build(GsonBuilder::setPrettyPrinting);
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()} and support for
|
* {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()} and support for
|
||||||
* Java records and additional {@link TypeAdapterFactory} provided with
|
* Java records and additional {@link TypeAdapterFactory} provided with
|
||||||
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
|
* {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
|
||||||
*/
|
*/
|
||||||
public static final Gson gsonSerializeNulls = build(GsonBuilder::serializeNulls);
|
public static final Gson gsonSerializeNulls = build(GsonBuilder::serializeNulls);
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()},
|
* {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()},
|
||||||
* {@link GsonBuilder#setPrettyPrinting()} and support for Java records and additional {@link TypeAdapterFactory}
|
* {@link GsonBuilder#setPrettyPrinting()} and support for Java records and additional {@link TypeAdapterFactory}
|
||||||
* provided with {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
|
* provided with {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
|
||||||
*/
|
*/
|
||||||
@@ -105,7 +106,7 @@ public class Json {
|
|||||||
.registerTypeAdapterFactory(new CustomAdapterFactory())
|
.registerTypeAdapterFactory(new CustomAdapterFactory())
|
||||||
.disableHtmlEscaping()
|
.disableHtmlEscaping()
|
||||||
.setObjectToNumberStrategy(YAML_EQUIVALENT_NUMBER_STRATEGY)
|
.setObjectToNumberStrategy(YAML_EQUIVALENT_NUMBER_STRATEGY)
|
||||||
.setLenient();
|
.setStrictness(Strictness.LENIENT);
|
||||||
return builderModifier.apply(base).create();
|
return builderModifier.apply(base).create();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -134,30 +134,30 @@ public class ThrowableAdapter implements JsonSerializer<Throwable>, JsonDeserial
|
|||||||
}
|
}
|
||||||
|
|
||||||
private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) {
|
private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) {
|
||||||
BiFunction<String, Throwable, T> constructor = null;
|
BiFunction<String, Throwable, T> constructionFunction = null;
|
||||||
|
|
||||||
// try (String, Throwable) constructor
|
// try (String, Throwable) constructor
|
||||||
try {
|
try {
|
||||||
Constructor<T> constr = clazz.getConstructor(String.class, Throwable.class);
|
Constructor<T> constructor = clazz.getConstructor(String.class, Throwable.class);
|
||||||
if (constr.canAccess(null)) {
|
if (constructor.canAccess(null)) {
|
||||||
constructor = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m, t));
|
constructionFunction = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m, t));
|
||||||
}
|
}
|
||||||
} catch (ReflectiveOperationException ignore) { }
|
} catch (ReflectiveOperationException ignore) { }
|
||||||
|
|
||||||
// try (String) constructor
|
// try (String) constructor
|
||||||
try {
|
try {
|
||||||
Constructor<T> constr = clazz.getConstructor(String.class);
|
Constructor<T> constructor = clazz.getConstructor(String.class);
|
||||||
if (constr.canAccess(null)) {
|
if (constructor.canAccess(null)) {
|
||||||
constructor = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m)));
|
constructionFunction = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m)));
|
||||||
}
|
}
|
||||||
} catch (ReflectiveOperationException ignore) { }
|
} catch (ReflectiveOperationException ignore) { }
|
||||||
|
|
||||||
if (constructor == null) {
|
if (constructionFunction == null) {
|
||||||
Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String).");
|
Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String).");
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
|
|
||||||
return new ThrowableSubAdapter<>(constructor);
|
return new ThrowableSubAdapter<>(constructionFunction);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@@ -37,8 +37,8 @@ public class MinecraftVersionUtil {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Decompose a version string into a series of integers.
|
* Decompose a version string into a series of integers.
|
||||||
* @param v a string representation of a version (eg. 1.19.1).
|
* @param v a string representation of a version (e.g. 1.19.1).
|
||||||
* @return an array of int representing the provided version (eg. [1, 19, 1]).
|
* @return an array of int representing the provided version (e.g. [1, 19, 1]).
|
||||||
*/
|
*/
|
||||||
public static int[] decomposedVersion(String v) {
|
public static int[] decomposedVersion(String v) {
|
||||||
try {
|
try {
|
||||||
@@ -114,7 +114,7 @@ public class MinecraftVersionUtil {
|
|||||||
else {
|
else {
|
||||||
// merge
|
// merge
|
||||||
if (i - firstConsecutive > 1)
|
if (i - firstConsecutive > 1)
|
||||||
keptVersions.add(versions.get(firstConsecutive) + "-" + versions.get(i));
|
keptVersions.add(versions.get(firstConsecutive) + " - " + versions.get(i));
|
||||||
else {
|
else {
|
||||||
keptVersions.add(versions.get(firstConsecutive));
|
keptVersions.add(versions.get(firstConsecutive));
|
||||||
keptVersions.add(versions.get(i));
|
keptVersions.add(versions.get(i));
|
||||||
|
@@ -68,12 +68,12 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
|
|||||||
|
|
||||||
private static void init() {
|
private static void init() {
|
||||||
// try online source first
|
// try online source first
|
||||||
try {
|
try (HttpClient cl = HttpClient.newBuilder()
|
||||||
HttpResponse<String> response = HttpClient.newBuilder()
|
.connectTimeout(Duration.ofSeconds(5))
|
||||||
.connectTimeout(Duration.ofSeconds(5))
|
.build()) {
|
||||||
.build()
|
HttpResponse<String> response = cl.send(
|
||||||
.send(HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
|
HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
|
||||||
BodyHandlers.ofString()
|
BodyHandlers.ofString()
|
||||||
);
|
);
|
||||||
if (response.statusCode() == 200) {
|
if (response.statusCode() == 200) {
|
||||||
MinecraftVersionList data = Json.gson.fromJson(response.body(), MinecraftVersionList.class);
|
MinecraftVersionList data = Json.gson.fromJson(response.body(), MinecraftVersionList.class);
|
||||||
@@ -123,7 +123,7 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the {@link ProtocolVersion} associated with the provided Minecraft version.
|
* Gets the {@link ProtocolVersion} associated with the provided Minecraft version.
|
||||||
* @param version The Minecraft version, in the format "X.X[.X]" (eg. "1.17" or "1.8.8").
|
* @param version The Minecraft version, in the format "X.X[.X]" (e.g. "1.17" or "1.8.8").
|
||||||
* @return an instance of {@link ProtocolVersion}.
|
* @return an instance of {@link ProtocolVersion}.
|
||||||
*/
|
*/
|
||||||
public static ProtocolVersion ofVersion(String version) {
|
public static ProtocolVersion ofVersion(String version) {
|
||||||
|
@@ -67,7 +67,15 @@
|
|||||||
"1.20.4": 765,
|
"1.20.4": 765,
|
||||||
"1.20.5": 766,
|
"1.20.5": 766,
|
||||||
"1.20.6": 766,
|
"1.20.6": 766,
|
||||||
"1.21": 767
|
"1.21": 767,
|
||||||
|
"1.21.1": 767,
|
||||||
|
"1.21.2": 768,
|
||||||
|
"1.21.3": 768,
|
||||||
|
"1.21.4": 769,
|
||||||
|
"1.21.5": 770,
|
||||||
|
"1.21.6": 771,
|
||||||
|
"1.21.7": 772,
|
||||||
|
"1.21.8": 772
|
||||||
},
|
},
|
||||||
"versionsOfProtocol": {
|
"versionsOfProtocol": {
|
||||||
"4": [
|
"4": [
|
||||||
@@ -220,7 +228,25 @@
|
|||||||
"1.20.6"
|
"1.20.6"
|
||||||
],
|
],
|
||||||
"767": [
|
"767": [
|
||||||
"1.21"
|
"1.21",
|
||||||
|
"1.21.1"
|
||||||
|
],
|
||||||
|
"768": [
|
||||||
|
"1.21.2",
|
||||||
|
"1.21.3"
|
||||||
|
],
|
||||||
|
"769": [
|
||||||
|
"1.21.4"
|
||||||
|
],
|
||||||
|
"770": [
|
||||||
|
"1.21.5"
|
||||||
|
],
|
||||||
|
"771": [
|
||||||
|
"1.21.6"
|
||||||
|
],
|
||||||
|
"772": [
|
||||||
|
"1.21.7",
|
||||||
|
"1.21.8"
|
||||||
]
|
]
|
||||||
}
|
}
|
||||||
}
|
}
|
@@ -227,7 +227,7 @@ public final class DB {
|
|||||||
*/
|
*/
|
||||||
public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException {
|
public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException {
|
||||||
SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset);
|
SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset);
|
||||||
return (elements.size() == 0) ? null : elements.get(0);
|
return (elements.isEmpty()) ? null : elements.get(0);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@@ -23,7 +23,8 @@ public class DBConnection {
|
|||||||
public DBConnection(String host, int port, String dbname, String login, String password) {
|
public DBConnection(String host, int port, String dbname, String login, String password) {
|
||||||
this("jdbc:mysql://" + host + ":" + port + "/" + dbname
|
this("jdbc:mysql://" + host + ":" + port + "/" + dbname
|
||||||
+ "?useUnicode=true"
|
+ "?useUnicode=true"
|
||||||
+ "&useSSL=false"
|
+ "&sslMode=DISABLED"
|
||||||
|
+ "&allowPublicKeyRetrieval=true"
|
||||||
+ "&characterEncoding=utf8"
|
+ "&characterEncoding=utf8"
|
||||||
+ "&characterSetResults=utf8"
|
+ "&characterSetResults=utf8"
|
||||||
+ "&character_set_server=utf8mb4"
|
+ "&character_set_server=utf8mb4"
|
||||||
|
@@ -42,7 +42,7 @@ public class SQLType<T> {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public boolean equals(Object obj) {
|
public boolean equals(Object obj) {
|
||||||
return obj instanceof SQLType o
|
return obj instanceof SQLType<?> o
|
||||||
&& toString().equals(o.toString());
|
&& toString().equals(o.toString());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -16,7 +16,7 @@
|
|||||||
<repositories>
|
<repositories>
|
||||||
<repository>
|
<repository>
|
||||||
<id>papermc</id>
|
<id>papermc</id>
|
||||||
<url>https://papermc.io/repo/repository/maven-public/</url>
|
<url>https://repo.papermc.io/repository/maven-public/</url>
|
||||||
</repository>
|
</repository>
|
||||||
|
|
||||||
<!-- WorldEdit -->
|
<!-- WorldEdit -->
|
||||||
|
@@ -7,6 +7,7 @@ import net.milkbowl.vault.chat.Chat;
|
|||||||
import net.milkbowl.vault.permission.Permission;
|
import net.milkbowl.vault.permission.Permission;
|
||||||
import org.bukkit.Bukkit;
|
import org.bukkit.Bukkit;
|
||||||
import org.bukkit.OfflinePlayer;
|
import org.bukkit.OfflinePlayer;
|
||||||
|
import org.bukkit.entity.Player;
|
||||||
import org.bukkit.plugin.ServicePriority;
|
import org.bukkit.plugin.ServicePriority;
|
||||||
|
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
@@ -120,6 +121,13 @@ import java.util.List;
|
|||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean playerAdd(Player player, String permission) {
|
||||||
|
// override because the super class sets the permission on the current world of the player, that is probably
|
||||||
|
// not intended by the calling plugin
|
||||||
|
return playerAdd(null, player, permission);
|
||||||
|
}
|
||||||
|
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@Override
|
@Override
|
||||||
public boolean playerRemove(String world, String player, String permission) {
|
public boolean playerRemove(String world, String player, String permission) {
|
||||||
@@ -136,6 +144,14 @@ import java.util.List;
|
|||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean playerRemove(Player player, String permission) {
|
||||||
|
// to stay coherent with the override of #playerAdd(Player, String), we also override this method.
|
||||||
|
// Will try first to remove the permission on the world itself (like super-method), then if it doesn't exist,
|
||||||
|
// removes on the server level.
|
||||||
|
return super.playerRemove(player, permission) || playerRemove(null, player, permission);
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public boolean groupHas(String world, String group, String permission) {
|
public boolean groupHas(String world, String group, String permission) {
|
||||||
checkEnabled();
|
checkEnabled();
|
||||||
|
@@ -16,12 +16,17 @@
|
|||||||
<repositories>
|
<repositories>
|
||||||
<repository>
|
<repository>
|
||||||
<id>papermc</id>
|
<id>papermc</id>
|
||||||
<url>https://papermc.io/repo/repository/maven-public/</url>
|
<url>https://repo.papermc.io/repository/maven-public/</url>
|
||||||
</repository>
|
</repository>
|
||||||
<repository>
|
<repository>
|
||||||
<id>fabricmc</id>
|
<id>fabricmc</id>
|
||||||
<url>https://maven.fabricmc.net/</url>
|
<url>https://maven.fabricmc.net/</url>
|
||||||
</repository>
|
</repository>
|
||||||
|
<repository>
|
||||||
|
<id>minecraft-libraries</id>
|
||||||
|
<name>Minecraft Libraries</name>
|
||||||
|
<url>https://libraries.minecraft.net</url>
|
||||||
|
</repository>
|
||||||
</repositories>
|
</repositories>
|
||||||
|
|
||||||
<dependencies>
|
<dependencies>
|
||||||
@@ -71,6 +76,12 @@
|
|||||||
<version>${project.version}</version>
|
<version>${project.version}</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
|
||||||
|
<dependency>
|
||||||
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
|
<artifactId>pandalib-bungee-chat</artifactId>
|
||||||
|
<version>${project.version}</version>
|
||||||
|
</dependency>
|
||||||
|
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>fr.pandacube.lib</groupId>
|
<groupId>fr.pandacube.lib</groupId>
|
||||||
<artifactId>pandalib-paper-permissions</artifactId>
|
<artifactId>pandalib-paper-permissions</artifactId>
|
||||||
@@ -78,17 +89,18 @@
|
|||||||
<scope>provided</scope>
|
<scope>provided</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
|
||||||
|
<dependency>
|
||||||
|
<groupId>com.mojang</groupId>
|
||||||
|
<artifactId>datafixerupper</artifactId>
|
||||||
|
<version>${datafixerupper.version}</version>
|
||||||
|
</dependency>
|
||||||
|
|
||||||
<!-- Paper -->
|
<!-- Paper -->
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>io.papermc.paper</groupId>
|
<groupId>io.papermc.paper</groupId>
|
||||||
<artifactId>paper-api</artifactId>
|
<artifactId>paper-api</artifactId>
|
||||||
<version>${paper.version}-SNAPSHOT</version>
|
<version>${paper.version}-SNAPSHOT</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
|
||||||
<groupId>io.papermc.paper</groupId>
|
|
||||||
<artifactId>paper-mojangapi</artifactId>
|
|
||||||
<version>${paper.version}-SNAPSHOT</version>
|
|
||||||
</dependency>
|
|
||||||
</dependencies>
|
</dependencies>
|
||||||
|
|
||||||
<build>
|
<build>
|
||||||
|
@@ -5,27 +5,47 @@ import fr.pandacube.lib.paper.json.PaperJson;
|
|||||||
import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager;
|
import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager;
|
||||||
import org.bukkit.plugin.Plugin;
|
import org.bukkit.plugin.Plugin;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Main class for pandalib-paper.
|
||||||
|
*/
|
||||||
public class PandaLibPaper {
|
public class PandaLibPaper {
|
||||||
|
|
||||||
private static Plugin plugin;
|
private static Plugin plugin;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Method to call in plugin's {@link Plugin#onLoad()} method.
|
||||||
|
* @param plugin the plugin instance.
|
||||||
|
*/
|
||||||
public static void onLoad(Plugin plugin) {
|
public static void onLoad(Plugin plugin) {
|
||||||
PandaLibPaper.plugin = plugin;
|
PandaLibPaper.plugin = plugin;
|
||||||
PaperJson.init();
|
PaperJson.init();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Method to call in plugin's {@link Plugin#onEnable()} method.
|
||||||
|
*/
|
||||||
public static void onEnable() {
|
public static void onEnable() {
|
||||||
PerformanceAnalysisManager.getInstance(); // initialize
|
PerformanceAnalysisManager.getInstance(); // initialize
|
||||||
ServerStopEvent.init();
|
ServerStopEvent.init();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Method to call in plugin's {@link Plugin#onDisable()} method.
|
||||||
|
*/
|
||||||
public static void disable() {
|
public static void disable() {
|
||||||
PerformanceAnalysisManager.getInstance().cancelInternalBossBar();
|
PerformanceAnalysisManager.getInstance().deinit();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the plugin instance.
|
||||||
|
* @return the plugin instance provided with {@link #onLoad(Plugin)}.
|
||||||
|
*/
|
||||||
public static Plugin getPlugin() {
|
public static Plugin getPlugin() {
|
||||||
return plugin;
|
return plugin;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private PandaLibPaper() {}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -6,14 +6,65 @@ import java.io.File;
|
|||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A basic class holding configuration for {@link PaperBackupManager}.
|
||||||
|
*/
|
||||||
@SuppressWarnings("CanBeFinal")
|
@SuppressWarnings("CanBeFinal")
|
||||||
public class PaperBackupConfig {
|
public class PaperBackupConfig {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new Paper backup config.
|
||||||
|
*/
|
||||||
|
public PaperBackupConfig() {}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set to true to enable worlds backup.
|
||||||
|
* Defaults to true.
|
||||||
|
*/
|
||||||
public boolean worldBackupEnabled = true;
|
public boolean worldBackupEnabled = true;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set to true to enable the backup of the working directory.
|
||||||
|
* The workdir backup will already ignore the logs directory and any world folder (folder with a level.dat file in it).
|
||||||
|
* Defaults to true.
|
||||||
|
*/
|
||||||
public boolean workdirBackupEnabled = true;
|
public boolean workdirBackupEnabled = true;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set to true to enable the backup of logs.
|
||||||
|
* Defaults to true.
|
||||||
|
*/
|
||||||
public boolean logsBackupEnabled = true;
|
public boolean logsBackupEnabled = true;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The cron-formatted scheduling of the worlds and workdir backups.
|
||||||
|
* The default value is {@code "0 2 * * *"}, that is every day at 2am.
|
||||||
|
*/
|
||||||
public String scheduling = "0 2 * * *"; // cron format, here is every day at 2am
|
public String scheduling = "0 2 * * *"; // cron format, here is every day at 2am
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The backup target directory.
|
||||||
|
* Must be set (defaults to null).
|
||||||
|
*/
|
||||||
public File backupDirectory = null;
|
public File backupDirectory = null;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The backup cleaner for the worlds backup.
|
||||||
|
* Defaults to keep 1 backup every 3 month + the last 5 backups.
|
||||||
|
*/
|
||||||
public BackupCleaner worldBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
|
public BackupCleaner worldBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The backup cleaner for the workdir backup.
|
||||||
|
* Defaults to keep 1 backup every 3 month + the last 5 backups.
|
||||||
|
*/
|
||||||
public BackupCleaner workdirBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
|
public BackupCleaner workdirBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The list of files or directory to ignore.
|
||||||
|
* Defaults to none.
|
||||||
|
* The workdir backup will already ignore the logs directory and any world folder (folder with a level.dat file in it).
|
||||||
|
*/
|
||||||
public List<String> workdirIgnoreList = new ArrayList<>();
|
public List<String> workdirIgnoreList = new ArrayList<>();
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -23,12 +23,19 @@ import java.util.Map;
|
|||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
import java.util.concurrent.CancellationException;
|
import java.util.concurrent.CancellationException;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The backup manager for Paper servers.
|
||||||
|
*/
|
||||||
public class PaperBackupManager extends BackupManager implements Listener {
|
public class PaperBackupManager extends BackupManager implements Listener {
|
||||||
|
|
||||||
private final Map<String, PaperWorldProcess> compressWorlds = new HashMap<>();
|
private final Map<String, PaperWorldProcess> compressWorlds = new HashMap<>();
|
||||||
|
|
||||||
PaperBackupConfig config;
|
PaperBackupConfig config;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Instantiate a new backup manager.
|
||||||
|
* @param config the configuration of the backups.
|
||||||
|
*/
|
||||||
public PaperBackupManager(PaperBackupConfig config) {
|
public PaperBackupManager(PaperBackupConfig config) {
|
||||||
super(config.backupDirectory);
|
super(config.backupDirectory);
|
||||||
setConfig(config);
|
setConfig(config);
|
||||||
@@ -49,13 +56,17 @@ public class PaperBackupManager extends BackupManager implements Listener {
|
|||||||
super.addProcess(process);
|
super.addProcess(process);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates the backups config
|
||||||
|
* @param config the new config.
|
||||||
|
*/
|
||||||
public void setConfig(PaperBackupConfig config) {
|
public void setConfig(PaperBackupConfig config) {
|
||||||
this.config = config;
|
this.config = config;
|
||||||
backupQueue.forEach(this::updateProcessConfig);
|
backupQueue.forEach(this::updateProcessConfig);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
public void updateProcessConfig(BackupProcess process) {
|
private void updateProcessConfig(BackupProcess process) {
|
||||||
if (process instanceof PaperWorkdirProcess) {
|
if (process instanceof PaperWorkdirProcess) {
|
||||||
process.setEnabled(config.workdirBackupEnabled);
|
process.setEnabled(config.workdirBackupEnabled);
|
||||||
process.setBackupCleaner(config.workdirBackupCleaner);
|
process.setBackupCleaner(config.workdirBackupCleaner);
|
||||||
@@ -119,12 +130,12 @@ public class PaperBackupManager extends BackupManager implements Listener {
|
|||||||
private final Set<String> dirtyForSave = new HashSet<>();
|
private final Set<String> dirtyForSave = new HashSet<>();
|
||||||
|
|
||||||
@EventHandler(priority = EventPriority.MONITOR)
|
@EventHandler(priority = EventPriority.MONITOR)
|
||||||
public void onWorldLoad(WorldLoadEvent event) {
|
void onWorldLoad(WorldLoadEvent event) {
|
||||||
initWorldProcess(event.getWorld().getName());
|
initWorldProcess(event.getWorld().getName());
|
||||||
}
|
}
|
||||||
|
|
||||||
@EventHandler(priority = EventPriority.MONITOR)
|
@EventHandler(priority = EventPriority.MONITOR)
|
||||||
public void onWorldSave(WorldSaveEvent event) {
|
void onWorldSave(WorldSaveEvent event) {
|
||||||
if (event.getWorld().getLoadedChunks().length > 0
|
if (event.getWorld().getLoadedChunks().length > 0
|
||||||
|| dirtyForSave.contains(event.getWorld().getName())) {
|
|| dirtyForSave.contains(event.getWorld().getName())) {
|
||||||
compressWorlds.get(event.getWorld().getName()).setDirtyAfterSave();
|
compressWorlds.get(event.getWorld().getName()).setDirtyAfterSave();
|
||||||
@@ -137,18 +148,18 @@ public class PaperBackupManager extends BackupManager implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler(priority = EventPriority.MONITOR)
|
@EventHandler(priority = EventPriority.MONITOR)
|
||||||
public void onPlayerChangeWorldEvent(PlayerChangedWorldEvent event) {
|
void onPlayerChangeWorldEvent(PlayerChangedWorldEvent event) {
|
||||||
dirtyForSave.add(event.getFrom().getName());
|
dirtyForSave.add(event.getFrom().getName());
|
||||||
dirtyForSave.add(event.getPlayer().getWorld().getName());
|
dirtyForSave.add(event.getPlayer().getWorld().getName());
|
||||||
}
|
}
|
||||||
|
|
||||||
@EventHandler(priority = EventPriority.MONITOR)
|
@EventHandler(priority = EventPriority.MONITOR)
|
||||||
public void onPlayerJoin(PlayerJoinEvent event) {
|
void onPlayerJoin(PlayerJoinEvent event) {
|
||||||
dirtyForSave.add(event.getPlayer().getWorld().getName());
|
dirtyForSave.add(event.getPlayer().getWorld().getName());
|
||||||
}
|
}
|
||||||
|
|
||||||
@EventHandler(priority = EventPriority.MONITOR)
|
@EventHandler(priority = EventPriority.MONITOR)
|
||||||
public void onPlayerQuit(PlayerQuitEvent event) {
|
void onPlayerQuit(PlayerQuitEvent event) {
|
||||||
dirtyForSave.add(event.getPlayer().getWorld().getName());
|
dirtyForSave.add(event.getPlayer().getWorld().getName());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -10,11 +10,19 @@ import net.kyori.adventure.bossbar.BossBar.Color;
|
|||||||
import net.kyori.adventure.bossbar.BossBar.Overlay;
|
import net.kyori.adventure.bossbar.BossBar.Overlay;
|
||||||
import org.bukkit.Bukkit;
|
import org.bukkit.Bukkit;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A backup process with specific logic around Paper server.
|
||||||
|
*/
|
||||||
public abstract class PaperBackupProcess extends BackupProcess {
|
public abstract class PaperBackupProcess extends BackupProcess {
|
||||||
|
|
||||||
|
|
||||||
private BossBar bossBar;
|
private BossBar bossBar;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Instantiates a new backup process.
|
||||||
|
* @param bm the associated backup manager.
|
||||||
|
* @param id the process identifier.
|
||||||
|
*/
|
||||||
protected PaperBackupProcess(PaperBackupManager bm, String id) {
|
protected PaperBackupProcess(PaperBackupManager bm, String id) {
|
||||||
super(bm, id);
|
super(bm, id);
|
||||||
}
|
}
|
||||||
|
@@ -3,8 +3,15 @@ package fr.pandacube.lib.paper.backup;
|
|||||||
import java.io.File;
|
import java.io.File;
|
||||||
import java.util.function.BiPredicate;
|
import java.util.function.BiPredicate;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A backup process with specific logic around Paper server working directory.
|
||||||
|
*/
|
||||||
public class PaperWorkdirProcess extends PaperBackupProcess {
|
public class PaperWorkdirProcess extends PaperBackupProcess {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Instantiates a new backup process for the paper server working directory.
|
||||||
|
* @param bm the associated backup manager.
|
||||||
|
*/
|
||||||
protected PaperWorkdirProcess(PaperBackupManager bm) {
|
protected PaperWorkdirProcess(PaperBackupManager bm) {
|
||||||
super(bm, "workdir");
|
super(bm, "workdir");
|
||||||
}
|
}
|
||||||
|
@@ -1,9 +1,9 @@
|
|||||||
package fr.pandacube.lib.paper.backup;
|
package fr.pandacube.lib.paper.backup;
|
||||||
|
|
||||||
|
import fr.pandacube.lib.chat.LegacyChatFormat;
|
||||||
import fr.pandacube.lib.paper.scheduler.SchedulerUtil;
|
import fr.pandacube.lib.paper.scheduler.SchedulerUtil;
|
||||||
import fr.pandacube.lib.paper.world.WorldUtil;
|
import fr.pandacube.lib.paper.world.WorldUtil;
|
||||||
import fr.pandacube.lib.util.log.Log;
|
import fr.pandacube.lib.util.log.Log;
|
||||||
import net.md_5.bungee.api.ChatColor;
|
|
||||||
import org.bukkit.Bukkit;
|
import org.bukkit.Bukkit;
|
||||||
import org.bukkit.World;
|
import org.bukkit.World;
|
||||||
|
|
||||||
@@ -11,14 +11,22 @@ import java.io.File;
|
|||||||
import java.text.DateFormat;
|
import java.text.DateFormat;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A backup process with specific logic around Paper server world.
|
||||||
|
*/
|
||||||
public class PaperWorldProcess extends PaperBackupProcess {
|
public class PaperWorldProcess extends PaperBackupProcess {
|
||||||
private final String worldName;
|
private final String worldName;
|
||||||
|
|
||||||
private boolean autoSave = true;
|
private boolean autoSave = true;
|
||||||
|
|
||||||
protected PaperWorldProcess(PaperBackupManager bm, final String n) {
|
/**
|
||||||
super(bm, "worlds/" + n);
|
* Instantiates a new backup process for a world.
|
||||||
worldName = n;
|
* @param bm the associated backup manager.
|
||||||
|
* @param worldName the name of the world.
|
||||||
|
*/
|
||||||
|
protected PaperWorldProcess(PaperBackupManager bm, final String worldName) {
|
||||||
|
super(bm, "worlds/" + worldName);
|
||||||
|
this.worldName = worldName;
|
||||||
}
|
}
|
||||||
|
|
||||||
private World getWorld() {
|
private World getWorld() {
|
||||||
@@ -62,11 +70,11 @@ public class PaperWorldProcess extends PaperBackupProcess {
|
|||||||
|
|
||||||
public void displayNextSchedule() {
|
public void displayNextSchedule() {
|
||||||
if (hasNextScheduled()) {
|
if (hasNextScheduled()) {
|
||||||
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " is dirty. Next backup on "
|
Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " is dirty. Next backup on "
|
||||||
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext())));
|
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext())));
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " is clean. Next backup not scheduled.");
|
Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " is clean. Next backup not scheduled.");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -80,7 +88,7 @@ public class PaperWorldProcess extends PaperBackupProcess {
|
|||||||
public void setDirtyAfterSave() {
|
public void setDirtyAfterSave() {
|
||||||
if (!isDirty()) { // don't set dirty if it is already
|
if (!isDirty()) { // don't set dirty if it is already
|
||||||
setDirtySinceNow();
|
setDirtySinceNow();
|
||||||
Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " was saved and is now dirty. Next backup on "
|
Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " was saved and is now dirty. Next backup on "
|
||||||
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG)
|
+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG)
|
||||||
.format(new Date(getNext()))
|
.format(new Date(getNext()))
|
||||||
);
|
);
|
||||||
|
@@ -18,11 +18,13 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftVector;
|
|||||||
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
|
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
|
|
||||||
import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
|
import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
|
||||||
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
|
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
|
||||||
import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
|
import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
|
||||||
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
import fr.pandacube.lib.util.log.Log;
|
import fr.pandacube.lib.util.log.Log;
|
||||||
import io.papermc.paper.command.brigadier.CommandSourceStack;
|
import io.papermc.paper.command.brigadier.CommandSourceStack;
|
||||||
import io.papermc.paper.plugin.lifecycle.event.types.LifecycleEvents;
|
import io.papermc.paper.plugin.lifecycle.event.types.LifecycleEvents;
|
||||||
@@ -37,13 +39,13 @@ import org.bukkit.event.Listener;
|
|||||||
import org.bukkit.plugin.Plugin;
|
import org.bukkit.plugin.Plugin;
|
||||||
import org.bukkit.util.Vector;
|
import org.bukkit.util.Vector;
|
||||||
|
|
||||||
|
import java.lang.reflect.InvocationTargetException;
|
||||||
import java.util.HashSet;
|
import java.util.HashSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
import java.util.function.Predicate;
|
import java.util.function.Predicate;
|
||||||
import java.util.stream.Stream;
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.unwrap;
|
|
||||||
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
|
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -54,10 +56,21 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
|
|
||||||
private static CommandDispatcher<CommandSourceStack> vanillaPaperDispatcher = null;
|
private static CommandDispatcher<CommandSourceStack> vanillaPaperDispatcher = null;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the Brigadier dispatcher provided by paper API during {@link LifecycleEvents#COMMANDS}.
|
||||||
|
* <p>
|
||||||
|
* This Dispatcher is not the vanilla one. Instead, Paper implementation wraps the vanilla one to handle proper registration
|
||||||
|
* of commands from plugins.
|
||||||
|
* @return the Brigadier dispatcher.
|
||||||
|
*/
|
||||||
public static CommandDispatcher<CommandSourceStack> getVanillaPaperDispatcher() {
|
public static CommandDispatcher<CommandSourceStack> getVanillaPaperDispatcher() {
|
||||||
return vanillaPaperDispatcher;
|
return vanillaPaperDispatcher;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the root node of the dispatcher from {@link #getVanillaPaperDispatcher()}.
|
||||||
|
* @return the root node, or null if {@link #getVanillaPaperDispatcher()} is also null.
|
||||||
|
*/
|
||||||
public static RootCommandNode<CommandSourceStack> getRootNode() {
|
public static RootCommandNode<CommandSourceStack> getRootNode() {
|
||||||
return vanillaPaperDispatcher == null ? null : vanillaPaperDispatcher.getRoot();
|
return vanillaPaperDispatcher == null ? null : vanillaPaperDispatcher.getRoot();
|
||||||
}
|
}
|
||||||
@@ -65,6 +78,19 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
private static void updateVanillaPaperDispatcher(CommandDispatcher<CommandSourceStack> newDispatcher) {
|
private static void updateVanillaPaperDispatcher(CommandDispatcher<CommandSourceStack> newDispatcher) {
|
||||||
if (vanillaPaperDispatcher == null || newDispatcher != vanillaPaperDispatcher) {
|
if (vanillaPaperDispatcher == null || newDispatcher != vanillaPaperDispatcher) {
|
||||||
vanillaPaperDispatcher = newDispatcher;
|
vanillaPaperDispatcher = newDispatcher;
|
||||||
|
|
||||||
|
// vanillaPaperDispatcher.getRoot() is not the real root but a wrapped root. Trying to map the fake root with the real one to trick the Paper/Brigadier (un)wrapper
|
||||||
|
RootCommandNode<CommandSourceStack> wrappedRoot = vanillaPaperDispatcher.getRoot();
|
||||||
|
ReflectClass<?> apiMirrorRootNodeClass = Reflect.ofClassOfInstance(wrappedRoot);
|
||||||
|
try {
|
||||||
|
RootCommandNode<?> unwrappedRoot = ((CommandDispatcher<?>) apiMirrorRootNodeClass.method("getDispatcher").invoke(wrappedRoot)).getRoot();
|
||||||
|
|
||||||
|
Reflect.ofClass(CommandNode.class).field("unwrappedCached").setValue(wrappedRoot, unwrappedRoot);
|
||||||
|
Reflect.ofClass(CommandNode.class).field("wrappedCached").setValue(unwrappedRoot, wrappedRoot);
|
||||||
|
|
||||||
|
} catch (InvocationTargetException|IllegalAccessException|NoSuchMethodException|NoSuchFieldException e) {
|
||||||
|
Log.severe("Unable to trick the Paper/Brigadier unwrapper to properly handle commands redirecting to root command node.", e);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -113,12 +139,15 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
/**
|
/**
|
||||||
* The command node of this command.
|
* The command node of this command.
|
||||||
*/
|
*/
|
||||||
protected final LiteralCommandNode<CommandSourceStack> commandNode;
|
protected LiteralCommandNode<CommandSourceStack> commandNode;
|
||||||
/**
|
/**
|
||||||
* The command requested aliases.
|
* The command requested aliases.
|
||||||
*/
|
*/
|
||||||
protected final String[] aliases;
|
protected final String[] aliases;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The command description.
|
||||||
|
*/
|
||||||
protected final String description;
|
protected final String description;
|
||||||
|
|
||||||
private final RegistrationPolicy registrationPolicy;
|
private final RegistrationPolicy registrationPolicy;
|
||||||
@@ -134,11 +163,9 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
public PaperBrigadierCommand(Plugin pl, RegistrationPolicy regPolicy) {
|
public PaperBrigadierCommand(Plugin pl, RegistrationPolicy regPolicy) {
|
||||||
plugin = pl;
|
plugin = pl;
|
||||||
registrationPolicy = regPolicy;
|
registrationPolicy = regPolicy;
|
||||||
commandNode = buildCommand().build();
|
|
||||||
String[] aliasesTmp = getAliases();
|
String[] aliasesTmp = getAliases();
|
||||||
aliases = aliasesTmp == null ? new String[0] : aliasesTmp;
|
aliases = aliasesTmp == null ? new String[0] : aliasesTmp;
|
||||||
description = getDescription();
|
description = getDescription();
|
||||||
postBuildCommand(commandNode);
|
|
||||||
register();
|
register();
|
||||||
//try {
|
//try {
|
||||||
// PandalibPaperPermissions.addPermissionMapping("minecraft.command." + commandNode.getLiteral().toLowerCase(), getTargetPermission().toLowerCase());
|
// PandalibPaperPermissions.addPermissionMapping("minecraft.command." + commandNode.getLiteral().toLowerCase(), getTargetPermission().toLowerCase());
|
||||||
@@ -160,12 +187,20 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
plugin.getLifecycleManager().registerEventHandler(LifecycleEvents.COMMANDS, event -> {
|
plugin.getLifecycleManager().registerEventHandler(LifecycleEvents.COMMANDS, event -> {
|
||||||
updateVanillaPaperDispatcher(event.registrar().getDispatcher());
|
updateVanillaPaperDispatcher(event.registrar().getDispatcher());
|
||||||
|
|
||||||
|
commandNode = buildCommand().build();
|
||||||
|
postBuildCommand(commandNode);
|
||||||
|
|
||||||
if (vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()) != null) {
|
if (vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()) != null) {
|
||||||
Log.info("Command /" + commandNode.getName() + " found in the vanilla dispatcher during initial command registration. Replacing it by force.");
|
Log.info("Command /" + commandNode.getName() + " found in the vanilla dispatcher during initial command registration. Replacing it by force.");
|
||||||
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(commandNode.getName()));
|
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(commandNode.getName()));
|
||||||
}
|
}
|
||||||
|
|
||||||
registeredAliases = new HashSet<>(event.registrar().register(commandNode, description, List.of(aliases)));
|
registeredAliases = new HashSet<>(event.registrar().register(commandNode, description, List.of(aliases)));
|
||||||
|
doPostRegistrationFixes();
|
||||||
|
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> registeredNode = wrap(vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()), fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
|
||||||
|
|
||||||
|
|
||||||
if (registrationPolicy == RegistrationPolicy.ALL) {
|
if (registrationPolicy == RegistrationPolicy.ALL) {
|
||||||
// enforce registration of aliases
|
// enforce registration of aliases
|
||||||
@@ -177,40 +212,86 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
});
|
|
||||||
|
|
||||||
Bukkit.getServer().getScheduler().runTask(plugin, () -> {
|
Bukkit.getServer().getScheduler().runTask(plugin, () -> {
|
||||||
if (vanillaPaperDispatcher == null)
|
if (vanillaPaperDispatcher == null)
|
||||||
return;
|
return;
|
||||||
|
|
||||||
Set<String> forceRegistrationAgain = new HashSet<>();
|
Set<String> forceRegistrationAgain = new HashSet<>();
|
||||||
forceRegistrationAgain.add(commandNode.getName());
|
forceRegistrationAgain.add(commandNode.getName());
|
||||||
if (registrationPolicy == RegistrationPolicy.ALL)
|
if (registrationPolicy == RegistrationPolicy.ALL)
|
||||||
forceRegistrationAgain.addAll(List.of(aliases));
|
forceRegistrationAgain.addAll(List.of(aliases));
|
||||||
|
|
||||||
for (String aliasToForce : forceRegistrationAgain) {
|
for (String aliasToForce : forceRegistrationAgain) {
|
||||||
CommandNode<CommandSourceStack> actualNode = vanillaPaperDispatcher.getRoot().getChild(aliasToForce);
|
CommandNode<CommandSourceStack> actualNode = vanillaPaperDispatcher.getRoot().getChild(aliasToForce);
|
||||||
if (actualNode != null) {
|
@SuppressWarnings("unchecked")
|
||||||
//Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode) + "?");
|
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(actualNode, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
|
||||||
if (PluginCommandNode.REFLECT.get().isInstance(actualNode)) {
|
if (actualNode != null) {
|
||||||
PluginCommandNode pcn = wrap(actualNode, PluginCommandNode.class);
|
if (wrappedCommandNode.apiCommandMeta() != null) {
|
||||||
if (pcn.getPlugin().equals(plugin))
|
APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
|
||||||
return;
|
if (meta.plugin().equals(plugin))
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
else if (BukkitCommandNode.REFLECT.get().isInstance(actualNode)) {
|
||||||
|
BukkitCommandNode bcn = wrap(actualNode, BukkitCommandNode.class);
|
||||||
|
if (bcn.getBukkitCommand() instanceof PluginCommand pc && pc.getPlugin().equals(plugin))
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
Log.warning("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode));
|
||||||
|
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(aliasToForce));
|
||||||
}
|
}
|
||||||
else if (BukkitCommandNode.REFLECT.get().isInstance(actualNode)) {
|
/*else {
|
||||||
BukkitCommandNode bcn = wrap(actualNode, BukkitCommandNode.class);
|
Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
|
||||||
if (bcn.getBukkitCommand() instanceof PluginCommand pc && pc.getPlugin().equals(plugin))
|
}*/
|
||||||
return;
|
LiteralCommandNode<CommandSourceStack> newPCN = getAliasNode(commandNode, aliasToForce);
|
||||||
}
|
@SuppressWarnings("unchecked")
|
||||||
vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(aliasToForce));
|
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedNewPCN = wrap(newPCN, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
|
||||||
|
wrappedNewPCN.apiCommandMeta(registeredNode.apiCommandMeta());
|
||||||
|
vanillaPaperDispatcher.getRoot().addChild(newPCN);
|
||||||
}
|
}
|
||||||
/*else {
|
});
|
||||||
Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
|
|
||||||
}*/
|
|
||||||
LiteralCommandNode<CommandSourceStack> newPCN = unwrap(new PluginCommandNode(aliasToForce, plugin.getPluginMeta(), commandNode, description));
|
|
||||||
vanillaPaperDispatcher.getRoot().addChild(newPCN);
|
|
||||||
}
|
|
||||||
});
|
});
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
private void doPostRegistrationFixes() {
|
||||||
|
postRegistrationFixNode(new HashSet<>(), commandNode);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void postRegistrationFixNode(Set<CommandNode<CommandSourceStack>> fixedNodes, CommandNode<CommandSourceStack> originalNode) {
|
||||||
|
if (originalNode instanceof RootCommandNode)
|
||||||
|
return;
|
||||||
|
if (fixedNodes.contains(originalNode))
|
||||||
|
return;
|
||||||
|
fixedNodes.add(originalNode);
|
||||||
|
if (originalNode.getRedirect() != null) {
|
||||||
|
try {
|
||||||
|
@SuppressWarnings("rawtypes")
|
||||||
|
ReflectClass<CommandNode> cmdNodeClass = Reflect.ofClass(CommandNode.class);
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
CommandNode<CommandSourceStack> unwrappedNode = (CommandNode<CommandSourceStack>) cmdNodeClass.field("unwrappedCached").getValue(originalNode);
|
||||||
|
if (unwrappedNode != null) {
|
||||||
|
cmdNodeClass.field("modifier").setValue(unwrappedNode, cmdNodeClass.field("modifier").getValue(originalNode));
|
||||||
|
cmdNodeClass.field("forks").setValue(unwrappedNode, cmdNodeClass.field("forks").getValue(originalNode));
|
||||||
|
}
|
||||||
|
} catch (IllegalAccessException | NoSuchFieldException e) {
|
||||||
|
throw new RuntimeException(e);
|
||||||
|
}
|
||||||
|
|
||||||
|
postRegistrationFixNode(fixedNodes, originalNode.getRedirect());
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
try {
|
||||||
|
for (CommandNode<CommandSourceStack> child : originalNode.getChildren())
|
||||||
|
postRegistrationFixNode(fixedNodes, child);
|
||||||
|
} catch (UnsupportedOperationException ignored) {
|
||||||
|
// in case getChildren is not possible (vanilla commands are wrapped by Paper API)
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -223,11 +304,8 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
}
|
}
|
||||||
|
|
||||||
private static String getCommandIdentity(CommandNode<CommandSourceStack> command) {
|
private static String getCommandIdentity(CommandNode<CommandSourceStack> command) {
|
||||||
if (PluginCommandNode.REFLECT.get().isInstance(command)) {
|
|
||||||
PluginCommandNode wrappedPCN = wrap(command, PluginCommandNode.class);
|
if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
|
||||||
return "Node /" + command.getName() + " from plugin " + wrappedPCN.getPlugin().getName();
|
|
||||||
}
|
|
||||||
else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
|
|
||||||
BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
|
BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
|
||||||
Command bukkitCmd = wrappedBCN.getBukkitCommand();
|
Command bukkitCmd = wrappedBCN.getBukkitCommand();
|
||||||
if (bukkitCmd instanceof PluginCommand cmd) {
|
if (bukkitCmd instanceof PluginCommand cmd) {
|
||||||
@@ -245,16 +323,22 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
return "Node /" + command.getName() + " wrapping " + bukkitCmd.getClass().getName() + " /" + bukkitCmd.getName();
|
return "Node /" + command.getName() + " wrapping " + bukkitCmd.getClass().getName() + " /" + bukkitCmd.getName();
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return "Node /" + command.getName() + " (unspecific)";
|
@SuppressWarnings("unchecked")
|
||||||
|
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
|
||||||
|
|
||||||
|
if (wrappedCommandNode.apiCommandMeta() != null) {
|
||||||
|
APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
|
||||||
|
return "Node /" + command.getName() + " from plugin " + meta.plugin().getName();
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
return "Node /" + command.getName() + " (unspecific)";
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
private static Boolean isPluginCommand(CommandNode<CommandSourceStack> command) {
|
private static Boolean isPluginCommand(CommandNode<CommandSourceStack> command) {
|
||||||
if (PluginCommandNode.REFLECT.get().isInstance(command)) {
|
if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
|
||||||
return true;
|
|
||||||
}
|
|
||||||
else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
|
|
||||||
BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
|
BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
|
||||||
Command bukkitCmd = wrappedBCN.getBukkitCommand();
|
Command bukkitCmd = wrappedBCN.getBukkitCommand();
|
||||||
if (bukkitCmd instanceof PluginCommand) {
|
if (bukkitCmd instanceof PluginCommand) {
|
||||||
@@ -272,10 +356,16 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return false;
|
@SuppressWarnings("unchecked")
|
||||||
|
fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
|
||||||
|
return wrappedCommandNode.apiCommandMeta() != null;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the aliases that are actually registered in the server.
|
||||||
|
* @return the actually registered aliases.
|
||||||
|
*/
|
||||||
protected Set<String> getRegisteredAliases() {
|
protected Set<String> getRegisteredAliases() {
|
||||||
return Set.copyOf(registeredAliases);
|
return Set.copyOf(registeredAliases);
|
||||||
}
|
}
|
||||||
@@ -322,12 +412,15 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@Override
|
||||||
public boolean isConsole(CommandSourceStack wrapper) {
|
public boolean isConsole(CommandSourceStack wrapper) {
|
||||||
return isConsole(getCommandSender(wrapper));
|
return isConsole(getCommandSender(wrapper));
|
||||||
}
|
}
|
||||||
|
@Override
|
||||||
public boolean isPlayer(CommandSourceStack wrapper) {
|
public boolean isPlayer(CommandSourceStack wrapper) {
|
||||||
return isPlayer(getCommandSender(wrapper));
|
return isPlayer(getCommandSender(wrapper));
|
||||||
}
|
}
|
||||||
|
@Override
|
||||||
public Predicate<CommandSourceStack> hasPermission(String permission) {
|
public Predicate<CommandSourceStack> hasPermission(String permission) {
|
||||||
return wrapper -> getCommandSender(wrapper).hasPermission(permission);
|
return wrapper -> getCommandSender(wrapper).hasPermission(permission);
|
||||||
}
|
}
|
||||||
|
@@ -10,28 +10,38 @@ import org.bukkit.event.server.PluginDisableEvent;
|
|||||||
import org.bukkit.event.server.ServerEvent;
|
import org.bukkit.event.server.ServerEvent;
|
||||||
import org.jetbrains.annotations.NotNull;
|
import org.jetbrains.annotations.NotNull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Fired at the beginning of the server stop process.
|
||||||
|
* More specifically, this event is called when the first plugin is disabling ({@link PluginDisableEvent}) while
|
||||||
|
* {@link Bukkit#isStopping()} returns true.
|
||||||
|
* <p>
|
||||||
|
* This event can be useful when a plugin want to execute stuff on server stop as soon as possible in the process,
|
||||||
|
* but not when the plugin itself is disabling (because some part of the Bukkit API is not usable at that moment).
|
||||||
|
*/
|
||||||
public class ServerStopEvent extends ServerEvent {
|
public class ServerStopEvent extends ServerEvent {
|
||||||
|
|
||||||
|
|
||||||
private static final HandlerList handlers = new HandlerList();
|
private static final HandlerList handlers = new HandlerList();
|
||||||
|
|
||||||
@NotNull
|
/**
|
||||||
@Override
|
* Gets the handler list of the event.
|
||||||
public HandlerList getHandlers() {
|
* @return the handler list of the event.
|
||||||
return handlers;
|
*/
|
||||||
}
|
|
||||||
|
|
||||||
@NotNull
|
@NotNull
|
||||||
public static HandlerList getHandlerList() {
|
public static HandlerList getHandlerList() {
|
||||||
return handlers;
|
return handlers;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
private static boolean hasTriggered = false;
|
private static boolean hasTriggered = false;
|
||||||
|
private static boolean isInit = false;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Register the event used to detect the server stop.
|
||||||
|
*/
|
||||||
public static void init() {
|
public static void init() {
|
||||||
|
if (isInit)
|
||||||
|
return;
|
||||||
|
|
||||||
BukkitEvent.register(new Listener() {
|
BukkitEvent.register(new Listener() {
|
||||||
|
|
||||||
@EventHandler(priority = EventPriority.LOWEST)
|
@EventHandler(priority = EventPriority.LOWEST)
|
||||||
@@ -45,7 +55,25 @@ public class ServerStopEvent extends ServerEvent {
|
|||||||
}
|
}
|
||||||
|
|
||||||
});
|
});
|
||||||
|
|
||||||
|
isInit = true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
private ServerStopEvent() {}
|
||||||
|
|
||||||
|
|
||||||
|
@NotNull
|
||||||
|
@Override
|
||||||
|
public HandlerList getHandlers() {
|
||||||
|
return handlers;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -63,6 +63,7 @@ public class DirectionalVector {
|
|||||||
* contained in the provided {@link Location}.
|
* contained in the provided {@link Location}.
|
||||||
* {@link Location#getYaw()} and {@link Location#getPitch()} values are automatically
|
* {@link Location#getYaw()} and {@link Location#getPitch()} values are automatically
|
||||||
* converted to conform {@link #yaw} and {@link #pitch} specification.
|
* converted to conform {@link #yaw} and {@link #pitch} specification.
|
||||||
|
* @param l the location.
|
||||||
*/
|
*/
|
||||||
public DirectionalVector(Location l) {
|
public DirectionalVector(Location l) {
|
||||||
this(
|
this(
|
||||||
@@ -79,6 +80,7 @@ public class DirectionalVector {
|
|||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
* Creates a new {@link DirectionalVector} from a simple {@link Vector}.
|
||||||
* @param v the vector representing the direction. If v.getX() and v.getZ() are 0,
|
* @param v the vector representing the direction. If v.getX() and v.getZ() are 0,
|
||||||
* the yaw will be 0. This may have inconsistency if the vector is calculated
|
* the yaw will be 0. This may have inconsistency if the vector is calculated
|
||||||
* from a {@link Location}'s yaw and pitch. In this case, prefer using
|
* from a {@link Location}'s yaw and pitch. In this case, prefer using
|
||||||
@@ -126,7 +128,10 @@ public class DirectionalVector {
|
|||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a Vector using the internal X, Y and Z values, that is a simple directional 3D vector.
|
||||||
|
* @return this vector as a simple 3D {@link Vector}.
|
||||||
|
*/
|
||||||
public Vector toVector() {
|
public Vector toVector() {
|
||||||
return new Vector(x, y, z);
|
return new Vector(x, y, z);
|
||||||
}
|
}
|
||||||
@@ -135,7 +140,8 @@ public class DirectionalVector {
|
|||||||
/**
|
/**
|
||||||
* Set the yaw and the pitch of the provided {@link Location}
|
* Set the yaw and the pitch of the provided {@link Location}
|
||||||
* with the values inside the current {@link DirectionalVector}
|
* with the values inside the current {@link DirectionalVector}
|
||||||
* after conversion of these values
|
* after conversion of these values.
|
||||||
|
* @param l the location.
|
||||||
*/
|
*/
|
||||||
public void putIntoLocation(Location l) {
|
public void putIntoLocation(Location l) {
|
||||||
/* std : -PI/2 : <0 ? +2PI : MC
|
/* std : -PI/2 : <0 ? +2PI : MC
|
||||||
@@ -148,7 +154,10 @@ public class DirectionalVector {
|
|||||||
l.setPitch((float) Math.toDegrees(-pitch));
|
l.setPitch((float) Math.toDegrees(-pitch));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the vector pointing to the opposite direction.
|
||||||
|
* @return the opposite vector.
|
||||||
|
*/
|
||||||
public DirectionalVector getOpposite() {
|
public DirectionalVector getOpposite() {
|
||||||
return new DirectionalVector(
|
return new DirectionalVector(
|
||||||
-x,
|
-x,
|
||||||
@@ -163,6 +172,7 @@ public class DirectionalVector {
|
|||||||
* If the current direction is the player face direction,
|
* If the current direction is the player face direction,
|
||||||
* this method return the direction of the back of the head.
|
* this method return the direction of the back of the head.
|
||||||
* This is an alias of {@link #getOpposite()}
|
* This is an alias of {@link #getOpposite()}
|
||||||
|
* @return the opposite of this vector.
|
||||||
*/
|
*/
|
||||||
public DirectionalVector getBackDirection() {
|
public DirectionalVector getBackDirection() {
|
||||||
return getOpposite();
|
return getOpposite();
|
||||||
@@ -171,6 +181,7 @@ public class DirectionalVector {
|
|||||||
/**
|
/**
|
||||||
* If the current direction is the player face direction,
|
* If the current direction is the player face direction,
|
||||||
* this method return the direction of the bottom of the head.
|
* this method return the direction of the bottom of the head.
|
||||||
|
* @return the vector pointing on the bottom, as if this vector was the front orientation of a player head.
|
||||||
*/
|
*/
|
||||||
public DirectionalVector getBottomDirection() {
|
public DirectionalVector getBottomDirection() {
|
||||||
return new DirectionalVector(
|
return new DirectionalVector(
|
||||||
@@ -182,6 +193,7 @@ public class DirectionalVector {
|
|||||||
/**
|
/**
|
||||||
* If the current direction is the player face direction,
|
* If the current direction is the player face direction,
|
||||||
* this method return the direction of the top of the head.
|
* this method return the direction of the top of the head.
|
||||||
|
* @return the vector pointing on the top, as if this vector was the front orientation of a player head.
|
||||||
*/
|
*/
|
||||||
public DirectionalVector getTopDirection() {
|
public DirectionalVector getTopDirection() {
|
||||||
return new DirectionalVector(
|
return new DirectionalVector(
|
||||||
@@ -194,6 +206,7 @@ public class DirectionalVector {
|
|||||||
/**
|
/**
|
||||||
* If the current direction is the player face direction,
|
* If the current direction is the player face direction,
|
||||||
* this method return the direction of the left of the head.
|
* this method return the direction of the left of the head.
|
||||||
|
* @return the vector pointing on the left, as if this vector was the front orientation of a player head.
|
||||||
*/
|
*/
|
||||||
public DirectionalVector getLeftDirection() {
|
public DirectionalVector getLeftDirection() {
|
||||||
return new DirectionalVector(
|
return new DirectionalVector(
|
||||||
@@ -206,6 +219,7 @@ public class DirectionalVector {
|
|||||||
/**
|
/**
|
||||||
* If the current direction is the player face direction,
|
* If the current direction is the player face direction,
|
||||||
* this method return the direction of the right of the head.
|
* this method return the direction of the right of the head.
|
||||||
|
* @return the vector pointing on the right, as if this vector was the front orientation of a player head.
|
||||||
*/
|
*/
|
||||||
public DirectionalVector getRightDirection() {
|
public DirectionalVector getRightDirection() {
|
||||||
return new DirectionalVector(
|
return new DirectionalVector(
|
||||||
|
@@ -2,24 +2,29 @@ package fr.pandacube.lib.paper.geometry;
|
|||||||
|
|
||||||
import org.bukkit.Location;
|
import org.bukkit.Location;
|
||||||
import org.bukkit.entity.Player;
|
import org.bukkit.entity.Player;
|
||||||
|
import org.bukkit.util.BoundingBox;
|
||||||
|
import org.bukkit.util.RayTraceResult;
|
||||||
import org.bukkit.util.Vector;
|
import org.bukkit.util.Vector;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Utility class related to geometry and Minecraft.
|
||||||
|
*/
|
||||||
public class GeometryUtil {
|
public class GeometryUtil {
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Value equal to <code>{@link Math#PI}</code>.
|
* Value equal to <code>{@link Math#PI}</code>.
|
||||||
*/
|
*/
|
||||||
public static final double PI = Math.PI;
|
static final double PI = Math.PI;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Value equal to <code>{@link Math#PI} / 2</code>.
|
* Value equal to <code>{@link Math#PI} / 2</code>.
|
||||||
*/
|
*/
|
||||||
public static final double PId2 = PI/2;
|
static final double PId2 = PI/2;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Value equal to <code>{@link Math#PI} * 2</code>.
|
* Value equal to <code>{@link Math#PI} * 2</code>.
|
||||||
*/
|
*/
|
||||||
public static final double PIx2 = PI*2;
|
static final double PIx2 = PI*2;
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
@@ -55,9 +60,21 @@ public class GeometryUtil {
|
|||||||
* Value provided by net.minecraft.world.entity.player.Player#getStandingEyeHeight
|
* Value provided by net.minecraft.world.entity.player.Player#getStandingEyeHeight
|
||||||
*/
|
*/
|
||||||
public static final double PLAYER_EYE_HEIGHT_SNEAK = 1.27;
|
public static final double PLAYER_EYE_HEIGHT_SNEAK = 1.27;
|
||||||
|
/**
|
||||||
|
* The size of a skin pixel.
|
||||||
|
*/
|
||||||
public static final double PLAYER_SKIN_PIXEL_SIZE = PLAYER_SKIN_HEIGHT / 32;
|
public static final double PLAYER_SKIN_PIXEL_SIZE = PLAYER_SKIN_HEIGHT / 32;
|
||||||
|
/**
|
||||||
|
* The height of the center of rotation of the head, that is the distance between neck and the player's foot.
|
||||||
|
*/
|
||||||
public static final double PLAYER_HEAD_ROTATION_HEIGHT = PLAYER_SKIN_PIXEL_SIZE * 24;
|
public static final double PLAYER_HEAD_ROTATION_HEIGHT = PLAYER_SKIN_PIXEL_SIZE * 24;
|
||||||
|
/**
|
||||||
|
* The height of the center of rotation of the head, that is the distance between neck and the player's foot, but when the player is sneaking.
|
||||||
|
*/
|
||||||
public static final double PLAYER_HEAD_ROTATION_HEIGHT_SNEAK = PLAYER_HEAD_ROTATION_HEIGHT - (PLAYER_SKIN_HEIGHT - PLAYER_SKIN_HEIGHT_SNEAK);
|
public static final double PLAYER_HEAD_ROTATION_HEIGHT_SNEAK = PLAYER_HEAD_ROTATION_HEIGHT - (PLAYER_SKIN_HEIGHT - PLAYER_SKIN_HEIGHT_SNEAK);
|
||||||
|
/**
|
||||||
|
* The size of the first layer of the players head.
|
||||||
|
*/
|
||||||
public static final double PLAYER_HEAD_SIZE = PLAYER_SKIN_PIXEL_SIZE * 8;
|
public static final double PLAYER_HEAD_SIZE = PLAYER_SKIN_PIXEL_SIZE * 8;
|
||||||
|
|
||||||
|
|
||||||
@@ -72,11 +89,10 @@ public class GeometryUtil {
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Get the {@link Location}s of the 8 vertex of the player head<br/>
|
* Get the {@link Location}s of the 8 vertex of the player head<br/>
|
||||||
* This method only work if the player is standing up
|
* This method only work if the player is standing up
|
||||||
* (not dead, not gliding, not sleeping).
|
* (not dead, not gliding, not sleeping, not swimming).
|
||||||
* @param playerLocation the location of the player, generally provided by {@link Player#getLocation()}
|
* @param playerLocation the location of the player, generally provided by {@link Player#getLocation()}
|
||||||
* @param isSneaking if the player is sneaking. Generally {@link Player#isSneaking()}
|
* @param isSneaking if the player is sneaking. Generally {@link Player#isSneaking()}
|
||||||
* @return an array of 8 {@link Location}s with x, y, and z values filled (yaw and pitch are ignored).
|
* @return an array of 8 {@link Location}s with x, y, and z values filled (yaw and pitch are ignored).
|
||||||
@@ -129,27 +145,22 @@ public class GeometryUtil {
|
|||||||
/**
|
/**
|
||||||
* Check if the path from <i>start</i> location to <i>end</i> pass through
|
* Check if the path from <i>start</i> location to <i>end</i> pass through
|
||||||
* the axis aligned bounding box defined by <i>min</i> and <i>max</i>.
|
* the axis aligned bounding box defined by <i>min</i> and <i>max</i>.
|
||||||
|
* @param start the start of the path.
|
||||||
|
* @param end the end of the path.
|
||||||
|
* @param min the min of the bounding box.
|
||||||
|
* @param max the max of the bounding box.
|
||||||
|
* @return true if the path intersects the bounding box.
|
||||||
|
* @deprecated use {@link BoundingBox#rayTrace(Vector, Vector, double)} instead.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public static boolean hasIntersection(Vector start, Vector end, Vector min, Vector max) {
|
public static boolean hasIntersection(Vector start, Vector end, Vector min, Vector max) {
|
||||||
final double epsilon = 0.0001f;
|
RayTraceResult res = BoundingBox.of(min, max).rayTrace(start, end.clone().subtract(start), end.distance(start));
|
||||||
|
return res != null;
|
||||||
Vector d = end.clone().subtract(start).multiply(0.5);
|
|
||||||
Vector e = max.clone().subtract(min).multiply(0.5);
|
|
||||||
Vector c = start.clone().add(d).subtract(min.clone().add(max).multiply(0.5));
|
|
||||||
Vector ad = d.clone();
|
|
||||||
ad.setX(Math.abs(ad.getX()));
|
|
||||||
ad.setY(Math.abs(ad.getY()));
|
|
||||||
ad.setZ(Math.abs(ad.getZ()));
|
|
||||||
|
|
||||||
return !(
|
|
||||||
Math.abs(c.getX()) > e.getX() + ad.getX()
|
|
||||||
|| Math.abs(c.getY()) > e.getY() + ad.getY()
|
|
||||||
|| Math.abs(c.getZ()) > e.getX() + ad.getZ()
|
|
||||||
|| Math.abs(d.getY() * c.getZ() - d.getZ() * c.getY()) > e.getY() * ad.getZ() + e.getZ() * ad.getY() + epsilon
|
|
||||||
|| Math.abs(d.getZ() * c.getX() - d.getX() * c.getZ()) > e.getZ() * ad.getX() + e.getX() * ad.getZ() + epsilon
|
|
||||||
|| Math.abs(d.getX() * c.getY() - d.getY() * c.getX()) > e.getX() * ad.getY() + e.getY() * ad.getX() + epsilon
|
|
||||||
);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
private GeometryUtil() {}
|
||||||
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -2,11 +2,10 @@ package fr.pandacube.lib.paper.geometry.blocks;
|
|||||||
|
|
||||||
import fr.pandacube.lib.util.RandomUtil;
|
import fr.pandacube.lib.util.RandomUtil;
|
||||||
import org.bukkit.Location;
|
import org.bukkit.Location;
|
||||||
import org.bukkit.World;
|
|
||||||
import org.bukkit.block.Block;
|
|
||||||
import org.bukkit.util.BlockVector;
|
import org.bukkit.util.BlockVector;
|
||||||
import org.bukkit.util.BoundingBox;
|
import org.bukkit.util.BoundingBox;
|
||||||
import org.bukkit.util.Vector;
|
import org.bukkit.util.Vector;
|
||||||
|
import org.jetbrains.annotations.NotNull;
|
||||||
|
|
||||||
import java.util.Iterator;
|
import java.util.Iterator;
|
||||||
|
|
||||||
@@ -30,10 +29,19 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
volume = original.volume;
|
volume = original.volume;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Construct a {@link AABBBlock} based on the two provided Bukkit's {@link Vector}.
|
||||||
|
* @param p1 the first vector.
|
||||||
|
* @param p2 the second vector.
|
||||||
|
*/
|
||||||
public AABBBlock(Vector p1, Vector p2) {
|
public AABBBlock(Vector p1, Vector p2) {
|
||||||
this(p1.getBlockX(), p1.getBlockY(), p1.getBlockZ(), p2.getBlockX(), p2.getBlockY(), p2.getBlockZ());
|
this(p1.getBlockX(), p1.getBlockY(), p1.getBlockZ(), p2.getBlockX(), p2.getBlockY(), p2.getBlockZ());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Construct a {@link AABBBlock} based on the provided Bukkit's {@link BoundingBox}.
|
||||||
|
* @param bb the bounding box.
|
||||||
|
*/
|
||||||
public AABBBlock(BoundingBox bb) {
|
public AABBBlock(BoundingBox bb) {
|
||||||
pos1 = bb.getMin();
|
pos1 = bb.getMin();
|
||||||
pos2 = bb.getMax();
|
pos2 = bb.getMax();
|
||||||
@@ -42,14 +50,34 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
bukkitBoundingBox = bb;
|
bukkitBoundingBox = bb;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Construct a {@link AABBBlock} based on the two provided Bukkit's {@link Location}.
|
||||||
|
* The worlds defined in the provided locations are ignored.
|
||||||
|
* @param l1 the first location.
|
||||||
|
* @param l2 the second location.
|
||||||
|
*/
|
||||||
public AABBBlock(Location l1, Location l2) {
|
public AABBBlock(Location l1, Location l2) {
|
||||||
this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
|
this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Construct a {@link AABBBlock} based on the two provided Bukkit's {@link BlockVector}.
|
||||||
|
* @param l1 the first block vector.
|
||||||
|
* @param l2 the second block vector.
|
||||||
|
*/
|
||||||
public AABBBlock(BlockVector l1, BlockVector l2) {
|
public AABBBlock(BlockVector l1, BlockVector l2) {
|
||||||
this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
|
this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Construct a {@link AABBBlock} based on the individual coordinates of the 2 vectors.
|
||||||
|
* @param p1x the x value of the first vector.
|
||||||
|
* @param p1y the y value of the first vector.
|
||||||
|
* @param p1z the z value of the first vector.
|
||||||
|
* @param p2x the x value of the second vector.
|
||||||
|
* @param p2y the y value of the second vector.
|
||||||
|
* @param p2z the z value of the second vector.
|
||||||
|
*/
|
||||||
public AABBBlock(int p1x, int p1y, int p1z, int p2x, int p2y, int p2z) {
|
public AABBBlock(int p1x, int p1y, int p1z, int p2x, int p2y, int p2z) {
|
||||||
/*
|
/*
|
||||||
* Prends les points extérieurs permettant de former un bounding box englobant
|
* Prends les points extérieurs permettant de former un bounding box englobant
|
||||||
@@ -74,22 +102,45 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the value of the "minimum" {@link Vector}, that is the vector with the lowest coordinates that is inside this bounding box.
|
||||||
|
* @return the minimum vector.
|
||||||
|
*/
|
||||||
public Vector getMin() {
|
public Vector getMin() {
|
||||||
return pos1.clone();
|
return pos1.clone();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the value of the "maximum" {@link Vector}, that is the vector with the highest coordinates that is inside this bounding box.
|
||||||
|
* @return the maximum vector.
|
||||||
|
*/
|
||||||
public Vector getMax() {
|
public Vector getMax() {
|
||||||
return pos2.clone();
|
return pos2.clone();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the {@link BlockVector} with the lowest coordinates in this bounding box.
|
||||||
|
* @return the minimum block vector.
|
||||||
|
*/
|
||||||
public BlockVector getMinBlock() {
|
public BlockVector getMinBlock() {
|
||||||
return pos1.toBlockVector();
|
return pos1.toBlockVector();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the {@link BlockVector} with the highest coordinates in this bounding box.
|
||||||
|
* @return the maximum block vector.
|
||||||
|
*/
|
||||||
public BlockVector getMaxBlock() {
|
public BlockVector getMaxBlock() {
|
||||||
return pos2.clone().add(new Vector(-1, -1, -1)).toBlockVector();
|
return pos2.clone().add(new Vector(-1, -1, -1)).toBlockVector();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a new {@link AABBBlock} with its coordinates shifted by the provided amount.
|
||||||
|
* @param x the x shift.
|
||||||
|
* @param y the y shift.
|
||||||
|
* @param z the z shift.
|
||||||
|
* @return a shifted bounding box.
|
||||||
|
*/
|
||||||
public AABBBlock shift(int x, int y, int z) {
|
public AABBBlock shift(int x, int y, int z) {
|
||||||
return new AABBBlock(this, x, y, z);
|
return new AABBBlock(this, x, y, z);
|
||||||
}
|
}
|
||||||
@@ -101,7 +152,6 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
public boolean overlaps(BoundingBox bb) {
|
public boolean overlaps(BoundingBox bb) {
|
||||||
return asBukkitBoundingBox().overlaps(bb);
|
return asBukkitBoundingBox().overlaps(bb);
|
||||||
}
|
}
|
||||||
@@ -110,6 +160,10 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
return asBukkitBoundingBox().contains(v);
|
return asBukkitBoundingBox().contains(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the coordinate of the center of this bounding box.
|
||||||
|
* @return the center of this bounding box.
|
||||||
|
*/
|
||||||
public Vector getCenter() {
|
public Vector getCenter() {
|
||||||
return center.clone();
|
return center.clone();
|
||||||
}
|
}
|
||||||
@@ -118,6 +172,10 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
return volume;
|
return volume;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the Bukkit equivalent of this bounding box.
|
||||||
|
* @return a {@link BoundingBox} corresponding to this {@link AABBBlock}.
|
||||||
|
*/
|
||||||
public BoundingBox asBukkitBoundingBox() {
|
public BoundingBox asBukkitBoundingBox() {
|
||||||
if (bukkitBoundingBox == null) {
|
if (bukkitBoundingBox == null) {
|
||||||
bukkitBoundingBox = new BoundingBox(pos1.getX(), pos1.getY(), pos1.getZ(),
|
bukkitBoundingBox = new BoundingBox(pos1.getX(), pos1.getY(), pos1.getZ(),
|
||||||
@@ -134,7 +192,7 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public Iterator<BlockVector> iterator() {
|
public @NotNull Iterator<BlockVector> iterator() {
|
||||||
return new Iterator<>() {
|
return new Iterator<>() {
|
||||||
private int x = pos1.getBlockX(),
|
private int x = pos1.getBlockX(),
|
||||||
y = pos1.getBlockY(),
|
y = pos1.getBlockY(),
|
||||||
@@ -164,22 +222,6 @@ public class AABBBlock implements BlockSet, Cloneable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
public Iterable<Block> asBlockIterable(World w) {
|
|
||||||
return () -> new Iterator<>() {
|
|
||||||
final Iterator<BlockVector> nested = AABBBlock.this.iterator();
|
|
||||||
@Override
|
|
||||||
public boolean hasNext() {
|
|
||||||
return nested.hasNext();
|
|
||||||
}
|
|
||||||
@Override
|
|
||||||
public Block next() {
|
|
||||||
BlockVector bv = nested.next();
|
|
||||||
return w.getBlockAt(bv.getBlockX(), bv.getBlockY(), bv.getBlockZ());
|
|
||||||
}
|
|
||||||
};
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public String toString() {
|
public String toString() {
|
||||||
return "{(" + pos1.getBlockX() +
|
return "{(" + pos1.getBlockX() +
|
||||||
|
@@ -12,12 +12,22 @@ import java.util.Collection;
|
|||||||
import java.util.Iterator;
|
import java.util.Iterator;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A group of {@link AABBBlock}.
|
||||||
|
*/
|
||||||
public class AABBBlockGroup implements BlockSet {
|
public class AABBBlockGroup implements BlockSet {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The list of {@link AABBBlock} contained in this group. This list is unmodifiable.
|
||||||
|
*/
|
||||||
public final List<AABBBlock> subAABB;
|
public final List<AABBBlock> subAABB;
|
||||||
|
|
||||||
private final AABBBlock englobingAABB;
|
private final AABBBlock englobingAABB;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new {@link AABBBlockGroup}.
|
||||||
|
* @param in the list of {@link AABBBlock} that will be contained in this group.
|
||||||
|
*/
|
||||||
public AABBBlockGroup(Collection<AABBBlock> in) {
|
public AABBBlockGroup(Collection<AABBBlock> in) {
|
||||||
if (in.isEmpty())
|
if (in.isEmpty())
|
||||||
throw new IllegalArgumentException("Provided collection must not be empty.");
|
throw new IllegalArgumentException("Provided collection must not be empty.");
|
||||||
@@ -25,6 +35,10 @@ public class AABBBlockGroup implements BlockSet {
|
|||||||
englobingAABB = initEnglobingAABB();
|
englobingAABB = initEnglobingAABB();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new {@link AABBBlockGroup}.
|
||||||
|
* @param in an array of {@link AABBBlock} that will be contained in this group.
|
||||||
|
*/
|
||||||
public AABBBlockGroup(AABBBlock... in) {
|
public AABBBlockGroup(AABBBlock... in) {
|
||||||
this(Arrays.asList(in));
|
this(Arrays.asList(in));
|
||||||
}
|
}
|
||||||
|
@@ -1,23 +1,58 @@
|
|||||||
package fr.pandacube.lib.paper.geometry.blocks;
|
package fr.pandacube.lib.paper.geometry.blocks;
|
||||||
|
|
||||||
import org.bukkit.Location;
|
import org.bukkit.Location;
|
||||||
|
import org.bukkit.World;
|
||||||
import org.bukkit.block.Block;
|
import org.bukkit.block.Block;
|
||||||
import org.bukkit.entity.Entity;
|
import org.bukkit.entity.Entity;
|
||||||
import org.bukkit.util.BlockVector;
|
import org.bukkit.util.BlockVector;
|
||||||
import org.bukkit.util.BoundingBox;
|
import org.bukkit.util.BoundingBox;
|
||||||
import org.bukkit.util.Vector;
|
import org.bukkit.util.Vector;
|
||||||
|
|
||||||
|
import java.util.Iterator;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents a set of blocks in a world.
|
||||||
|
*/
|
||||||
public interface BlockSet extends Iterable<BlockVector> {
|
public interface BlockSet extends Iterable<BlockVector> {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a random coordinate that is inside this block set.
|
||||||
|
* @return a random coordinate inside this block set.
|
||||||
|
*/
|
||||||
Vector getRandomPosition();
|
Vector getRandomPosition();
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the volume, in blocks (or cubic meters), of this block set.
|
||||||
|
* @return the volume of this block set.
|
||||||
|
*/
|
||||||
long getVolume();
|
long getVolume();
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the englobing bounding box if this block set.
|
||||||
|
* @return the englobing bounding box if this block set.
|
||||||
|
*/
|
||||||
AABBBlock getEnglobingAABB();
|
AABBBlock getEnglobingAABB();
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if this block set overlaps the provided bounding box.
|
||||||
|
* @param bb the provided bounding box
|
||||||
|
* @return true if its overlaps, false otherwise.
|
||||||
|
*/
|
||||||
boolean overlaps(BoundingBox bb);
|
boolean overlaps(BoundingBox bb);
|
||||||
|
/**
|
||||||
|
* Tells if this block set overlaps the bounding box of the provided entity.
|
||||||
|
* @param e the provided entity.
|
||||||
|
* @return true if its overlaps, false otherwise.
|
||||||
|
*/
|
||||||
default boolean overlaps(Entity e) {
|
default boolean overlaps(Entity e) {
|
||||||
return overlaps(e.getBoundingBox());
|
return overlaps(e.getBoundingBox());
|
||||||
}
|
}
|
||||||
|
/**
|
||||||
|
* Tells if this block set overlaps the provided one. that is there is at least one block in common.
|
||||||
|
* @param bs the provided block set.
|
||||||
|
* @return true if its overlaps, false otherwise.
|
||||||
|
*/
|
||||||
default boolean overlaps(BlockSet bs) {
|
default boolean overlaps(BlockSet bs) {
|
||||||
if (this instanceof AABBBlock b1) {
|
if (this instanceof AABBBlock b1) {
|
||||||
if (bs instanceof AABBBlock b2)
|
if (bs instanceof AABBBlock b2)
|
||||||
@@ -37,20 +72,78 @@ public interface BlockSet extends Iterable<BlockVector> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if the provided vector is inside this bounding box.
|
||||||
|
* @param v the vector.
|
||||||
|
* @return true if its inside, false otherwise.
|
||||||
|
*/
|
||||||
boolean isInside(Vector v);
|
boolean isInside(Vector v);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if the provided location is inside this bounding box.
|
||||||
|
* The world of the location is ignored.
|
||||||
|
* @param l the location.
|
||||||
|
* @return true if its inside, false otherwise.
|
||||||
|
*/
|
||||||
default boolean isInside(Location l) {
|
default boolean isInside(Location l) {
|
||||||
return isInside(l.toVector());
|
return isInside(l.toVector());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if the provided block is inside this bounding box.
|
||||||
|
* The world of the block is ignored.
|
||||||
|
* @param b the block.
|
||||||
|
* @return true if its inside, false otherwise.
|
||||||
|
*/
|
||||||
default boolean isInside(Block b) {
|
default boolean isInside(Block b) {
|
||||||
return isInside(b.getLocation().add(.5, .5, .5));
|
return isInside(b.getLocation().add(.5, .5, .5));
|
||||||
}
|
}
|
||||||
default boolean isInside(Entity p) {
|
|
||||||
return isInside(p.getLocation());
|
/**
|
||||||
|
* Tells if the provided entity is inside this bounding box.
|
||||||
|
* It calls {@link #isInside(Location)} using the returned value of {@link Entity#getLocation()}.
|
||||||
|
* The world of the entity is ignored.
|
||||||
|
* @param e the entity.
|
||||||
|
* @return true if its inside, false otherwise.
|
||||||
|
*/
|
||||||
|
default boolean isInside(Entity e) {
|
||||||
|
return isInside(e.getLocation());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets an iterator iterating through all the blocks of this block set.
|
||||||
|
* @param w the world of the blocks.
|
||||||
|
* @return a new iterator.
|
||||||
|
*/
|
||||||
|
default Iterable<Block> asBlockIterable(World w) {
|
||||||
|
return () -> new Iterator<>() {
|
||||||
|
final Iterator<BlockVector> nested = BlockSet.this.iterator();
|
||||||
|
@Override
|
||||||
|
public boolean hasNext() {
|
||||||
|
return nested.hasNext();
|
||||||
|
}
|
||||||
|
@Override
|
||||||
|
public Block next() {
|
||||||
|
BlockVector bv = nested.next();
|
||||||
|
return w.getBlockAt(bv.getBlockX(), bv.getBlockY(), bv.getBlockZ());
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tests the two block set overlap each other.
|
||||||
|
* This method works on any implementation of this interface, but they should override the
|
||||||
|
* {@link #overlaps(BlockSet)} method to provide a more optimized code.
|
||||||
|
* @param bs1 the first block set.
|
||||||
|
* @param bs2 the second block set.
|
||||||
|
* @return true if the two block set overlap, false otherwise.
|
||||||
|
*/
|
||||||
static boolean overlap(BlockSet bs1, BlockSet bs2) {
|
static boolean overlap(BlockSet bs1, BlockSet bs2) {
|
||||||
if (!bs1.getEnglobingAABB().overlaps(bs2.getEnglobingAABB()))
|
if (!bs1.getEnglobingAABB().overlaps(bs2.getEnglobingAABB()))
|
||||||
return false;
|
return false;
|
||||||
|
@@ -38,12 +38,20 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
private final List<Player> currentPlayers = new ArrayList<>();
|
private final List<Player> currentPlayers = new ArrayList<>();
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set up a new gui hot bar. You should not instantiate more than one hot bar.
|
||||||
|
* @param defaultSlot the default slot (currently held item) when the player joins the hot bar.
|
||||||
|
*/
|
||||||
public GUIHotBar(int defaultSlot) {
|
public GUIHotBar(int defaultSlot) {
|
||||||
this.defaultSlot = Math.max(0, Math.min(8, defaultSlot));
|
this.defaultSlot = Math.max(0, Math.min(8, defaultSlot));
|
||||||
|
|
||||||
BukkitEvent.register(this);
|
BukkitEvent.register(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Disables this hot bar.
|
||||||
|
* @param clearPlayerMenuItems if the items of this hot bar should be removed from the players inventories.
|
||||||
|
*/
|
||||||
public void disable(boolean clearPlayerMenuItems) {
|
public void disable(boolean clearPlayerMenuItems) {
|
||||||
removeAllPlayers(clearPlayerMenuItems);
|
removeAllPlayers(clearPlayerMenuItems);
|
||||||
|
|
||||||
@@ -53,9 +61,10 @@ public class GUIHotBar implements Listener {
|
|||||||
/**
|
/**
|
||||||
* Add the item to this hot bar menu. if there is already players hooked to this hot bar, the item will be directly added to
|
* Add the item to this hot bar menu. if there is already players hooked to this hot bar, the item will be directly added to
|
||||||
* their inventories.
|
* their inventories.
|
||||||
* @param i the item stack
|
* @param i the item stack.
|
||||||
* @param setter code executed to put the item in the inventory. Additionally, check for permission before doing the addition.
|
* @param setter code executed to put the item in the inventory. Additionally, check for permission before doing the addition.
|
||||||
* @param run the Runnable to run when the user right-click on the item in the hot bar.
|
* @param run the Runnable to run when the user right-click on the item in the hot bar.
|
||||||
|
* @return itself for daisy-chaining.
|
||||||
*/
|
*/
|
||||||
public GUIHotBar addItem(ItemStack i, BiConsumer<PlayerInventory, ItemStack> setter, Consumer<Player> run) {
|
public GUIHotBar addItem(ItemStack i, BiConsumer<PlayerInventory, ItemStack> setter, Consumer<Player> run) {
|
||||||
itemsAndSetters.put(i, setter);
|
itemsAndSetters.put(i, setter);
|
||||||
@@ -69,8 +78,9 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Add the hot bar elements to this player, or update them if applicable.
|
* Add the hot bar elements to this player, or update them if applicable.
|
||||||
*
|
* <br>
|
||||||
* The player is automatically removed when they quit. You can remove it before by calling {@link #removePlayer(Player, boolean)}.
|
* The player is automatically removed when they quit. You can remove it before by calling {@link #removePlayer(Player, boolean)}.
|
||||||
|
* @param p the player to add.
|
||||||
*/
|
*/
|
||||||
public void addPlayer(Player p) {
|
public void addPlayer(Player p) {
|
||||||
if (!currentPlayers.contains(p))
|
if (!currentPlayers.contains(p))
|
||||||
@@ -85,6 +95,7 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Detach this player from this hot bar manager and removes the managed items from the players inventory.
|
* Detach this player from this hot bar manager and removes the managed items from the players inventory.
|
||||||
|
* @param p the player to remove.
|
||||||
*/
|
*/
|
||||||
public void removePlayer(Player p) {
|
public void removePlayer(Player p) {
|
||||||
removePlayer(p, true);
|
removePlayer(p, true);
|
||||||
@@ -92,6 +103,8 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Detach this player from this hot bar manager and optionally removes the managed items from the players inventory.
|
* Detach this player from this hot bar manager and optionally removes the managed items from the players inventory.
|
||||||
|
* @param p the player to remove.
|
||||||
|
* @param clearMenuItems if the items from this hot bar should be removed from the player inventory.
|
||||||
*/
|
*/
|
||||||
public void removePlayer(Player p, boolean clearMenuItems) {
|
public void removePlayer(Player p, boolean clearMenuItems) {
|
||||||
if (!currentPlayers.contains(p))
|
if (!currentPlayers.contains(p))
|
||||||
@@ -107,17 +120,27 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if the provided player is attached to this hot bar.
|
||||||
|
* @param p the player to check.
|
||||||
|
* @return true if the player is attached, false otherwise.
|
||||||
|
*/
|
||||||
public boolean containsPlayer(Player p) {
|
public boolean containsPlayer(Player p) {
|
||||||
return currentPlayers.contains(p);
|
return currentPlayers.contains(p);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Detach all players from this hot bar.
|
||||||
|
*/
|
||||||
public void removeAllPlayers() {
|
public void removeAllPlayers() {
|
||||||
removeAllPlayers(true);
|
removeAllPlayers(true);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Detach all players from this hot bar.
|
||||||
|
* @param clearMenuItems if the items from this hot bar should be removed from the player inventory.
|
||||||
|
*/
|
||||||
public void removeAllPlayers(boolean clearMenuItems) {
|
public void removeAllPlayers(boolean clearMenuItems) {
|
||||||
for (Player p : new ArrayList<>(currentPlayers))
|
for (Player p : new ArrayList<>(currentPlayers))
|
||||||
removePlayer(p, clearMenuItems);
|
removePlayer(p, clearMenuItems);
|
||||||
@@ -127,7 +150,7 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
public void addItemToPlayer(Player p, ItemStack is) {
|
private void addItemToPlayer(Player p, ItemStack is) {
|
||||||
if (!itemsAndSetters.containsKey(is))
|
if (!itemsAndSetters.containsKey(is))
|
||||||
throw new IllegalArgumentException("The provided ItemStack is not registered in this GUIHotBar");
|
throw new IllegalArgumentException("The provided ItemStack is not registered in this GUIHotBar");
|
||||||
if (!currentPlayers.contains(p))
|
if (!currentPlayers.contains(p))
|
||||||
@@ -135,7 +158,7 @@ public class GUIHotBar implements Listener {
|
|||||||
itemsAndSetters.get(is).accept(p.getInventory(), is.clone());
|
itemsAndSetters.get(is).accept(p.getInventory(), is.clone());
|
||||||
}
|
}
|
||||||
|
|
||||||
public void removeItemFromPlayer(Player p, ItemStack is) {
|
private void removeItemFromPlayer(Player p, ItemStack is) {
|
||||||
p.getInventory().remove(is);
|
p.getInventory().remove(is);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -144,7 +167,7 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onPlayerDropItem(PlayerDropItemEvent event) {
|
void onPlayerDropItem(PlayerDropItemEvent event) {
|
||||||
if (!currentPlayers.contains(event.getPlayer()))
|
if (!currentPlayers.contains(event.getPlayer()))
|
||||||
return;
|
return;
|
||||||
|
|
||||||
@@ -159,7 +182,7 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onPlayerInteract(PlayerInteractEvent event) {
|
void onPlayerInteract(PlayerInteractEvent event) {
|
||||||
if (!currentPlayers.contains(event.getPlayer()))
|
if (!currentPlayers.contains(event.getPlayer()))
|
||||||
return;
|
return;
|
||||||
|
|
||||||
@@ -188,7 +211,7 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onInventoryClick(InventoryClickEvent event) {
|
void onInventoryClick(InventoryClickEvent event) {
|
||||||
if (event.getClickedInventory() == null || !(event.getClickedInventory() instanceof PlayerInventory inv))
|
if (event.getClickedInventory() == null || !(event.getClickedInventory() instanceof PlayerInventory inv))
|
||||||
return;
|
return;
|
||||||
|
|
||||||
@@ -213,20 +236,20 @@ public class GUIHotBar implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onPlayerQuit(PlayerQuitEvent event) {
|
void onPlayerQuit(PlayerQuitEvent event) {
|
||||||
removePlayer(event.getPlayer());
|
removePlayer(event.getPlayer());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onPlayerDeath(PlayerDeathEvent event) {
|
void onPlayerDeath(PlayerDeathEvent event) {
|
||||||
if (!currentPlayers.contains(event.getEntity()))
|
if (!currentPlayers.contains(event.getEntity()))
|
||||||
return;
|
return;
|
||||||
event.getDrops().removeAll(itemsAndSetters.keySet());
|
event.getDrops().removeAll(itemsAndSetters.keySet());
|
||||||
}
|
}
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onPlayerRespawn(PlayerRespawnEvent event) {
|
void onPlayerRespawn(PlayerRespawnEvent event) {
|
||||||
if (!currentPlayers.contains(event.getPlayer()))
|
if (!currentPlayers.contains(event.getPlayer()))
|
||||||
return;
|
return;
|
||||||
|
|
||||||
|
@@ -38,7 +38,7 @@ public class GUIInventory implements Listener {
|
|||||||
if (title == null)
|
if (title == null)
|
||||||
inv = Bukkit.createInventory(null, nbLines * 9);
|
inv = Bukkit.createInventory(null, nbLines * 9);
|
||||||
else
|
else
|
||||||
inv = Bukkit.createInventory(null, nbLines * 9, title.getAdv());
|
inv = Bukkit.createInventory(null, nbLines * 9, title.get());
|
||||||
|
|
||||||
setCloseEvent(closeEventAction);
|
setCloseEvent(closeEventAction);
|
||||||
|
|
||||||
@@ -50,6 +50,10 @@ public class GUIInventory implements Listener {
|
|||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the action when the player closes the inventory window.
|
||||||
|
* @param closeEventAction the action to run.
|
||||||
|
*/
|
||||||
protected void setCloseEvent(Consumer<InventoryCloseEvent> closeEventAction) {
|
protected void setCloseEvent(Consumer<InventoryCloseEvent> closeEventAction) {
|
||||||
onCloseEvent = closeEventAction;
|
onCloseEvent = closeEventAction;
|
||||||
}
|
}
|
||||||
@@ -190,11 +194,11 @@ public class GUIInventory implements Listener {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells the number of inventory line needed to show the provided number of slot.
|
||||||
|
* @param nb the number of slot.
|
||||||
|
* @return the number of line.
|
||||||
|
*/
|
||||||
public static int nbLineForNbElements(int nb) {
|
public static int nbLineForNbElements(int nb) {
|
||||||
return nb / 9 + ((nb % 9 == 0) ? 0 : 1);
|
return nb / 9 + ((nb % 9 == 0) ? 0 : 1);
|
||||||
}
|
}
|
||||||
|
@@ -0,0 +1,232 @@
|
|||||||
|
package fr.pandacube.lib.paper.inventory;
|
||||||
|
|
||||||
|
import com.google.common.base.Preconditions;
|
||||||
|
import org.bukkit.Material;
|
||||||
|
import org.bukkit.entity.HumanEntity;
|
||||||
|
import org.bukkit.inventory.EquipmentSlot;
|
||||||
|
import org.bukkit.inventory.Inventory;
|
||||||
|
import org.bukkit.inventory.ItemStack;
|
||||||
|
import org.bukkit.inventory.PlayerInventory;
|
||||||
|
import org.jetbrains.annotations.NotNull;
|
||||||
|
import org.jetbrains.annotations.Nullable;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Dummy implementation of a player inventory.
|
||||||
|
*/
|
||||||
|
public class DummyPlayerInventory extends InventoryWrapper implements PlayerInventory {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Total number of item slots in the player inventory.
|
||||||
|
*/
|
||||||
|
public static final int PLAYER_INVENTORY_SIZE = 43; // 36 base inventory + 4 armor slots + 1 off hand + 2 hidden slots (body and saddle)
|
||||||
|
|
||||||
|
private int heldItemSlot;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a dummy player inventory.
|
||||||
|
* @param base the inventory itself.
|
||||||
|
* @param heldItemSlot the currently held item slot, from 0 to 8.
|
||||||
|
*/
|
||||||
|
public DummyPlayerInventory(Inventory base, int heldItemSlot) {
|
||||||
|
super(base);
|
||||||
|
if (base.getSize() < PLAYER_INVENTORY_SIZE)
|
||||||
|
throw new IllegalArgumentException("base inventory should have a size of " + PLAYER_INVENTORY_SIZE + " (" + base.getSize() + " given).");
|
||||||
|
if (heldItemSlot < 0 || heldItemSlot > 8)
|
||||||
|
throw new IllegalArgumentException("heldItemSlot should be between 0 and 8 inclusive.");
|
||||||
|
this.heldItemSlot = heldItemSlot;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @Nullable ItemStack @NotNull [] getStorageContents() {
|
||||||
|
return Arrays.copyOfRange(getContents(), 0, 36);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @Nullable ItemStack @NotNull [] getArmorContents() {
|
||||||
|
return Arrays.copyOfRange(getContents(), 36, 40);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setArmorContents(@Nullable ItemStack[] items) {
|
||||||
|
this.setSlots(items, 36, 4);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @Nullable ItemStack @NotNull [] getExtraContents() {
|
||||||
|
return Arrays.copyOfRange(getContents(), 40, getSize());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setExtraContents(@Nullable ItemStack[] items) {
|
||||||
|
this.setSlots(items, 40, getSize() - 40);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void setSlots(ItemStack[] items, int baseSlot, int length) {
|
||||||
|
if (items == null) {
|
||||||
|
items = new ItemStack[length];
|
||||||
|
}
|
||||||
|
Preconditions.checkArgument(items.length <= length, "items.length must be < %s", length);
|
||||||
|
|
||||||
|
for (int i = 0; i < length; i++) {
|
||||||
|
if (i >= items.length) {
|
||||||
|
this.setItem(baseSlot + i, null);
|
||||||
|
} else {
|
||||||
|
this.setItem(baseSlot + i, items[i]);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ItemStack getHelmet() {
|
||||||
|
return getItem(39);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setHelmet(@Nullable ItemStack helmet) {
|
||||||
|
setItem(39, helmet);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ItemStack getChestplate() {
|
||||||
|
return getItem(38);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setChestplate(@Nullable ItemStack chestplate) {
|
||||||
|
setItem(38, chestplate);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ItemStack getLeggings() {
|
||||||
|
return getItem(37);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setLeggings(@Nullable ItemStack leggings) {
|
||||||
|
setItem(37, leggings);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ItemStack getBoots() {
|
||||||
|
return getItem(36);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setBoots(@Nullable ItemStack boots) {
|
||||||
|
setItem(36, boots);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the item stack in the SADDLE {@link EquipmentSlot}.
|
||||||
|
* @return the SADDLE item stack.
|
||||||
|
*/
|
||||||
|
public ItemStack getSaddle() {
|
||||||
|
return getItem(42);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Puts the provided item stack in the SADDLE {@link EquipmentSlot}.
|
||||||
|
* @param saddle the item.
|
||||||
|
*/
|
||||||
|
public void setSaddle(@Nullable ItemStack saddle) {
|
||||||
|
setItem(42, saddle);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the item stack in the BODY {@link EquipmentSlot}.
|
||||||
|
* @return the BODY item stack.
|
||||||
|
*/
|
||||||
|
public ItemStack getBody() {
|
||||||
|
return getItem(41);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Puts the provided item stack in the BODY {@link EquipmentSlot}.
|
||||||
|
* @param body the item.
|
||||||
|
*/
|
||||||
|
public void setBody(@Nullable ItemStack body) {
|
||||||
|
setItem(41, body);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setItem(EquipmentSlot slot, ItemStack item) {
|
||||||
|
Preconditions.checkArgument(slot != null, "slot must not be null");
|
||||||
|
|
||||||
|
switch (slot) {
|
||||||
|
case HAND -> this.setItemInMainHand(item);
|
||||||
|
case OFF_HAND -> this.setItemInOffHand(item);
|
||||||
|
case FEET -> this.setBoots(item);
|
||||||
|
case LEGS -> this.setLeggings(item);
|
||||||
|
case CHEST -> this.setChestplate(item);
|
||||||
|
case HEAD -> this.setHelmet(item);
|
||||||
|
case BODY -> this.setBody(item);
|
||||||
|
case SADDLE -> this.setSaddle(item);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @NotNull ItemStack getItem(@NotNull EquipmentSlot slot) {
|
||||||
|
return switch (slot) {
|
||||||
|
case HAND -> this.getItemInMainHand();
|
||||||
|
case OFF_HAND -> this.getItemInOffHand();
|
||||||
|
case FEET -> Objects.requireNonNullElseGet(this.getBoots(), () -> new ItemStack(Material.AIR));
|
||||||
|
case LEGS -> Objects.requireNonNullElseGet(this.getLeggings(), () -> new ItemStack(Material.AIR));
|
||||||
|
case CHEST -> Objects.requireNonNullElseGet(this.getChestplate(), () -> new ItemStack(Material.AIR));
|
||||||
|
case HEAD -> Objects.requireNonNullElseGet(this.getHelmet(), () -> new ItemStack(Material.AIR));
|
||||||
|
case BODY -> Objects.requireNonNullElseGet(this.getBody(), () -> new ItemStack(Material.AIR)); // for horses/wolves armor
|
||||||
|
case SADDLE -> Objects.requireNonNullElseGet(this.getSaddle(), () -> new ItemStack(Material.AIR));
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @NotNull ItemStack getItemInMainHand() {
|
||||||
|
return Objects.requireNonNullElse(getItem(heldItemSlot), new ItemStack(Material.AIR));
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setItemInMainHand(@Nullable ItemStack item) {
|
||||||
|
setItem(heldItemSlot, item);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @NotNull ItemStack getItemInOffHand() {
|
||||||
|
return Objects.requireNonNullElse(getItem(40), new ItemStack(Material.AIR));
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setItemInOffHand(@Nullable ItemStack item) {
|
||||||
|
setItem(40, item);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @NotNull ItemStack getItemInHand() {
|
||||||
|
return getItemInMainHand();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setItemInHand(@Nullable ItemStack stack) {
|
||||||
|
setItemInMainHand(stack);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int getHeldItemSlot() {
|
||||||
|
return heldItemSlot;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setHeldItemSlot(int slot) {
|
||||||
|
if (slot < 0 || slot > 8)
|
||||||
|
throw new IllegalArgumentException("Slot is not between 0 and 8 inclusive");
|
||||||
|
heldItemSlot = slot;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public @Nullable HumanEntity getHolder() {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
}
|
@@ -1,4 +1,4 @@
|
|||||||
package fr.pandacube.lib.paper.util;
|
package fr.pandacube.lib.paper.inventory;
|
||||||
|
|
||||||
import org.bukkit.Location;
|
import org.bukkit.Location;
|
||||||
import org.bukkit.Material;
|
import org.bukkit.Material;
|
||||||
@@ -13,12 +13,22 @@ import org.jetbrains.annotations.Nullable;
|
|||||||
import java.util.HashMap;
|
import java.util.HashMap;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.ListIterator;
|
import java.util.ListIterator;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for an {@link Inventory}.
|
||||||
|
* Can be overridden to add specific behaviour to some methods.
|
||||||
|
*/
|
||||||
public class InventoryWrapper implements Inventory {
|
public class InventoryWrapper implements Inventory {
|
||||||
private final Inventory base;
|
private final Inventory base;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a wrapper for the provided inventory.
|
||||||
|
* @param base the wrapped inventory. Cannot be null.
|
||||||
|
* @throws NullPointerException if the base inventory is null.
|
||||||
|
*/
|
||||||
public InventoryWrapper(Inventory base) {
|
public InventoryWrapper(Inventory base) {
|
||||||
this.base = base;
|
this.base = Objects.requireNonNull(base, "base inventory cannot be null.");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
@@ -0,0 +1,413 @@
|
|||||||
|
package fr.pandacube.lib.paper.inventory;
|
||||||
|
|
||||||
|
import com.google.common.collect.Streams;
|
||||||
|
import fr.pandacube.lib.chat.Chat;
|
||||||
|
import io.papermc.paper.datacomponent.DataComponentType;
|
||||||
|
import io.papermc.paper.datacomponent.DataComponentType.Valued;
|
||||||
|
import io.papermc.paper.datacomponent.DataComponentTypes;
|
||||||
|
import io.papermc.paper.datacomponent.item.ResolvableProfile;
|
||||||
|
import net.kyori.adventure.text.Component;
|
||||||
|
import net.kyori.adventure.text.ComponentLike;
|
||||||
|
import org.bukkit.Material;
|
||||||
|
import org.bukkit.NamespacedKey;
|
||||||
|
import org.bukkit.enchantments.Enchantment;
|
||||||
|
import org.bukkit.inventory.ItemFlag;
|
||||||
|
import org.bukkit.inventory.ItemStack;
|
||||||
|
import org.bukkit.inventory.meta.Damageable;
|
||||||
|
import org.bukkit.inventory.meta.ItemMeta;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.function.Consumer;
|
||||||
|
|
||||||
|
import static fr.pandacube.lib.chat.ChatStatic.chatComponent;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A builder for {@link ItemStack}.
|
||||||
|
*/
|
||||||
|
public class ItemStackBuilder {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a builder with a clone of the provided ItemStack.
|
||||||
|
* <p>
|
||||||
|
* The returned builder will not alter the provided ItemStack.
|
||||||
|
* If you want to modify the ItemStack with the builder, please use {@link #wrap(ItemStack)}.
|
||||||
|
* @param base the original ItemStack.
|
||||||
|
* @return the builder
|
||||||
|
*/
|
||||||
|
public static ItemStackBuilder of(ItemStack base) {
|
||||||
|
return wrap(base.clone());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a builder of a new ItemStack with the specified Material.
|
||||||
|
* @param mat the material of the new built ItemStack
|
||||||
|
* @return the builder
|
||||||
|
*/
|
||||||
|
public static ItemStackBuilder of(Material mat) {
|
||||||
|
return wrap(new ItemStack(mat));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a builder that will alter the data of the provided ItemStack.
|
||||||
|
* <p>
|
||||||
|
* The {@link #build()} method of the returned builder will return the same instance
|
||||||
|
* of ItemStack as the parameter of this method.
|
||||||
|
* <p>
|
||||||
|
* To create a builder that doesn't modify the provided ItemStack, use {@link #of(ItemStack)}.
|
||||||
|
* @param stack the wrapped item stack.
|
||||||
|
* @return the builder
|
||||||
|
*/
|
||||||
|
public static ItemStackBuilder wrap(ItemStack stack) {
|
||||||
|
return new ItemStackBuilder(stack);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
private final ItemStack stack;
|
||||||
|
|
||||||
|
private ItemStackBuilder(ItemStack base) {
|
||||||
|
stack = base;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Runs the provided updater on the {@link ItemMeta} instance of the built stack.
|
||||||
|
* @param metaUpdater the updater that will modify the meta.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder meta(Consumer<ItemMeta> metaUpdater) {
|
||||||
|
return meta(metaUpdater, ItemMeta.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Runs the provided updater on the {@link ItemMeta} instance of the built stack.
|
||||||
|
* @param metaUpdater the updater that will modify the meta.
|
||||||
|
* @param metaType the type of the meta instance.
|
||||||
|
* @param <T> the type of item meta.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public <T extends ItemMeta> ItemStackBuilder meta(Consumer<T> metaUpdater, Class<T> metaType) {
|
||||||
|
stack.editMeta(metaType, metaUpdater);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the amount of the built stack.
|
||||||
|
* @param a the new amount.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder amount(int a) {
|
||||||
|
stack.setAmount(a);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the display name of the item, directly passing to {@link ItemMeta#displayName(Component)}.
|
||||||
|
* @param displayName the new display name. Can be null to unset.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder rawDisplayName(Component displayName) {
|
||||||
|
return meta(m -> m.displayName(displayName));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the display name of the item, filtering to make default italic to false.
|
||||||
|
* @param displayName the new display name. Can be null to unset.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder displayName(ComponentLike displayName) {
|
||||||
|
return rawDisplayName(displayName != null
|
||||||
|
? Chat.italicFalseIfNotSet(chatComponent(displayName)).asComponent()
|
||||||
|
: null);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the lore of the item, directly passing to {@link ItemMeta#lore(List)}.
|
||||||
|
* @param lore the new lore. Can be null to unset.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder rawLore(List<Component> lore) {
|
||||||
|
return meta(m -> m.lore(lore));
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the lore of the item, filtering to make default italic to false.
|
||||||
|
* @param lore the new lore. Can be null to unset.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder lore(List<? extends ComponentLike> lore) {
|
||||||
|
if (lore != null) {
|
||||||
|
return rawLore(lore.stream()
|
||||||
|
.map(line -> Chat.italicFalseIfNotSet(chatComponent(line)).get())
|
||||||
|
.toList());
|
||||||
|
}
|
||||||
|
else
|
||||||
|
return rawLore(Collections.emptyList());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Adds new lore lines to the existing lore of the item.
|
||||||
|
* @param lores the added lore lines.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder addLoreAfter(List<? extends ComponentLike> lores) {
|
||||||
|
if (lores != null) {
|
||||||
|
List<Component> baseLore = stack.getItemMeta().lore();
|
||||||
|
if (baseLore == null) baseLore = Collections.emptyList();
|
||||||
|
return rawLore(
|
||||||
|
Streams.concat(
|
||||||
|
baseLore.stream(),
|
||||||
|
lores.stream()
|
||||||
|
.map(line -> Chat.italicFalseIfNotSet(chatComponent(line)).get())
|
||||||
|
)
|
||||||
|
.toList());
|
||||||
|
}
|
||||||
|
else
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Adds new lore lines to the existing lore of the item.
|
||||||
|
* @param lores the added lore lines.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder addLoreAfter(ComponentLike... lores) {
|
||||||
|
if (lores == null || lores.length == 0)
|
||||||
|
return this;
|
||||||
|
return addLoreAfter(Arrays.asList(lores));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enchant the item.
|
||||||
|
* Supports unsafe enchants.
|
||||||
|
* @param enchantment the enchantment.
|
||||||
|
* @param level the enchant level.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder enchant(Enchantment enchantment, int level) {
|
||||||
|
return meta(m -> m.addEnchant(enchantment, level, true));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Adds the provided flags to the item.
|
||||||
|
* @param flags he flags to add.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder flags(ItemFlag... flags) {
|
||||||
|
return flags(true, flags);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Adds or removes the provided flags to the item.
|
||||||
|
* @param add true to add, false to remove.
|
||||||
|
* @param flags he flags to add.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder flags(boolean add, ItemFlag... flags) {
|
||||||
|
return add ? meta(m -> m.addItemFlags(flags))
|
||||||
|
: meta(m -> m.removeItemFlags(flags));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Hides the enchants from the tooltip of the item.
|
||||||
|
* Will set the {@link ItemFlag#HIDE_ENCHANTS} flag of the item.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder hideEnchants() {
|
||||||
|
return hideEnchants(true);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets or unsets the {@link ItemFlag#HIDE_ENCHANTS} flag of the item.
|
||||||
|
* @param hide true to hide, false to show.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder hideEnchants(boolean hide) {
|
||||||
|
return flags(hide, ItemFlag.HIDE_ENCHANTS);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Hides the attributes from the tooltip of the item.
|
||||||
|
* Will set the {@link ItemFlag#HIDE_ATTRIBUTES} flag of the item.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder hideAttributes() {
|
||||||
|
return hideAttributes(true);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets or unsets the {@link ItemFlag#HIDE_ATTRIBUTES} flag of the item.
|
||||||
|
* @param hide true to hide, false to show.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder hideAttributes(boolean hide) {
|
||||||
|
return flags(hide, ItemFlag.HIDE_ATTRIBUTES);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Apply the enchantment glint to the item, event if it's not enchant.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder fakeEnchant() {
|
||||||
|
return fakeEnchant(true);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the enchantment glint override to the item.
|
||||||
|
* @param apply true to enforce the enchantment glint, false to set to default.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder fakeEnchant(boolean apply) {
|
||||||
|
return meta(m -> m.setEnchantmentGlintOverride(apply ? true : null));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets this item as unbreakable.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder unbreakable() {
|
||||||
|
return unbreakable(true);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the unbreakable status of this item.
|
||||||
|
* @param unbreakable the unbreakable status.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder unbreakable(boolean unbreakable) {
|
||||||
|
return meta(m -> m.setUnbreakable(unbreakable));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the damage value of this item.
|
||||||
|
* @param d the new damage value.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder damage(int d) {
|
||||||
|
return meta(m -> m.setDamage(d), Damageable.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets a value for a data component of this item.
|
||||||
|
* @param dataType the data component type.
|
||||||
|
* @param dataValue the data component value.
|
||||||
|
* @return itself.
|
||||||
|
* @param <T> the data component API type.
|
||||||
|
*/
|
||||||
|
public <T> ItemStackBuilder data(Valued<T> dataType, T dataValue) {
|
||||||
|
stack.setData(dataType, dataValue);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unset (set to empty) a value for a data component of this item.
|
||||||
|
* @param dataType the data component type.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder unsetData(DataComponentType dataType) {
|
||||||
|
stack.unsetData(dataType);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reset (act as default) a value for a data component of this item.
|
||||||
|
* @param dataType the data component type.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder resetData(DataComponentType dataType) {
|
||||||
|
stack.resetData(dataType);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the {@code can_break} data component to the provided list of {@link Material}.
|
||||||
|
* @param canBreak a list of {@link Material}.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder canBreakMaterials(Collection<Material> canBreak) {
|
||||||
|
return canBreak(canBreak.stream().map(Material::getKey).toList());
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the {@code can_break} data component to the provided list of {@link NamespacedKey}.
|
||||||
|
* @param canBreak a list of block predicate. If empty, unsets the data component. If null, reset to default.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("removal")
|
||||||
|
public ItemStackBuilder canBreak(Collection<NamespacedKey> canBreak) {
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
Collection<com.destroystokyo.paper.Namespaced> nsCanBreak = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canBreak;
|
||||||
|
return meta(m -> m.setDestroyableKeys(nsCanBreak));
|
||||||
|
|
||||||
|
/*
|
||||||
|
if (canBreak == null)
|
||||||
|
return resetData(DataComponentTypes.CAN_BREAK);
|
||||||
|
else if (canBreak.isEmpty())
|
||||||
|
return unsetData(DataComponentTypes.CAN_BREAK);
|
||||||
|
else
|
||||||
|
return data(DataComponentTypes.CAN_BREAK, ItemAdventurePredicate.itemAdventurePredicate(canBreak));*/
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the {@code can_place_on} data component to the provided list of {@link Material}.
|
||||||
|
* @param canPlaceOn a list of {@link Material}.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder canPlaceOnMaterials(Collection<Material> canPlaceOn) {
|
||||||
|
return canPlaceOn(canPlaceOn.stream().map(Material::getKey).toList());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the {@code can_place_on} data component to the provided list of {@link NamespacedKey}.
|
||||||
|
* @param canPlaceOn a list of block predicate. If empty, unsets the data component. If null, reset to default.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("removal")
|
||||||
|
public ItemStackBuilder canPlaceOn(Collection<NamespacedKey> canPlaceOn) {
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
Collection<com.destroystokyo.paper.Namespaced> nsCanPlaceOn = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canPlaceOn;
|
||||||
|
return meta(m -> m.setPlaceableKeys(nsCanPlaceOn));
|
||||||
|
|
||||||
|
/* if (canPlaceOn == null)
|
||||||
|
return resetData(DataComponentTypes.CAN_PLACE_ON);
|
||||||
|
else if (canPlaceOn.isEmpty())
|
||||||
|
return unsetData(DataComponentTypes.CAN_PLACE_ON);
|
||||||
|
else
|
||||||
|
return data(DataComponentTypes.CAN_PLACE_ON, ItemAdventurePredicate.itemAdventurePredicate(canPlaceOn)); */
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the {@code profile} data component to the provided profile.
|
||||||
|
* @param profile the profile to use as the component value.
|
||||||
|
* @return itself.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder profile(ResolvableProfile profile) {
|
||||||
|
return data(DataComponentTypes.PROFILE, profile);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build the {@link ItemStack}.
|
||||||
|
* @return the build item stack.
|
||||||
|
*/
|
||||||
|
public ItemStack build() {
|
||||||
|
return stack;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
}
|
@@ -0,0 +1,126 @@
|
|||||||
|
package fr.pandacube.lib.paper.inventory;
|
||||||
|
|
||||||
|
import com.destroystokyo.paper.profile.ProfileProperty;
|
||||||
|
import io.papermc.paper.datacomponent.item.ResolvableProfile;
|
||||||
|
import org.bukkit.Material;
|
||||||
|
import org.bukkit.inventory.ItemStack;
|
||||||
|
|
||||||
|
import java.util.Base64;
|
||||||
|
import java.util.regex.Pattern;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents some special mob heads, also support creating player skulls and custom skulls.
|
||||||
|
*/
|
||||||
|
public enum Skull {
|
||||||
|
|
||||||
|
/** Jungle wood arrow left. */
|
||||||
|
ARROW_LEFT("http://textures.minecraft.net/texture/3625902b389ed6c147574e422da8f8f361c8eb57e7631676a72777e7b1d"),
|
||||||
|
/** Jungle wood arrow right. */
|
||||||
|
ARROW_RIGHT("http://textures.minecraft.net/texture/d4be8aeec11849697adc6fd1f189b16642dff19f2955c05deaba68c9dff1be"),
|
||||||
|
/** Jungle wood arrow up. */
|
||||||
|
ARROW_UP("http://textures.minecraft.net/texture/88c0f37dec764d6e26b57aa8212572fbace5ee8f27f7b61c1fdaa47dd4c893"),
|
||||||
|
/** Jungle wood arrow down. */
|
||||||
|
ARROW_DOWN("http://textures.minecraft.net/texture/751ced2e647366f8f3ad2dfe415cca85651bfaf9739a95cd57b6f21cba053"),
|
||||||
|
/** Jungle wood question mark. */
|
||||||
|
QUESTION("http://textures.minecraft.net/texture/b4d7cc4dca986a53f1d6b52aaf376dc6acc73b8b287f42dc8fef5808bb5d76"),
|
||||||
|
/** Jungle wood exclamation mark. */
|
||||||
|
EXCLAMATION("http://textures.minecraft.net/texture/e869dc405a3155f281c16a3e8d9ff54afc1599153b4d9385c9b7bab88680f0");
|
||||||
|
|
||||||
|
private final String skinUrl;
|
||||||
|
|
||||||
|
Skull(String skinUrl) {
|
||||||
|
this.skinUrl = skinUrl;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Return the item based on this Skull enum.
|
||||||
|
* @return the item stack.
|
||||||
|
*/
|
||||||
|
public ItemStack get() {
|
||||||
|
return getFromSkinURL(skinUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Return an item stack builder already containing the skull.
|
||||||
|
* @return an item stack builder already containing the skull.
|
||||||
|
*/
|
||||||
|
public ItemStackBuilder builder() {
|
||||||
|
return ItemStackBuilder.wrap(get());
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Return a skull of a player based on their name.
|
||||||
|
*
|
||||||
|
* @param name player's name
|
||||||
|
* @return item stack
|
||||||
|
*/
|
||||||
|
public static ItemStack getFromPlayerName(String name) {
|
||||||
|
return getFromProfile(ResolvableProfile.resolvableProfile().name(name).build());
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Return a skull that has a custom texture specified by url.
|
||||||
|
* @param url skin url.
|
||||||
|
* @return item stack
|
||||||
|
*/
|
||||||
|
public static ItemStack getFromSkinURL(String url) {
|
||||||
|
return getFromProfile(ResolvableProfile.resolvableProfile().addProperty(getTexturesProperty(url)).build());
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
private static ItemStack getFromProfile(ResolvableProfile profile) {
|
||||||
|
return ItemStackBuilder.of(Material.PLAYER_HEAD).profile(profile).build();
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The URL prefix for all the player related textures (skin, cape)
|
||||||
|
*/
|
||||||
|
public static final String TEXTURE_URL_PREFIX = "http://textures.minecraft.net/texture/";
|
||||||
|
|
||||||
|
private static final Pattern textureIdMatcher = Pattern.compile("^[0-9a-fA-F]+$");
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Generate the base64 value of the "textures" profile property, based on the provided skin url!
|
||||||
|
* @param skinURL the URL of the skin. The "https" will be replaced by "http" because this is the protocol used in
|
||||||
|
* the profile property url. If only the texture id part is provided, {@link #TEXTURE_URL_PREFIX} is
|
||||||
|
* prepended.
|
||||||
|
* @return the base64 encoded texture data.
|
||||||
|
*/
|
||||||
|
private static String encodeTextureBase64String(String skinURL) {
|
||||||
|
if (skinURL.startsWith("https://")) // secure url is not the url found in texture data (even if it actually works in the browser)
|
||||||
|
skinURL = "http://" + skinURL.substring("https://".length());
|
||||||
|
if (!skinURL.startsWith(TEXTURE_URL_PREFIX)) { // accept taking only the texture id part ()
|
||||||
|
if (textureIdMatcher.matcher(skinURL).matches())
|
||||||
|
skinURL = TEXTURE_URL_PREFIX + skinURL;
|
||||||
|
else
|
||||||
|
throw new IllegalArgumentException("Invalid skin URL. Must be from " + TEXTURE_URL_PREFIX + ".");
|
||||||
|
}
|
||||||
|
return Base64.getEncoder().encodeToString(String.format("{\"textures\":{\"SKIN\":{\"url\":\"%s\"}}}", skinURL).getBytes());
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private static ProfileProperty getTexturesProperty(String skinURL) {
|
||||||
|
return new ProfileProperty("textures", encodeTextureBase64String(skinURL));
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
}
|
||||||
|
|
@@ -23,7 +23,7 @@ import java.util.Map;
|
|||||||
/**
|
/**
|
||||||
* Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease
|
* Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease
|
||||||
* serialization to YAML.
|
* serialization to YAML.
|
||||||
*
|
* <p>
|
||||||
* To not reinvent the wheel, this class uses the Bukkit’s Yaml API to convert the objects from/to json.
|
* To not reinvent the wheel, this class uses the Bukkit’s Yaml API to convert the objects from/to json.
|
||||||
*/
|
*/
|
||||||
/* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> {
|
/* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> {
|
||||||
|
@@ -9,10 +9,13 @@ import com.google.gson.JsonObject;
|
|||||||
import com.google.gson.JsonParseException;
|
import com.google.gson.JsonParseException;
|
||||||
import com.google.gson.JsonSerializationContext;
|
import com.google.gson.JsonSerializationContext;
|
||||||
import com.google.gson.JsonSerializer;
|
import com.google.gson.JsonSerializer;
|
||||||
|
import com.google.gson.Strictness;
|
||||||
import com.google.gson.TypeAdapterFactory;
|
import com.google.gson.TypeAdapterFactory;
|
||||||
import com.google.gson.internal.bind.TreeTypeAdapter;
|
import com.google.gson.internal.bind.TreeTypeAdapter;
|
||||||
import com.google.gson.reflect.TypeToken;
|
import com.google.gson.reflect.TypeToken;
|
||||||
|
import net.kyori.adventure.key.Key;
|
||||||
import org.bukkit.Bukkit;
|
import org.bukkit.Bukkit;
|
||||||
|
import org.bukkit.Registry;
|
||||||
import org.bukkit.configuration.serialization.ConfigurationSerializable;
|
import org.bukkit.configuration.serialization.ConfigurationSerializable;
|
||||||
import org.bukkit.configuration.serialization.ConfigurationSerialization;
|
import org.bukkit.configuration.serialization.ConfigurationSerialization;
|
||||||
import org.bukkit.inventory.ItemStack;
|
import org.bukkit.inventory.ItemStack;
|
||||||
@@ -28,16 +31,25 @@ import java.util.Map;
|
|||||||
private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { };
|
private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { };
|
||||||
|
|
||||||
/** Gson instance with no custom type adapter */
|
/** Gson instance with no custom type adapter */
|
||||||
private static final Gson vanillaGson = new GsonBuilder().setLenient().create();
|
private static final Gson vanillaGson = new GsonBuilder().setStrictness(Strictness.LENIENT).create();
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
|
public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
|
||||||
if (!(json instanceof JsonObject jsonObj))
|
if (!(json instanceof JsonObject jsonObj))
|
||||||
throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure.");
|
throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure.");
|
||||||
|
|
||||||
|
// if it contains both old and new data, delete the old one introduced for compatibility
|
||||||
|
if (jsonObj.has("DataVersion") || jsonObj.has("id")) {
|
||||||
|
jsonObj.remove("v");
|
||||||
|
jsonObj.remove("type");
|
||||||
|
}
|
||||||
|
|
||||||
|
// format used when using ConfigurationSerialization
|
||||||
if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY))
|
if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY))
|
||||||
return context.deserialize(jsonObj, ConfigurationSerializable.class);
|
return context.deserialize(jsonObj, ConfigurationSerializable.class);
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
if (jsonObj.has("meta")
|
if (jsonObj.has("meta")
|
||||||
&& jsonObj.get("meta") instanceof JsonObject metaJson
|
&& jsonObj.get("meta") instanceof JsonObject metaJson
|
||||||
&& !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) {
|
&& !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) {
|
||||||
@@ -47,6 +59,8 @@ import java.util.Map;
|
|||||||
Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType());
|
Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType());
|
||||||
fixDeserializationVersion(map);
|
fixDeserializationVersion(map);
|
||||||
map.remove("meta");
|
map.remove("meta");
|
||||||
|
|
||||||
|
|
||||||
ItemStack is = ItemStack.deserialize(map);
|
ItemStack is = ItemStack.deserialize(map);
|
||||||
|
|
||||||
Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass();
|
Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass();
|
||||||
|
@@ -14,4 +14,7 @@ public class PaperJson {
|
|||||||
Json.registerTypeAdapterFactory(ItemStackAdapter.FACTORY);
|
Json.registerTypeAdapterFactory(ItemStackAdapter.FACTORY);
|
||||||
Json.registerTypeAdapterFactory(ConfigurationSerializableAdapter.FACTORY);
|
Json.registerTypeAdapterFactory(ConfigurationSerializableAdapter.FACTORY);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private PaperJson() {}
|
||||||
}
|
}
|
||||||
|
@@ -4,7 +4,6 @@ import com.destroystokyo.paper.event.server.ServerTickEndEvent;
|
|||||||
import com.destroystokyo.paper.event.server.ServerTickStartEvent;
|
import com.destroystokyo.paper.event.server.ServerTickStartEvent;
|
||||||
import fr.pandacube.lib.chat.Chat;
|
import fr.pandacube.lib.chat.Chat;
|
||||||
import fr.pandacube.lib.chat.ChatColorGradient;
|
import fr.pandacube.lib.chat.ChatColorGradient;
|
||||||
import fr.pandacube.lib.chat.ChatColorUtil;
|
|
||||||
import fr.pandacube.lib.chat.ChatConfig.PandaTheme;
|
import fr.pandacube.lib.chat.ChatConfig.PandaTheme;
|
||||||
import fr.pandacube.lib.paper.PandaLibPaper;
|
import fr.pandacube.lib.paper.PandaLibPaper;
|
||||||
import fr.pandacube.lib.paper.players.PaperOffPlayer;
|
import fr.pandacube.lib.paper.players.PaperOffPlayer;
|
||||||
@@ -13,16 +12,16 @@ import fr.pandacube.lib.paper.scheduler.SchedulerUtil;
|
|||||||
import fr.pandacube.lib.paper.util.AutoUpdatedBossBar;
|
import fr.pandacube.lib.paper.util.AutoUpdatedBossBar;
|
||||||
import fr.pandacube.lib.paper.util.AutoUpdatedBossBar.BarUpdater;
|
import fr.pandacube.lib.paper.util.AutoUpdatedBossBar.BarUpdater;
|
||||||
import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
|
import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
|
||||||
import fr.pandacube.lib.util.log.Log;
|
|
||||||
import fr.pandacube.lib.util.MemoryUtil;
|
import fr.pandacube.lib.util.MemoryUtil;
|
||||||
import fr.pandacube.lib.util.MemoryUtil.MemoryUnit;
|
import fr.pandacube.lib.util.MemoryUtil.MemoryUnit;
|
||||||
import fr.pandacube.lib.util.TimeUtil;
|
import fr.pandacube.lib.util.TimeUtil;
|
||||||
|
import fr.pandacube.lib.util.log.Log;
|
||||||
import net.kyori.adventure.bossbar.BossBar;
|
import net.kyori.adventure.bossbar.BossBar;
|
||||||
import net.kyori.adventure.bossbar.BossBar.Color;
|
import net.kyori.adventure.bossbar.BossBar.Color;
|
||||||
import net.kyori.adventure.bossbar.BossBar.Overlay;
|
import net.kyori.adventure.bossbar.BossBar.Overlay;
|
||||||
import net.kyori.adventure.text.format.NamedTextColor;
|
import net.kyori.adventure.text.format.NamedTextColor;
|
||||||
import net.kyori.adventure.text.format.TextColor;
|
import net.kyori.adventure.text.format.TextColor;
|
||||||
import net.md_5.bungee.api.ChatColor;
|
import org.apache.commons.lang3.tuple.Pair;
|
||||||
import org.bukkit.Bukkit;
|
import org.bukkit.Bukkit;
|
||||||
import org.bukkit.command.CommandSender;
|
import org.bukkit.command.CommandSender;
|
||||||
import org.bukkit.command.ConsoleCommandSender;
|
import org.bukkit.command.ConsoleCommandSender;
|
||||||
@@ -38,6 +37,7 @@ import java.lang.management.ThreadMXBean;
|
|||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.LinkedList;
|
import java.util.LinkedList;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.concurrent.atomic.AtomicInteger;
|
||||||
|
|
||||||
import static fr.pandacube.lib.chat.ChatStatic.chat;
|
import static fr.pandacube.lib.chat.ChatStatic.chat;
|
||||||
import static fr.pandacube.lib.chat.ChatStatic.failureText;
|
import static fr.pandacube.lib.chat.ChatStatic.failureText;
|
||||||
@@ -45,10 +45,17 @@ import static fr.pandacube.lib.chat.ChatStatic.infoText;
|
|||||||
import static fr.pandacube.lib.chat.ChatStatic.successText;
|
import static fr.pandacube.lib.chat.ChatStatic.successText;
|
||||||
import static fr.pandacube.lib.chat.ChatStatic.text;
|
import static fr.pandacube.lib.chat.ChatStatic.text;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Various tools to supervise the JVM RAM and the CPU usage of the main server thread.
|
||||||
|
*/
|
||||||
public class PerformanceAnalysisManager implements Listener {
|
public class PerformanceAnalysisManager implements Listener {
|
||||||
|
|
||||||
private static PerformanceAnalysisManager instance;
|
private static PerformanceAnalysisManager instance;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the instance of {@link PerformanceAnalysisManager}.
|
||||||
|
* @return the instance of {@link PerformanceAnalysisManager}.
|
||||||
|
*/
|
||||||
public static synchronized PerformanceAnalysisManager getInstance() {
|
public static synchronized PerformanceAnalysisManager getInstance() {
|
||||||
if (instance == null)
|
if (instance == null)
|
||||||
instance = new PerformanceAnalysisManager();
|
instance = new PerformanceAnalysisManager();
|
||||||
@@ -77,14 +84,22 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
private final LinkedList<Long> interTPSDurations = new LinkedList<>();
|
private final LinkedList<Long> interTPSDurations = new LinkedList<>();
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The boss bar that shows in real time the CPU performance of the main server thread.
|
||||||
|
*/
|
||||||
public final AutoUpdatedBossBar tpsBar;
|
public final AutoUpdatedBossBar tpsBar;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The boss bar that shows in real time the JVM RAM usage.
|
||||||
|
*/
|
||||||
public final AutoUpdatedBossBar memoryBar;
|
public final AutoUpdatedBossBar memoryBar;
|
||||||
private final List<Player> barPlayers = new ArrayList<>();
|
private final List<Player> barPlayers = new ArrayList<>();
|
||||||
private final List<BossBar> relatedBossBars = new ArrayList<>();
|
private final List<BossBar> relatedBossBars = new ArrayList<>();
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The gradient of color covering the common range of TPS values.
|
||||||
|
*/
|
||||||
public final ChatColorGradient tps1sGradient = new ChatColorGradient()
|
public final ChatColorGradient tps1sGradient = new ChatColorGradient()
|
||||||
.add(0, NamedTextColor.BLACK)
|
.add(0, NamedTextColor.BLACK)
|
||||||
.add(1, NamedTextColor.DARK_RED)
|
.add(1, NamedTextColor.DARK_RED)
|
||||||
@@ -95,23 +110,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
.add(21, PandaTheme.CHAT_GREEN_1_NORMAL)
|
.add(21, PandaTheme.CHAT_GREEN_1_NORMAL)
|
||||||
.add(26, NamedTextColor.BLUE);
|
.add(26, NamedTextColor.BLUE);
|
||||||
|
|
||||||
|
private final ChatColorGradient memoryUsageGradient = new ChatColorGradient()
|
||||||
public final ChatColorGradient tps10sGradient = new ChatColorGradient()
|
|
||||||
.add(0, NamedTextColor.DARK_RED)
|
|
||||||
.add(5, NamedTextColor.RED)
|
|
||||||
.add(10, NamedTextColor.GOLD)
|
|
||||||
.add(14, NamedTextColor.YELLOW)
|
|
||||||
.add(19, PandaTheme.CHAT_GREEN_1_NORMAL);
|
|
||||||
|
|
||||||
|
|
||||||
public final ChatColorGradient tps1mGradient = new ChatColorGradient()
|
|
||||||
.add(0, NamedTextColor.DARK_RED)
|
|
||||||
.add(8, NamedTextColor.RED)
|
|
||||||
.add(14, NamedTextColor.GOLD)
|
|
||||||
.add(17, NamedTextColor.YELLOW)
|
|
||||||
.add(19, PandaTheme.CHAT_GREEN_1_NORMAL);
|
|
||||||
|
|
||||||
public final ChatColorGradient memoryUsageGradient = new ChatColorGradient()
|
|
||||||
.add(.60f, PandaTheme.CHAT_GREEN_1_NORMAL)
|
.add(.60f, PandaTheme.CHAT_GREEN_1_NORMAL)
|
||||||
.add(.70f, NamedTextColor.YELLOW)
|
.add(.70f, NamedTextColor.YELLOW)
|
||||||
.add(.80f, NamedTextColor.GOLD)
|
.add(.80f, NamedTextColor.GOLD)
|
||||||
@@ -133,10 +132,19 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Tells if the provided players is seeing the performance boss bars.
|
||||||
|
* @param p the player to verify.
|
||||||
|
* @return true if the provided players is seeing the performance boss bars, false otherwise.
|
||||||
|
*/
|
||||||
public boolean barsContainsPlayer(Player p) {
|
public boolean barsContainsPlayer(Player p) {
|
||||||
return barPlayers.contains(p);
|
return barPlayers.contains(p);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Shows the performance boss bars to the provided player.
|
||||||
|
* @param p the player.
|
||||||
|
*/
|
||||||
public synchronized void addPlayerToBars(Player p) {
|
public synchronized void addPlayerToBars(Player p) {
|
||||||
barPlayers.add(p);
|
barPlayers.add(p);
|
||||||
p.showBossBar(tpsBar.bar);
|
p.showBossBar(tpsBar.bar);
|
||||||
@@ -145,6 +153,10 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
p.showBossBar(bar);
|
p.showBossBar(bar);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Hides the performance boss bars from the provided player.
|
||||||
|
* @param p the player.
|
||||||
|
*/
|
||||||
public synchronized void removePlayerToBars(Player p) {
|
public synchronized void removePlayerToBars(Player p) {
|
||||||
p.hideBossBar(tpsBar.bar);
|
p.hideBossBar(tpsBar.bar);
|
||||||
p.hideBossBar(memoryBar.bar);
|
p.hideBossBar(memoryBar.bar);
|
||||||
@@ -153,6 +165,10 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
barPlayers.remove(p);
|
barPlayers.remove(p);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Show an additional boss bar to the players currently seeing the performance ones.
|
||||||
|
* @param bar the new bar to show.
|
||||||
|
*/
|
||||||
public synchronized void addBossBar(BossBar bar) {
|
public synchronized void addBossBar(BossBar bar) {
|
||||||
if (relatedBossBars.contains(bar))
|
if (relatedBossBars.contains(bar))
|
||||||
return;
|
return;
|
||||||
@@ -161,6 +177,10 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
p.showBossBar(bar);
|
p.showBossBar(bar);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Hides an additional boss bar from the players currently seeing the performance ones.
|
||||||
|
* @param bar the additional bar to hide.
|
||||||
|
*/
|
||||||
public synchronized void removeBossBar(BossBar bar) {
|
public synchronized void removeBossBar(BossBar bar) {
|
||||||
if (!relatedBossBars.contains(bar))
|
if (!relatedBossBars.contains(bar))
|
||||||
return;
|
return;
|
||||||
@@ -169,7 +189,10 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
p.hideBossBar(bar);
|
p.hideBossBar(bar);
|
||||||
}
|
}
|
||||||
|
|
||||||
public synchronized void cancelInternalBossBar() {
|
/**
|
||||||
|
* De-initialize the performance analyzer.
|
||||||
|
*/
|
||||||
|
public synchronized void deinit() {
|
||||||
tpsBar.cancel();
|
tpsBar.cancel();
|
||||||
memoryBar.cancel();
|
memoryBar.cancel();
|
||||||
}
|
}
|
||||||
@@ -179,7 +202,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public synchronized void onTickStart(ServerTickStartEvent event) {
|
synchronized void onTickStart(ServerTickStartEvent event) {
|
||||||
tickStartNanoTime = System.nanoTime();
|
tickStartNanoTime = System.nanoTime();
|
||||||
tickStartCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
|
tickStartCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
|
||||||
|
|
||||||
@@ -187,7 +210,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
}
|
}
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public synchronized void onTickEnd(ServerTickEndEvent event) {
|
synchronized void onTickEnd(ServerTickEndEvent event) {
|
||||||
tickEndNanoTime = System.nanoTime();
|
tickEndNanoTime = System.nanoTime();
|
||||||
long tickEndCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
|
long tickEndCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
|
||||||
|
|
||||||
@@ -214,7 +237,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onPlayerJoin(PlayerJoinEvent event) {
|
void onPlayerJoin(PlayerJoinEvent event) {
|
||||||
plugin.getServer().getScheduler().runTaskAsynchronously(plugin, () -> {
|
plugin.getServer().getScheduler().runTaskAsynchronously(plugin, () -> {
|
||||||
@SuppressWarnings("unchecked")
|
@SuppressWarnings("unchecked")
|
||||||
AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer> playerManager = (AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer>) AbstractPlayerManager.getInstance();
|
AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer> playerManager = (AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer>) AbstractPlayerManager.getInstance();
|
||||||
@@ -234,7 +257,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onPlayerQuit(PlayerQuitEvent event) {
|
void onPlayerQuit(PlayerQuitEvent event) {
|
||||||
removePlayerToBars(event.getPlayer());
|
removePlayerToBars(event.getPlayer());
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -297,18 +320,23 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
|
|
||||||
int[] tpsHistory = getTPSHistory();
|
int[] tpsHistory = getTPSHistory();
|
||||||
|
|
||||||
// keep the legacy text when generating the bar to save space when converting to component
|
List<Pair<TextColor, AtomicInteger>> barComponents = new ArrayList<>(60);
|
||||||
StringBuilder s = new StringBuilder();
|
|
||||||
ChatColor prevC = ChatColor.RESET;
|
|
||||||
for (int i = 58; i >= 0; i--) {
|
for (int i = 58; i >= 0; i--) {
|
||||||
int t = tpsHistory[i];
|
int t = tpsHistory[i];
|
||||||
ChatColor newC = ChatColorUtil.toBungee(tps1sGradient.pickColorAt(t));
|
TextColor newC = tps1sGradient.pickColorAt(t);
|
||||||
if (!newC.equals(prevC)) {
|
if (barComponents.isEmpty() || !newC.equals(barComponents.get(barComponents.size() - 1).getKey())) {
|
||||||
s.append(newC);
|
barComponents.add(Pair.of(newC, new AtomicInteger(1)));
|
||||||
prevC = newC;
|
}
|
||||||
|
else {
|
||||||
|
barComponents.get(barComponents.size() - 1).getValue().incrementAndGet();
|
||||||
}
|
}
|
||||||
s.append("|");
|
|
||||||
}
|
}
|
||||||
|
Chat history = chat();
|
||||||
|
barComponents.forEach(p -> {
|
||||||
|
history.then(text("|".repeat(p.getValue().get()))
|
||||||
|
.color(p.getKey())
|
||||||
|
);
|
||||||
|
});
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
@@ -332,7 +360,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
: (avgTickCPUTime1s < 50) ? NamedTextColor.RED
|
: (avgTickCPUTime1s < 50) ? NamedTextColor.RED
|
||||||
: NamedTextColor.DARK_RED;
|
: NamedTextColor.DARK_RED;
|
||||||
|
|
||||||
float avgTickWaitingTime1s = avgTickDuration1s - avgTickCPUTime1s;
|
float avgTickWaitingTime1s = Math.max(0, avgTickDuration1s - avgTickCPUTime1s);
|
||||||
TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL
|
TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL
|
||||||
: (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW
|
: (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW
|
||||||
: (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD
|
: (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD
|
||||||
@@ -348,16 +376,16 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
: NamedTextColor.RED;
|
: NamedTextColor.RED;
|
||||||
|
|
||||||
timings = text("(R/W/S:")
|
timings = text("(R/W/S:")
|
||||||
.then(text(Math.round(avgTickCPUTime1s)).color(avgTickCPUTime1sColor))
|
.then(text("%02d".formatted(Math.round(avgTickCPUTime1s))).color(avgTickCPUTime1sColor))
|
||||||
.thenText("/")
|
.thenText("/")
|
||||||
.then(text(Math.round(avgTickWaitingTime1s)).color(avgTickWaitingTime1sColor))
|
.then(text("%02d".formatted(Math.round(avgTickWaitingTime1s))).color(avgTickWaitingTime1sColor))
|
||||||
.thenText("/")
|
.thenText("/")
|
||||||
.then(text(Math.round(avgInterTickDuration1s)).color(avgInterTickDuration1sColor))
|
.then(text("%02d".formatted(Math.round(avgInterTickDuration1s))).color(avgInterTickDuration1sColor))
|
||||||
.thenText("ms)");
|
.thenText("ms)");
|
||||||
}
|
}
|
||||||
|
|
||||||
title = infoText("TPS [")
|
title = infoText("TPS [")
|
||||||
.thenLegacyText(s.toString())
|
.then(history)
|
||||||
.thenText("] ")
|
.thenText("] ")
|
||||||
.then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s)))
|
.then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s)))
|
||||||
.then(timings);
|
.then(timings);
|
||||||
@@ -375,6 +403,10 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
|
|
||||||
private Chat alteredTPSTitle = null;
|
private Chat alteredTPSTitle = null;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Temporary change the title of the TPS boss bar.
|
||||||
|
* @param title the title override. null to restore to the normal TPS title.
|
||||||
|
*/
|
||||||
public synchronized void setAlteredTPSTitle(Chat title) {
|
public synchronized void setAlteredTPSTitle(Chat title) {
|
||||||
alteredTPSTitle = title;
|
alteredTPSTitle = title;
|
||||||
}
|
}
|
||||||
@@ -385,17 +417,19 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
// special case where the getTPS method always returns a whole number when retrieving the TPS for 1 sec
|
/**
|
||||||
|
* Gets the number of tick in the last second.
|
||||||
|
* @return the number of tick in the last second.
|
||||||
|
*/
|
||||||
public int getTPS1s() {
|
public int getTPS1s() {
|
||||||
return (int) getTPS(1_000);
|
return (int) getTPS(1_000);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
*
|
|
||||||
* @param nbTicks number of ticks when the avg value is computed from history
|
* @param nbTicks number of ticks when the avg value is computed from history
|
||||||
* @return the avg number of TPS in the interval
|
* @return the avg number of TPS in the interval
|
||||||
*/
|
*/
|
||||||
public synchronized float getAvgNano(List<Long> data, int nbTicks) {
|
private synchronized float getAvgNano(List<Long> data, int nbTicks) {
|
||||||
if (data.isEmpty())
|
if (data.isEmpty())
|
||||||
return 0;
|
return 0;
|
||||||
|
|
||||||
@@ -409,7 +443,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
*
|
* Gets the average number of tick per second in the n last milliseconds.
|
||||||
* @param nbMillis number of milliseconds when the avg TPS is computed from history
|
* @param nbMillis number of milliseconds when the avg TPS is computed from history
|
||||||
* @return the avg number of TPS in the interval
|
* @return the avg number of TPS in the interval
|
||||||
*/
|
*/
|
||||||
@@ -430,6 +464,10 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the history of TPS performance.
|
||||||
|
* @return an array of TPS values from the last minute. The value at 0 is in the last second (current second on the clock - 1), the value at index 1 is now - 2, ...
|
||||||
|
*/
|
||||||
public synchronized int[] getTPSHistory() {
|
public synchronized int[] getTPSHistory() {
|
||||||
int[] history = new int[60];
|
int[] history = new int[60];
|
||||||
|
|
||||||
@@ -447,15 +485,22 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the current server's target tick rate.
|
||||||
|
* Usually 20 but the server can be configured to tick at a different rate.
|
||||||
|
* @return the current server's target tick rate.
|
||||||
|
*/
|
||||||
public static int getTargetTickRate() {
|
public static int getTargetTickRate() {
|
||||||
return Math.round(Bukkit.getServerTickManager().getTickRate());
|
return Math.round(Bukkit.getServerTickManager().getTickRate());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Runs the garbage collector on the server.
|
||||||
|
* Depending on the server load and the used memory, this can freeze the server for a second.
|
||||||
|
* @param sender the command sender that triggers the garbage collector. Can be null (the report will be sent to the
|
||||||
|
* console)
|
||||||
|
*/
|
||||||
public static void gc(CommandSender sender) {
|
public static void gc(CommandSender sender) {
|
||||||
long t1 = System.currentTimeMillis();
|
long t1 = System.currentTimeMillis();
|
||||||
long alloc1 = Runtime.getRuntime().totalMemory();
|
long alloc1 = Runtime.getRuntime().totalMemory();
|
||||||
@@ -477,7 +522,7 @@ public class PerformanceAnalysisManager implements Listener {
|
|||||||
Log.info(finalMessage.getLegacyText());
|
Log.info(finalMessage.getLegacyText());
|
||||||
}
|
}
|
||||||
|
|
||||||
public static String displayRound10(double val) {
|
private static String displayRound10(double val) {
|
||||||
long v = (long) Math.ceil(val * 10);
|
long v = (long) Math.ceil(val * 10);
|
||||||
return "" + (v / 10f);
|
return "" + (v / 10f);
|
||||||
}
|
}
|
||||||
|
@@ -1,10 +1,11 @@
|
|||||||
package fr.pandacube.lib.paper.players;
|
package fr.pandacube.lib.paper.players;
|
||||||
|
|
||||||
import fr.pandacube.lib.paper.reflect.util.PrimaryWorlds;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
|
||||||
|
import fr.pandacube.lib.paper.world.PrimaryWorlds;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
|
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.NbtIo;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.NbtIo;
|
||||||
import fr.pandacube.lib.paper.util.PlayerDataWrapper;
|
import fr.pandacube.lib.paper.players.PlayerDataWrapper.PlayerDataLoadException;
|
||||||
import fr.pandacube.lib.paper.world.WorldUtil;
|
import fr.pandacube.lib.paper.world.WorldUtil;
|
||||||
import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
|
import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
@@ -115,26 +116,31 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
|
|||||||
* Player config
|
* Player config
|
||||||
*/
|
*/
|
||||||
|
|
||||||
|
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
|
||||||
@Override
|
@Override
|
||||||
default String getConfig(String key) throws Exception {
|
default String getConfig(String key) throws Exception {
|
||||||
return PaperPlayerConfigStorage.get(getUniqueId(), key);
|
return PaperPlayerConfigStorage.get(getUniqueId(), key);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
|
||||||
@Override
|
@Override
|
||||||
default String getConfig(String key, String deflt) throws Exception {
|
default String getConfig(String key, String deflt) throws Exception {
|
||||||
return PaperPlayerConfigStorage.get(getUniqueId(), key, deflt);
|
return PaperPlayerConfigStorage.get(getUniqueId(), key, deflt);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
|
||||||
@Override
|
@Override
|
||||||
default void setConfig(String key, String value) throws Exception {
|
default void setConfig(String key, String value) throws Exception {
|
||||||
PaperPlayerConfigStorage.set(getUniqueId(), key, value);
|
PaperPlayerConfigStorage.set(getUniqueId(), key, value);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
|
||||||
@Override
|
@Override
|
||||||
default void updateConfig(String key, String deflt, UnaryOperator<String> updater) throws Exception {
|
default void updateConfig(String key, String deflt, UnaryOperator<String> updater) throws Exception {
|
||||||
PaperPlayerConfigStorage.update(getUniqueId(), key, deflt, updater);
|
PaperPlayerConfigStorage.update(getUniqueId(), key, deflt, updater);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
|
||||||
@Override
|
@Override
|
||||||
default void unsetConfig(String key) throws Exception {
|
default void unsetConfig(String key) throws Exception {
|
||||||
PaperPlayerConfigStorage.unset(getUniqueId(), key);
|
PaperPlayerConfigStorage.unset(getUniqueId(), key);
|
||||||
@@ -155,12 +161,16 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
|
|||||||
*/
|
*/
|
||||||
default CompoundTag getPlayerData() {
|
default CompoundTag getPlayerData() {
|
||||||
if (isOnline())
|
if (isOnline())
|
||||||
throw new IllegalStateException("Cannot access data file of " + getName() + " because they’re online.");
|
throw new IllegalStateException("Cannot access data file of " + getName() + " because they're online.");
|
||||||
return ReflectWrapper.wrapTyped(Bukkit.getServer(), CraftServer.class)
|
try {
|
||||||
.getServer()
|
return ReflectWrapper.wrapTyped(Bukkit.getServer(), CraftServer.class)
|
||||||
.getPlayerList()
|
.getServer()
|
||||||
.playerIo()
|
.getPlayerList()
|
||||||
.load(getName(), getUniqueId().toString()).orElse(null);
|
.playerIo()
|
||||||
|
.load(getName(), getUniqueId().toString(), ProblemReporter.DISCARDING()).orElse(null);
|
||||||
|
} catch (Exception|LinkageError e) {
|
||||||
|
throw new PlayerDataLoadException(getName(), getUniqueId(), e);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@@ -3,7 +3,7 @@ package fr.pandacube.lib.paper.players;
|
|||||||
import com.destroystokyo.paper.ClientOption;
|
import com.destroystokyo.paper.ClientOption;
|
||||||
import com.destroystokyo.paper.ClientOption.ChatVisibility;
|
import com.destroystokyo.paper.ClientOption.ChatVisibility;
|
||||||
import com.destroystokyo.paper.SkinParts;
|
import com.destroystokyo.paper.SkinParts;
|
||||||
import fr.pandacube.lib.paper.players.PlayerNonPersistentConfig.Expiration;
|
import fr.pandacube.lib.paper.players.PlayerNonPersistentConfig.ExpirationPolicy;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftPlayer;
|
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftPlayer;
|
||||||
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
|
import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
@@ -170,7 +170,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
|
|||||||
@Override
|
@Override
|
||||||
public boolean isChatFullyVisible() {
|
public boolean isChatFullyVisible() {
|
||||||
ChatVisibility v = getChatVisibility();
|
ChatVisibility v = getChatVisibility();
|
||||||
return v == ChatVisibility.FULL || v == ChatVisibility.UNKNOWN;
|
return v == ChatVisibility.FULL;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -283,7 +283,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
|
|||||||
* @param relZ the relative z coordinate.
|
* @param relZ the relative z coordinate.
|
||||||
*/
|
*/
|
||||||
default void teleportRelatively(float relX, float relY, float relZ) {
|
default void teleportRelatively(float relX, float relY, float relZ) {
|
||||||
getBukkitPlayer().teleport(getBukkitPlayer().getLocation().add(relX, relY, relZ), Relative.X, Relative.Y, Relative.Z, Relative.YAW, Relative.PITCH);
|
getBukkitPlayer().teleport(getBukkitPlayer().getLocation().add(relX, relY, relZ), Relative.VELOCITY_X, Relative.VELOCITY_Y, Relative.VELOCITY_Z, Relative.VELOCITY_ROTATION);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -291,7 +291,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
|
|||||||
* @param destination the destination.
|
* @param destination the destination.
|
||||||
*/
|
*/
|
||||||
default void teleportRelatively(Location destination) {
|
default void teleportRelatively(Location destination) {
|
||||||
getBukkitPlayer().teleport(destination, Relative.X, Relative.Y, Relative.Z, Relative.YAW, Relative.PITCH);
|
getBukkitPlayer().teleport(destination, Relative.VELOCITY_X, Relative.VELOCITY_Y, Relative.VELOCITY_Z, Relative.VELOCITY_ROTATION);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -304,18 +304,39 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
|
|||||||
* Player config
|
* Player config
|
||||||
*/
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the non-persistent value of the provided configuration key of this player.
|
||||||
|
* @param key the configuration key.
|
||||||
|
* @return the value of the configuration, or null if the configuration is not set.
|
||||||
|
*/
|
||||||
default String getNonPersistentConfig(String key) {
|
default String getNonPersistentConfig(String key) {
|
||||||
return PlayerNonPersistentConfig.getData(getUniqueId(), key);
|
return PlayerNonPersistentConfig.getData(getUniqueId(), key);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the non-persistent value of the provided configuration key of this player.
|
||||||
|
* @param key the configuration key.
|
||||||
|
* @param deflt the default value if the configuration is not set.
|
||||||
|
* @return the value of the configuration, or {@code deflt} if the configuration is not set.
|
||||||
|
*/
|
||||||
default String getNonPersistentConfig(String key, String deflt) {
|
default String getNonPersistentConfig(String key, String deflt) {
|
||||||
return PlayerNonPersistentConfig.getData(getUniqueId(), key);
|
return PlayerNonPersistentConfig.getData(getUniqueId(), key);
|
||||||
}
|
}
|
||||||
|
|
||||||
default void setNonPersistentConfig(String key, String value, Expiration expiration) {
|
/**
|
||||||
PlayerNonPersistentConfig.setData(getUniqueId(), key, value, expiration);
|
* Sets the non-persistent value of the provided configuration key for this player.
|
||||||
|
* @param key the configuration key to set.
|
||||||
|
* @param value the new value.
|
||||||
|
* @param expirationPolicy the expiration policy.
|
||||||
|
*/
|
||||||
|
default void setNonPersistentConfig(String key, String value, ExpirationPolicy expirationPolicy) {
|
||||||
|
PlayerNonPersistentConfig.setData(getUniqueId(), key, value, expirationPolicy);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unsets the non-persistent value of the provided configuration key for this player.
|
||||||
|
* @param key the configuration key to update.
|
||||||
|
*/
|
||||||
default void unsetNonPersistentConfig(String key) {
|
default void unsetNonPersistentConfig(String key) {
|
||||||
PlayerNonPersistentConfig.unsetData(getUniqueId(), key);
|
PlayerNonPersistentConfig.unsetData(getUniqueId(), key);
|
||||||
}
|
}
|
||||||
|
@@ -16,6 +16,10 @@ import java.util.UUID;
|
|||||||
import java.util.function.UnaryOperator;
|
import java.util.function.UnaryOperator;
|
||||||
import java.util.stream.Collectors;
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Provides rudimentary player data storage using a file in the plugin configuration.
|
||||||
|
* The file is loaded on the first access, and is auto-saved if needed every 30 seconds.
|
||||||
|
*/
|
||||||
public class PaperPlayerConfigStorage {
|
public class PaperPlayerConfigStorage {
|
||||||
|
|
||||||
static final File storageFile = new File(PandaLibPaper.getPlugin().getDataFolder(), "playerdata.yml");
|
static final File storageFile = new File(PandaLibPaper.getPlugin().getDataFolder(), "playerdata.yml");
|
||||||
@@ -77,6 +81,8 @@ public class PaperPlayerConfigStorage {
|
|||||||
|
|
||||||
|
|
||||||
private static synchronized void save() {
|
private static synchronized void save() {
|
||||||
|
if (!changed)
|
||||||
|
return;
|
||||||
YamlConfiguration config = new YamlConfiguration();
|
YamlConfiguration config = new YamlConfiguration();
|
||||||
for (UUID pId : playerSortedData.keySet()) {
|
for (UUID pId : playerSortedData.keySet()) {
|
||||||
String pIdStr = pId.toString();
|
String pIdStr = pId.toString();
|
||||||
@@ -109,11 +115,17 @@ public class PaperPlayerConfigStorage {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
public static synchronized void set(UUID player, String key, String newValue) {
|
/**
|
||||||
|
* Sets the value of the provided configuration key for the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key to set.
|
||||||
|
* @param value the new value.
|
||||||
|
*/
|
||||||
|
public static synchronized void set(UUID player, String key, String value) {
|
||||||
initIfNeeded();
|
initIfNeeded();
|
||||||
ConfigKey cKey = new ConfigKey(player, key);
|
ConfigKey cKey = new ConfigKey(player, key);
|
||||||
ConfigEntry e = data.get(cKey);
|
ConfigEntry e = data.get(cKey);
|
||||||
if (e != null && newValue == null) { // delete
|
if (e != null && value == null) { // delete
|
||||||
data.remove(cKey);
|
data.remove(cKey);
|
||||||
if (playerSortedData.containsKey(player))
|
if (playerSortedData.containsKey(player))
|
||||||
playerSortedData.get(player).remove(e);
|
playerSortedData.get(player).remove(e);
|
||||||
@@ -121,50 +133,91 @@ public class PaperPlayerConfigStorage {
|
|||||||
keySortedData.get(key).remove(e);
|
keySortedData.get(key).remove(e);
|
||||||
changed = true;
|
changed = true;
|
||||||
}
|
}
|
||||||
else if (e == null && newValue != null) { // create
|
else if (e == null && value != null) { // create
|
||||||
create(player, key, newValue);
|
create(player, key, value);
|
||||||
changed = true;
|
changed = true;
|
||||||
}
|
}
|
||||||
else if (e != null && !newValue.equals(e.value)) { // update
|
else if (e != null && !value.equals(e.value)) { // update
|
||||||
e.value = newValue;
|
e.value = value;
|
||||||
changed = true;
|
changed = true;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the value of the provided configuration key of the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key.
|
||||||
|
* @return the value of the configuration, or null if the configuration is not set.
|
||||||
|
*/
|
||||||
public static synchronized String get(UUID player, String key) {
|
public static synchronized String get(UUID player, String key) {
|
||||||
initIfNeeded();
|
initIfNeeded();
|
||||||
ConfigEntry e = data.get(new ConfigKey(player, key));
|
ConfigEntry e = data.get(new ConfigKey(player, key));
|
||||||
return e != null ? e.value : null;
|
return e != null ? e.value : null;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static String get(UUID p, String k, String deflt) {
|
/**
|
||||||
String value = get(p, k);
|
* Gets the value of the provided configuration key of the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key.
|
||||||
|
* @param deflt the default value if the configuration is not set.
|
||||||
|
* @return the value of the configuration, or {@code deflt} if the configuration is not set.
|
||||||
|
*/
|
||||||
|
public static String get(UUID player, String key, String deflt) {
|
||||||
|
String value = get(player, key);
|
||||||
return value == null ? deflt : value;
|
return value == null ? deflt : value;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static synchronized void update(UUID p, String k, String deflt, UnaryOperator<String> updater) {
|
/**
|
||||||
String oldValue = get(p, k, deflt);
|
* Updates the value of the provided configuration key for the player, using the provided updater.
|
||||||
set(p, k, updater.apply(oldValue));
|
* @param player the player.
|
||||||
|
* @param key the configuration key to update.
|
||||||
|
* @param deflt the default value to use if the configuration is not already set.
|
||||||
|
* @param updater the unary operator to use to update th value. The old value is used as the parameter of the updater,
|
||||||
|
* and it returns the new value of the configuration.
|
||||||
|
*/
|
||||||
|
public static synchronized void update(UUID player, String key, String deflt, UnaryOperator<String> updater) {
|
||||||
|
String oldValue = get(player, key, deflt);
|
||||||
|
set(player, key, updater.apply(oldValue));
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void unset(UUID p, String k) {
|
/**
|
||||||
set(p, k, null);
|
* Unsets the value of the provided configuration key for the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key to update.
|
||||||
|
*/
|
||||||
|
public static void unset(UUID player, String key) {
|
||||||
|
set(player, key, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
public static LinkedHashSet<ConfigEntry> getAllFromPlayer(UUID p) {
|
* Gets all the config key-value pairs of the provided player.
|
||||||
|
* @param player the player.
|
||||||
|
* @return all the config key-value pairs of the provided player.
|
||||||
|
*/
|
||||||
|
public static LinkedHashSet<ConfigEntry> getAllFromPlayer(UUID player) {
|
||||||
initIfNeeded();
|
initIfNeeded();
|
||||||
return new LinkedHashSet<>(playerSortedData.getOrDefault(p, new LinkedHashSet<>()));
|
return new LinkedHashSet<>(playerSortedData.getOrDefault(player, new LinkedHashSet<>()));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets all the config key-value pairs of all players that have the provided key.
|
||||||
|
* @param key the key.
|
||||||
|
* @return all the config key-value pairs of all players that have the provided key.
|
||||||
|
*/
|
||||||
public static LinkedHashSet<ConfigEntry> getAllWithKeys(String key) {
|
public static LinkedHashSet<ConfigEntry> getAllWithKeys(String key) {
|
||||||
initIfNeeded();
|
initIfNeeded();
|
||||||
return new LinkedHashSet<>(keySortedData.getOrDefault(key, new LinkedHashSet<>()));
|
return new LinkedHashSet<>(keySortedData.getOrDefault(key, new LinkedHashSet<>()));
|
||||||
}
|
}
|
||||||
|
|
||||||
public static LinkedHashSet<ConfigEntry> getAllWithKeyValue(String k, String v) {
|
/**
|
||||||
|
* Gets all the config key-value pairs of all players that have the provided key AND value.
|
||||||
|
* @param key the key.
|
||||||
|
* @param v the value.
|
||||||
|
* @return all the config key-value pairs of all players that have the provided key AND value.
|
||||||
|
*/
|
||||||
|
public static LinkedHashSet<ConfigEntry> getAllWithKeyValue(String key, String v) {
|
||||||
initIfNeeded();
|
initIfNeeded();
|
||||||
return getAllWithKeys(k).stream()
|
return getAllWithKeys(key).stream()
|
||||||
.filter(c -> c.value.equals(v))
|
.filter(c -> c.value.equals(v))
|
||||||
.collect(Collectors.toCollection(LinkedHashSet::new));
|
.collect(Collectors.toCollection(LinkedHashSet::new));
|
||||||
}
|
}
|
||||||
@@ -173,25 +226,46 @@ public class PaperPlayerConfigStorage {
|
|||||||
|
|
||||||
private record ConfigKey(UUID playerId, String key) { }
|
private record ConfigKey(UUID playerId, String key) { }
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Class holding the playerId-key-value triplet.
|
||||||
|
*/
|
||||||
public static class ConfigEntry {
|
public static class ConfigEntry {
|
||||||
private final UUID playerId;
|
private final UUID playerId;
|
||||||
private final String key;
|
private final String key;
|
||||||
private String value;
|
private String value;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new {@link ConfigEntry}.
|
||||||
|
* @param playerId the player id.
|
||||||
|
* @param key the key.
|
||||||
|
* @param value the value.
|
||||||
|
*/
|
||||||
private ConfigEntry(UUID playerId, String key, String value) {
|
private ConfigEntry(UUID playerId, String key, String value) {
|
||||||
this.playerId = playerId;
|
this.playerId = playerId;
|
||||||
this.key = key;
|
this.key = key;
|
||||||
this.value = value;
|
this.value = value;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the player id.
|
||||||
|
* @return the player id.
|
||||||
|
*/
|
||||||
public UUID getPlayerId() {
|
public UUID getPlayerId() {
|
||||||
return playerId;
|
return playerId;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the config key.
|
||||||
|
* @return the config key.
|
||||||
|
*/
|
||||||
public String getKey() {
|
public String getKey() {
|
||||||
return key;
|
return key;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the config value.
|
||||||
|
* @return the config value.
|
||||||
|
*/
|
||||||
public String getValue() {
|
public String getValue() {
|
||||||
return value;
|
return value;
|
||||||
}
|
}
|
||||||
@@ -208,4 +282,7 @@ public class PaperPlayerConfigStorage {
|
|||||||
&& Objects.equals(key, o.key);
|
&& Objects.equals(key, o.key);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private PaperPlayerConfigStorage() {}
|
||||||
}
|
}
|
||||||
|
@@ -0,0 +1,237 @@
|
|||||||
|
package fr.pandacube.lib.paper.players;
|
||||||
|
|
||||||
|
import fr.pandacube.lib.paper.inventory.DummyPlayerInventory;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftItemStack;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
|
||||||
|
import fr.pandacube.lib.paper.util.ExperienceUtil;
|
||||||
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
|
import org.bukkit.Bukkit;
|
||||||
|
import org.bukkit.event.inventory.InventoryType;
|
||||||
|
import org.bukkit.inventory.Inventory;
|
||||||
|
import org.bukkit.inventory.ItemStack;
|
||||||
|
import org.bukkit.inventory.PlayerInventory;
|
||||||
|
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.Map.Entry;
|
||||||
|
import java.util.Optional;
|
||||||
|
import java.util.TreeMap;
|
||||||
|
import java.util.UUID;
|
||||||
|
import java.util.function.IntUnaryOperator;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A wrapper to easily manipulate the player data file.
|
||||||
|
*
|
||||||
|
* @param data The NBT data structure as it is stored in the player file.
|
||||||
|
*/
|
||||||
|
public record PlayerDataWrapper(CompoundTag data) {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new wrapper for the provided player data.
|
||||||
|
* @param data the NBT data to wrap.
|
||||||
|
*/
|
||||||
|
public PlayerDataWrapper(CompoundTag data) {
|
||||||
|
this.data = data == null ? new CompoundTag() : data;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a snapshot of the inventory of this player.
|
||||||
|
* If the inventory is modified, the {@link #setInventory(PlayerInventory)} method should be called to update the
|
||||||
|
* data in this wrapper.
|
||||||
|
* @return the player inventory.
|
||||||
|
*/
|
||||||
|
public PlayerInventory getInventory() {
|
||||||
|
return new DummyPlayerInventory(
|
||||||
|
getBukkitInventory("Inventory", InventoryType.PLAYER, this::fromNBTtoBukkitInventorySlot),
|
||||||
|
getHeldItemSlot());
|
||||||
|
}
|
||||||
|
|
||||||
|
private int fromNBTtoBukkitInventorySlot(int nbtSlot) {
|
||||||
|
// cat nbEl NBTSlot bukkitSlot NBT->Bukkit
|
||||||
|
// items 36 0-35 ==
|
||||||
|
// armor 4 starts at 100 36-39 -100 + 36
|
||||||
|
// offhand 1 starts at 150 40 -150 + 40
|
||||||
|
if (nbtSlot >= 0 && nbtSlot < 36) { // regular inventory slots
|
||||||
|
return nbtSlot;
|
||||||
|
}
|
||||||
|
if (nbtSlot >= 100 && nbtSlot < 104) { // armor slots
|
||||||
|
return nbtSlot - 100 + 36;
|
||||||
|
}
|
||||||
|
if (nbtSlot == 150) { // second hand
|
||||||
|
return 40;
|
||||||
|
}
|
||||||
|
throw new IllegalArgumentException("Unrecognized NBT player inventory slot " + nbtSlot);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the player inventory to the content of the provided one.
|
||||||
|
* The internal data of this wrapper will be updated.
|
||||||
|
* @param inv the inventory to store in this player data in place of the old one.
|
||||||
|
*/
|
||||||
|
public void setInventory(PlayerInventory inv) {
|
||||||
|
setBukkitInventory("Inventory", inv, this::fromBukkitToNBTInventorySlot);
|
||||||
|
setHeldItemSlot(inv.getHeldItemSlot());
|
||||||
|
}
|
||||||
|
|
||||||
|
private int fromBukkitToNBTInventorySlot(int bukkitSlot) {
|
||||||
|
if (bukkitSlot >= 0 && bukkitSlot < 36) { // regular inventory slots
|
||||||
|
return bukkitSlot;
|
||||||
|
}
|
||||||
|
if (bukkitSlot >= 36 && bukkitSlot < 40) { // armor slots
|
||||||
|
return bukkitSlot + 100 - 36;
|
||||||
|
}
|
||||||
|
if (bukkitSlot == 40) { // second hand
|
||||||
|
return 150;
|
||||||
|
}
|
||||||
|
throw new IllegalArgumentException("Unrecognized Bukkit player inventory slot " + bukkitSlot);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a snapshot of the enderchest of this player.
|
||||||
|
* If the enderchest is modified, the {@link #setEnderChest(Inventory)} method should be called to update the
|
||||||
|
* data in this wrapper.
|
||||||
|
* @return the player enderchest.
|
||||||
|
*/
|
||||||
|
public Inventory getEnderChest() {
|
||||||
|
return getBukkitInventory("EnderItems", InventoryType.ENDER_CHEST, IntUnaryOperator.identity());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the player enderchest to the content of the provided one.
|
||||||
|
* The internal data of this wrapper will be updated.
|
||||||
|
* @param inv the enderchest content to store in this player data in place of the old enderchest.
|
||||||
|
*/
|
||||||
|
public void setEnderChest(Inventory inv) {
|
||||||
|
setBukkitInventory("EnderItems", inv, IntUnaryOperator.identity());
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private Inventory getBukkitInventory(String nbtKey, InventoryType bukkitType, IntUnaryOperator nbtToBukkitSlotConverter) {
|
||||||
|
Map<Integer, ItemStack> stacks = getRawInventoryContent(nbtKey);
|
||||||
|
Inventory inv = Bukkit.createInventory(null, bukkitType);
|
||||||
|
if (stacks.isEmpty())
|
||||||
|
return inv;
|
||||||
|
for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
|
||||||
|
inv.setItem(nbtToBukkitSlotConverter.applyAsInt(is.getKey()), is.getValue());
|
||||||
|
}
|
||||||
|
return inv;
|
||||||
|
}
|
||||||
|
|
||||||
|
private Map<Integer, ItemStack> getRawInventoryContent(String key) {
|
||||||
|
|
||||||
|
ValueInput vi = TagValueInput.createGlobal(ProblemReporter.DISCARDING(), data);
|
||||||
|
Iterable<?> listNMSItemStackWithSlot = ReflectWrapper.unwrap(vi.listOrEmpty(key, ItemStackWithSlot.CODEC()));
|
||||||
|
|
||||||
|
Map<Integer, ItemStack> stacks = new TreeMap<>();
|
||||||
|
|
||||||
|
for (Object nmsISWS : listNMSItemStackWithSlot) {
|
||||||
|
ItemStackWithSlot isws = ReflectWrapper.wrap(nmsISWS, ItemStackWithSlot.class);
|
||||||
|
|
||||||
|
int nbtSlot = isws.slot() & 255;
|
||||||
|
Optional.of(isws.stack())
|
||||||
|
.map(nms -> filterStack(CraftItemStack.asCraftMirror(nms)))
|
||||||
|
.ifPresent(is -> stacks.put(nbtSlot, is));
|
||||||
|
}
|
||||||
|
return stacks;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private void setBukkitInventory(String nbtKey, Inventory inv, IntUnaryOperator bukkitToNBTSlotConverter) {
|
||||||
|
Map<Integer, ItemStack> stacks = new TreeMap<>();
|
||||||
|
if (inv == null) {
|
||||||
|
setRawInventoryContent(nbtKey, stacks);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
for (int bukkitSlot = 0; bukkitSlot < inv.getSize(); bukkitSlot++) {
|
||||||
|
ItemStack is = filterStack(inv.getItem(bukkitSlot));
|
||||||
|
if (is == null)
|
||||||
|
continue;
|
||||||
|
int nbtSlot = bukkitToNBTSlotConverter.applyAsInt(bukkitSlot);
|
||||||
|
stacks.put(nbtSlot, is);
|
||||||
|
}
|
||||||
|
setRawInventoryContent(nbtKey, stacks);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void setRawInventoryContent(String key, Map<Integer, ItemStack> stacks) {
|
||||||
|
|
||||||
|
TagValueOutput vo = TagValueOutput.createWrappingGlobal(ProblemReporter.DISCARDING(), data);
|
||||||
|
ValueOutputTypedOutputList listNMSItemStackWithSlot = vo.list(key, ItemStackWithSlot.CODEC());
|
||||||
|
|
||||||
|
for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
|
||||||
|
ItemStack stack = filterStack(is.getValue());
|
||||||
|
if (stack == null)
|
||||||
|
continue;
|
||||||
|
|
||||||
|
listNMSItemStackWithSlot.add(ReflectWrapper.unwrap(new ItemStackWithSlot(is.getKey(), CraftItemStack.asNMSCopy(is.getValue()))));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private ItemStack filterStack(ItemStack is) {
|
||||||
|
return is == null || is.isEmpty() || is.getAmount() <= 0 ? null : is;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private int getHeldItemSlot() {
|
||||||
|
return data.getInt("SelectedItemSlot").orElse(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void setHeldItemSlot(int slot) {
|
||||||
|
data.putInt("SelectedItemSlot", slot);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the score of the player, as stored in the data with the key {@code Score}.
|
||||||
|
* @return the value of Score.
|
||||||
|
*/
|
||||||
|
public int getScore() {
|
||||||
|
return data.getInt("Score").orElse(0);
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the score of the player, as stored in the data with the key {@code Score}.
|
||||||
|
* @param score the value of Score to set.
|
||||||
|
*/
|
||||||
|
public void setScore(int score) {
|
||||||
|
data.putInt("Score", score);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the total experience of the player, as stored in the data with the key {@code XpTotal}.
|
||||||
|
* @return the value of XpTotal.
|
||||||
|
*/
|
||||||
|
public int getTotalExperience() {
|
||||||
|
return data.getInt("XpTotal").orElse(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the total experience of the player, as stored in the data with the key {@code XpTotal}.
|
||||||
|
* @param xp the value of XpTotal to set.
|
||||||
|
*/
|
||||||
|
public void setTotalExperience(int xp) {
|
||||||
|
data.putInt("XpTotal", xp);
|
||||||
|
double levelAndExp = ExperienceUtil.getLevelFromExp(xp);
|
||||||
|
int level = (int) levelAndExp;
|
||||||
|
double expProgress = levelAndExp - level;
|
||||||
|
data.putInt("XpLevel", level);
|
||||||
|
data.putFloat("XpP", (float) expProgress);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Thrown to indicate that an error occurred while loading the data of the player from the file.
|
||||||
|
*/
|
||||||
|
public static class PlayerDataLoadException extends RuntimeException {
|
||||||
|
/* package */ PlayerDataLoadException(String playerName, UUID playerId, Throwable cause) {
|
||||||
|
super("Unable to load data of player " + playerName + " (" + playerId + ")", cause);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
@@ -12,6 +12,9 @@ import java.util.Map;
|
|||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
import java.util.UUID;
|
import java.util.UUID;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Handles the player related configuration that is not persisted to disk.
|
||||||
|
*/
|
||||||
public class PlayerNonPersistentConfig {
|
public class PlayerNonPersistentConfig {
|
||||||
private static final Map<UUID, Map<String, ConfigEntry>> data = new HashMap<>();
|
private static final Map<UUID, Map<String, ConfigEntry>> data = new HashMap<>();
|
||||||
|
|
||||||
@@ -22,34 +25,58 @@ public class PlayerNonPersistentConfig {
|
|||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
public static void setData(UUID playerId, String key, String value, Expiration expiration) {
|
/**
|
||||||
data.computeIfAbsent(Objects.requireNonNull(playerId, "playerId"), pp -> new HashMap<>())
|
* Sets the value of the provided configuration key for the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key to set.
|
||||||
|
* @param value the new value.
|
||||||
|
* @param expirationPolicy the expiration policy for this config. If the config key already exists for this player. the expiration will be overridden.
|
||||||
|
*/
|
||||||
|
public static void setData(UUID player, String key, String value, ExpirationPolicy expirationPolicy) {
|
||||||
|
data.computeIfAbsent(Objects.requireNonNull(player, "playerId"), pp -> new HashMap<>())
|
||||||
.put(Objects.requireNonNull(key, "key"),
|
.put(Objects.requireNonNull(key, "key"),
|
||||||
new ConfigEntry(Objects.requireNonNull(value, "value"),
|
new ConfigEntry(Objects.requireNonNull(value, "value"),
|
||||||
Objects.requireNonNull(expiration, "expiration")
|
Objects.requireNonNull(expirationPolicy, "expiration")
|
||||||
)
|
)
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void unsetData(UUID playerId, String key) {
|
/**
|
||||||
data.getOrDefault(Objects.requireNonNull(playerId, "playerId"), new HashMap<>())
|
* Unsets the value of the provided configuration key for the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key to update.
|
||||||
|
*/
|
||||||
|
public static void unsetData(UUID player, String key) {
|
||||||
|
data.getOrDefault(Objects.requireNonNull(player, "playerId"), new HashMap<>())
|
||||||
.remove(Objects.requireNonNull(key, "key"));
|
.remove(Objects.requireNonNull(key, "key"));
|
||||||
}
|
}
|
||||||
|
|
||||||
public static String getData(UUID playerId, String key) {
|
/**
|
||||||
Map<String, ConfigEntry> playerData = data.getOrDefault(Objects.requireNonNull(playerId, "playerId"), new HashMap<>());
|
* Gets the value of the provided configuration key of the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key.
|
||||||
|
* @return the value of the configuration, or {@code deflt} if the configuration is not set.
|
||||||
|
*/
|
||||||
|
public static String getData(UUID player, String key) {
|
||||||
|
Map<String, ConfigEntry> playerData = data.getOrDefault(Objects.requireNonNull(player, "playerId"), new HashMap<>());
|
||||||
ConfigEntry ce = playerData.get(Objects.requireNonNull(key, "key"));
|
ConfigEntry ce = playerData.get(Objects.requireNonNull(key, "key"));
|
||||||
if (ce == null)
|
if (ce == null)
|
||||||
return null;
|
return null;
|
||||||
if (!ce.expiration.valid(playerId, key)) {
|
if (!ce.expirationPolicy.valid(player, key)) {
|
||||||
playerData.remove(key);
|
playerData.remove(key);
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
return ce.value;
|
return ce.value;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static boolean isDataSet(UUID playerId, String key) {
|
/**
|
||||||
return getData(playerId, key) != null;
|
* Tells if the provided config key is set for the player.
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key.
|
||||||
|
* @return true if the value is set, false otherwise.
|
||||||
|
*/
|
||||||
|
public static boolean isDataSet(UUID player, String key) {
|
||||||
|
return getData(player, key) != null;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -63,34 +90,76 @@ public class PlayerNonPersistentConfig {
|
|||||||
|
|
||||||
|
|
||||||
|
|
||||||
private record ConfigEntry(String value, Expiration expiration) { }
|
private record ConfigEntry(String value, ExpirationPolicy expirationPolicy) { }
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Super class for all expiration policies.
|
||||||
|
*/
|
||||||
|
public static abstract class ExpirationPolicy {
|
||||||
|
/**
|
||||||
|
* Creates an expiration policy.
|
||||||
|
*/
|
||||||
|
public ExpirationPolicy() {}
|
||||||
|
|
||||||
|
/**
|
||||||
public static abstract class Expiration {
|
* Tests if the associated configuration is still valid (not expired).
|
||||||
|
* @param player the player.
|
||||||
|
* @param key the configuration key.
|
||||||
|
* @return true if the associated configuration is still valid, false otherwise.
|
||||||
|
*/
|
||||||
abstract boolean valid(UUID player, String key);
|
abstract boolean valid(UUID player, String key);
|
||||||
}
|
}
|
||||||
|
|
||||||
public static class ExpiresLogout extends Expiration {
|
/**
|
||||||
|
* Expiration policy for a config that expires when the player logs out.
|
||||||
|
*/
|
||||||
|
public static class ExpiresLogout extends ExpirationPolicy {
|
||||||
|
/**
|
||||||
|
* Creates a logout expiration policy.
|
||||||
|
*/
|
||||||
|
public ExpiresLogout() {
|
||||||
|
super();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
protected boolean valid(UUID player, String key) {
|
protected boolean valid(UUID player, String key) {
|
||||||
return Bukkit.getPlayer(player) != null; // should not be call if player reconnects because it is removed on player quit
|
return Bukkit.getPlayer(player) != null; // should not be call if player reconnects because it is removed on player quit
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static class ExpiresTick extends Expiration {
|
/**
|
||||||
|
* Expiration policy for a config that expires after a certain amount of game tick.
|
||||||
|
*/
|
||||||
|
public static class ExpiresTick extends ExpirationPolicy {
|
||||||
final long expirationTick;
|
final long expirationTick;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a delay expiration policy.
|
||||||
|
* @param expirationDelayTick the number of tick after which the config will expire. If 0, will expire immediately ; 1 to expire on the next tick.
|
||||||
|
*/
|
||||||
public ExpiresTick(long expirationDelayTick) {
|
public ExpiresTick(long expirationDelayTick) {
|
||||||
expirationTick = tick + expirationDelayTick;
|
expirationTick = tick + expirationDelayTick;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
protected boolean valid(UUID player, String key) {
|
protected boolean valid(UUID player, String key) {
|
||||||
return tick < expirationTick;
|
return tick < expirationTick;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static class ExpiresServerStop extends Expiration {
|
/**
|
||||||
|
* Expiration policy for a config that expires when the server stops.
|
||||||
|
*/
|
||||||
|
public static class ExpiresServerStop extends ExpirationPolicy {
|
||||||
|
/**
|
||||||
|
* Creates a server stop expiration policy.
|
||||||
|
*/
|
||||||
|
public ExpiresServerStop() {
|
||||||
|
super();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
protected boolean valid(UUID player, String key) {
|
protected boolean valid(UUID player, String key) {
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
@@ -103,7 +172,7 @@ public class PlayerNonPersistentConfig {
|
|||||||
|
|
||||||
|
|
||||||
private static class ConfigListeners implements Listener {
|
private static class ConfigListeners implements Listener {
|
||||||
public ConfigListeners() {
|
private ConfigListeners() {
|
||||||
Bukkit.getPluginManager().registerEvents(this, PandaLibPaper.getPlugin());
|
Bukkit.getPluginManager().registerEvents(this, PandaLibPaper.getPlugin());
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -111,7 +180,7 @@ public class PlayerNonPersistentConfig {
|
|||||||
public void onPlayerQuit(PlayerQuitEvent event) {
|
public void onPlayerQuit(PlayerQuitEvent event) {
|
||||||
data.getOrDefault(event.getPlayer().getUniqueId(), new HashMap<>())
|
data.getOrDefault(event.getPlayer().getUniqueId(), new HashMap<>())
|
||||||
.entrySet()
|
.entrySet()
|
||||||
.removeIf(e -> e.getValue().expiration instanceof ExpiresLogout);
|
.removeIf(e -> e.getValue().expirationPolicy instanceof ExpiresLogout);
|
||||||
}
|
}
|
||||||
|
|
||||||
@EventHandler
|
@EventHandler
|
||||||
@@ -119,4 +188,9 @@ public class PlayerNonPersistentConfig {
|
|||||||
tick++;
|
tick++;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
private PlayerNonPersistentConfig() {}
|
||||||
}
|
}
|
||||||
|
@@ -23,4 +23,6 @@ public class OBCReflect {
|
|||||||
return Reflect.ofClass(CRAFTBUKKIT_PACKAGE + "." + obcClass);
|
return Reflect.ofClass(CRAFTBUKKIT_PACKAGE + "." + obcClass);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private OBCReflect() { }
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -14,9 +14,7 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
|
|||||||
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter;
|
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType;
|
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry;
|
import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.DetectedVersion;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.WorldVersion;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
|
||||||
@@ -54,17 +52,25 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerGamePacketL
|
|||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.RegionFileStorage;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInputTypedInputList;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutput;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock;
|
||||||
@@ -72,13 +78,13 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.Block;
|
|||||||
import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf;
|
import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled;
|
import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.QueuedChangesMapLong2Object;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PaperBrigadier;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PaperBrigadier;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.ShadowBrigNode;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.ShadowBrigNode;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration;
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.spottedleaf.moonrise.ChunkSystemChunkStorage;
|
||||||
import fr.pandacube.lib.reflect.ReflectionWrapperBypass;
|
import fr.pandacube.lib.reflect.ReflectionWrapperBypass;
|
||||||
import fr.pandacube.lib.util.ThrowableAccumulator;
|
import fr.pandacube.lib.util.ThrowableAccumulator;
|
||||||
|
|
||||||
@@ -179,6 +185,7 @@ public class PandalibPaperReflect {
|
|||||||
thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.REFLECT.get()));
|
||||||
// minecraft.util
|
// minecraft.util
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(ProblemReporter.class, ProblemReporter.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.REFLECT.get()));
|
||||||
// minecraft.world.block
|
// minecraft.world.block
|
||||||
thAcc.catchThrowable(() -> initWrapper(Block.class, Block.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(Block.class, Block.REFLECT.get()));
|
||||||
@@ -187,28 +194,33 @@ public class PandalibPaperReflect {
|
|||||||
thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(DataVersion.class, DataVersion.REFLECT.get()));
|
|
||||||
thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(ItemStackWithSlot.class, ItemStackWithSlot.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(Level.class, Level.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(Level.class, Level.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(RegionFileStorage.class, RegionFileStorage.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(TagValueInput.class, TagValueInput.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(TagValueOutput.class, TagValueOutput.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(ValueInput.class, ValueInput.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(ValueInputTypedInputList.class, ValueInputTypedInputList.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(ValueOutput.class, ValueOutput.REFLECT.get()));
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(ValueOutputTypedOutputList.class, ValueOutputTypedOutputList.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.REFLECT.get()));
|
||||||
// minecraft
|
// minecraft
|
||||||
thAcc.catchThrowable(() -> initWrapper(DetectedVersion.class, DetectedVersion.REFLECT.get()));
|
|
||||||
thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(WorldVersion.class, WorldVersion.REFLECT.get()));
|
|
||||||
|
|
||||||
// netty
|
// netty
|
||||||
thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get()));
|
||||||
|
|
||||||
// paper.commands
|
// paper.commands
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(APICommandMeta.class, APICommandMeta.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(BukkitCommandNode.class, BukkitCommandNode.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(BukkitCommandNode.class, BukkitCommandNode.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(PaperBrigadier.class, PaperBrigadier.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(PaperBrigadier.class, PaperBrigadier.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(PluginCommandNode.class, PluginCommandNode.REFLECT.get()));
|
|
||||||
thAcc.catchThrowable(() -> initWrapper(ShadowBrigNode.class, ShadowBrigNode.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(ShadowBrigNode.class, ShadowBrigNode.REFLECT.get()));
|
||||||
// paper.configuration
|
// paper.configuration
|
||||||
thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get()));
|
||||||
@@ -216,10 +228,14 @@ public class PandalibPaperReflect {
|
|||||||
thAcc.catchThrowable(() -> initWrapper(WorldConfiguration.Chunks.class, WorldConfiguration.Chunks.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(WorldConfiguration.Chunks.class, WorldConfiguration.Chunks.REFLECT.get()));
|
||||||
// paper
|
// paper
|
||||||
thAcc.catchThrowable(() -> initWrapper(PaperAdventure.class, PaperAdventure.REFLECT.get()));
|
thAcc.catchThrowable(() -> initWrapper(PaperAdventure.class, PaperAdventure.REFLECT.get()));
|
||||||
thAcc.catchThrowable(() -> initWrapper(QueuedChangesMapLong2Object.class, QueuedChangesMapLong2Object.REFLECT.get()));
|
|
||||||
|
// spottedleaf
|
||||||
|
thAcc.catchThrowable(() -> initWrapper(ChunkSystemChunkStorage.class, ChunkSystemChunkStorage.REFLECT.get()));
|
||||||
|
|
||||||
|
|
||||||
thAcc.throwCaught();
|
thAcc.throwCaught();
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private PandalibPaperReflect() {}
|
||||||
}
|
}
|
||||||
|
@@ -12,15 +12,29 @@ import org.bukkit.event.Listener;
|
|||||||
import org.bukkit.event.block.BlockPlaceEvent;
|
import org.bukkit.event.block.BlockPlaceEvent;
|
||||||
import org.bukkit.util.BoundingBox;
|
import org.bukkit.util.BoundingBox;
|
||||||
|
|
||||||
// simplified version of https://github.com/Camotoy/BambooCollisionFix/tree/c7d7d5327791cbb416d106de0b9eb0bf2461acbd/src/main/java/net/camotoy/bamboocollisionfix
|
// simplified version of
|
||||||
// we remove the bamboo bounding box due to bedrock clients not having the same placement for bamboos
|
|
||||||
|
/**
|
||||||
|
* Disables the server-side bounding box of the bamboo stalk blocks.
|
||||||
|
* Bamboo stalks are the thin bamboo plants that are shifted differently, depending on the X and Z coordinate.
|
||||||
|
* This X/Z dependent shift is different between Java and Bedrock implementation.
|
||||||
|
* But since this block as a collision box and players cannot go through them, Bedrock players are often rolled back
|
||||||
|
* when they are walking around bamboo stalk due to the server being in Java Edition and thinking the player tries to
|
||||||
|
* move through the bamboo.
|
||||||
|
* To avoid this issue, we reduce to 0 the size of the bounding box on the server.
|
||||||
|
* <br>
|
||||||
|
* See <a href="https://github.com/Camotoy/BambooCollisionFix/tree/c7d7d5327791cbb416d106de0b9eb0bf2461acbd/src/main/java/net/camotoy/bamboocollisionfix">the original implementation</a>.
|
||||||
|
*/
|
||||||
public final class BedrockBambooCollisionFixer implements Listener {
|
public final class BedrockBambooCollisionFixer implements Listener {
|
||||||
private final BoundingBox originalBambooBoundingBox = new BoundingBox(6.5D / 16D, 0.0D, 6.5D / 16.0D, 9.5D / 16.0D, 1D, 9.5D / 16.0D);
|
private final BoundingBox originalBambooBoundingBox = new BoundingBox(6.5D / 16D, 0.0D, 6.5D / 16.0D, 9.5D / 16.0D, 1D, 9.5D / 16.0D);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new {@link BedrockBambooCollisionFixer}. There is no need for multiple instances.
|
||||||
|
*/
|
||||||
public BedrockBambooCollisionFixer() {
|
public BedrockBambooCollisionFixer() {
|
||||||
// Make the bamboo block have zero collision.
|
// Make the bamboo block have zero collision.
|
||||||
try {
|
try {
|
||||||
BambooStalkBlock.COLLISION_SHAPE(Block.box(8, 0, 8, 8, 0, 8));
|
BambooStalkBlock.SHAPE_COLLISION(Block.box(8, 0, 8, 8, 0, 8));
|
||||||
Log.info("Bamboo block collision box removed successfully.");
|
Log.info("Bamboo block collision box removed successfully.");
|
||||||
} catch (Exception e) {
|
} catch (Exception e) {
|
||||||
Log.severe("Unable to remove the collision box of the Bamboo block.", e);
|
Log.severe("Unable to remove the collision box of the Bamboo block.", e);
|
||||||
@@ -34,7 +48,7 @@ public final class BedrockBambooCollisionFixer implements Listener {
|
|||||||
* our ability.
|
* our ability.
|
||||||
*/
|
*/
|
||||||
@EventHandler
|
@EventHandler
|
||||||
public void onBlockPlace(BlockPlaceEvent event) {
|
void onBlockPlace(BlockPlaceEvent event) {
|
||||||
if (event.getBlockPlaced().getBlockData().getMaterial().equals(Material.BAMBOO)) {
|
if (event.getBlockPlaced().getBlockData().getMaterial().equals(Material.BAMBOO)) {
|
||||||
BoundingBox currentBambooBoundingBox = originalBambooBoundingBox.clone().shift(event.getBlockPlaced().getLocation());
|
BoundingBox currentBambooBoundingBox = originalBambooBoundingBox.clone().shift(event.getBlockPlaced().getLocation());
|
||||||
for (LivingEntity e : event.getBlock().getLocation().getNearbyLivingEntities(5)) {
|
for (LivingEntity e : event.getBlock().getLocation().getNearbyLivingEntities(5)) {
|
||||||
|
@@ -1,21 +1,24 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.util;
|
package fr.pandacube.lib.paper.reflect.util;
|
||||||
|
|
||||||
import org.bukkit.Bukkit;
|
|
||||||
import org.bukkit.World;
|
|
||||||
|
|
||||||
import fr.pandacube.lib.chat.Chat;
|
import fr.pandacube.lib.chat.Chat;
|
||||||
import fr.pandacube.lib.chat.ChatConfig.PandaTheme;
|
import fr.pandacube.lib.chat.ChatConfig.PandaTheme;
|
||||||
import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager;
|
import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftWorld;
|
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftWorld;
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ChunkMap;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
|
import org.bukkit.Bukkit;
|
||||||
|
import org.bukkit.World;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Provides static methods to save worlds presumably in a better way than Bukkit provides (better flushing, more released RAM).
|
||||||
|
*/
|
||||||
public class WorldSaveUtil {
|
public class WorldSaveUtil {
|
||||||
|
|
||||||
private static ChunkMap getChunkMap(World w) {
|
/**
|
||||||
return ReflectWrapper.wrapTyped(w, CraftWorld.class).getHandle().getChunkSource().chunkMap;
|
* Save the provided world using the NMS {@link ServerLevel#save(ProgressListener, boolean, boolean)} method.
|
||||||
}
|
* @param w the world to save.
|
||||||
|
*/
|
||||||
public static void nmsSaveFlush(World w) {
|
public static void nmsSaveFlush(World w) {
|
||||||
PerformanceAnalysisManager.getInstance().setAlteredTPSTitle(
|
PerformanceAnalysisManager.getInstance().setAlteredTPSTitle(
|
||||||
Chat.text("Sauvegarde map ").color(PandaTheme.CHAT_BROWN_2_SAT).thenData(w.getName()).thenText(" ...")
|
Chat.text("Sauvegarde map ").color(PandaTheme.CHAT_BROWN_2_SAT).thenData(w.getName()).thenText(" ...")
|
||||||
@@ -28,8 +31,13 @@ public class WorldSaveUtil {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Save all the loaded worlds, using {@link #nmsSaveFlush(World)}.
|
||||||
|
*/
|
||||||
public static void nmsSaveAllFlush() {
|
public static void nmsSaveAllFlush() {
|
||||||
Bukkit.getWorlds().forEach(WorldSaveUtil::nmsSaveFlush);
|
Bukkit.getWorlds().forEach(WorldSaveUtil::nmsSaveFlush);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private WorldSaveUtil() {}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -1,6 +1,8 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.wrapper.brigadier;
|
package fr.pandacube.lib.paper.reflect.wrapper.brigadier;
|
||||||
|
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
|
||||||
import fr.pandacube.lib.reflect.Reflect;
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectField;
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
|
||||||
import fr.pandacube.lib.reflect.ReflectClass;
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
import fr.pandacube.lib.reflect.ReflectMethod;
|
import fr.pandacube.lib.reflect.ReflectMethod;
|
||||||
@@ -11,11 +13,20 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|||||||
public class CommandNode<S> extends ReflectWrapperTyped<com.mojang.brigadier.tree.CommandNode<S>> {
|
public class CommandNode<S> extends ReflectWrapperTyped<com.mojang.brigadier.tree.CommandNode<S>> {
|
||||||
public static final ReflectClass<?> REFLECT = Reflect.ofClass(com.mojang.brigadier.tree.CommandNode.class);
|
public static final ReflectClass<?> REFLECT = Reflect.ofClass(com.mojang.brigadier.tree.CommandNode.class);
|
||||||
private static final ReflectMethod<?> removeCommand = wrapEx(() -> REFLECT.method("removeCommand", String.class));
|
private static final ReflectMethod<?> removeCommand = wrapEx(() -> REFLECT.method("removeCommand", String.class));
|
||||||
|
private static final ReflectField<?> apiCommandMeta = wrapEx(() -> REFLECT.field("apiCommandMeta"));
|
||||||
|
|
||||||
public void removeCommand(String cmd) {
|
public void removeCommand(String cmd) {
|
||||||
wrapReflectEx(() -> removeCommand.invoke(__getRuntimeInstance(), cmd));
|
wrapReflectEx(() -> removeCommand.invoke(__getRuntimeInstance(), cmd));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public APICommandMeta apiCommandMeta() {
|
||||||
|
return wrap(wrapReflectEx(() -> apiCommandMeta.getValue(__getRuntimeInstance())), APICommandMeta.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
public void apiCommandMeta(APICommandMeta meta) {
|
||||||
|
wrapReflectEx(() -> apiCommandMeta.setValue(__getRuntimeInstance(), unwrap(meta)));
|
||||||
|
}
|
||||||
|
|
||||||
protected CommandNode(Object obj) {
|
protected CommandNode(Object obj) {
|
||||||
super(obj);
|
super(obj);
|
||||||
}
|
}
|
||||||
|
@@ -1,12 +1,10 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.wrapper.craftbukkit;
|
package fr.pandacube.lib.paper.reflect.wrapper.craftbukkit;
|
||||||
|
|
||||||
import fr.pandacube.lib.paper.reflect.OBCReflect;
|
import fr.pandacube.lib.paper.reflect.OBCReflect;
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.BlockPos;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
|
||||||
import fr.pandacube.lib.reflect.ReflectClass;
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
import fr.pandacube.lib.reflect.ReflectMethod;
|
import fr.pandacube.lib.reflect.ReflectMethod;
|
||||||
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
import fr.pandacube.lib.util.ThrowableUtil;
|
import fr.pandacube.lib.util.ThrowableUtil;
|
||||||
import org.bukkit.util.Vector;
|
import org.bukkit.util.Vector;
|
||||||
|
|
||||||
@@ -16,26 +14,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|||||||
public class CraftVector extends ReflectWrapper {
|
public class CraftVector extends ReflectWrapper {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("util.CraftVector"));
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("util.CraftVector"));
|
||||||
public static final ReflectMethod<?> toBukkit_Vec3 = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", Vec3.REFLECT.get()));
|
public static final ReflectMethod<?> toBukkit_Vec3 = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", Vec3.REFLECT.get()));
|
||||||
public static final ReflectMethod<?> toBukkit_BlockPos = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", BlockPos.REFLECT.get()));
|
|
||||||
public static final ReflectMethod<?> toNMS = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
|
|
||||||
public static final ReflectMethod<?> toBlockPos = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
|
|
||||||
|
|
||||||
public static Vector toBukkit(Vec3 nms) {
|
public static Vector toBukkit(Vec3 nms) {
|
||||||
return (Vector) wrapReflectEx(() -> toBukkit_Vec3.invokeStatic(unwrap(nms)));
|
return (Vector) wrapReflectEx(() -> toBukkit_Vec3.invokeStatic(unwrap(nms)));
|
||||||
}
|
}
|
||||||
|
|
||||||
public static Vector toBukkit(BlockPos blockPos) {
|
|
||||||
return (Vector) wrapReflectEx(() -> toBukkit_BlockPos.invokeStatic(unwrap(blockPos)));
|
|
||||||
}
|
|
||||||
|
|
||||||
public static Vec3 toNMS(Vector bukkit) {
|
|
||||||
return wrap(wrapReflectEx(() -> toNMS.invokeStatic(bukkit)), Vec3.class);
|
|
||||||
}
|
|
||||||
|
|
||||||
public static BlockPos toBlockPos(Vector bukkit) {
|
|
||||||
return wrap(wrapReflectEx(() -> toBlockPos.invokeStatic(bukkit)), BlockPos.class);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
protected CraftVector(Object obj) {
|
protected CraftVector(Object obj) {
|
||||||
super(obj);
|
super(obj);
|
||||||
|
@@ -17,13 +17,9 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|||||||
|
|
||||||
public class VanillaCommandWrapper extends ReflectWrapperTyped<BukkitCommand> {
|
public class VanillaCommandWrapper extends ReflectWrapperTyped<BukkitCommand> {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("command.VanillaCommandWrapper"));
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("command.VanillaCommandWrapper"));
|
||||||
public static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(Commands.REFLECT.get(), CommandNode.class));
|
|
||||||
public static final ReflectField<?> vanillaCommand = wrapEx(() -> REFLECT.field("vanillaCommand"));
|
public static final ReflectField<?> vanillaCommand = wrapEx(() -> REFLECT.field("vanillaCommand"));
|
||||||
public static final ReflectMethod<?> getListener = wrapEx(() -> REFLECT.method("getListener", CommandSender.class));
|
public static final ReflectMethod<?> getListener = wrapEx(() -> REFLECT.method("getListener", CommandSender.class));
|
||||||
|
|
||||||
public VanillaCommandWrapper(Commands dispatcher, CommandNode<CommandSourceStack> vanillaCommand) {
|
|
||||||
this(wrapReflectEx(() -> CONSTRUCTOR.instantiate(unwrap(dispatcher), vanillaCommand)));
|
|
||||||
}
|
|
||||||
|
|
||||||
@SuppressWarnings("unchecked")
|
@SuppressWarnings("unchecked")
|
||||||
public CommandNode<CommandSourceStack> vanillaCommand() {
|
public CommandNode<CommandSourceStack> vanillaCommand() {
|
||||||
|
@@ -1,15 +0,0 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.wrapper.minecraft;
|
|
||||||
|
|
||||||
import fr.pandacube.lib.reflect.Reflect;
|
|
||||||
import fr.pandacube.lib.reflect.ReflectClass;
|
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
|
||||||
|
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
|
||||||
|
|
||||||
public class DetectedVersion extends ReflectWrapper implements WorldVersion {
|
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.DetectedVersion"));
|
|
||||||
|
|
||||||
protected DetectedVersion(Object obj) {
|
|
||||||
super(obj);
|
|
||||||
}
|
|
||||||
}
|
|
@@ -10,15 +10,10 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|||||||
|
|
||||||
public class SharedConstants extends ReflectWrapper {
|
public class SharedConstants extends ReflectWrapper {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.SharedConstants"));
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.SharedConstants"));
|
||||||
private static final ReflectMethod<?> getCurrentVersion = wrapEx(() -> REFLECT.method("getCurrentVersion"));
|
|
||||||
private static final ReflectMethod<?> getProtocolVersion = wrapEx(() -> REFLECT.method("getProtocolVersion"));
|
private static final ReflectMethod<?> getProtocolVersion = wrapEx(() -> REFLECT.method("getProtocolVersion"));
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
public static WorldVersion getCurrentVersion() {
|
|
||||||
return wrap(wrapReflectEx(() -> getCurrentVersion.invokeStatic()), WorldVersion.class);
|
|
||||||
}
|
|
||||||
|
|
||||||
public static int getProtocolVersion() {
|
public static int getProtocolVersion() {
|
||||||
return (int) wrapReflectEx(() -> getProtocolVersion.invokeStatic());
|
return (int) wrapReflectEx(() -> getProtocolVersion.invokeStatic());
|
||||||
}
|
}
|
||||||
|
@@ -14,7 +14,7 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|||||||
|
|
||||||
@ConcreteWrapper(Coordinates.__concrete.class)
|
@ConcreteWrapper(Coordinates.__concrete.class)
|
||||||
public interface Coordinates extends ReflectWrapperI {
|
public interface Coordinates extends ReflectWrapperI {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates"));
|
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates"));
|
||||||
ReflectMethod<?> getPosition = wrapEx(() -> REFLECT.method("getPosition", CommandSourceStack.REFLECT.get()));
|
ReflectMethod<?> getPosition = wrapEx(() -> REFLECT.method("getPosition", CommandSourceStack.REFLECT.get()));
|
||||||
|
|
||||||
default Vec3 getPosition(io.papermc.paper.command.brigadier.CommandSourceStack source) {
|
default Vec3 getPosition(io.papermc.paper.command.brigadier.CommandSourceStack source) {
|
||||||
|
@@ -6,10 +6,9 @@ import fr.pandacube.lib.reflect.ReflectConstructor;
|
|||||||
import fr.pandacube.lib.reflect.ReflectMethod;
|
import fr.pandacube.lib.reflect.ReflectMethod;
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
|
|
||||||
import java.util.List;
|
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
import java.util.Optional;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
import java.util.UUID;
|
|
||||||
|
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
||||||
@@ -20,21 +19,16 @@ public class CompoundTag extends ReflectWrapper implements Tag {
|
|||||||
private static final ReflectMethod<?> putBoolean = wrapEx(() -> REFLECT.method("putBoolean", String.class, boolean.class));
|
private static final ReflectMethod<?> putBoolean = wrapEx(() -> REFLECT.method("putBoolean", String.class, boolean.class));
|
||||||
private static final ReflectMethod<?> putByte = wrapEx(() -> REFLECT.method("putByte", String.class, byte.class));
|
private static final ReflectMethod<?> putByte = wrapEx(() -> REFLECT.method("putByte", String.class, byte.class));
|
||||||
private static final ReflectMethod<?> putByteArray = wrapEx(() -> REFLECT.method("putByteArray", String.class, byte[].class));
|
private static final ReflectMethod<?> putByteArray = wrapEx(() -> REFLECT.method("putByteArray", String.class, byte[].class));
|
||||||
private static final ReflectMethod<?> putByteArray_List = wrapEx(() -> REFLECT.method("putByteArray", String.class, List.class));
|
|
||||||
private static final ReflectMethod<?> putDouble = wrapEx(() -> REFLECT.method("putDouble", String.class, double.class));
|
private static final ReflectMethod<?> putDouble = wrapEx(() -> REFLECT.method("putDouble", String.class, double.class));
|
||||||
private static final ReflectMethod<?> putFloat = wrapEx(() -> REFLECT.method("putFloat", String.class, float.class));
|
private static final ReflectMethod<?> putFloat = wrapEx(() -> REFLECT.method("putFloat", String.class, float.class));
|
||||||
private static final ReflectMethod<?> putInt = wrapEx(() -> REFLECT.method("putInt", String.class, int.class));
|
private static final ReflectMethod<?> putInt = wrapEx(() -> REFLECT.method("putInt", String.class, int.class));
|
||||||
private static final ReflectMethod<?> putIntArray = wrapEx(() -> REFLECT.method("putIntArray", String.class, int[].class));
|
private static final ReflectMethod<?> putIntArray = wrapEx(() -> REFLECT.method("putIntArray", String.class, int[].class));
|
||||||
private static final ReflectMethod<?> putIntArray_List = wrapEx(() -> REFLECT.method("putIntArray", String.class, List.class));
|
|
||||||
private static final ReflectMethod<?> putString = wrapEx(() -> REFLECT.method("putString", String.class, String.class));
|
private static final ReflectMethod<?> putString = wrapEx(() -> REFLECT.method("putString", String.class, String.class));
|
||||||
private static final ReflectMethod<?> putUUID = wrapEx(() -> REFLECT.method("putUUID", String.class, UUID.class));
|
|
||||||
private static final ReflectMethod<?> putLong = wrapEx(() -> REFLECT.method("putLong", String.class, long.class));
|
private static final ReflectMethod<?> putLong = wrapEx(() -> REFLECT.method("putLong", String.class, long.class));
|
||||||
private static final ReflectMethod<?> putLongArray = wrapEx(() -> REFLECT.method("putLongArray", String.class, long[].class));
|
private static final ReflectMethod<?> putLongArray = wrapEx(() -> REFLECT.method("putLongArray", String.class, long[].class));
|
||||||
private static final ReflectMethod<?> putLongArray_List = wrapEx(() -> REFLECT.method("putLongArray", String.class, List.class));
|
|
||||||
private static final ReflectMethod<?> putShort = wrapEx(() -> REFLECT.method("putShort", String.class, short.class));
|
private static final ReflectMethod<?> putShort = wrapEx(() -> REFLECT.method("putShort", String.class, short.class));
|
||||||
private static final ReflectMethod<?> put = wrapEx(() -> REFLECT.method("put", String.class, Tag.REFLECT.get()));
|
private static final ReflectMethod<?> put = wrapEx(() -> REFLECT.method("put", String.class, Tag.REFLECT.get()));
|
||||||
|
|
||||||
private static final ReflectMethod<?> getTagType = wrapEx(() -> REFLECT.method("getTagType", String.class));
|
|
||||||
private static final ReflectMethod<?> getByte = wrapEx(() -> REFLECT.method("getByte", String.class));
|
private static final ReflectMethod<?> getByte = wrapEx(() -> REFLECT.method("getByte", String.class));
|
||||||
private static final ReflectMethod<?> getShort = wrapEx(() -> REFLECT.method("getShort", String.class));
|
private static final ReflectMethod<?> getShort = wrapEx(() -> REFLECT.method("getShort", String.class));
|
||||||
private static final ReflectMethod<?> getInt = wrapEx(() -> REFLECT.method("getInt", String.class));
|
private static final ReflectMethod<?> getInt = wrapEx(() -> REFLECT.method("getInt", String.class));
|
||||||
@@ -47,14 +41,13 @@ public class CompoundTag extends ReflectWrapper implements Tag {
|
|||||||
private static final ReflectMethod<?> getLongArray = wrapEx(() -> REFLECT.method("getLongArray", String.class));
|
private static final ReflectMethod<?> getLongArray = wrapEx(() -> REFLECT.method("getLongArray", String.class));
|
||||||
private static final ReflectMethod<?> getCompound = wrapEx(() -> REFLECT.method("getCompound", String.class));
|
private static final ReflectMethod<?> getCompound = wrapEx(() -> REFLECT.method("getCompound", String.class));
|
||||||
private static final ReflectMethod<?> getBoolean = wrapEx(() -> REFLECT.method("getBoolean", String.class));
|
private static final ReflectMethod<?> getBoolean = wrapEx(() -> REFLECT.method("getBoolean", String.class));
|
||||||
private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class, int.class));
|
private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class));
|
||||||
|
|
||||||
private static final ReflectMethod<?> get = wrapEx(() -> REFLECT.method("get", String.class));
|
private static final ReflectMethod<?> get = wrapEx(() -> REFLECT.method("get", String.class));
|
||||||
private static final ReflectMethod<?> getAllKeys = wrapEx(() -> REFLECT.method("getAllKeys"));
|
private static final ReflectMethod<?> keySet = wrapEx(() -> REFLECT.method("keySet"));
|
||||||
private static final ReflectMethod<?> entrySet = wrapEx(() -> REFLECT.method("entrySet"));
|
private static final ReflectMethod<?> entrySet = wrapEx(() -> REFLECT.method("entrySet"));
|
||||||
private static final ReflectMethod<?> size = wrapEx(() -> REFLECT.method("size"));
|
private static final ReflectMethod<?> size = wrapEx(() -> REFLECT.method("size"));
|
||||||
private static final ReflectMethod<?> contains = wrapEx(() -> REFLECT.method("contains", String.class));
|
private static final ReflectMethod<?> contains = wrapEx(() -> REFLECT.method("contains", String.class));
|
||||||
private static final ReflectMethod<?> containsStringInt = wrapEx(() -> REFLECT.method("contains", String.class, int.class));
|
|
||||||
|
|
||||||
public CompoundTag() {
|
public CompoundTag() {
|
||||||
this(wrapReflectEx(() -> CONSTRUCTOR.instantiate()));
|
this(wrapReflectEx(() -> CONSTRUCTOR.instantiate()));
|
||||||
@@ -73,9 +66,6 @@ public class CompoundTag extends ReflectWrapper implements Tag {
|
|||||||
public void putByteArray(String key, byte[] value) {
|
public void putByteArray(String key, byte[] value) {
|
||||||
wrapReflectEx(() -> putByteArray.invoke(__getRuntimeInstance(), key, value));
|
wrapReflectEx(() -> putByteArray.invoke(__getRuntimeInstance(), key, value));
|
||||||
}
|
}
|
||||||
public void putByteArray(String key, List<Byte> value) {
|
|
||||||
wrapReflectEx(() -> putByteArray_List.invoke(__getRuntimeInstance(), key, value));
|
|
||||||
}
|
|
||||||
public void putDouble(String key, double value) {
|
public void putDouble(String key, double value) {
|
||||||
wrapReflectEx(() -> putDouble.invoke(__getRuntimeInstance(), key, value));
|
wrapReflectEx(() -> putDouble.invoke(__getRuntimeInstance(), key, value));
|
||||||
}
|
}
|
||||||
@@ -88,78 +78,79 @@ public class CompoundTag extends ReflectWrapper implements Tag {
|
|||||||
public void putIntArray(String key, int[] value) {
|
public void putIntArray(String key, int[] value) {
|
||||||
wrapReflectEx(() -> putIntArray.invoke(__getRuntimeInstance(), key, value));
|
wrapReflectEx(() -> putIntArray.invoke(__getRuntimeInstance(), key, value));
|
||||||
}
|
}
|
||||||
public void putIntArray(String key, List<Integer> value) {
|
|
||||||
wrapReflectEx(() -> putIntArray_List.invoke(__getRuntimeInstance(), key, value));
|
|
||||||
}
|
|
||||||
public void putString(String key, String value) {
|
public void putString(String key, String value) {
|
||||||
wrapReflectEx(() -> putString.invoke(__getRuntimeInstance(), key, value));
|
wrapReflectEx(() -> putString.invoke(__getRuntimeInstance(), key, value));
|
||||||
}
|
}
|
||||||
public void putUUID(String key, UUID value) {
|
|
||||||
wrapReflectEx(() -> putUUID.invoke(__getRuntimeInstance(), key, value));
|
|
||||||
}
|
|
||||||
public void putLong(String key, long value) {
|
public void putLong(String key, long value) {
|
||||||
wrapReflectEx(() -> putLong.invoke(__getRuntimeInstance(), key, value));
|
wrapReflectEx(() -> putLong.invoke(__getRuntimeInstance(), key, value));
|
||||||
}
|
}
|
||||||
public void putLongArray(String key, long[] value) {
|
public void putLongArray(String key, long[] value) {
|
||||||
wrapReflectEx(() -> putLongArray.invoke(__getRuntimeInstance(), key, value));
|
wrapReflectEx(() -> putLongArray.invoke(__getRuntimeInstance(), key, value));
|
||||||
}
|
}
|
||||||
public void putLongArray(String key, List<Long> value) {
|
|
||||||
wrapReflectEx(() -> putLongArray_List.invoke(__getRuntimeInstance(), key, value));
|
|
||||||
}
|
|
||||||
public void putShort(String key, short value) {
|
public void putShort(String key, short value) {
|
||||||
wrapReflectEx(() -> putShort.invoke(__getRuntimeInstance(), key, value));
|
wrapReflectEx(() -> putShort.invoke(__getRuntimeInstance(), key, value));
|
||||||
}
|
}
|
||||||
public void put(String key, Tag value) {
|
public void put(String key, Tag value) {
|
||||||
wrapReflectEx(() -> put.invoke(__getRuntimeInstance(), key, unwrap(value)));
|
wrapReflectEx(() -> put.invoke(__getRuntimeInstance(), key, unwrap(value)));
|
||||||
}
|
}
|
||||||
public byte getTagType(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (byte) wrapReflectEx(() -> getTagType.invoke(__getRuntimeInstance(), key));
|
public Optional<Byte> getByte(String key) {
|
||||||
|
return (Optional<Byte>) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public byte getByte(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (byte) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key));
|
public Optional<Short> getShort(String key) {
|
||||||
|
return (Optional<Short>) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public short getShort(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (short) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key));
|
public Optional<Integer> getInt(String key) {
|
||||||
|
return (Optional<Integer>) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public int getInt(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (int) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key));
|
public Optional<Long> getLong(String key) {
|
||||||
|
return (Optional<Long>) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public long getLong(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (long) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key));
|
public Optional<Float> getFloat(String key) {
|
||||||
|
return (Optional<Float>) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public float getFloat(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (float) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key));
|
public Optional<Double> getDouble(String key) {
|
||||||
|
return (Optional<Double>) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public double getDouble(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (double) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key));
|
public Optional<String> getString(String key) {
|
||||||
|
return (Optional<String>) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public String getString(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (String) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key));
|
public Optional<byte[]> getByteArray(String key) {
|
||||||
|
return (Optional<byte[]>) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public byte[] getByteArray(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (byte[]) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key));
|
public Optional<int[]> getIntArray(String key) {
|
||||||
|
return (Optional<int[]>) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public int[] getIntArray(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return (int[]) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key));
|
public Optional<long[]> getLongArray(String key) {
|
||||||
|
return (Optional<long[]>) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public long[] getLongArray(String key) {
|
public Optional<CompoundTag> getCompound(String key) {
|
||||||
return (long[]) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key));
|
return ((Optional<?>) wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)))
|
||||||
|
.map(u -> wrap(u, CompoundTag.class));
|
||||||
}
|
}
|
||||||
public CompoundTag getCompound(String key) {
|
@SuppressWarnings("unchecked")
|
||||||
return wrap(wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)), CompoundTag.class);
|
public Optional<Boolean> getBoolean(String key) {
|
||||||
|
return (Optional<Boolean>) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public boolean getBoolean(String key) {
|
public Optional<ListTag> getList(String key) {
|
||||||
return (boolean) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key));
|
return ((Optional<?>) wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key)))
|
||||||
}
|
.map(u -> wrap(u, ListTag.class));
|
||||||
public ListTag getList(String key, int type) {
|
|
||||||
return wrap(wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key, type)), ListTag.class);
|
|
||||||
}
|
}
|
||||||
public Tag get(String key) {
|
public Tag get(String key) {
|
||||||
return wrap(wrapReflectEx(() -> get.invoke(__getRuntimeInstance(), key)), Tag.class);
|
return wrap(wrapReflectEx(() -> get.invoke(__getRuntimeInstance(), key)), Tag.class);
|
||||||
}
|
}
|
||||||
@SuppressWarnings("unchecked")
|
@SuppressWarnings("unchecked")
|
||||||
public Set<String> getAllKeys() {
|
public Set<String> keySet() {
|
||||||
return (Set<String>) wrapReflectEx(() -> getAllKeys.invoke(__getRuntimeInstance()));
|
return (Set<String>) wrapReflectEx(() -> keySet.invoke(__getRuntimeInstance()));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -176,8 +167,5 @@ public class CompoundTag extends ReflectWrapper implements Tag {
|
|||||||
public boolean contains(String key) {
|
public boolean contains(String key) {
|
||||||
return (boolean) wrapReflectEx(() -> contains.invoke(__getRuntimeInstance(), key));
|
return (boolean) wrapReflectEx(() -> contains.invoke(__getRuntimeInstance(), key));
|
||||||
}
|
}
|
||||||
public boolean contains(String key, int type) {
|
|
||||||
return (boolean) wrapReflectEx(() -> containsStringInt.invoke(__getRuntimeInstance(), key, type));
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
@@ -8,20 +8,22 @@ import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
|
|||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
|
||||||
|
|
||||||
|
import java.util.Optional;
|
||||||
|
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
||||||
|
|
||||||
@ConcreteWrapper(Tag.__concrete.class)
|
@ConcreteWrapper(Tag.__concrete.class)
|
||||||
public interface Tag extends ReflectWrapperI {
|
public interface Tag extends ReflectWrapperI {
|
||||||
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.nbt.Tag"));
|
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.nbt.Tag"));
|
||||||
ReflectMethod<?> getAsString = wrapEx(() -> REFLECT.method("getAsString"));
|
ReflectMethod<?> asString = wrapEx(() -> REFLECT.method("asString"));
|
||||||
ReflectField<?> TAG_LIST = wrapEx(() -> REFLECT.field("TAG_LIST"));
|
ReflectField<?> TAG_LIST = wrapEx(() -> REFLECT.field("TAG_LIST"));
|
||||||
ReflectField<?> TAG_COMPOUND = wrapEx(() -> REFLECT.field("TAG_COMPOUND"));
|
ReflectField<?> TAG_COMPOUND = wrapEx(() -> REFLECT.field("TAG_COMPOUND"));
|
||||||
ReflectField<?> TAG_ANY_NUMERIC = wrapEx(() -> REFLECT.field("TAG_ANY_NUMERIC"));
|
|
||||||
|
|
||||||
|
|
||||||
default String getAsString() {
|
@SuppressWarnings("unchecked")
|
||||||
return wrapReflectEx(() -> (String) getAsString.invoke(__getRuntimeInstance()));
|
default Optional<String> asString() {
|
||||||
|
return wrapReflectEx(() -> (Optional<String>) asString.invoke(__getRuntimeInstance()));
|
||||||
}
|
}
|
||||||
|
|
||||||
static byte TAG_LIST() {
|
static byte TAG_LIST() {
|
||||||
@@ -32,10 +34,6 @@ public interface Tag extends ReflectWrapperI {
|
|||||||
return wrapReflectEx(() -> (byte) TAG_COMPOUND.getStaticValue());
|
return wrapReflectEx(() -> (byte) TAG_COMPOUND.getStaticValue());
|
||||||
}
|
}
|
||||||
|
|
||||||
static byte TAG_ANY_NUMERIC() {
|
|
||||||
return wrapReflectEx(() -> (byte) TAG_ANY_NUMERIC.getStaticValue());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
class __concrete extends ReflectWrapper implements Tag {
|
class __concrete extends ReflectWrapper implements Tag {
|
||||||
private __concrete(Object obj) {
|
private __concrete(Object obj) {
|
||||||
|
@@ -0,0 +1,31 @@
|
|||||||
|
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.util;
|
||||||
|
|
||||||
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectField;
|
||||||
|
import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
|
||||||
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
|
||||||
|
|
||||||
|
import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
|
||||||
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
||||||
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
||||||
|
|
||||||
|
@ConcreteWrapper(ProblemReporter.__concrete.class)
|
||||||
|
public interface ProblemReporter extends ReflectWrapperI {
|
||||||
|
ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.util.ProblemReporter"));
|
||||||
|
ReflectField<?> DISCARDING = wrapEx(() -> REFLECT.field("DISCARDING"));
|
||||||
|
|
||||||
|
static ProblemReporter DISCARDING() {
|
||||||
|
return wrap(wrapReflectEx(DISCARDING::getStaticValue), ProblemReporter.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
class __concrete extends ReflectWrapper implements ProblemReporter {
|
||||||
|
protected __concrete(Object obj) {
|
||||||
|
super(obj);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
@@ -1,6 +1,7 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
||||||
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
|
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
|
||||||
|
import fr.pandacube.lib.paper.reflect.wrapper.spottedleaf.moonrise.ChunkSystemChunkStorage;
|
||||||
import fr.pandacube.lib.reflect.Reflect;
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
import fr.pandacube.lib.reflect.ReflectClass;
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
import fr.pandacube.lib.reflect.ReflectMethod;
|
import fr.pandacube.lib.reflect.ReflectMethod;
|
||||||
@@ -12,17 +13,13 @@ import java.util.concurrent.CompletableFuture;
|
|||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
||||||
|
|
||||||
public class ChunkStorage extends ReflectWrapper {
|
public class ChunkStorage extends ReflectWrapper implements ChunkSystemChunkStorage {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.chunk.storage.ChunkStorage"));
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.chunk.storage.ChunkStorage"));
|
||||||
private static final ReflectMethod<?> readSync = wrapEx(() -> REFLECT.method("readSync", ChunkPos.REFLECT.get())); // spigot/paper method
|
private static final ReflectMethod<?> read = wrapEx(() -> REFLECT.method("read", ChunkPos.REFLECT.get())); // spigot/paper method
|
||||||
|
|
||||||
public CompoundTag readSync(ChunkPos pos) {
|
|
||||||
return wrap(wrapReflectEx(() -> readSync.invoke(__getRuntimeInstance(), unwrap(pos))), CompoundTag.class);
|
|
||||||
}
|
|
||||||
|
|
||||||
public CompletableFuture<Optional<CompoundTag>> read(ChunkPos pos) {
|
public CompletableFuture<Optional<CompoundTag>> read(ChunkPos pos) {
|
||||||
@SuppressWarnings("unchecked")
|
@SuppressWarnings("unchecked")
|
||||||
CompletableFuture<Optional<?>> nmsFuture = (CompletableFuture<Optional<?>>) wrapReflectEx(() -> readSync.invoke(__getRuntimeInstance(), unwrap(pos)));
|
CompletableFuture<Optional<?>> nmsFuture = ((CompletableFuture<Optional<?>>) wrapReflectEx(() -> read.invoke(__getRuntimeInstance(), unwrap(pos))));
|
||||||
return nmsFuture.thenApply(o -> o.map(c -> wrap(c, CompoundTag.class)));
|
return nmsFuture.thenApply(o -> o.map(c -> wrap(c, CompoundTag.class)));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -1,32 +0,0 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
|
||||||
|
|
||||||
import fr.pandacube.lib.reflect.Reflect;
|
|
||||||
import fr.pandacube.lib.reflect.ReflectClass;
|
|
||||||
import fr.pandacube.lib.reflect.ReflectMethod;
|
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
|
||||||
|
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|
||||||
|
|
||||||
public class DataVersion extends ReflectWrapper {
|
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.DataVersion"));
|
|
||||||
private static final ReflectMethod<?> getVersion = wrapEx(() -> REFLECT.method("getVersion"));
|
|
||||||
private static final ReflectMethod<?> getSeries = wrapEx(() -> REFLECT.method("getSeries"));
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
public int getVersion() {
|
|
||||||
return (int) wrapReflectEx(() -> getVersion.invoke(__getRuntimeInstance()));
|
|
||||||
}
|
|
||||||
|
|
||||||
public String getSeries() {
|
|
||||||
return (String) wrapReflectEx(() -> getSeries.invoke(__getRuntimeInstance()));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
protected DataVersion(Object obj) {
|
|
||||||
super(obj);
|
|
||||||
}
|
|
||||||
}
|
|
@@ -1,6 +1,5 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
||||||
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
|
|
||||||
import fr.pandacube.lib.reflect.Reflect;
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
import fr.pandacube.lib.reflect.ReflectClass;
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
import fr.pandacube.lib.reflect.ReflectMethod;
|
import fr.pandacube.lib.reflect.ReflectMethod;
|
||||||
@@ -12,16 +11,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|||||||
public class Entity extends ReflectWrapper {
|
public class Entity extends ReflectWrapper {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.entity.Entity"));
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.entity.Entity"));
|
||||||
public static final ReflectMethod<?> getBukkitEntity = wrapEx(() -> REFLECT.method("getBukkitEntity")); // spigot method
|
public static final ReflectMethod<?> getBukkitEntity = wrapEx(() -> REFLECT.method("getBukkitEntity")); // spigot method
|
||||||
public static final ReflectMethod<?> serializeEntity = wrapEx(() -> REFLECT.method("serializeEntity", CompoundTag.REFLECT.get())); // paper method
|
|
||||||
|
|
||||||
public org.bukkit.entity.Entity getBukkitEntity() {
|
public org.bukkit.entity.Entity getBukkitEntity() {
|
||||||
return (org.bukkit.entity.Entity) wrapReflectEx(() -> getBukkitEntity.invoke(__getRuntimeInstance()));
|
return (org.bukkit.entity.Entity) wrapReflectEx(() -> getBukkitEntity.invoke(__getRuntimeInstance()));
|
||||||
}
|
}
|
||||||
|
|
||||||
public boolean serializeEntity(CompoundTag nbt) {
|
|
||||||
return wrapReflectEx(() -> (Boolean) serializeEntity.invoke(__getRuntimeInstance(), unwrap(nbt)));
|
|
||||||
}
|
|
||||||
|
|
||||||
protected Entity(Object obj) {
|
protected Entity(Object obj) {
|
||||||
super(obj);
|
super(obj);
|
||||||
}
|
}
|
||||||
|
@@ -1,63 +1,15 @@
|
|||||||
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
||||||
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.HolderLookupProvider;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.RegistryAccess;
|
|
||||||
import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.Tag;
|
|
||||||
import fr.pandacube.lib.reflect.Reflect;
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
import fr.pandacube.lib.reflect.ReflectClass;
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
import fr.pandacube.lib.reflect.ReflectMethod;
|
|
||||||
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
import org.bukkit.Bukkit;
|
|
||||||
|
|
||||||
import java.util.Optional;
|
|
||||||
|
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
||||||
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|
||||||
|
|
||||||
public class ItemStack extends ReflectWrapper {
|
public class ItemStack extends ReflectWrapper {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.item.ItemStack"));
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.item.ItemStack"));
|
||||||
private static final ReflectMethod<?> parse = wrapEx(() -> REFLECT.method("parse", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
|
|
||||||
private static final ReflectMethod<?> saveWithPrefix = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
|
|
||||||
private static final ReflectMethod<?> save = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get()));
|
|
||||||
|
|
||||||
@SuppressWarnings("unchecked")
|
|
||||||
public static Optional<ItemStack> parse(HolderLookupProvider registries, Tag nbt) {
|
|
||||||
return ((Optional<Object>) wrapReflectEx(() -> parse.invokeStatic(unwrap(registries), unwrap(nbt))))
|
|
||||||
.map(o -> wrap(o, ItemStack.class));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
public static Optional<ItemStack> parse(Tag nbt) {
|
|
||||||
return parse(getRegistries(), nbt);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
protected ItemStack(Object obj) {
|
protected ItemStack(Object obj) {
|
||||||
super(obj);
|
super(obj);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
public Tag save(HolderLookupProvider registries, Tag prefix) {
|
|
||||||
return wrap(wrapReflectEx(() -> saveWithPrefix.invoke(__getRuntimeInstance(), unwrap(registries), unwrap(prefix))), Tag.class);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
public Tag save(HolderLookupProvider registries) {
|
|
||||||
return wrap(wrapReflectEx(() -> save.invoke(__getRuntimeInstance(), unwrap(registries))), Tag.class);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
public Tag save(Tag prefix) {
|
|
||||||
return save(getRegistries(), prefix);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
public Tag save() {
|
|
||||||
return save(getRegistries());
|
|
||||||
}
|
|
||||||
|
|
||||||
private static RegistryAccess getRegistries() {
|
|
||||||
return wrap(Bukkit.getServer(), CraftServer.class).getServer().registryAccess();
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
@@ -0,0 +1,44 @@
|
|||||||
|
package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
|
||||||
|
|
||||||
|
import com.mojang.serialization.Codec;
|
||||||
|
import fr.pandacube.lib.reflect.Reflect;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectClass;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectConstructor;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectField;
|
||||||
|
import fr.pandacube.lib.reflect.ReflectMethod;
|
||||||
|
import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
|
||||||
|
|
||||||
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
|
||||||
|
import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
||||||
|
|
||||||
|
public class ItemStackWithSlot extends ReflectWrapper {
|
||||||
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.ItemStackWithSlot"));
|
||||||
|
private static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(int.class, ItemStack.REFLECT.get()));
|
||||||
|
private static final ReflectField<?> CODEC = wrapEx(() -> REFLECT.field("CODEC"));
|
||||||
|
private static final ReflectMethod<?> slot = wrapEx(() -> REFLECT.method("slot"));
|
||||||
|
private static final ReflectMethod<?> stack = wrapEx(() -> REFLECT.method("stack"));
|
||||||
|
|
||||||
|
public static Codec<?> CODEC() {
|
||||||
|
return (Codec<?>) wrapReflectEx(CODEC::getStaticValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
protected ItemStackWithSlot(Object obj) {
|
||||||
|
super(obj);
|
||||||
|
}
|
||||||
|
|
||||||
|
public ItemStackWithSlot(int slot, ItemStack stack) {
|
||||||
|
super(wrapReflectEx(() -> CONSTRUCTOR.instantiate(slot, unwrap(stack))));
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
public int slot() {
|
||||||
|
return (int) wrapReflectEx(() -> slot.invoke(__getRuntimeInstance()));
|
||||||
|
}
|
||||||
|
|
||||||
|
public ItemStack stack() {
|
||||||
|
return wrap(wrapReflectEx(() -> stack.invoke(__getRuntimeInstance())), ItemStack.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
@@ -12,17 +12,12 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
|
|||||||
public class Level extends ReflectWrapper {
|
public class Level extends ReflectWrapper {
|
||||||
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.Level"));
|
public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.Level"));
|
||||||
public static final ReflectMethod<?> getGameTime = wrapEx(() -> REFLECT.method("getGameTime"));
|
public static final ReflectMethod<?> getGameTime = wrapEx(() -> REFLECT.method("getGameTime"));
|
||||||
public static final ReflectMethod<?> getFreeMapId = wrapEx(() -> REFLECT.method("getFreeMapId"));
|
|
||||||
public static final ReflectMethod<?> paperConfig = wrapEx(() -> REFLECT.method("paperConfig")); // paper method
|
public static final ReflectMethod<?> paperConfig = wrapEx(() -> REFLECT.method("paperConfig")); // paper method
|
||||||
|
|
||||||
public long getGameTime() {
|
public long getGameTime() {
|
||||||
return (long) wrapReflectEx(() -> getGameTime.invoke(__getRuntimeInstance()));
|
return (long) wrapReflectEx(() -> getGameTime.invoke(__getRuntimeInstance()));
|
||||||
}
|
}
|
||||||
|
|
||||||
public int getFreeMapId() {
|
|
||||||
return (int) wrapReflectEx(() -> getFreeMapId.invoke(__getRuntimeInstance()));
|
|
||||||
}
|
|
||||||
|
|
||||||
public WorldConfiguration paperConfig() {
|
public WorldConfiguration paperConfig() {
|
||||||
return wrap(wrapReflectEx(() -> paperConfig.invoke(__getRuntimeInstance())), WorldConfiguration.class);
|
return wrap(wrapReflectEx(() -> paperConfig.invoke(__getRuntimeInstance())), WorldConfiguration.class);
|
||||||
}
|
}
|
||||||
|
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user