ItemStackAdapter for Json: removed backward compatibility of serialized data (was temporary during the server upgrade)

-> temporary fix so the older servers does not throw an error when trying to deserialize (e.g. when using the lobby compass menu)

Readme.md

@@ -9,17 +9,18 @@ that are detailed in their respective Readme file (if any).
 - `pandalib-util` General purpose utility and helper classes;
 - `pandalib-chat` A chat API working on top of the Adventure API;
 - `pandalib-db` An ORM working with a MySQL server through JDBC;
-- `pandalib-bungee` Utility and helper classes to use in Bungeecord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
+- `pandalib-bungee` Utility and helper classes to use in BungeeCord plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
 - `pandalib-paper` Utility and helper classes to use in Spigot/Paper plugins. Also provides platform implementation for `pandalib-players` and `pandalib-commands`;
 - `pandalib-reflect` A reflection wrapper to make reflective operation easier;
 - `pandalib-permissions` A general purpose permission system;
-- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into Bungeecord;
+- `pandalib-bungee-permissions` Integration of the permission system `pandalib-permissions` into BungeeCord;
 - `pandalib-paper-permissions` Integration of the permission system `pandalib-permissions` into Bukkit, Vault and WEPIF permission systems;
 - `pandalib-players` A library to handle classes representing online or offline players;
 - `pandalib-players-permissible` An extension of `pandalib-players` with support for the permission system `pandalib-permissions`;
 - `pandalib-netapi` A poorly designed, but working TCP network library;
+- `pandalib-config` Utility and helper classes to handle configuration related files and folders;
 - `pandalib-commands` An abstract command manager working on top of [Brigadier](https://github.com/Mojang/brigadier);
-- `pandalib-cli` Utility and helper classes for a standalone CLI Java application.
+- `pandalib-cli` Utility and helper classes for a standalone CLI Java application;
 - `pandalib-core` A catch-all module for some helper classes that didn't have their own module yet;
 
 ### Use in your projects

pandalib-bungee-chat/pom.xml

@@ -21,11 +21,6 @@
     </repositories>
 
     <dependencies>
-        <dependency>
-            <groupId>fr.pandacube.lib</groupId>
-            <artifactId>pandalib-util</artifactId>
-            <version>${project.version}</version>
-        </dependency>
         <dependency>
             <groupId>fr.pandacube.lib</groupId>
             <artifactId>pandalib-chat</artifactId>

pandalib-bungee-chat/src/main/java/fr/pandacube/lib/bungee/chat/ChatBungee.java

@@ -1,33 +1,36 @@
 package fr.pandacube.lib.bungee.chat;
 
 import fr.pandacube.lib.chat.Chat;
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import net.kyori.adventure.text.Component;
 import net.kyori.adventure.text.ComponentLike;
 import net.kyori.adventure.text.serializer.bungeecord.BungeeComponentSerializer;
 import net.md_5.bungee.api.chat.BaseComponent;
 
+/**
+ * Utility class to ease conversion between our Adventure backed Chat API and BungeeCord chat API.
+ */
 public class ChatBungee {
 
 
 
     /**
-     * Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent}.
+     * Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent}.
      * @param c the {@link BaseComponent}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat chatComponent(BaseComponent c) {
+    public static FormattableChat chatComponent(BaseComponent c) {
         return Chat.chatComponent(toAdventure(c));
     }
 
 
 
     /**
-     * Creates a {@link FormatableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
+     * Creates a {@link FormattableChat} from the provided Bungee {@link BaseComponent BaseComponent[]}.
      * @param c the array of {@link BaseComponent}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat chatComponent(BaseComponent[] c) {
+    public static FormattableChat chatComponent(BaseComponent[] c) {
         return Chat.chatComponent(toAdventure(c));
     }
 
@@ -68,4 +71,7 @@ public class ChatBungee {
         BaseComponent[] arr = toBungeeArray(component);
         return arr.length == 1 ? arr[0] : new net.md_5.bungee.api.chat.TextComponent(arr);
     }
+
+
+    private ChatBungee() {}
 }

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/PandaLibBungee.java

@@ -1,7 +1,7 @@
 package fr.pandacube.lib.bungee;
 
 import fr.pandacube.lib.bungee.util.BungeeDailyLogRotateFileHandler;
-import fr.pandacube.lib.bungee.util.PluginMessagePassthrough;
+import fr.pandacube.lib.bungee.util.PluginMessagePassThrough;
 import net.md_5.bungee.api.plugin.Plugin;
 
 /**
@@ -24,7 +24,7 @@ public class PandaLibBungee {
      * Method to be called in {@link Plugin#onEnable()} method.
      */
     public static void onEnable() {
-        PluginMessagePassthrough.init(plugin);
+        PluginMessagePassThrough.init(plugin);
         BungeeDailyLogRotateFileHandler.init(true);
     }
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/backup/BungeeBackupConfig.java

@@ -7,7 +7,7 @@ import java.util.ArrayList;
 import java.util.List;
 
 /**
- * Class that holds the configuration varables for {@link BungeeBackupManager}.
+ * Class that holds the configuration variables for {@link BungeeBackupManager}.
  */
 @SuppressWarnings("CanBeFinal")
 public class BungeeBackupConfig {

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/backup/BungeeBackupManager.java

@@ -7,14 +7,14 @@ import fr.pandacube.lib.core.backup.RotatedLogsBackupProcess;
 import java.io.File;
 
 /**
- * Handles the backup processes for a Bungeecord instance.
+ * Handles the backup processes for a BungeeCord instance.
  */
 public class BungeeBackupManager extends BackupManager {
 
 	BungeeBackupConfig config;
 
 	/**
-	 * Instanciate a new {@link BungeeBackupManager}.
+	 * Creates a new {@link BungeeBackupManager}.
 	 * @param config the configuration.
 	 */
 	public BungeeBackupManager(BungeeBackupConfig config) {

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/backup/BungeeWorkdirProcess.java

@@ -6,7 +6,7 @@ import java.io.File;
 import java.util.function.BiPredicate;
 
 /**
- * The backup process responsible for the working directory of the current Bungeecord instance.
+ * The backup process responsible for the working directory of the current BungeeCord instance.
  */
 public class BungeeWorkdirProcess extends BackupProcess {
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/players/BungeeOffPlayer.java

@@ -6,7 +6,7 @@ import net.md_5.bungee.api.connection.ProxiedPlayer;
 import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
 
 /**
- * Represents any player on a Bungeecord proxy, either offline or online.
+ * Represents any player on a BungeeCord proxy, either offline or online.
  */
 public interface BungeeOffPlayer extends AbstractOffPlayer {
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/players/BungeeOnlinePlayer.java

@@ -20,7 +20,7 @@ import net.md_5.bungee.protocol.packet.PluginMessage;
 import java.util.Locale;
 
 /**
- * Represents any online player on a Bungeecord proxy.
+ * Represents any online player on a BungeeCord proxy.
  */
 public interface BungeeOnlinePlayer extends BungeeOffPlayer, AbstractOnlinePlayer {
 

pandalib-bungee/src/main/java/fr/pandacube/lib/bungee/util/PluginMessagePassThrough.java

@@ -19,16 +19,16 @@ import net.md_5.bungee.event.EventHandler;
  * <p>
  * Usage example, in your plugin init code:
  * <pre>{@code
- * PluginMessagePassthrough.init(yourPluginInstance);
- * PluginMessagePassthrough.register("worldedit:cui"); // plugin message used by WorldEdit
+ * PluginMessagePassThrough.init(yourPluginInstance);
+ * PluginMessagePassThrough.register("worldedit:cui"); // plugin message used by WorldEdit
  * }</pre>
  */
-public class PluginMessagePassthrough implements Listener {
+public class PluginMessagePassThrough implements Listener {
     private static final List<String> channels = Collections.synchronizedList(new ArrayList<>());
-    private static final PluginMessagePassthrough instance = new PluginMessagePassthrough();
+    private static final PluginMessagePassThrough instance = new PluginMessagePassThrough();
 
     /**
-     * Initialize the {@link PluginMessagePassthrough}.
+     * Initialize the {@link PluginMessagePassThrough}.
      * It registers the required event listener.
      * @param plugin the plugin instance.
      */
@@ -92,7 +92,7 @@ public class PluginMessagePassthrough implements Listener {
     }
 
 
-    private PluginMessagePassthrough() { }
+    private PluginMessagePassThrough() { }
 
 
     /**

pandalib-chat/pom.xml

@@ -54,7 +54,7 @@
         <dependency>
             <groupId>com.google.code.gson</groupId>
             <artifactId>gson</artifactId>
-            <version>2.10.1</version>
+            <version>${gson.version}</version>
         </dependency>
     </dependencies>
 

pandalib-chat/src/main/java/fr/pandacube/lib/chat/Chat.java

@@ -35,8 +35,8 @@ import java.util.function.UnaryOperator;
  * This class implements {@link ComponentLike} and {@link HoverEventSource} so they can be used directly in
  * Adventure API and its implementation without using the final methods of this builder.
  * <p>
- * The unique possible concrete subclass of this class, {@link FormatableChat}, takes care of the formatting of the
- * built component. The rationale for this design is explained in the documentation of {@link FormatableChat}.
+ * The unique possible concrete subclass of this class, {@link FormattableChat}, takes care of the formatting of the
+ * built component. The rationale for this design is explained in the documentation of {@link FormattableChat}.
  */
 public abstract sealed class Chat extends ChatStatic implements HoverEventSource<Component>, ComponentLike {
 
@@ -296,7 +296,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * @param key the keybinding to display.
      * @return this.
      */
-    public Chat thenKeyBind(String key) { return then(keybind(key)); }
+    public Chat thenKeyBind(String key) { return then(keyBind(key)); }
 
     /**
      * Appends a component with the provided score name and objective.
@@ -454,7 +454,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * Appends a component filling a chat line with the configured decoration character and
      * color and a left-aligned text.
      * @param leftText the text aligned to the left.
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a left-aligned text.
      */
     public Chat thenLeftText(ComponentLike leftText) { return then(leftText(leftText, console)); }
@@ -463,7 +463,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * Appends a component filling a chat line with the configured decoration character and
      * color and a right-aligned text.
      * @param rightText the text aligned to the right.
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a right-aligned text.
      */
     public Chat thenRightText(ComponentLike rightText) { return then(rightText(rightText, console)); }
@@ -472,7 +472,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * Appends a component filling a chat line with the configured decoration character and
      * color and a centered text.
      * @param centerText the text aligned to the center.
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a centered text.
      */
     public Chat thenCenterText(ComponentLike centerText) {
@@ -481,7 +481,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
 
     /**
      * Appends a component filling a chat line with the configured decoration character and color.
-     * @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
+     * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
      */
     public Chat thenFilledLine() { return then(filledLine(console)); }
 
@@ -520,10 +520,10 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      *         .thenText("!"); // short for .then(Chat.text("!"))
      *         // the red color for "!" is not needed because the parent component is already red.
      * }</pre>
-     * When calling {@link #then(Component) #then(...)} on a {@link FormatableChat}, the method returns itself, cast
+     * When calling {@link #then(Component) #then(...)} on a {@link FormattableChat}, the method returns itself, cast
      * to {@link Chat}, to prevent future formatting (that the programmer would think it formats the previously appended
      * subcomponent). If the formatting of the currently built component is needed, since {@link Chat} is a sealed
-     * class which only subclass is {@link FormatableChat}, you can cast the builder, and use the format methods again.
+     * class which only subclass is {@link FormattableChat}, you can cast the builder, and use the format methods again.
      * <pre>{@code
      * Chat component = Chat.text("Hello ").red()
      *         .then(Chat.text("world").darkRed().bold())
@@ -532,8 +532,8 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
      * ((FormatableChat)component).underlined(); // this will not format only the last appended text.
      * }</pre>
      */
-    public static final class FormatableChat extends Chat {
-        /* package */ FormatableChat(ComponentBuilder<?, ?> c) {
+    public static final class FormattableChat extends Chat {
+        /* package */ FormattableChat(ComponentBuilder<?, ?> c) {
             super(c);
         }
 
@@ -543,33 +543,33 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param c true for console, false for game UI.
          * @return this.
          */
-        public FormatableChat console(boolean c) { console = c; return this; }
+        public FormattableChat console(boolean c) { console = c; return this; }
         /**
          * Configure the width of the line.
          * @param w the width to consider when rendering the line. In pixel for game UI rendering, n character for
          *                 console rendering.
          * @return this.
          */
-        public FormatableChat maxWidth(int w) { maxWidth = w; return this; }
+        public FormattableChat maxWidth(int w) { maxWidth = w; return this; }
 
         /**
          * Sets the color of this component.
          * @param c the color.
          * @return this.
          */
-        public FormatableChat color(TextColor c) { builder.color(c); return this; }
+        public FormattableChat color(TextColor c) { builder.color(c); return this; }
         /**
          * Sets the color of this component.
          * @param c the color.
          * @return this.
          */
-        public FormatableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
+        public FormattableChat color(Color c) { return color(c == null ? null : TextColor.color(c.getRGB())); }
         /**
          * Sets the color of this component.
          * @param c the color.
          * @return this.
          */
-        public FormatableChat color(String c) {
+        public FormattableChat color(String c) {
             if (c == null)
                 return color((TextColor) null);
             TextColor tc = c.startsWith("#")
@@ -585,138 +585,138 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * Sets the color of this component to {@link NamedTextColor#BLACK}.
          * @return this.
          */
-        public FormatableChat black() { return color(NamedTextColor.BLACK); }
+        public FormattableChat black() { return color(NamedTextColor.BLACK); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_BLUE}.
          * @return this.
          */
-        public FormatableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
+        public FormattableChat darkBlue() { return color(NamedTextColor.DARK_BLUE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_GREEN}.
          * @return this.
          */
-        public FormatableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
+        public FormattableChat darkGreen() { return color(NamedTextColor.DARK_GREEN); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_AQUA}.
          * @return this.
          */
-        public FormatableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
+        public FormattableChat darkAqua() { return color(NamedTextColor.DARK_AQUA); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_RED}.
          * @return this.
          */
-        public FormatableChat darkRed() { return color(NamedTextColor.DARK_RED); }
+        public FormattableChat darkRed() { return color(NamedTextColor.DARK_RED); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_PURPLE}.
          * @return this.
          */
-        public FormatableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
+        public FormattableChat darkPurple() { return color(NamedTextColor.DARK_PURPLE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#GOLD}.
          * @return this.
          */
-        public FormatableChat gold() { return color(NamedTextColor.GOLD); }
+        public FormattableChat gold() { return color(NamedTextColor.GOLD); }
         /**
          * Sets the color of this component to {@link NamedTextColor#GRAY}.
          * @return this.
          */
-        public FormatableChat gray() { return color(NamedTextColor.GRAY); }
+        public FormattableChat gray() { return color(NamedTextColor.GRAY); }
         /**
          * Sets the color of this component to {@link NamedTextColor#DARK_GRAY}.
          * @return this.
          */
-        public FormatableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
+        public FormattableChat darkGray() { return color(NamedTextColor.DARK_GRAY); }
         /**
          * Sets the color of this component to {@link NamedTextColor#BLUE}.
          * @return this.
          */
-        public FormatableChat blue() { return color(NamedTextColor.BLUE); }
+        public FormattableChat blue() { return color(NamedTextColor.BLUE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#GREEN}.
          * @return this.
          */
-        public FormatableChat green() { return color(NamedTextColor.GREEN); }
+        public FormattableChat green() { return color(NamedTextColor.GREEN); }
         /**
          * Sets the color of this component to {@link NamedTextColor#AQUA}.
          * @return this.
          */
-        public FormatableChat aqua() { return color(NamedTextColor.AQUA); }
+        public FormattableChat aqua() { return color(NamedTextColor.AQUA); }
         /**
          * Sets the color of this component to {@link NamedTextColor#RED}.
          * @return this.
          */
-        public FormatableChat red() { return color(NamedTextColor.RED); }
+        public FormattableChat red() { return color(NamedTextColor.RED); }
         /**
          * Sets the color of this component to {@link NamedTextColor#LIGHT_PURPLE}.
          * @return this.
          */
-        public FormatableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
+        public FormattableChat lightPurple() { return color(NamedTextColor.LIGHT_PURPLE); }
         /**
          * Sets the color of this component to {@link NamedTextColor#YELLOW}.
          * @return this.
          */
-        public FormatableChat yellow() { return color(NamedTextColor.YELLOW); }
+        public FormattableChat yellow() { return color(NamedTextColor.YELLOW); }
         /**
          * Sets the color of this component to {@link NamedTextColor#WHITE}.
          * @return this.
          */
-        public FormatableChat white() { return color(NamedTextColor.WHITE); }
+        public FormattableChat white() { return color(NamedTextColor.WHITE); }
 
 
         /**
          * Sets the color of this component to {@link ChatConfig#successColor}.
          * @return this.
          */
-        public FormatableChat successColor() { return color(ChatConfig.successColor); }
+        public FormattableChat successColor() { return color(ChatConfig.successColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#failureColor}.
          * @return this.
          */
-        public FormatableChat failureColor() { return color(ChatConfig.failureColor); }
+        public FormattableChat failureColor() { return color(ChatConfig.failureColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#infoColor}.
          * @return this.
          */
-        public FormatableChat infoColor() { return color(ChatConfig.infoColor); }
+        public FormattableChat infoColor() { return color(ChatConfig.infoColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#warningColor}.
          * @return this.
          */
-        public FormatableChat warningColor() { return color(ChatConfig.warningColor); }
+        public FormattableChat warningColor() { return color(ChatConfig.warningColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#dataColor}.
          * @return this.
          */
-        public FormatableChat dataColor() { return color(ChatConfig.dataColor); }
+        public FormattableChat dataColor() { return color(ChatConfig.dataColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#decorationColor}.
          * @return this.
          */
-        public FormatableChat decorationColor() { return color(ChatConfig.decorationColor); }
+        public FormattableChat decorationColor() { return color(ChatConfig.decorationColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#urlColor}.
          * @return this.
          */
-        public FormatableChat urlColor() { return color(ChatConfig.urlColor); }
+        public FormattableChat urlColor() { return color(ChatConfig.urlColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#commandColor}.
          * @return this.
          */
-        public FormatableChat commandColor() { return color(ChatConfig.commandColor); }
+        public FormattableChat commandColor() { return color(ChatConfig.commandColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#highlightedCommandColor}.
          * @return this.
          */
-        public FormatableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
+        public FormattableChat highlightedCommandColor() { return color(ChatConfig.highlightedCommandColor); }
         /**
          * Sets the color of this component to {@link ChatConfig#broadcastColor}.
          * @return this.
          */
-        public FormatableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
+        public FormattableChat broadcastColor() { return color(ChatConfig.broadcastColor); }
 
 
-        private FormatableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
-        private FormatableChat setDecoration(TextDecoration deco, Boolean state) {
+        private FormattableChat setStyle(Consumer<Style.Builder> styleOp) { builder.style(styleOp); return this; }
+        private FormattableChat setDecoration(TextDecoration deco, Boolean state) {
             return setStyle(b -> b.decoration(deco, State.byBoolean(state)));
         }
 
@@ -726,56 +726,56 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param b true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
+        public FormattableChat bold(Boolean b) { return setDecoration(TextDecoration.BOLD, b); }
         /**
          * Enables the bold status of this component.
          * @return this.
          */
-        public FormatableChat bold() { return bold(true); }
+        public FormattableChat bold() { return bold(true); }
         /**
          * Sets the italic status of this component.
          * @param i true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
+        public FormattableChat italic(Boolean i) { return setDecoration(TextDecoration.ITALIC, i); }
         /**
          * Enables the italic status of this component.
          * @return this.
          */
-        public FormatableChat italic() { return italic(true); }
+        public FormattableChat italic() { return italic(true); }
         /**
          * Sets the underlined status of this component.
          * @param u true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
+        public FormattableChat underlined(Boolean u) { return setDecoration(TextDecoration.UNDERLINED, u); }
         /**
          * Enables the underlined status of this component.
          * @return this.
          */
-        public FormatableChat underlined() { return underlined(true); }
+        public FormattableChat underlined() { return underlined(true); }
         /**
          * Sets the strikethrough status of this component.
          * @param s true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
+        public FormattableChat strikethrough(Boolean s) { return setDecoration(TextDecoration.STRIKETHROUGH, s); }
         /**
          * Enables the strikethrough status of this component.
          * @return this.
          */
-        public FormatableChat strikethrough() { return strikethrough(true); }
+        public FormattableChat strikethrough() { return strikethrough(true); }
         /**
          * Sets the obfuscated status of this component.
          * @param o true to enable, false to disable, or null to inherit from parent.
          * @return this.
          */
-        public FormatableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
+        public FormattableChat obfuscated(Boolean o) { return setDecoration(TextDecoration.OBFUSCATED, o); }
         /**
          * Enables the obfuscated status of this component.
          * @return this.
          */
-        public FormatableChat obfuscated() { return obfuscated(true); }
+        public FormattableChat obfuscated() { return obfuscated(true); }
 
 
         /**
@@ -783,7 +783,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param f the font namespaced key.
          * @return this.
          */
-        public FormatableChat font(Key f) { return setStyle(s -> s.font(f)); }
+        public FormattableChat font(Key f) { return setStyle(s -> s.font(f)); }
 
 
         /**
@@ -791,7 +791,7 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param i the text to insert.
          * @return this.
          */
-        public FormatableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
+        public FormattableChat shiftClickInsertion(String i) { builder.insertion(i); return this; }
 
 
         /**
@@ -799,37 +799,37 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param e the {@link ClickEvent}.
          * @return this.
          */
-        private FormatableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
+        private FormattableChat click(ClickEvent e) { builder.clickEvent(e); return this; }
         /**
          * Configure this component to execute the specified command when clicked.
          * @param cmdWithSlash the command to execute.
          * @return this.
          */
-        public FormatableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
+        public FormattableChat clickCommand(String cmdWithSlash) { return click(ClickEvent.runCommand(cmdWithSlash)); }
         /**
          * Configure this component to insert in the chat-box the specified command when clicked.
          * @param cmdWithSlash the command to suggest.
          * @return this.
          */
-        public FormatableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
+        public FormattableChat clickSuggest(String cmdWithSlash) { return click(ClickEvent.suggestCommand(cmdWithSlash)); }
         /**
          * Configure this component to copy into clipboard the specified text when clicked.
          * @param value the text to copy.
          * @return this.
          */
-        public FormatableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
+        public FormattableChat clickClipboard(String value) { return click(ClickEvent.copyToClipboard(value)); }
         /**
          * Configure this component to open the specified URL when clicked.
          * @param url the URL to open.
          * @return this.
          */
-        public FormatableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
+        public FormattableChat clickURL(String url) { return click(ClickEvent.openUrl(url)); }
         /**
          * Configure this component to change the page of the opened book when clicked.
          * @param page the page to go to.
          * @return this.
          */
-        public FormatableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
+        public FormattableChat clickBookPage(int page) { return click(ClickEvent.changePage(page)); }
 
 
         /**
@@ -837,31 +837,31 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
          * @param e the {@link HoverEventSource}.
          * @return this.
          */
-        public FormatableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
+        public FormattableChat hover(HoverEventSource<?> e) { builder.hoverEvent(e); return this; }
         /**
          * Configure this component to show the provided component when hovered.
          * @param v the component to show.
          * @return this.
          */
-        public FormatableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
+        public FormattableChat hover(Component v) { return hover((HoverEventSource<Component>) v); }
         /**
          * Configure this component to show the provided component when hovered.
          * @param v the component to show.
          * @return this.
          */
-        public FormatableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
+        public FormattableChat hover(Chat v) { return hover((HoverEventSource<Component>) v); }
         /**
          * Configure this component to show the provided component when hovered.
          * @param v the component to show.
          * @return this.
          */
-        public FormatableChat hover(ComponentLike v) { return hover(v.asComponent()); }
+        public FormattableChat hover(ComponentLike v) { return hover(v.asComponent()); }
         /**
          * Configure this component to show the provided legacy text when hovered.
          * @param legacyText the legacy text to show.
          * @return this.
          */
-        public FormatableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
+        public FormattableChat hover(String legacyText) { return hover(legacyText(legacyText)); }
 
     }
 
@@ -932,14 +932,14 @@ public abstract sealed class Chat extends ChatStatic implements HoverEventSource
 
     /**
      * Force the italic formatting to be set to false if it is not explicitly set in the component.
-     * This is useful for item lores that defaults to italic in the game UI.
+     * This is useful for item lore that defaults to italic in the game UI.
      * @param c the {@link Chat} in which to set the italic property if needed.
      * @return the provided {@link Chat} instance.
      */
     public static Chat italicFalseIfNotSet(Chat c) {
         c.builder.style(b -> {
             if (b.build().decoration(TextDecoration.ITALIC) == State.NOT_SET) {
-                ((FormatableChat) c).italic(false);
+                ((FormattableChat) c).italic(false);
             }
         });
         return c;

pandalib-chat/src/main/java/fr/pandacube/lib/chat/ChatFilledLine.java

@@ -5,7 +5,7 @@ import net.kyori.adventure.text.ComponentLike;
 import net.kyori.adventure.text.format.TextColor;
 import org.jetbrains.annotations.NotNull;
 
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 
 /**
  * Builder for a {@link Chat} component for filling a chat line, with decoration and eventual aligned text.
@@ -150,10 +150,10 @@ public class ChatFilledLine implements ComponentLike {
 
 
     /**
-     * Renders this line to a {@link FormatableChat}.
-     * @return a new {@link FormatableChat} built by this {@link ChatFilledLine}.
+     * Renders this line to a {@link FormattableChat}.
+     * @return a new {@link FormattableChat} built by this {@link ChatFilledLine}.
      */
-    public FormatableChat toChat() {
+    public FormattableChat toChat() {
         int maxWidth = (this.maxWidth != null)
                 ? this.maxWidth
                 : console ? ChatUtil.CONSOLE_NB_CHAR_DEFAULT : ChatUtil.DEFAULT_CHAT_WIDTH;
@@ -170,7 +170,7 @@ public class ChatFilledLine implements ComponentLike {
         int textWidth = ChatUtil.componentWidth(text.asComponent(), console);
 
         if (textWidth > maxWidth)
-            return (FormatableChat) text;
+            return (FormattableChat) text;
 
         int repeatedCharWidth = ChatUtil.charW(decorationChar, console, decorationBold);
         int nbCharLeft = 0, nbCharRight = 0;
@@ -179,12 +179,12 @@ public class ChatFilledLine implements ComponentLike {
             case CENTER -> {
                 nbCharLeft = nbCharRight = (maxWidth - textWidth) / 2 / repeatedCharWidth;
                 if (nbCharLeft == 0)
-                    return (FormatableChat) text;
+                    return (FormattableChat) text;
             }
             case LEFT, RIGHT -> {
                 int remWidth = textWidth + nbSide * repeatedCharWidth;
                 if (remWidth > maxWidth)
-                    return (FormatableChat) text;
+                    return (FormattableChat) text;
                 boolean left = alignment == Alignment.LEFT;
                 int nbOtherSide = (maxWidth - remWidth) / repeatedCharWidth;
                 nbCharLeft  = left ? nbSide : nbOtherSide;
@@ -197,7 +197,7 @@ public class ChatFilledLine implements ComponentLike {
                 .then(text);
         if (decorationChar != ' ' || spacesDecorationRightSide)
             d.then(Chat.text(ChatUtil.repeatedChar(decorationChar, nbCharRight)).color(decorationColor).bold(decorationBold));
-        return (FormatableChat) d;
+        return (FormattableChat) d;
     }
 
 

pandalib-chat/src/main/java/fr/pandacube/lib/chat/ChatStatic.java

@@ -1,6 +1,6 @@
 package fr.pandacube.lib.chat;
 
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import net.kyori.adventure.text.BlockNBTComponent;
 import net.kyori.adventure.text.Component;
 import net.kyori.adventure.text.ComponentBuilder;
@@ -27,27 +27,27 @@ public abstract class ChatStatic {
 
 
 
-    private static FormatableChat chatComponent(Component c) {
-        return new FormatableChat(componentToBuilder(c));
+    private static FormattableChat chatComponent(Component c) {
+        return new FormattableChat(componentToBuilder(c));
     }
 
     /**
-     * Creates a {@link FormatableChat} from the provided {@link ComponentLike}.
+     * Creates a {@link FormattableChat} from the provided {@link ComponentLike}.
      * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
      * will be untouched.
      * @param c the {@link ComponentLike}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat chatComponent(ComponentLike c) {
+    public static FormattableChat chatComponent(ComponentLike c) {
         return chatComponent(c.asComponent());
     }
 
     /**
-     * Creates a {@link FormatableChat} with an empty main text content.
-     * @return a new empty {@link FormatableChat}.
+     * Creates a {@link FormattableChat} with an empty main text content.
+     * @return a new empty {@link FormattableChat}.
      */
-    public static FormatableChat chat() {
-        return new FormatableChat(Component.text());
+    public static FormattableChat chat() {
+        return new FormattableChat(Component.text());
     }
 
 
@@ -56,60 +56,60 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content.
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content.
+     * @return a new {@link FormattableChat} with the provided text as its main text content.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    public static FormatableChat text(Object plainText) {
+    public static FormattableChat text(Object plainText) {
         if (plainText instanceof ComponentLike) {
             throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + plainText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
         }
-        return new FormatableChat(Component.text().content(Objects.toString(plainText)));
+        return new FormattableChat(Component.text().content(Objects.toString(plainText)));
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its content, using the section {@code "§"}
+     * Creates a {@link FormattableChat} with the provided legacy text as its content, using the section {@code "§"}
      * character.
      * @param legacyText the legacy text to use as the content, that uses the {@code "§"} character.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    public static FormatableChat legacyText(Object legacyText) {
+    public static FormattableChat legacyText(Object legacyText) {
         return legacyText(legacyText, LegacyComponentSerializer.SECTION_CHAR);
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
+     * Creates a {@link FormattableChat} with the provided legacy text as its content, using the ampersand {@code "&"}
      * character.
      * @param legacyText the legacy text to use as the content, that uses the {@code "&"} character.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    public static FormatableChat legacyAmpersandText(Object legacyText) {
+    public static FormattableChat legacyAmpersandText(Object legacyText) {
         return legacyText(legacyText, LegacyComponentSerializer.AMPERSAND_CHAR);
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its content, using the specified
+     * Creates a {@link FormattableChat} with the provided legacy text as its content, using the specified
      * legacyCharacter.
      * @param legacyText the legacy text to use as the content.
      * @param legacyCharacter the character used in the provided text to prefix color and format code.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      * @throws IllegalArgumentException If the {@code legacyText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)}
      *         instead.
      */
-    private static FormatableChat legacyText(Object legacyText, char legacyCharacter) {
+    private static FormattableChat legacyText(Object legacyText, char legacyCharacter) {
         if (legacyText instanceof ComponentLike) {
             throw new IllegalArgumentException("Expected any object except instance of " + ComponentLike.class + ". Received " + legacyText + ". Please use ChatStatic.chatComponent(ComponentLike) instead.");
         }
@@ -118,118 +118,118 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided MiniMessage text as its content.
+     * Creates a {@link FormattableChat} with the provided MiniMessage text as its content.
      * @param miniMessageText the MiniMessage text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its content.
+     * @return a new {@link FormattableChat} with the provided text as its content.
      */
-    public static FormatableChat miniMessageText(String miniMessageText) {
+    public static FormattableChat miniMessageText(String miniMessageText) {
         return chatComponent(MiniMessage.miniMessage().deserialize(miniMessageText));
     }
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#infoColor configured info color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#infoColor()} instead.
+     *         {@link FormattableChat#infoColor()} instead.
      */
-    public static FormatableChat infoText(Object plainText) {
+    public static FormattableChat infoText(Object plainText) {
         return text(plainText).infoColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#warningColor configured warning color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#warningColor()} instead.
+     *         {@link FormattableChat#warningColor()} instead.
      */
-    public static FormatableChat warningText(Object plainText) {
+    public static FormattableChat warningText(Object plainText) {
         return text(plainText).warningColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#dataColor configured data color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#dataColor()} instead.
+     *         {@link FormattableChat#dataColor()} instead.
      */
-    public static FormatableChat dataText(Object plainText) {
+    public static FormattableChat dataText(Object plainText) {
         return text(plainText).dataColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#decorationColor configured decorationColor color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#decorationColor()} instead.
+     *         {@link FormattableChat#decorationColor()} instead.
      */
-    public static FormatableChat decorationText(Object plainText) {
+    public static FormattableChat decorationText(Object plainText) {
         return text(plainText).decorationColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#successColor configured success color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#successColor()} instead.
+     *         {@link FormattableChat#successColor()} instead.
      */
-    public static FormatableChat successText(Object plainText) {
+    public static FormattableChat successText(Object plainText) {
         return text(plainText).successColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided plain text as its main text content, and colored using the
+     * Creates a {@link FormattableChat} with the provided plain text as its main text content, and colored using the
      * {@link ChatConfig#failureColor configured failure color}.
      * @param plainText the text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#failureColor()} instead.
+     *         {@link FormattableChat#failureColor()} instead.
      */
-    public static FormatableChat failureText(Object plainText) {
+    public static FormattableChat failureText(Object plainText) {
         return text(plainText).failureColor();
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided legacy text as its main text content, and colored in white in
+     * Creates a {@link FormattableChat} with the provided legacy text as its main text content, and colored in white in
      * case there is no color on the generated parent component.
      * @param legacyText the legacy text to use as the content.
-     * @return a new {@link FormatableChat} with the provided text as its main text content, and the configured color.
+     * @return a new {@link FormattableChat} with the provided text as its main text content, and the configured color.
      * @throws IllegalArgumentException if the {@code plainText} parameter is instance of {@link Chat} or
      *         {@link Component}. The caller should use {@link #chatComponent(ComponentLike)} and
-     *         {@link FormatableChat#failureColor()} instead.
+     *         {@link FormattableChat#failureColor()} instead.
      */
-    public static FormatableChat playerNameText(String legacyText) {
-        FormatableChat fc = legacyText(legacyText);
+    public static FormattableChat playerNameText(String legacyText) {
+        FormattableChat fc = legacyText(legacyText);
         fc.builder.colorIfAbsent(NamedTextColor.WHITE);
         return fc;
     }
 
     /**
-     * Creates a {@link FormatableChat} from the provided {@link Component}, coloring in white the generated parent
+     * Creates a {@link FormattableChat} from the provided {@link Component}, coloring in white the generated parent
      * component in case there is no color defined.
      * If the provided component is an instance of {@link Chat}, its content will be duplicated, and the provided one
      * will be untouched.
      * @param c the {@link Component}.
-     * @return a new {@link FormatableChat}.
+     * @return a new {@link FormattableChat}.
      */
-    public static FormatableChat playerNameComponent(ComponentLike c) {
-        FormatableChat fc = chatComponent(c);
+    public static FormattableChat playerNameComponent(ComponentLike c) {
+        FormattableChat fc = chatComponent(c);
         fc.builder.colorIfAbsent(NamedTextColor.WHITE);
         return fc;
     }
@@ -238,32 +238,32 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} with the provided translation key and parameters.
+     * Creates a {@link FormattableChat} with the provided translation key and parameters.
      * @param key the translation key.
      * @param with the translation parameters.
-     * @return a new {@link FormatableChat} with the provided translation key and parameters.
+     * @return a new {@link FormattableChat} with the provided translation key and parameters.
      */
-    public static FormatableChat translation(String key, Object... with) {
-        return new FormatableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
+    public static FormattableChat translation(String key, Object... with) {
+        return new FormattableChat(Component.translatable().key(key).arguments(Chat.filterObjToTranslationArgumentLike(with)));
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided keybinding.
+     * Creates a {@link FormattableChat} with the provided keybinding.
      * @param key the keybinding to display.
-     * @return a new {@link FormatableChat} with the provided keybinding.
+     * @return a new {@link FormattableChat} with the provided keybinding.
      */
-    public static FormatableChat keybind(String key) {
-        return new FormatableChat(Component.keybind().keybind(key));
+    public static FormattableChat keyBind(String key) {
+        return new FormattableChat(Component.keybind().keybind(key));
     }
 
     /**
-     * Creates a {@link FormatableChat} with the provided score name and objective.
+     * Creates a {@link FormattableChat} with the provided score name and objective.
      * @param name the score name.
      * @param objective the score objective.
-     * @return a new {@link FormatableChat} with the provided score name and objective.
+     * @return a new {@link FormattableChat} with the provided score name and objective.
      */
-    public static FormatableChat score(String name, String objective) {
-        return new FormatableChat(Component.score().name(name).objective(objective));
+    public static FormattableChat score(String name, String objective) {
+        return new FormattableChat(Component.score().name(name).objective(objective));
     }
 
 
@@ -272,49 +272,49 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * @param inner the component to make clickable.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
+    public static FormattableChat clickableURL(ComponentLike inner, String url, HoverEventSource<?> hover) {
         Objects.requireNonNull(url, "url");
         if (inner == null)
             inner = text(url);
         if (hover == null)
             hover = text(ChatUtil.wrapInLimitedPixels(url, 240));
-        return (FormatableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
+        return (FormattableChat) chat().clickURL(url).urlColor().hover(hover).then(inner);
     }
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * <p>
      * When hovered, the component will display the url. To customize the hover content, use
      * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
      * @param inner the component to make clickable.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(ComponentLike inner, String url) {
+    public static FormattableChat clickableURL(ComponentLike inner, String url) {
         return clickableURL(inner, url, null);
     }
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * <p>
      * The text on which to click will be the URL itself. To configure the clicked text, use
      * {@link #clickableURL(ComponentLike, String, HoverEventSource)}.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(String url, HoverEventSource<?> hover) {
+    public static FormattableChat clickableURL(String url, HoverEventSource<?> hover) {
         return clickableURL(null, url, hover);
     }
 
     /**
-     * Creates a {@link FormatableChat} that leads to a URL when clicked.
+     * Creates a {@link FormattableChat} that leads to a URL when clicked.
      * <p>
      * The text on which to click will be the URL itself. To configure the clicked text, use
      * {@link #clickableURL(ComponentLike, String)}.
@@ -322,9 +322,9 @@ public abstract class ChatStatic {
      * When hovered, the component will display the url. To customize the hover content, use
      * {@link #clickableURL(String, HoverEventSource)}.
      * @param url the target url. Must start with {@code "http://"} or {@code "https://"}.
-     * @return a new {@link FormatableChat} that leads to a URL when clicked.
+     * @return a new {@link FormattableChat} that leads to a URL when clicked.
      */
-    public static FormatableChat clickableURL(String url) {
+    public static FormattableChat clickableURL(String url) {
         return clickableURL(null, url, null);
     }
 
@@ -334,14 +334,14 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
         Objects.requireNonNull(commandWithSlash, "commandWithSlash");
         if (!commandWithSlash.startsWith("/"))
             throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -349,39 +349,39 @@ public abstract class ChatStatic {
             inner = text(commandWithSlash);
         if (hover == null)
             hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
-        return (FormatableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
+        return (FormattableChat) chat().clickCommand(commandWithSlash).commandColor().hover(hover).then(inner);
     }
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * <p>
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
+    public static FormattableChat clickableCommand(ComponentLike inner, String commandWithSlash) {
         return clickableCommand(inner, commandWithSlash, null);
     }
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableCommand(ComponentLike, String, HoverEventSource)}.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableCommand(String commandWithSlash, HoverEventSource<?> hover) {
         return clickableCommand(null, commandWithSlash, hover);
     }
 
     /**
-     * Creates a {@link FormatableChat} that runs a command when clicked.
+     * Creates a {@link FormattableChat} that runs a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableCommand(ComponentLike, String)}.
@@ -389,10 +389,10 @@ public abstract class ChatStatic {
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableCommand(String, HoverEventSource)}.
      * @param commandWithSlash the command to run. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that runs a command when clicked.
+     * @return a new {@link FormattableChat} that runs a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableCommand(String commandWithSlash) {
+    public static FormattableChat clickableCommand(String commandWithSlash) {
         return clickableCommand(null, commandWithSlash, null);
     }
 
@@ -402,14 +402,14 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash, HoverEventSource<?> hover) {
         Objects.requireNonNull(commandWithSlash, "commandWithSlash");
         if (!commandWithSlash.startsWith("/"))
             throw new IllegalArgumentException("commandWithSlash must start with a '/' character.");
@@ -417,39 +417,39 @@ public abstract class ChatStatic {
             inner = text(commandWithSlash);
         if (hover == null)
             hover = text(ChatUtil.wrapInLimitedPixels(commandWithSlash, 240));
-        return (FormatableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
+        return (FormattableChat) chat().clickSuggest(commandWithSlash).commandColor().hover(hover).then(inner);
     }
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * <p>
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
      * @param inner the component to make clickable.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
+    public static FormattableChat clickableSuggest(ComponentLike inner, String commandWithSlash) {
         return clickableSuggest(inner, commandWithSlash, null);
     }
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableSuggest(ComponentLike, String, HoverEventSource)}.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
      * @param hover the content to display when hovering the component.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
+    public static FormattableChat clickableSuggest(String commandWithSlash, HoverEventSource<?> hover) {
         return clickableSuggest(null, commandWithSlash, hover);
     }
 
     /**
-     * Creates a {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * Creates a {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * <p>
      * The text on which to click will be the command itself. To configure the clicked text, use
      * {@link #clickableSuggest(ComponentLike, String)}.
@@ -457,10 +457,10 @@ public abstract class ChatStatic {
      * When hovered, the component will display the command itself. To customize the hover content, use
      * {@link #clickableSuggest(String, HoverEventSource)}.
      * @param commandWithSlash the command to suggest. Must start with {@code "/"}.
-     * @return a new {@link FormatableChat} that pre-fill the chat box with a command when clicked.
+     * @return a new {@link FormattableChat} that pre-fill the chat box with a command when clicked.
      * @throws IllegalArgumentException if {@code commandWithSlash} does not start with a {@code "/"}.
      */
-    public static FormatableChat clickableSuggest(String commandWithSlash) {
+    public static FormattableChat clickableSuggest(String commandWithSlash) {
         return clickableSuggest(null, commandWithSlash, null);
     }
 
@@ -472,112 +472,112 @@ public abstract class ChatStatic {
 
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with decoration and a left-aligned text.
+     * Creates a {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
      * @param text the text aligned to the left.
      * @param decorationChar the character used for decoration around the text.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with decoration and a left-aligned text.
+     * @return a new {@link FormattableChat} filling a chat line with decoration and a left-aligned text.
      * @see ChatFilledLine#leftText(ComponentLike)
      */
-    public static FormatableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat leftText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.leftText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color and a left-aligned text.
      * @param text the text aligned to the left.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a left-aligned text.
      * @see ChatFilledLine#leftText(ComponentLike)
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat leftText(ComponentLike text, boolean console) {
+    public static FormattableChat leftText(ComponentLike text, boolean console) {
         return ChatFilledLine.leftText(text).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with decoration and a right-aligned text.
+     * Creates a {@link FormattableChat} filling a chat line with decoration and a right-aligned text.
      * @param text the text aligned to the right.
      * @param decorationChar the character used for decoration around the text.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with decoration and a right-aligned
+     * @return a new {@link FormattableChat} filling a chat line with decoration and a right-aligned
      *         text.
      * @see ChatFilledLine#rightText(ComponentLike)
      */
-    public static FormatableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat rightText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.rightText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color and a right-aligned text.
      * @param text the text aligned to the right.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a right-aligned text.
      * @see ChatFilledLine#rightText(ComponentLike)
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat rightText(ComponentLike text, boolean console) {
+    public static FormattableChat rightText(ComponentLike text, boolean console) {
         return ChatFilledLine.rightText(text).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with decoration and a centered text.
+     * Creates a {@link FormattableChat} filling a chat line with decoration and a centered text.
      * @param text the text aligned to the center.
      * @param decorationChar the character used for decoration around the text.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with decoration and a centered text.
+     * @return a new {@link FormattableChat} filling a chat line with decoration and a centered text.
      * @see ChatFilledLine#centerText(ComponentLike)
      */
-    public static FormatableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat centerText(ComponentLike text, char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.centerText(text).decoChar(decorationChar).decoColor(decorationColor).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color and a centered text.
      * @param text the text aligned to the center.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with the configured decoration character
+     * @return a new {@link FormattableChat} filling a chat line with the configured decoration character
      *         and color and a centered text.
      * @see ChatFilledLine#centerText(ComponentLike)
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat centerText(ComponentLike text, boolean console) {
+    public static FormattableChat centerText(ComponentLike text, boolean console) {
         return ChatFilledLine.centerText(text).spacesAroundText().console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with a decoration character and color.
+     * Creates a {@link FormattableChat} filling a chat line with a decoration character and color.
      * @param decorationChar the character used for decoration.
      * @param decorationColor the color used for the decoration characters.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
+     * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
      * @see ChatFilledLine#filled()
      */
-    public static FormatableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
+    public static FormattableChat filledLine(char decorationChar, TextColor decorationColor, boolean console) {
         return ChatFilledLine.filled().decoChar(decorationChar).decoColor(decorationColor).console(console).toChat();
     }
 
     /**
-     * Creates a {@link FormatableChat} filling a chat line with the configured decoration character and
+     * Creates a {@link FormattableChat} filling a chat line with the configured decoration character and
      * color.
      * @param console if the line is rendered on console (true) or IG (false).
-     * @return a new {@link FormatableChat} filling a chat line with a decoration character and color.
+     * @return a new {@link FormattableChat} filling a chat line with a decoration character and color.
      * @see ChatFilledLine#filled()
      * @see ChatConfig#decorationChar
      * @see ChatConfig#decorationColor
      */
-    public static FormatableChat filledLine(boolean console) {
+    public static FormattableChat filledLine(boolean console) {
         return ChatFilledLine.filled().console(console).toChat();
     }
 

pandalib-chat/src/main/java/fr/pandacube/lib/chat/ChatUtil.java

@@ -1,6 +1,6 @@
 package fr.pandacube.lib.chat;
 
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import net.kyori.adventure.text.Component;
 import net.kyori.adventure.text.ComponentLike;
 import net.kyori.adventure.text.TextComponent;
@@ -152,7 +152,7 @@ public class ChatUtil {
             else
                 first = false;
 
-            FormatableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
+            FormattableChat pDisplay = Chat.clickableCommand(Chat.text(page), String.format(cmdFormat, page), Chat.text("Aller à la page " + page));
             if (page == currentPage) {
                 pDisplay.highlightedCommandColor();
             }
@@ -180,12 +180,12 @@ public class ChatUtil {
      * @param elements the components to join.
      * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
      */
-    public static FormatableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
+    public static FormattableChat joinGrammatically(ComponentLike regularSeparator, ComponentLike finalSeparator, List<? extends ComponentLike> elements) {
         int size = elements == null ? 0 : elements.size();
         int last = size - 1;
         return switch (size) {
             case 0, 1, 2 -> join(finalSeparator, elements);
-            default -> (FormatableChat) join(regularSeparator, elements.subList(0, last))
+            default -> (FormattableChat) join(regularSeparator, elements.subList(0, last))
                     .then(finalSeparator)
                     .then(elements.get(last));
         };
@@ -202,8 +202,8 @@ public class ChatUtil {
      * @param elements the components to join.
      * @return a new {@link Chat} instance with all the provided {@code component} joined using the separators.
      */
-    public static FormatableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
-        FormatableChat c = chat();
+    public static FormattableChat join(ComponentLike separator, Iterable<? extends ComponentLike> elements) {
+        FormattableChat c = chat();
         if (elements == null)
             return c;
         boolean first = true;
@@ -596,7 +596,7 @@ public class ChatUtil {
         for (int i = 0; i < sizes.length; i++) {
             sumSizes += sizes[i];
 
-            FormatableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
+            FormattableChat subC = ChatStatic.text(repeatedChar(PROGRESS_BAR_FULL_CHAR, sizes[i]));
 
             if (colors != null && i < colors.length && colors[i] != null)
                 subC.color(colors[i]);

pandalib-chat/src/main/java/fr/pandacube/lib/chat/LegacyChatFormat.java

@@ -11,36 +11,107 @@ import java.util.LinkedHashMap;
 import java.util.Map;
 import java.util.stream.Collectors;
 
+/**
+ * Convenient enum to uses legacy format while keeping compatibility with modern chat format and API (Adventure, ...)
+ */
 public enum LegacyChatFormat {
 
+    /**
+     * Black (0) color format code.
+     */
     BLACK('0'),
+    /**
+     * Dark blue (1) color format code.
+     */
     DARK_BLUE('1'),
+    /**
+     * Dark green (2) color format code.
+     */
     DARK_GREEN('2'),
+    /**
+     * Dark aqua (3) color format code.
+     */
     DARK_AQUA('3'),
+    /**
+     * Dark red (4) color format code.
+     */
     DARK_RED('4'),
+    /**
+     * Dark purple (5) color format code.
+     */
     DARK_PURPLE('5'),
+    /**
+     * Gold (6) color format code.
+     */
     GOLD('6'),
+    /**
+     * Gray (7) color format code.
+     */
     GRAY('7'),
+    /**
+     * Dark gray (8) color format code.
+     */
     DARK_GRAY('8'),
+    /**
+     * Blue (9) color format code.
+     */
     BLUE('9'),
+    /**
+     * Green (A) color format code.
+     */
     GREEN('a'),
+    /**
+     * Aqua (B) color format code.
+     */
     AQUA('b'),
+    /**
+     * Red (C) color format code.
+     */
     RED('c'),
+    /**
+     * Light purple (D) color format code.
+     */
     LIGHT_PURPLE('d'),
+    /**
+     * Yellow (E) color format code.
+     */
     YELLOW('e'),
+    /**
+     * White (F) color format code.
+     */
     WHITE('f'),
-    MAGIC('k'),
+    /**
+     * Obfuscated (K) decoration format code.
+     */
+    OBFUSCATED('k'),
+    /**
+     * Bold (L) decoration format code.
+     */
     BOLD('l'),
+    /**
+     * Strikethrough (M) decoration format code.
+     */
     STRIKETHROUGH('m'),
+    /**
+     * Underlined (N) decoration format code.
+     */
     UNDERLINED('n'),
+    /**
+     * Italic (O) decoration format code.
+     */
     ITALIC('o'),
+    /**
+     * Reset (R) format code.
+     */
     RESET('r');
 
 
-
-
-
+    /**
+     * The character used by Minecraft for legacy chat format.
+     */
     public static final char COLOR_CHAR = LegacyComponentSerializer.SECTION_CHAR;
+
+    /** {@link #COLOR_CHAR} but as a String! */
     public static final String COLOR_STR_PREFIX = Character.toString(COLOR_CHAR);
 
     private static final Map<Character, LegacyChatFormat> BY_CHAR;
@@ -48,10 +119,20 @@ public enum LegacyChatFormat {
     private static final Map<LegacyFormat, LegacyChatFormat> BY_LEGACY;
 
 
+    /**
+     * Gets the {@link LegacyChatFormat} from the provided chat color code.
+     * @param code the character code from [0-9A-Fa-fK-Ok-oRr].
+     * @return the {@link LegacyChatFormat} related to the provided code.
+     */
     public static LegacyChatFormat of(char code) {
         return BY_CHAR.get(Character.toLowerCase(code));
     }
 
+    /**
+     * Gets the {@link LegacyChatFormat} from the provided {@link TextFormat} instance.
+     * @param format the {@link TextFormat} instance.
+     * @return the {@link LegacyChatFormat} related to the provided format.
+     */
     public static LegacyChatFormat of(TextFormat format) {
         LegacyChatFormat colorOrDecoration = BY_FORMAT.get(format);
         if (colorOrDecoration != null)
@@ -61,19 +142,24 @@ public enum LegacyChatFormat {
         throw new IllegalArgumentException("Unsupported format of type " + format.getClass());
     }
 
+    /**
+     * Gets the {@link LegacyChatFormat} from the provided {@link LegacyFormat} instance.
+     * @param advLegacy the {@link LegacyFormat} instance.
+     * @return the {@link LegacyChatFormat} related to the provided format.
+     */
     public static LegacyChatFormat of(LegacyFormat advLegacy) {
         return BY_LEGACY.get(advLegacy);
     }
 
 
-
-
-
-
-
-
-
+    /**
+     * The format code of this chat format.
+     */
     public final char code;
+
+    /**
+     * The Adventure legacy format instance related to this chat format.
+     */
     public final LegacyFormat advLegacyFormat;
 
     LegacyChatFormat(char code) {
@@ -81,22 +167,42 @@ public enum LegacyChatFormat {
         advLegacyFormat = LegacyComponentSerializer.parseChar(code);
     }
 
+    /**
+     * Gets the related {@link TextColor}, or null if it's not a color.
+     * @return the related {@link TextColor}, or null if it's not a color.
+     */
     public TextColor getTextColor() {
         return advLegacyFormat.color();
     }
 
+    /**
+     * Tells if this format is a color.
+     * @return true if this format is a color, false otherwise.
+     */
     public boolean isColor() {
         return getTextColor() != null;
     }
 
+    /**
+     * Gets the related {@link TextDecoration}, or null if it's not a decoration.
+     * @return the related {@link TextDecoration}, or null if it's not a decoration.
+     */
     public TextDecoration getTextDecoration() {
         return advLegacyFormat.decoration();
     }
 
+    /**
+     * Tells if this format is a decoration (bold, italic, ...).
+     * @return true if this format is a decoration, false otherwise.
+     */
     public boolean isDecoration() {
         return getTextDecoration() != null;
     }
 
+    /**
+     * Tells if this format is the reset.
+     * @return true if this format is the reset, false otherwise.
+     */
     public boolean isReset() {
         return this == RESET;
     }
@@ -109,14 +215,16 @@ public enum LegacyChatFormat {
 
 
     static {
-        BY_CHAR = Arrays.stream(values()).sequential().collect(Collectors.toMap(e -> e.code, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
+        BY_CHAR = Arrays.stream(values()).sequential()
+                .collect(Collectors.toMap(e -> e.code, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
         BY_FORMAT = Arrays.stream(values()).sequential()
                 .filter(e -> e.isColor() || e.isDecoration())
                 .collect(Collectors.toMap(e -> {
-            if (e.isColor())
-                return e.getTextColor();
-            return e.getTextDecoration();
-        }, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
-        BY_LEGACY = Arrays.stream(values()).sequential().collect(Collectors.toMap(e -> e.advLegacyFormat, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
+                    if (e.isColor())
+                        return e.getTextColor();
+                    return e.getTextDecoration();
+                }, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
+        BY_LEGACY = Arrays.stream(values()).sequential()
+                .collect(Collectors.toMap(e -> e.advLegacyFormat, e -> e, (e1, e2) -> e1, LinkedHashMap::new));
     }
 }

pandalib-cli/pom.xml

@@ -15,42 +15,26 @@
     <packaging>jar</packaging>
     
 	<repositories>
-		<repository>
-			<id>minecraft-libraries</id>
-			<name>Minecraft Libraries</name>
-			<url>https://libraries.minecraft.net</url>
-		</repository>
         <repository>
             <id>bungeecord-repo</id>
             <url>https://oss.sonatype.org/content/repositories/snapshots</url>
         </repository>
     </repositories>
 
-  <dependencies>
-      <dependency>
-          <groupId>fr.pandacube.lib</groupId>
-          <artifactId>pandalib-core</artifactId>
-          <version>${project.version}</version>
-      </dependency>
-      <dependency>
-          <groupId>fr.pandacube.lib</groupId>
-          <artifactId>pandalib-reflect</artifactId>
-          <version>${project.version}</version>
-      </dependency>
-      <dependency>
-          <groupId>fr.pandacube.lib</groupId>
-          <artifactId>pandalib-commands</artifactId>
-          <version>${project.version}</version>
-      </dependency>
-
+    <dependencies>
         <dependency>
-            <groupId>net.md-5</groupId>
-            <artifactId>bungeecord-log</artifactId>
-            <version>${bungeecord.version}</version>
+            <groupId>fr.pandacube.lib</groupId>
+            <artifactId>pandalib-core</artifactId>
+            <version>${project.version}</version>
+        </dependency>
+        <dependency>
+            <groupId>fr.pandacube.lib</groupId>
+            <artifactId>pandalib-commands</artifactId>
+            <version>${project.version}</version>
         </dependency>
         <dependency>
             <groupId>net.md-5</groupId>
-            <artifactId>bungeecord-config</artifactId>
+            <artifactId>bungeecord-log</artifactId>
             <version>${bungeecord.version}</version>
         </dependency>
 

pandalib-cli/src/main/java/fr/pandacube/lib/cli/CLI.java

@@ -1,22 +1,25 @@
 package fr.pandacube.lib.cli;
 
+import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
+import fr.pandacube.lib.cli.log.CLILogger;
+import fr.pandacube.lib.util.log.Log;
+import org.jline.reader.EndOfFileException;
+import org.jline.reader.LineReader;
+import org.jline.reader.LineReaderBuilder;
+import org.jline.reader.UserInterruptException;
+import org.jline.terminal.Terminal;
+import org.jline.terminal.TerminalBuilder;
+
 import java.io.IOException;
 import java.util.logging.Logger;
 
-import fr.pandacube.lib.cli.commands.CLIBrigadierDispatcher;
-import fr.pandacube.lib.cli.log.CLILogger;
-import jline.console.ConsoleReader;
-import org.fusesource.jansi.AnsiConsole;
-
-import fr.pandacube.lib.util.log.Log;
-
 /**
- * Class to handle general standard IO operation for a CLI application. It uses Jline’s {@link ConsoleReader} for the
+ * Class to handle general standard IO operation for a CLI application. It uses Jline’s {@link LineReader} for the
  * console rendering, a JUL {@link Logger} for logging, and Brigadier to handle commands.
  */
 public class CLI extends Thread {
 	
-	private final ConsoleReader reader;
+	private final LineReader reader;
 	private final Logger logger;
 
 
@@ -28,10 +31,11 @@ public class CLI extends Thread {
 		super("Console Thread");
 		setDaemon(true);
 
-        AnsiConsole.systemInstall();
-		reader = new ConsoleReader();
-		reader.setPrompt(">");
-		reader.addCompleter(CLIBrigadierDispatcher.instance);
+		Terminal terminal = TerminalBuilder.builder().build();
+		reader = LineReaderBuilder.builder().terminal(terminal)
+				.completer(CLIBrigadierDispatcher.instance)
+				.build()
+		;
 
 		// configure logger's formatter
 		System.setProperty("net.md_5.bungee.log-date-format", "yyyy-MM-dd HH:mm:ss");
@@ -40,10 +44,10 @@ public class CLI extends Thread {
 
 
 	/**
-	 * Gets the Jline {@link ConsoleReader} of this CLI instance.
-	 * @return the Jline {@link ConsoleReader} of this CLI instance.
+	 * Gets the Jline {@link LineReader} of this CLI instance.
+	 * @return the Jline {@link LineReader} of this CLI instance.
 	 */
-	public ConsoleReader getConsoleReader() {
+	public LineReader getConsoleReader() {
 		return reader;
 	}
 
@@ -65,15 +69,14 @@ public class CLI extends Thread {
 		int i = 0;
 		String line;
 		try {
-			while((line = reader.readLine()) != null) {
-				if (line.trim().equals(""))
+			while((line = reader.readLine(">")) != null) {
+				if (line.trim().isEmpty())
 					continue;
 				String cmdLine = line;
-				new Thread(() -> CLIBrigadierDispatcher.instance.execute(cmdLine), "CLICmdThread #"+(i++)).start();
+				Thread.ofVirtual().name("CLICmdThread #"+(i++))
+						.start(() -> CLIBrigadierDispatcher.instance.execute(cmdLine));
 			}
-		} catch (IOException e) {
-			Log.severe(e);
-		}
+		} catch (UserInterruptException | EndOfFileException ignore) { }
 		
 	}
 	

pandalib-cli/src/main/java/fr/pandacube/lib/cli/CLIApplication.java

@@ -32,6 +32,7 @@ public abstract class CLIApplication {
     /**
      * Creates a new application instance.
      */
+    @SuppressWarnings("CallToPrintStackTrace")
     protected CLIApplication() {
         instance = this;
         CLI tmpCLI = null;

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLIBrigadierCommand.java

@@ -38,16 +38,9 @@ public abstract class CLIBrigadierCommand extends BrigadierCommand<CLICommandSen
 	}
 	
 	protected abstract LiteralArgumentBuilder<CLICommandSender> buildCommand();
-	
-	protected String[] getAliases() {
-		return new String[0];
-	}
 
 
-
-
-
-	public boolean isPlayer(CLICommandSender sender) {
+    public boolean isPlayer(CLICommandSender sender) {
 		return sender.isPlayer();
 	}
 

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLIBrigadierDispatcher.java

@@ -3,8 +3,11 @@ package fr.pandacube.lib.cli.commands;
 import com.mojang.brigadier.suggestion.Suggestion;
 import com.mojang.brigadier.suggestion.Suggestions;
 import fr.pandacube.lib.commands.BrigadierDispatcher;
-import jline.console.completer.Completer;
 import net.kyori.adventure.text.ComponentLike;
+import org.jline.reader.Candidate;
+import org.jline.reader.Completer;
+import org.jline.reader.LineReader;
+import org.jline.reader.ParsedLine;
 
 import java.util.List;
 
@@ -39,17 +42,15 @@ public class CLIBrigadierDispatcher extends BrigadierDispatcher<CLICommandSender
 	
 	
 	@Override
-	public int complete(String buffer, int cursor, List<CharSequence> candidates) {
-		
-		String bufferBeforeCursor = buffer.substring(0, cursor);
-		
+	public void complete(LineReader lineReader, ParsedLine parsedLine, List<Candidate> candidates) {
+		String bufferBeforeCursor = parsedLine.line().substring(0, parsedLine.cursor());
+
 		Suggestions completeResult = getSuggestions(bufferBeforeCursor);
-		
+
 		completeResult.getList().stream()
 				.map(Suggestion::getText)
+				.map(Candidate::new)
 				.forEach(candidates::add);
-		
-		return completeResult.getRange().getStart();
 	}
 
 	/**

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLICommandSender.java

@@ -41,6 +41,9 @@ public interface CLICommandSender extends Audience {
      */
     void sendMessage(String message);
 
+    @SuppressWarnings({"UnstableApiUsage", "deprecation"})
     @Override // force implementation of super-interface default method
     void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type);
+
+
 }

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CLIConsoleCommandSender.java

@@ -38,7 +38,7 @@ public class CLIConsoleCommandSender implements CLICommandSender {
     }
 
     @Override
-    public void sendMessage(@NotNull Identity source, @NotNull Component message, @NotNull MessageType type) {
+    public void sendMessage(@NotNull Identity source, @NotNull Component message, @SuppressWarnings({"UnstableApiUsage", "deprecation"}) @NotNull MessageType type) {
         sendMessage(Chat.chatComponent(message).getLegacyText());
     }
 }

pandalib-cli/src/main/java/fr/pandacube/lib/cli/commands/CommandAdmin.java

@@ -14,7 +14,7 @@ import com.mojang.brigadier.tree.CommandNode;
 import com.mojang.brigadier.tree.LiteralCommandNode;
 import com.mojang.brigadier.tree.RootCommandNode;
 import fr.pandacube.lib.chat.Chat;
-import fr.pandacube.lib.chat.Chat.FormatableChat;
+import fr.pandacube.lib.chat.Chat.FormattableChat;
 import fr.pandacube.lib.chat.ChatTreeNode;
 import fr.pandacube.lib.cli.CLIApplication;
 import fr.pandacube.lib.util.log.Log;
@@ -195,13 +195,13 @@ public class CommandAdmin extends CLIBrigadierCommand {
 	private Component displayCurrentNode(CommandNode<CLICommandSender> node, boolean redirectTarget, CLICommandSender sender) {
 		if (node == null)
 			throw new IllegalArgumentException("node must not be null");
-		FormatableChat d;
+		FormattableChat d;
 		if (node instanceof RootCommandNode) {
 			d = text("(root)").italic()
 				.hover("Root command node");
 		}
-		else if (node instanceof ArgumentCommandNode) {
-			ArgumentType<?> type = ((ArgumentCommandNode<?, ?>) node).getType();
+		else if (node instanceof ArgumentCommandNode<?, ?> argNode) {
+			ArgumentType<?> type = argNode.getType();
 			String typeStr = type.getClass().getSimpleName();
 			if (type instanceof IntegerArgumentType
 					|| type instanceof LongArgumentType
@@ -260,10 +260,10 @@ public class CommandAdmin extends CLIBrigadierCommand {
 		return d.get();
 		
 	}
-	
-	
-	
-	
+
+
+
+
 	private static class DisplayCommandNode {
 		final List<CommandNode<CLICommandSender>> nodes = new ArrayList<>();
 		final List<DisplayCommandNode> children = new ArrayList<>();

pandalib-commands/pom.xml

@@ -45,7 +45,7 @@
         <dependency>
             <groupId>com.mojang</groupId>
             <artifactId>brigadier</artifactId>
-            <version>1.0.18</version>
+            <version>${brigadier.version}</version>
         </dependency>
 
     </dependencies>

pandalib-commands/src/main/java/fr/pandacube/lib/commands/BadCommandUsage.java

@@ -3,35 +3,39 @@ package fr.pandacube.lib.commands;
 import java.util.logging.Logger;
 
 /**
- * Throw an instance of this exception to indicate to the plugin command handler that the user has missused the command.
- * The message, if provided, must indicate the reason of the mussusage of the command. It will be displayed on the
+ * Throw an instance of this exception to indicate to the plugin command handler that the user has badly used the command.
+ * The message, if provided, must indicate the reason of the bad usage of the command. It will be displayed on the
  * screen with eventual indications of how to use the command (help command for example).
  * If a {@link Throwable} cause is provided, it will be relayed to the plugin {@link Logger}.
  * 
  */
 public class BadCommandUsage extends RuntimeException {
 
-	/** Constructs a new runtime exception with no message or cause.
+	/**
+	 * Constructs a new runtime exception with no message or cause.
 	 */
 	public BadCommandUsage() {
 		super();
 	}
 
-	/** Constructs a new runtime exception with the specified cause.
+	/**
+	 * Constructs a new runtime exception with the specified cause.
 	 * @param cause the cause.
 	 */
 	public BadCommandUsage(Throwable cause) {
 		super(cause);
 	}
 
-	/** Constructs a new runtime exception with the specified message.
+	/**
+	 * Constructs a new runtime exception with the specified message.
 	 * @param message the message.
 	 */
 	public BadCommandUsage(String message) {
 		super(message);
 	}
 
-	/** Constructs a new runtime exception with the specified message and cause.
+	/**
+	 * Constructs a new runtime exception with the specified message and cause.
 	 * @param message the message.
 	 * @param cause the cause.
 	 */

pandalib-commands/src/main/java/fr/pandacube/lib/commands/BrigadierCommand.java

@@ -223,14 +223,14 @@ public abstract class BrigadierCommand<S> {
     /**
      * Wraps the provided {@link SuggestionsSupplier} into a Brigadier’s {@link SuggestionProvider}.
      * @param suggestions the suggestions to wrap.
-     * @param senderUnwrapper function to convert the command sender provided by brigadier into the command sender
+     * @param senderUnWrapper function to convert the command sender provided by brigadier into the command sender
      *                        supported by {@link SuggestionsSupplier}.
      * @return a {@link SuggestionProvider} generating the suggestions from the provided {@link SuggestionsSupplier}.
      * @param <AS> the type of command sender supported by the {@link SuggestionsSupplier}.
      */
-    protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnwrapper) {
+    protected <AS> SuggestionProvider<S> wrapSuggestions(SuggestionsSupplier<AS> suggestions, Function<S, AS> senderUnWrapper) {
         return (context, builder) -> {
-            AS sender = senderUnwrapper.apply(context.getSource());
+            AS sender = senderUnWrapper.apply(context.getSource());
             String message = builder.getInput();
             try {
                 int tokenStartPos = builder.getStart();

pandalib-commands/src/main/java/fr/pandacube/lib/commands/SuggestionsSupplier.java

@@ -241,7 +241,7 @@ public interface SuggestionsSupplier<S> {
 			return (s, ti, token, a) -> {
 				try {
 					List<Long> proposedValues = new ArrayList<>();
-					if (token.length() == 0) {
+					if (token.isEmpty()) {
 						long start = Math.max(Math.max(Math.min(-4, max - 9), min), -9);
 						long end = Math.min(Math.min(start + 9, max), 9);
 						ListUtil.addLongRangeToList(proposedValues, start, end);
@@ -399,7 +399,7 @@ public interface SuggestionsSupplier<S> {
 	 */
 	default SuggestionsSupplier<S> quotableString() {
 		return (s, ti, token, a) -> {
-			boolean startWithQuote = token.length() > 0 && (token.charAt(0) == '"' || token.charAt(0) == '\'');
+			boolean startWithQuote = !token.isEmpty() && (token.charAt(0) == '"' || token.charAt(0) == '\'');
 			String realToken = startWithQuote ? unescapeBrigadierQuotable(token.substring(1), token.charAt(0)) : token;
 			String[] argsCopy = Arrays.copyOf(a, a.length);
 			argsCopy[a.length - 1] = realToken;

pandalib-config/pom.xml

@@ -0,0 +1,33 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project xmlns="http://maven.apache.org/POM/4.0.0"
+         xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+         xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
+    <parent>
+        <artifactId>pandalib-parent</artifactId>
+        <groupId>fr.pandacube.lib</groupId>
+        <version>1.0-SNAPSHOT</version>
+        <relativePath>../pom.xml</relativePath>
+    </parent>
+    <modelVersion>4.0.0</modelVersion>
+
+    <artifactId>pandalib-config</artifactId>
+    <packaging>jar</packaging>
+
+    <repositories>
+        <repository>
+            <id>bungeecord-repo</id>
+            <url>https://oss.sonatype.org/content/repositories/snapshots</url>
+        </repository>
+    </repositories>
+
+    <dependencies>
+
+        <dependency>
+            <groupId>net.md-5</groupId>
+            <artifactId>bungeecord-config</artifactId>
+            <version>${bungeecord.version}</version>
+        </dependency>
+
+    </dependencies>
+
+</project>

pandalib-config/src/main/java/fr/pandacube/lib/config/AbstractConfig.java

@@ -1,7 +1,4 @@
-package fr.pandacube.lib.core.config;
-
-import fr.pandacube.lib.chat.ChatColorUtil;
-import fr.pandacube.lib.util.log.Log;
+package fr.pandacube.lib.config;
 
 import java.io.BufferedReader;
 import java.io.File;
@@ -56,7 +53,7 @@ public abstract class AbstractConfig {
 		while ((line = reader.readLine()) != null) {
 			String trimmedLine = line.trim();
 			
-			if (ignoreEmpty && trimmedLine.equals(""))
+			if (ignoreEmpty && trimmedLine.isEmpty())
 				continue;
 			
 			if (ignoreHashtagComment && trimmedLine.startsWith("#"))
@@ -114,25 +111,6 @@ public abstract class AbstractConfig {
 	}
 
 
-	/**
-	 * Utility method to that translate the {@code '&'} formatted string to the legacy format.
-	 * @param string the string to convert.
-	 * @return a legacy formatted string (using {@code '§'}).
-	 */
-	public static String getTranslatedColorCode(String string) {
-		return ChatColorUtil.translateAlternateColorCodes('&', string);
-	}
-
-
-	/**
-	 * Logs the message as a warning into console, prefixed with the context of this config.
-	 * @param message the message to log.
-	 */
-	protected void warning(String message) {
-		Log.warning("Error in configuration '"+configFile.getName()+"': " + message);
-	}
-
-
 	/**
 	 * The type of config.
 	 */

pandalib-config/src/main/java/fr/pandacube/lib/config/AbstractConfigManager.java

@@ -1,4 +1,4 @@
-package fr.pandacube.lib.core.config;
+package fr.pandacube.lib.config;
 
 import java.io.File;
 import java.io.IOException;

pandalib-core/src/main/java/fr/pandacube/lib/core/backup/ZipCompressor.java

@@ -5,6 +5,7 @@ import java.io.File;
 import java.io.FileOutputStream;
 import java.io.IOException;
 import java.nio.file.Files;
+import java.nio.file.NoSuchFileException;
 import java.nio.file.attribute.BasicFileAttributes;
 import java.util.ArrayList;
 import java.util.List;
@@ -117,7 +118,11 @@ public class ZipCompressor {
 			}
 			
 			for (Entry entry : entriesToCompress) {
-				entry.zip();
+				try {
+					entry.zip();
+				} catch (NoSuchFileException ignored) {
+					// file has been deleted since
+				}
 			}
 			
 			synchronized (stateLock) {

pandalib-core/src/main/java/fr/pandacube/lib/core/json/Json.java

@@ -3,6 +3,7 @@ package fr.pandacube.lib.core.json;
 import com.google.gson.Gson;
 import com.google.gson.GsonBuilder;
 import com.google.gson.JsonParseException;
+import com.google.gson.Strictness;
 import com.google.gson.ToNumberStrategy;
 import com.google.gson.TypeAdapter;
 import com.google.gson.TypeAdapterFactory;
@@ -32,7 +33,7 @@ public class Json {
 		boolean isFloat = value.contains(".");
 
 		if (isFloat) {
-			// if float, will only parse to Double
+			// if is float, will only parse to Double
 			//   (see org.yaml.snakeyaml.constructor.SafeConstructor.ConstructYamlFloat)
 			try {
 				Double d = Double.valueOf(value);
@@ -74,21 +75,21 @@ public class Json {
 	public static final Gson gson = build(Function.identity());
 
 	/**
-	 * {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#setPrettyPrinting()} and support
+	 * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#setPrettyPrinting()} and support
 	 * for Java records and additional {@link TypeAdapterFactory} provided with
 	 * {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
 	 */
 	public static final Gson gsonPrettyPrinting = build(GsonBuilder::setPrettyPrinting);
 
 	/**
-	 * {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()} and support for
+	 * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()} and support for
 	 * Java records and additional {@link TypeAdapterFactory} provided with
 	 * {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
 	 */
 	public static final Gson gsonSerializeNulls = build(GsonBuilder::serializeNulls);
 
 	/**
-	 * {@link Gson} instance with {@link GsonBuilder#setLenient()}, {@link GsonBuilder#serializeNulls()},
+	 * {@link Gson} instance with {@link Strictness#LENIENT}, {@link GsonBuilder#serializeNulls()},
 	 * {@link GsonBuilder#setPrettyPrinting()} and support for Java records and additional {@link TypeAdapterFactory}
 	 * provided with {@link #registerTypeAdapterFactory(TypeAdapterFactory)}.
 	 */
@@ -105,7 +106,7 @@ public class Json {
 				.registerTypeAdapterFactory(new CustomAdapterFactory())
 				.disableHtmlEscaping()
 				.setObjectToNumberStrategy(YAML_EQUIVALENT_NUMBER_STRATEGY)
-				.setLenient();
+				.setStrictness(Strictness.LENIENT);
 		return builderModifier.apply(base).create();
 	}
 

pandalib-core/src/main/java/fr/pandacube/lib/core/json/ThrowableAdapter.java

@@ -134,30 +134,30 @@ public class ThrowableAdapter implements JsonSerializer<Throwable>, JsonDeserial
     }
 
     private static <T extends Throwable> ThrowableSubAdapter<T> defaultSubAdapter(Class<T> clazz) {
-        BiFunction<String, Throwable, T> constructor = null;
+        BiFunction<String, Throwable, T> constructionFunction = null;
 
         // try (String, Throwable) constructor
         try {
-            Constructor<T> constr = clazz.getConstructor(String.class, Throwable.class);
-            if (constr.canAccess(null)) {
-                constructor = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m, t));
+            Constructor<T> constructor = clazz.getConstructor(String.class, Throwable.class);
+            if (constructor.canAccess(null)) {
+                constructionFunction = (m, t) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m, t));
             }
         } catch (ReflectiveOperationException ignore) { }
 
         // try (String) constructor
         try {
-            Constructor<T> constr = clazz.getConstructor(String.class);
-            if (constr.canAccess(null)) {
-                constructor = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constr.newInstance(m)));
+            Constructor<T> constructor = clazz.getConstructor(String.class);
+            if (constructor.canAccess(null)) {
+                constructionFunction = ThrowableSubAdapter.messageOnly((m) -> ThrowableUtil.wrapReflectEx(() -> constructor.newInstance(m)));
             }
         } catch (ReflectiveOperationException ignore) { }
 
-        if (constructor == null) {
+        if (constructionFunction == null) {
             Log.warning("Provided Throwable class '" + clazz + "' does not have any of those constructors or are not accessible: (String, Throwable), (String).");
             return null;
         }
 
-        return new ThrowableSubAdapter<>(constructor);
+        return new ThrowableSubAdapter<>(constructionFunction);
     }
 
 

pandalib-core/src/main/java/fr/pandacube/lib/core/mc_version/MinecraftVersionUtil.java

@@ -37,8 +37,8 @@ public class MinecraftVersionUtil {
 
     /**
      * Decompose a version string into a series of integers.
-     * @param v a string representation of a version (eg. 1.19.1).
-     * @return an array of int representing the provided version (eg. [1, 19, 1]).
+     * @param v a string representation of a version (e.g. 1.19.1).
+     * @return an array of int representing the provided version (e.g. [1, 19, 1]).
      */
     public static int[] decomposedVersion(String v) {
         try {
@@ -114,7 +114,7 @@ public class MinecraftVersionUtil {
                 else {
                     // merge
                     if (i - firstConsecutive > 1)
-                        keptVersions.add(versions.get(firstConsecutive) + "-" + versions.get(i));
+                        keptVersions.add(versions.get(firstConsecutive) + " - " + versions.get(i));
                     else {
                         keptVersions.add(versions.get(firstConsecutive));
                         keptVersions.add(versions.get(i));

pandalib-core/src/main/java/fr/pandacube/lib/core/mc_version/ProtocolVersion.java

@@ -68,12 +68,12 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
 
     private static void init() {
         // try online source first
-        try {
-            HttpResponse<String> response = HttpClient.newBuilder()
-                    .connectTimeout(Duration.ofSeconds(5))
-                    .build()
-                    .send(HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
-                            BodyHandlers.ofString()
+        try (HttpClient cl = HttpClient.newBuilder()
+                .connectTimeout(Duration.ofSeconds(5))
+                .build()) {
+            HttpResponse<String> response = cl.send(
+                    HttpRequest.newBuilder(URI.create(ONLINE_DATA_URL)).build(),
+                    BodyHandlers.ofString()
                     );
             if (response.statusCode() == 200) {
                 MinecraftVersionList data = Json.gson.fromJson(response.body(), MinecraftVersionList.class);
@@ -123,7 +123,7 @@ public class ProtocolVersion implements Comparable<ProtocolVersion> {
 
     /**
      * Gets the {@link ProtocolVersion} associated with the provided Minecraft version.
-     * @param version The Minecraft version, in the format "X.X[.X]" (eg. "1.17" or "1.8.8").
+     * @param version The Minecraft version, in the format "X.X[.X]" (e.g. "1.17" or "1.8.8").
      * @return an instance of {@link ProtocolVersion}.
      */
     public static ProtocolVersion ofVersion(String version) {

pandalib-core/src/main/resources/fr/pandacube/lib/core/mc_version/mcversion.json

@@ -70,7 +70,12 @@
     "1.21": 767,
     "1.21.1": 767,
     "1.21.2": 768,
-    "1.21.3": 768
+    "1.21.3": 768,
+    "1.21.4": 769,
+    "1.21.5": 770,
+    "1.21.6": 771,
+    "1.21.7": 772,
+    "1.21.8": 772
   },
   "versionsOfProtocol": {
     "4": [
@@ -229,6 +234,19 @@
     "768": [
       "1.21.2",
       "1.21.3"
+    ],
+    "769": [
+      "1.21.4"
+    ],
+    "770": [
+      "1.21.5"
+    ],
+    "771": [
+      "1.21.6"
+    ],
+    "772": [
+      "1.21.7",
+      "1.21.8"
     ]
   }
 }

pandalib-db/src/main/java/fr/pandacube/lib/db/DB.java

@@ -227,7 +227,7 @@ public final class DB {
      */
     public static <E extends SQLElement<E>> E getFirst(Class<E> elemClass, SQLWhere<E> where, SQLOrderBy<E> orderBy, Integer offset) throws DBException {
         SQLElementList<E> elements = getAll(elemClass, where, orderBy, 1, offset);
-        return (elements.size() == 0) ? null : elements.get(0);
+        return (elements.isEmpty()) ? null : elements.get(0);
     }
 
     /**

pandalib-db/src/main/java/fr/pandacube/lib/db/SQLType.java

@@ -42,7 +42,7 @@ public class SQLType<T> {
 
     @Override
     public boolean equals(Object obj) {
-        return obj instanceof SQLType o
+        return obj instanceof SQLType<?> o
                 && toString().equals(o.toString());
     }
 

pandalib-paper-permissions/pom.xml

@@ -16,7 +16,7 @@
     <repositories>
         <repository>
             <id>papermc</id>
-            <url>https://papermc.io/repo/repository/maven-public/</url>
+            <url>https://repo.papermc.io/repository/maven-public/</url>
         </repository>
 
         <!-- WorldEdit -->

pandalib-paper-permissions/src/main/java/fr/pandacube/lib/paper/permissions/PermissionsInjectorVault.java

@@ -7,6 +7,7 @@ import net.milkbowl.vault.chat.Chat;
 import net.milkbowl.vault.permission.Permission;
 import org.bukkit.Bukkit;
 import org.bukkit.OfflinePlayer;
+import org.bukkit.entity.Player;
 import org.bukkit.plugin.ServicePriority;
 
 import java.util.List;
@@ -120,6 +121,13 @@ import java.util.List;
 			return true;
 		}
 
+		@Override
+		public boolean playerAdd(Player player, String permission) {
+			// override because the super class sets the permission on the current world of the player, that is probably
+			// not intended by the calling plugin
+			return playerAdd(null, player, permission);
+		}
+
 		@Deprecated
 		@Override
 		public boolean playerRemove(String world, String player, String permission) {
@@ -136,6 +144,14 @@ import java.util.List;
 			return true;
 		}
 
+		@Override
+		public boolean playerRemove(Player player, String permission) {
+			// to stay coherent with the override of #playerAdd(Player, String), we also override this method.
+			// Will try first to remove the permission on the world itself (like super-method), then if it doesn't exist,
+			// removes on the server level.
+			return super.playerRemove(player, permission) || playerRemove(null, player, permission);
+		}
+
 		@Override
 		public boolean groupHas(String world, String group, String permission) {
 			checkEnabled();

pandalib-paper/pom.xml

@@ -16,12 +16,17 @@
     <repositories>
         <repository>
             <id>papermc</id>
-            <url>https://papermc.io/repo/repository/maven-public/</url>
+            <url>https://repo.papermc.io/repository/maven-public/</url>
         </repository>
         <repository>
             <id>fabricmc</id>
             <url>https://maven.fabricmc.net/</url>
         </repository>
+        <repository>
+            <id>minecraft-libraries</id>
+            <name>Minecraft Libraries</name>
+            <url>https://libraries.minecraft.net</url>
+        </repository>
     </repositories>
 
     <dependencies>
@@ -84,17 +89,18 @@
             <scope>provided</scope>
         </dependency>
 
+        <dependency>
+            <groupId>com.mojang</groupId>
+            <artifactId>datafixerupper</artifactId>
+            <version>${datafixerupper.version}</version>
+        </dependency>
+
         <!-- Paper -->
         <dependency>
             <groupId>io.papermc.paper</groupId>
             <artifactId>paper-api</artifactId>
             <version>${paper.version}-SNAPSHOT</version>
         </dependency>
-        <dependency>
-            <groupId>io.papermc.paper</groupId>
-            <artifactId>paper-mojangapi</artifactId>
-            <version>${paper.version}-SNAPSHOT</version>
-        </dependency>
     </dependencies>
 
     <build>

pandalib-paper/src/main/java/fr/pandacube/lib/paper/PandaLibPaper.java

@@ -5,27 +5,47 @@ import fr.pandacube.lib.paper.json.PaperJson;
 import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager;
 import org.bukkit.plugin.Plugin;
 
+/**
+ * Main class for pandalib-paper.
+ */
 public class PandaLibPaper {
 	
 	private static Plugin plugin;
-	
+
+	/**
+	 * Method to call in plugin's {@link Plugin#onLoad()} method.
+	 * @param plugin the plugin instance.
+	 */
 	public static void onLoad(Plugin plugin) {
 		PandaLibPaper.plugin = plugin;
 		PaperJson.init();
 	}
 
+	/**
+	 * Method to call in plugin's {@link Plugin#onEnable()} method.
+	 */
 	public static void onEnable() {
 		PerformanceAnalysisManager.getInstance(); // initialize
 		ServerStopEvent.init();
 	}
 
 
+
+	/**
+	 * Method to call in plugin's {@link Plugin#onDisable()} method.
+	 */
 	public static void disable() {
-		PerformanceAnalysisManager.getInstance().cancelInternalBossBar();
+		PerformanceAnalysisManager.getInstance().deinit();
 	}
-	
+
+	/**
+	 * Gets the plugin instance.
+	 * @return the plugin instance provided with {@link #onLoad(Plugin)}.
+	 */
 	public static Plugin getPlugin() {
 		return plugin;
 	}
 
+	private PandaLibPaper() {}
+
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/backup/PaperBackupConfig.java

@@ -6,14 +6,65 @@ import java.io.File;
 import java.util.ArrayList;
 import java.util.List;
 
+/**
+ * A basic class holding configuration for {@link PaperBackupManager}.
+ */
 @SuppressWarnings("CanBeFinal")
 public class PaperBackupConfig {
+
+    /**
+     * Creates a new Paper backup config.
+     */
+    public PaperBackupConfig() {}
+
+    /**
+     * Set to true to enable worlds backup.
+     * Defaults to true.
+     */
     public boolean worldBackupEnabled = true;
+
+    /**
+     * Set to true to enable the backup of the working directory.
+     * The workdir backup will already ignore the logs directory and any world folder (folder with a level.dat file in it).
+     * Defaults to true.
+     */
     public boolean workdirBackupEnabled = true;
+
+    /**
+     * Set to true to enable the backup of logs.
+     * Defaults to true.
+     */
     public boolean logsBackupEnabled = true;
+
+    /**
+     * The cron-formatted scheduling of the worlds and workdir backups.
+     * The default value is {@code "0 2 * * *"}, that is every day at 2am.
+     */
     public String scheduling = "0 2 * * *"; // cron format, here is every day at 2am
+
+    /**
+     * The backup target directory.
+     * Must be set (defaults to null).
+     */
     public File backupDirectory = null;
+
+    /**
+     * The backup cleaner for the worlds backup.
+     * Defaults to keep 1 backup every 3 month + the last 5 backups.
+     */
     public BackupCleaner worldBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
+
+    /**
+     * The backup cleaner for the workdir backup.
+     * Defaults to keep 1 backup every 3 month + the last 5 backups.
+     */
     public BackupCleaner workdirBackupCleaner = BackupCleaner.KEEPING_1_EVERY_N_MONTH(3).merge(BackupCleaner.KEEPING_N_LAST(5));
+
+    /**
+     * The list of files or directory to ignore.
+     * Defaults to none.
+     * The workdir backup will already ignore the logs directory and any world folder (folder with a level.dat file in it).
+     */
     public List<String> workdirIgnoreList = new ArrayList<>();
+
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/backup/PaperBackupManager.java

@@ -23,12 +23,19 @@ import java.util.Map;
 import java.util.Set;
 import java.util.concurrent.CancellationException;
 
+/**
+ * The backup manager for Paper servers.
+ */
 public class PaperBackupManager extends BackupManager implements Listener {
 
 	private final Map<String, PaperWorldProcess> compressWorlds = new HashMap<>();
 
 	PaperBackupConfig config;
-	
+
+	/**
+	 * Instantiate a new backup manager.
+	 * @param config the configuration of the backups.
+	 */
 	public PaperBackupManager(PaperBackupConfig config) {
 		super(config.backupDirectory);
 		setConfig(config);
@@ -49,13 +56,17 @@ public class PaperBackupManager extends BackupManager implements Listener {
 		super.addProcess(process);
 	}
 
+	/**
+	 * Updates the backups config
+	 * @param config the new config.
+	 */
 	public void setConfig(PaperBackupConfig config) {
 		this.config = config;
 		backupQueue.forEach(this::updateProcessConfig);
 	}
 
 
-	public void updateProcessConfig(BackupProcess process) {
+	private void updateProcessConfig(BackupProcess process) {
 		if (process instanceof PaperWorkdirProcess) {
 			process.setEnabled(config.workdirBackupEnabled);
 			process.setBackupCleaner(config.workdirBackupCleaner);
@@ -119,12 +130,12 @@ public class PaperBackupManager extends BackupManager implements Listener {
 	private final Set<String> dirtyForSave = new HashSet<>();
 
 	@EventHandler(priority = EventPriority.MONITOR)
-	public void onWorldLoad(WorldLoadEvent event) {
+	void onWorldLoad(WorldLoadEvent event) {
 		initWorldProcess(event.getWorld().getName());
 	}
 
 	@EventHandler(priority = EventPriority.MONITOR)
-	public void onWorldSave(WorldSaveEvent event) {
+	void onWorldSave(WorldSaveEvent event) {
 		if (event.getWorld().getLoadedChunks().length > 0
 				|| dirtyForSave.contains(event.getWorld().getName())) {
 			compressWorlds.get(event.getWorld().getName()).setDirtyAfterSave();
@@ -137,18 +148,18 @@ public class PaperBackupManager extends BackupManager implements Listener {
 
 
 	@EventHandler(priority = EventPriority.MONITOR)
-	public void onPlayerChangeWorldEvent(PlayerChangedWorldEvent event) {
+	void onPlayerChangeWorldEvent(PlayerChangedWorldEvent event) {
 		dirtyForSave.add(event.getFrom().getName());
 		dirtyForSave.add(event.getPlayer().getWorld().getName());
 	}
 
 	@EventHandler(priority = EventPriority.MONITOR)
-	public void onPlayerJoin(PlayerJoinEvent event) {
+	void onPlayerJoin(PlayerJoinEvent event) {
 		dirtyForSave.add(event.getPlayer().getWorld().getName());
 	}
 
 	@EventHandler(priority = EventPriority.MONITOR)
-	public void onPlayerQuit(PlayerQuitEvent event) {
+	void onPlayerQuit(PlayerQuitEvent event) {
 		dirtyForSave.add(event.getPlayer().getWorld().getName());
 	}
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/backup/PaperBackupProcess.java

@@ -10,11 +10,19 @@ import net.kyori.adventure.bossbar.BossBar.Color;
 import net.kyori.adventure.bossbar.BossBar.Overlay;
 import org.bukkit.Bukkit;
 
+/**
+ * A backup process with specific logic around Paper server.
+ */
 public abstract class PaperBackupProcess extends BackupProcess {
 
 
 	private BossBar bossBar;
-	
+
+	/**
+	 * Instantiates a new backup process.
+	 * @param bm the associated backup manager.
+	 * @param id the process identifier.
+	 */
 	protected PaperBackupProcess(PaperBackupManager bm, String id) {
 		super(bm, id);
 	}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/backup/PaperWorkdirProcess.java

@@ -3,8 +3,15 @@ package fr.pandacube.lib.paper.backup;
 import java.io.File;
 import java.util.function.BiPredicate;
 
+/**
+ * A backup process with specific logic around Paper server working directory.
+ */
 public class PaperWorkdirProcess extends PaperBackupProcess {
-	
+
+	/**
+	 * Instantiates a new backup process for the paper server working directory.
+	 * @param bm the associated backup manager.
+	 */
 	protected PaperWorkdirProcess(PaperBackupManager bm) {
 		super(bm, "workdir");
 	}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/backup/PaperWorldProcess.java

@@ -1,9 +1,9 @@
 package fr.pandacube.lib.paper.backup;
 
+import fr.pandacube.lib.chat.LegacyChatFormat;
 import fr.pandacube.lib.paper.scheduler.SchedulerUtil;
 import fr.pandacube.lib.paper.world.WorldUtil;
 import fr.pandacube.lib.util.log.Log;
-import net.md_5.bungee.api.ChatColor;
 import org.bukkit.Bukkit;
 import org.bukkit.World;
 
@@ -11,14 +11,22 @@ import java.io.File;
 import java.text.DateFormat;
 import java.util.Date;
 
+/**
+ * A backup process with specific logic around Paper server world.
+ */
 public class PaperWorldProcess extends PaperBackupProcess {
 	private final String worldName;
 	
-	private boolean autoSave = true; 
-	
-	protected PaperWorldProcess(PaperBackupManager bm, final String n) {
-		super(bm, "worlds/" + n);
-		worldName = n;
+	private boolean autoSave = true;
+
+	/**
+	 * Instantiates a new backup process for a world.
+	 * @param bm the associated backup manager.
+	 * @param worldName the name of the world.
+	 */
+	protected PaperWorldProcess(PaperBackupManager bm, final String worldName) {
+		super(bm, "worlds/" + worldName);
+		this.worldName = worldName;
 	}
 	
 	private World getWorld() {
@@ -62,11 +70,11 @@ public class PaperWorldProcess extends PaperBackupProcess {
 
 	public void displayNextSchedule() {
 		if (hasNextScheduled()) {
-			Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " is dirty. Next backup on "
+			Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " is dirty. Next backup on "
 					+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG).format(new Date(getNext())));
 		}
 		else {
-			Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " is clean. Next backup not scheduled.");
+			Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " is clean. Next backup not scheduled.");
 		}
 	}
 
@@ -80,7 +88,7 @@ public class PaperWorldProcess extends PaperBackupProcess {
 	public void setDirtyAfterSave() {
 		if (!isDirty()) { // don't set dirty if it is already
 			setDirtySinceNow();
-			Log.info("[Backup] " + ChatColor.GRAY + getDisplayName() + ChatColor.RESET + " was saved and is now dirty. Next backup on "
+			Log.info("[Backup] " + LegacyChatFormat.GRAY + getDisplayName() + LegacyChatFormat.RESET + " was saved and is now dirty. Next backup on "
 					+ DateFormat.getDateTimeInstance(DateFormat.LONG, DateFormat.LONG)
 					.format(new Date(getNext()))
 			);

pandalib-paper/src/main/java/fr/pandacube/lib/paper/commands/PaperBrigadierCommand.java

@@ -18,8 +18,8 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftVector;
 import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Vec3Argument;
+import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
-import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
 import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
 import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
 import fr.pandacube.lib.players.standalone.AbstractPlayerManager;
@@ -46,7 +46,6 @@ import java.util.Set;
 import java.util.function.Predicate;
 import java.util.stream.Stream;
 
-import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.unwrap;
 import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
 
 /**
@@ -57,10 +56,21 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
 
     private static CommandDispatcher<CommandSourceStack> vanillaPaperDispatcher = null;
 
+    /**
+     * Gets the Brigadier dispatcher provided by paper API during {@link LifecycleEvents#COMMANDS}.
+     * <p>
+     * This Dispatcher is not the vanilla one. Instead, Paper implementation wraps the vanilla one to handle proper registration
+     * of commands from plugins.
+     * @return the Brigadier dispatcher.
+     */
     public static CommandDispatcher<CommandSourceStack> getVanillaPaperDispatcher() {
         return vanillaPaperDispatcher;
     }
 
+    /**
+     * Gets the root node of the dispatcher from {@link #getVanillaPaperDispatcher()}.
+     * @return the root node, or null if {@link #getVanillaPaperDispatcher()} is also null.
+     */
     public static RootCommandNode<CommandSourceStack> getRootNode() {
         return vanillaPaperDispatcher == null ? null : vanillaPaperDispatcher.getRoot();
     }
@@ -73,13 +83,13 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
             RootCommandNode<CommandSourceStack> wrappedRoot = vanillaPaperDispatcher.getRoot();
             ReflectClass<?> apiMirrorRootNodeClass = Reflect.ofClassOfInstance(wrappedRoot);
             try {
-                RootCommandNode<?> actualRoot = ((CommandDispatcher<?>) apiMirrorRootNodeClass.method("getDispatcher").invoke(wrappedRoot)).getRoot();
+                RootCommandNode<?> unwrappedRoot = ((CommandDispatcher<?>) apiMirrorRootNodeClass.method("getDispatcher").invoke(wrappedRoot)).getRoot();
 
-                Reflect.ofClass(CommandNode.class).field("unwrappedCached").setValue(wrappedRoot, actualRoot);
-                Reflect.ofClass(CommandNode.class).field("wrappedCached").setValue(actualRoot, wrappedRoot);
+                Reflect.ofClass(CommandNode.class).field("unwrappedCached").setValue(wrappedRoot, unwrappedRoot);
+                Reflect.ofClass(CommandNode.class).field("wrappedCached").setValue(unwrappedRoot, wrappedRoot);
 
             } catch (InvocationTargetException|IllegalAccessException|NoSuchMethodException|NoSuchFieldException e) {
-                Log.severe("Unable to trick the Paper/Brigadier unwrapper to properly handle redirecting to root command node.", e);
+                Log.severe("Unable to trick the Paper/Brigadier unwrapper to properly handle commands redirecting to root command node.", e);
             }
         }
     }
@@ -135,6 +145,9 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
      */
     protected final String[] aliases;
 
+    /**
+     * The command description.
+     */
     protected final String description;
 
     private final RegistrationPolicy registrationPolicy;
@@ -183,6 +196,11 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
             }
 
             registeredAliases = new HashSet<>(event.registrar().register(commandNode, description, List.of(aliases)));
+            doPostRegistrationFixes();
+
+            @SuppressWarnings("unchecked")
+            fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> registeredNode = wrap(vanillaPaperDispatcher.getRoot().getChild(commandNode.getName()), fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+
 
             if (registrationPolicy == RegistrationPolicy.ALL) {
                 // enforce registration of aliases
@@ -206,11 +224,12 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
 
                 for (String aliasToForce : forceRegistrationAgain) {
                     CommandNode<CommandSourceStack> actualNode = vanillaPaperDispatcher.getRoot().getChild(aliasToForce);
+                    @SuppressWarnings("unchecked")
+                    fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(actualNode, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
                     if (actualNode != null) {
-                        //Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode) + "?");
-                        if (PluginCommandNode.REFLECT.get().isInstance(actualNode)) {
-                            PluginCommandNode pcn = wrap(actualNode, PluginCommandNode.class);
-                            if (pcn.getPlugin().equals(plugin))
+                        if (wrappedCommandNode.apiCommandMeta() != null) {
+                            APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
+                            if (meta.plugin().equals(plugin))
                                 return;
                         }
                         else if (BukkitCommandNode.REFLECT.get().isInstance(actualNode)) {
@@ -218,12 +237,16 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
                             if (bcn.getBukkitCommand() instanceof PluginCommand pc && pc.getPlugin().equals(plugin))
                                 return;
                         }
+                        Log.warning("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": replacing " + getCommandIdentity(actualNode));
                         vanillaPaperDispatcher.getRoot().getChildren().removeIf(c -> c.getName().equals(aliasToForce));
                     }
-                /*else {
-                    Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
-                }*/
-                    LiteralCommandNode<CommandSourceStack> newPCN = unwrap(new PluginCommandNode(aliasToForce, plugin.getPluginMeta(), commandNode, description));
+                    /*else {
+                        Log.info("Forcing registration of alias /" + aliasToForce + " for command /" + commandNode.getName() + ": no command found for alias. Adding alias.");
+                    }*/
+                    LiteralCommandNode<CommandSourceStack> newPCN = getAliasNode(commandNode, aliasToForce);
+                    @SuppressWarnings("unchecked")
+                    fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedNewPCN = wrap(newPCN, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+                    wrappedNewPCN.apiCommandMeta(registeredNode.apiCommandMeta());
                     vanillaPaperDispatcher.getRoot().addChild(newPCN);
                 }
             });
@@ -233,6 +256,45 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
     }
 
 
+
+
+    private void doPostRegistrationFixes() {
+        postRegistrationFixNode(new HashSet<>(), commandNode);
+    }
+
+    private void postRegistrationFixNode(Set<CommandNode<CommandSourceStack>> fixedNodes, CommandNode<CommandSourceStack> originalNode) {
+        if (originalNode instanceof RootCommandNode)
+            return;
+        if (fixedNodes.contains(originalNode))
+            return;
+        fixedNodes.add(originalNode);
+        if (originalNode.getRedirect() != null) {
+            try {
+                @SuppressWarnings("rawtypes")
+                ReflectClass<CommandNode> cmdNodeClass = Reflect.ofClass(CommandNode.class);
+                @SuppressWarnings("unchecked")
+                CommandNode<CommandSourceStack> unwrappedNode = (CommandNode<CommandSourceStack>) cmdNodeClass.field("unwrappedCached").getValue(originalNode);
+                if (unwrappedNode != null) {
+                    cmdNodeClass.field("modifier").setValue(unwrappedNode, cmdNodeClass.field("modifier").getValue(originalNode));
+                    cmdNodeClass.field("forks").setValue(unwrappedNode, cmdNodeClass.field("forks").getValue(originalNode));
+                }
+            } catch (IllegalAccessException | NoSuchFieldException e) {
+                throw new RuntimeException(e);
+            }
+
+            postRegistrationFixNode(fixedNodes, originalNode.getRedirect());
+        }
+        else {
+            try {
+                for (CommandNode<CommandSourceStack> child : originalNode.getChildren())
+                    postRegistrationFixNode(fixedNodes, child);
+            } catch (UnsupportedOperationException ignored) {
+                // in case getChildren is not possible (vanilla commands are wrapped by Paper API)
+            }
+        }
+    }
+
+
     private static LiteralCommandNode<CommandSourceStack> getAliasNode(CommandNode<CommandSourceStack> commandNode, String alias) {
          return LiteralArgumentBuilder.<CommandSourceStack>literal(alias)
                 .requires(commandNode.getRequirement())
@@ -242,11 +304,8 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
     }
 
     private static String getCommandIdentity(CommandNode<CommandSourceStack> command) {
-        if (PluginCommandNode.REFLECT.get().isInstance(command)) {
-            PluginCommandNode wrappedPCN = wrap(command, PluginCommandNode.class);
-            return "Node /" + command.getName() + " from plugin " + wrappedPCN.getPlugin().getName();
-        }
-        else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
+
+        if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
             BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
             Command bukkitCmd = wrappedBCN.getBukkitCommand();
             if (bukkitCmd instanceof PluginCommand cmd) {
@@ -264,16 +323,22 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
                 return "Node /" + command.getName() + " wrapping " + bukkitCmd.getClass().getName() + " /" + bukkitCmd.getName();
         }
         else {
-            return "Node /" + command.getName() + " (unspecific)";
+            @SuppressWarnings("unchecked")
+            fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+
+            if (wrappedCommandNode.apiCommandMeta() != null) {
+                APICommandMeta meta = wrappedCommandNode.apiCommandMeta();
+                return "Node /" + command.getName() + " from plugin " + meta.plugin().getName();
+            }
+            else {
+                return "Node /" + command.getName() + " (unspecific)";
+            }
         }
     }
 
 
     private static Boolean isPluginCommand(CommandNode<CommandSourceStack> command) {
-        if (PluginCommandNode.REFLECT.get().isInstance(command)) {
-            return true;
-        }
-        else if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
+        if (BukkitCommandNode.REFLECT.get().isInstance(command)) {
             BukkitCommandNode wrappedBCN = wrap(command, BukkitCommandNode.class);
             Command bukkitCmd = wrappedBCN.getBukkitCommand();
             if (bukkitCmd instanceof PluginCommand) {
@@ -291,10 +356,16 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
                 return null;
         }
         else {
-            return false;
+            @SuppressWarnings("unchecked")
+            fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode<CommandSourceStack> wrappedCommandNode = wrap(command, fr.pandacube.lib.paper.reflect.wrapper.brigadier.CommandNode.class);
+            return wrappedCommandNode.apiCommandMeta() != null;
         }
     }
 
+    /**
+     * Gets the aliases that are actually registered in the server.
+     * @return the actually registered aliases.
+     */
     protected Set<String> getRegisteredAliases() {
         return Set.copyOf(registeredAliases);
     }
@@ -341,12 +412,15 @@ public abstract class PaperBrigadierCommand extends BrigadierCommand<CommandSour
 
 
 
+    @Override
     public boolean isConsole(CommandSourceStack wrapper) {
         return isConsole(getCommandSender(wrapper));
     }
+    @Override
     public boolean isPlayer(CommandSourceStack wrapper) {
         return isPlayer(getCommandSender(wrapper));
     }
+    @Override
     public Predicate<CommandSourceStack> hasPermission(String permission) {
         return wrapper -> getCommandSender(wrapper).hasPermission(permission);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/event/ServerStopEvent.java

@@ -10,28 +10,38 @@ import org.bukkit.event.server.PluginDisableEvent;
 import org.bukkit.event.server.ServerEvent;
 import org.jetbrains.annotations.NotNull;
 
+/**
+ * Fired at the beginning of the server stop process.
+ * More specifically, this event is called when the first plugin is disabling ({@link PluginDisableEvent}) while
+ * {@link Bukkit#isStopping()} returns true.
+ * <p>
+ * This event can be useful when a plugin want to execute stuff on server stop as soon as possible in the process,
+ * but not when the plugin itself is disabling (because some part of the Bukkit API is not usable at that moment).
+ */
 public class ServerStopEvent extends ServerEvent {
 
 
     private static final HandlerList handlers = new HandlerList();
 
-    @NotNull
-    @Override
-    public HandlerList getHandlers() {
-        return handlers;
-    }
-
+    /**
+     * Gets the handler list of the event.
+     * @return the handler list of the event.
+     */
     @NotNull
     public static HandlerList getHandlerList() {
         return handlers;
     }
 
-
-
-
     private static boolean hasTriggered = false;
+    private static boolean isInit = false;
 
+    /**
+     * Register the event used to detect the server stop.
+     */
     public static void init() {
+        if (isInit)
+            return;
+
         BukkitEvent.register(new Listener() {
 
             @EventHandler(priority = EventPriority.LOWEST)
@@ -45,7 +55,25 @@ public class ServerStopEvent extends ServerEvent {
             }
 
         });
+
+        isInit = true;
     }
 
 
+
+
+
+    private ServerStopEvent() {}
+
+
+    @NotNull
+    @Override
+    public HandlerList getHandlers() {
+        return handlers;
+    }
+
+
+
+
+
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/geometry/DirectionalVector.java

@@ -63,6 +63,7 @@ public class DirectionalVector {
      * contained in the provided {@link Location}.
      * {@link Location#getYaw()} and {@link Location#getPitch()} values are automatically
      * converted to conform {@link #yaw} and {@link #pitch} specification.
+     * @param l the location.
      */
     public DirectionalVector(Location l) {
         this(
@@ -79,6 +80,7 @@ public class DirectionalVector {
 
 
     /**
+     * Creates a new {@link DirectionalVector} from a simple {@link Vector}.
      * @param v the vector representing the direction. If v.getX() and v.getZ() are 0,
      *          the yaw will be 0. This may have inconsistency if the vector is calculated
      *          from a {@link Location}'s yaw and pitch. In this case, prefer using
@@ -126,7 +128,10 @@ public class DirectionalVector {
 
     }
 
-
+    /**
+     * Gets a Vector using the internal X, Y and Z values, that is a simple directional 3D vector.
+     * @return this vector as a simple 3D {@link Vector}.
+     */
     public Vector toVector() {
         return new Vector(x, y, z);
     }
@@ -135,7 +140,8 @@ public class DirectionalVector {
     /**
      * Set the yaw and the pitch of the provided {@link Location}
      * with the values inside the current {@link DirectionalVector}
-     * after conversion of these values
+     * after conversion of these values.
+     * @param l the location.
      */
     public void putIntoLocation(Location l) {
         /*              std   : -PI/2         : <0 ? +2PI : MC
@@ -148,7 +154,10 @@ public class DirectionalVector {
         l.setPitch((float) Math.toDegrees(-pitch));
     }
 
-
+    /**
+     * Gets the vector pointing to the opposite direction.
+     * @return the opposite vector.
+     */
     public DirectionalVector getOpposite() {
         return new DirectionalVector(
                 -x,
@@ -163,6 +172,7 @@ public class DirectionalVector {
      * If the current direction is the player face direction,
      * this method return the direction of the back of the head.
      * This is an alias of {@link #getOpposite()}
+     * @return the opposite of this vector.
      */
     public DirectionalVector getBackDirection() {
         return getOpposite();
@@ -171,6 +181,7 @@ public class DirectionalVector {
     /**
      * If the current direction is the player face direction,
      * this method return the direction of the bottom of the head.
+     * @return the vector pointing on the bottom, as if this vector was the front orientation of a player head.
      */
     public DirectionalVector getBottomDirection() {
         return new DirectionalVector(
@@ -182,6 +193,7 @@ public class DirectionalVector {
     /**
      * If the current direction is the player face direction,
      * this method return the direction of the top of the head.
+     * @return the vector pointing on the top, as if this vector was the front orientation of a player head.
      */
     public DirectionalVector getTopDirection() {
         return new DirectionalVector(
@@ -194,6 +206,7 @@ public class DirectionalVector {
     /**
      * If the current direction is the player face direction,
      * this method return the direction of the left of the head.
+     * @return the vector pointing on the left, as if this vector was the front orientation of a player head.
      */
     public DirectionalVector getLeftDirection() {
         return new DirectionalVector(
@@ -206,6 +219,7 @@ public class DirectionalVector {
     /**
      * If the current direction is the player face direction,
      * this method return the direction of the right of the head.
+     * @return the vector pointing on the right, as if this vector was the front orientation of a player head.
      */
     public DirectionalVector getRightDirection() {
         return new DirectionalVector(

pandalib-paper/src/main/java/fr/pandacube/lib/paper/geometry/GeometryUtil.java

@@ -2,24 +2,29 @@ package fr.pandacube.lib.paper.geometry;
 
 import org.bukkit.Location;
 import org.bukkit.entity.Player;
+import org.bukkit.util.BoundingBox;
+import org.bukkit.util.RayTraceResult;
 import org.bukkit.util.Vector;
 
+/**
+ * Utility class related to geometry and Minecraft.
+ */
 public class GeometryUtil {
-	
+
 	/**
 	 * Value equal to <code>{@link Math#PI}</code>.
 	 */
-	public static final double PI   = Math.PI;
-	
+	static final double PI   = Math.PI;
+
 	/**
 	 * Value equal to <code>{@link Math#PI} / 2</code>.
 	 */
-	public static final double PId2 = PI/2;
-	
+	static final double PId2 = PI/2;
+
 	/**
 	 * Value equal to <code>{@link Math#PI} * 2</code>.
 	 */
-	public static final double PIx2 = PI*2;
+	static final double PIx2 = PI*2;
 	
 	
 	
@@ -55,9 +60,21 @@ public class GeometryUtil {
 	 * Value provided by net.minecraft.world.entity.player.Player#getStandingEyeHeight
 	 */
 	public static final double PLAYER_EYE_HEIGHT_SNEAK = 1.27;
+	/**
+	 * The size of a skin pixel.
+	 */
 	public static final double PLAYER_SKIN_PIXEL_SIZE = PLAYER_SKIN_HEIGHT / 32;
+	/**
+	 * The height of the center of rotation of the head, that is the distance between neck and the player's foot.
+	 */
 	public static final double PLAYER_HEAD_ROTATION_HEIGHT = PLAYER_SKIN_PIXEL_SIZE * 24;
+	/**
+	 * The height of the center of rotation of the head, that is the distance between neck and the player's foot, but when the player is sneaking.
+	 */
 	public static final double PLAYER_HEAD_ROTATION_HEIGHT_SNEAK = PLAYER_HEAD_ROTATION_HEIGHT - (PLAYER_SKIN_HEIGHT - PLAYER_SKIN_HEIGHT_SNEAK);
+	/**
+	 * The size of the first layer of the players head.
+	 */
 	public static final double PLAYER_HEAD_SIZE = PLAYER_SKIN_PIXEL_SIZE * 8;
 	
 	
@@ -67,7 +84,6 @@ public class GeometryUtil {
 	
 	
 	
-	
 
 	
 	
@@ -76,7 +92,7 @@ public class GeometryUtil {
 	/**
 	 * Get the {@link Location}s of the 8 vertex of the player head<br/>
 	 * This method only work if the player is standing up
-	 * (not dead, not gliding, not sleeping).
+	 * (not dead, not gliding, not sleeping, not swimming).
 	 * @param playerLocation the location of the player, generally provided by {@link Player#getLocation()}
 	 * @param isSneaking if the player is sneaking. Generally {@link Player#isSneaking()}
 	 * @return an array of 8 {@link Location}s with x, y, and z values filled (yaw and pitch are ignored).
@@ -129,27 +145,22 @@ public class GeometryUtil {
 	/**
 	 * Check if the path from <i>start</i> location to <i>end</i> pass through
 	 * the axis aligned bounding box defined by <i>min</i> and <i>max</i>.
+	 * @param start the start of the path.
+	 * @param end the end of the path.
+	 * @param min the min of the bounding box.
+	 * @param max the max of the bounding box.
+	 * @return true if the path intersects the bounding box.
+	 * @deprecated use {@link BoundingBox#rayTrace(Vector, Vector, double)} instead.
 	 */
+	@Deprecated
     public static boolean hasIntersection(Vector start, Vector end, Vector min, Vector max) {
-        final double epsilon = 0.0001f;
- 
-        Vector d = end.clone().subtract(start).multiply(0.5);
-        Vector e = max.clone().subtract(min).multiply(0.5);
-        Vector c = start.clone().add(d).subtract(min.clone().add(max).multiply(0.5));
-        Vector ad = d.clone();
-        ad.setX(Math.abs(ad.getX()));
-        ad.setY(Math.abs(ad.getY()));
-        ad.setZ(Math.abs(ad.getZ()));
-
-        return !(
-				Math.abs(c.getX()) > e.getX() + ad.getX()
-				|| Math.abs(c.getY()) > e.getY() + ad.getY()
-				|| Math.abs(c.getZ()) > e.getX() + ad.getZ()
-				|| Math.abs(d.getY() * c.getZ() - d.getZ() * c.getY()) > e.getY() * ad.getZ() + e.getZ() * ad.getY() + epsilon
-				|| Math.abs(d.getZ() * c.getX() - d.getX() * c.getZ()) > e.getZ() * ad.getX() + e.getX() * ad.getZ() + epsilon
-				|| Math.abs(d.getX() * c.getY() - d.getY() * c.getX()) > e.getX() * ad.getY() + e.getY() * ad.getX() + epsilon
-		);
+        RayTraceResult res = BoundingBox.of(min, max).rayTrace(start, end.clone().subtract(start), end.distance(start));
+		return res != null;
     }
 
 
+
+	private GeometryUtil() {}
+
+
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/geometry/blocks/AABBBlock.java

@@ -2,11 +2,10 @@ package fr.pandacube.lib.paper.geometry.blocks;
 
 import fr.pandacube.lib.util.RandomUtil;
 import org.bukkit.Location;
-import org.bukkit.World;
-import org.bukkit.block.Block;
 import org.bukkit.util.BlockVector;
 import org.bukkit.util.BoundingBox;
 import org.bukkit.util.Vector;
+import org.jetbrains.annotations.NotNull;
 
 import java.util.Iterator;
 
@@ -30,10 +29,19 @@ public class AABBBlock implements BlockSet, Cloneable {
 		volume = original.volume;
 	}
 
+	/**
+	 * Construct a {@link AABBBlock} based on the two provided Bukkit's {@link Vector}.
+	 * @param p1 the first vector.
+	 * @param p2 the second vector.
+	 */
 	public AABBBlock(Vector p1, Vector p2) {
 		this(p1.getBlockX(), p1.getBlockY(), p1.getBlockZ(), p2.getBlockX(), p2.getBlockY(), p2.getBlockZ());
 	}
 
+	/**
+	 * Construct a {@link AABBBlock} based on the provided Bukkit's {@link BoundingBox}.
+	 * @param bb the bounding box.
+	 */
 	public AABBBlock(BoundingBox bb) {
 		pos1 = bb.getMin();
 		pos2 = bb.getMax();
@@ -41,15 +49,35 @@ public class AABBBlock implements BlockSet, Cloneable {
 		volume = (int) bb.getVolume();
 		bukkitBoundingBox = bb;
 	}
-	
+
+	/**
+	 * Construct a {@link AABBBlock} based on the two provided Bukkit's {@link Location}.
+	 * The worlds defined in the provided locations are ignored.
+	 * @param l1 the first location.
+	 * @param l2 the second location.
+	 */
 	public AABBBlock(Location l1, Location l2) {
 		this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
 	}
-	
+
+	/**
+	 * Construct a {@link AABBBlock} based on the two provided Bukkit's {@link BlockVector}.
+	 * @param l1 the first block vector.
+	 * @param l2 the second block vector.
+	 */
 	public AABBBlock(BlockVector l1, BlockVector l2) {
 		this(l1.getBlockX(), l1.getBlockY(), l1.getBlockZ(), l2.getBlockX(), l2.getBlockY(), l2.getBlockZ());
 	}
-	
+
+	/**
+	 * Construct a {@link AABBBlock} based on the individual coordinates of the 2 vectors.
+	 * @param p1x the x value of the first vector.
+	 * @param p1y the y value of the first vector.
+	 * @param p1z the z value of the first vector.
+	 * @param p2x the x value of the second vector.
+	 * @param p2y the y value of the second vector.
+	 * @param p2z the z value of the second vector.
+	 */
 	public AABBBlock(int p1x, int p1y, int p1z, int p2x, int p2y, int p2z) {
 		/*
 		 * Prends les points extérieurs permettant de former un bounding box englobant
@@ -74,22 +102,45 @@ public class AABBBlock implements BlockSet, Cloneable {
 		return this;
 	}
 
+	/**
+	 * Gets the value of the "minimum" {@link Vector}, that is the vector with the lowest coordinates that is inside this bounding box.
+	 * @return the minimum vector.
+	 */
 	public Vector getMin() {
 		return pos1.clone();
 	}
 
+	/**
+	 * Gets the value of the "maximum" {@link Vector}, that is the vector with the highest coordinates that is inside this bounding box.
+	 * @return the maximum vector.
+	 */
 	public Vector getMax() {
 		return pos2.clone();
 	}
 
+	/**
+	 * Gets the {@link BlockVector} with the lowest coordinates in this bounding box.
+	 * @return the minimum block vector.
+	 */
 	public BlockVector getMinBlock() {
 		return pos1.toBlockVector();
 	}
 
+	/**
+	 * Gets the {@link BlockVector} with the highest coordinates in this bounding box.
+	 * @return the maximum block vector.
+	 */
 	public BlockVector getMaxBlock() {
 		return pos2.clone().add(new Vector(-1, -1, -1)).toBlockVector();
 	}
 
+	/**
+	 * Gets a new {@link AABBBlock} with its coordinates shifted by the provided amount.
+	 * @param x the x shift.
+	 * @param y the y shift.
+	 * @param z the z shift.
+	 * @return a shifted bounding box.
+	 */
 	public AABBBlock shift(int x, int y, int z) {
 		return new AABBBlock(this, x, y, z);
 	}
@@ -101,7 +152,6 @@ public class AABBBlock implements BlockSet, Cloneable {
 	}
 
 
-	
 	public boolean overlaps(BoundingBox bb) {
 		return asBukkitBoundingBox().overlaps(bb);
 	}
@@ -109,15 +159,23 @@ public class AABBBlock implements BlockSet, Cloneable {
 	public boolean isInside(Vector v) {
 		return asBukkitBoundingBox().contains(v);
 	}
-	
+
+	/**
+	 * Gets the coordinate of the center of this bounding box.
+	 * @return the center of this bounding box.
+	 */
 	public Vector getCenter() {
 		return center.clone();
 	}
-	
+
 	public long getVolume() {
 		return volume;
 	}
-	
+
+	/**
+	 * Gets the Bukkit equivalent of this bounding box.
+	 * @return a {@link BoundingBox} corresponding to this {@link AABBBlock}.
+	 */
 	public BoundingBox asBukkitBoundingBox() {
 		if (bukkitBoundingBox == null) {
 			bukkitBoundingBox = new BoundingBox(pos1.getX(), pos1.getY(), pos1.getZ(),
@@ -134,7 +192,7 @@ public class AABBBlock implements BlockSet, Cloneable {
 	}
 	
 	@Override
-	public Iterator<BlockVector> iterator() {
+	public @NotNull Iterator<BlockVector> iterator() {
 		return new Iterator<>() {
 			private int x = pos1.getBlockX(),
 					y = pos1.getBlockY(),
@@ -162,22 +220,6 @@ public class AABBBlock implements BlockSet, Cloneable {
 			}
 		};
 	}
-	
-	
-	public Iterable<Block> asBlockIterable(World w) {
-		return () -> new Iterator<>() {
-			final Iterator<BlockVector> nested = AABBBlock.this.iterator();
-			@Override
-			public boolean hasNext() {
-				return nested.hasNext();
-			}
-			@Override
-			public Block next() {
-				BlockVector bv = nested.next();
-				return w.getBlockAt(bv.getBlockX(), bv.getBlockY(), bv.getBlockZ());
-			}
-		};
-	}
 
 
 	@Override

pandalib-paper/src/main/java/fr/pandacube/lib/paper/geometry/blocks/AABBBlockGroup.java

@@ -12,19 +12,33 @@ import java.util.Collection;
 import java.util.Iterator;
 import java.util.List;
 
+/**
+ * A group of {@link AABBBlock}.
+ */
 public class AABBBlockGroup implements BlockSet {
-	
+
+	/**
+	 * The list of {@link AABBBlock} contained in this group. This list is unmodifiable.
+	 */
 	public final List<AABBBlock> subAABB;
 
 	private final AABBBlock englobingAABB;
 
+	/**
+	 * Creates a new {@link AABBBlockGroup}.
+	 * @param in the list of {@link AABBBlock} that will be contained in this group.
+	 */
 	public AABBBlockGroup(Collection<AABBBlock> in) {
 		if (in.isEmpty())
 			throw new IllegalArgumentException("Provided collection must not be empty.");
 		subAABB = List.copyOf(in);
 		englobingAABB = initEnglobingAABB();
 	}
-	
+
+	/**
+	 * Creates a new {@link AABBBlockGroup}.
+	 * @param in an array of {@link AABBBlock} that will be contained in this group.
+	 */
 	public AABBBlockGroup(AABBBlock... in) {
 		this(Arrays.asList(in));
 	}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/geometry/blocks/BlockSet.java

@@ -1,23 +1,58 @@
 package fr.pandacube.lib.paper.geometry.blocks;
 
 import org.bukkit.Location;
+import org.bukkit.World;
 import org.bukkit.block.Block;
 import org.bukkit.entity.Entity;
 import org.bukkit.util.BlockVector;
 import org.bukkit.util.BoundingBox;
 import org.bukkit.util.Vector;
 
+import java.util.Iterator;
+
+/**
+ * Represents a set of blocks in a world.
+ */
 public interface BlockSet extends Iterable<BlockVector> {
 
+    /**
+     * Gets a random coordinate that is inside this block set.
+     * @return a random coordinate inside this block set.
+     */
     Vector getRandomPosition();
+
+    /**
+     * Gets the volume, in blocks (or cubic meters), of this block set.
+     * @return the volume of this block set.
+     */
     long getVolume();
+
+    /**
+     * Gets the englobing bounding box if this block set.
+     * @return the englobing bounding box if this block set.
+     */
     AABBBlock getEnglobingAABB();
 
 
+    /**
+     * Tells if this block set overlaps the provided bounding box.
+     * @param bb the provided bounding box
+     * @return true if its overlaps, false otherwise.
+     */
     boolean overlaps(BoundingBox bb);
+    /**
+     * Tells if this block set overlaps the bounding box of the provided entity.
+     * @param e the provided entity.
+     * @return true if its overlaps, false otherwise.
+     */
     default boolean overlaps(Entity e) {
         return overlaps(e.getBoundingBox());
     }
+    /**
+     * Tells if this block set overlaps the provided one. that is there is at least one block in common.
+     * @param bs the provided block set.
+     * @return true if its overlaps, false otherwise.
+     */
     default boolean overlaps(BlockSet bs) {
         if (this instanceof AABBBlock b1) {
             if (bs instanceof AABBBlock b2)
@@ -37,20 +72,78 @@ public interface BlockSet extends Iterable<BlockVector> {
     }
 
 
+    /**
+     * Tells if the provided vector is inside this bounding box.
+     * @param v the vector.
+     * @return true if its inside, false otherwise.
+     */
     boolean isInside(Vector v);
+
+    /**
+     * Tells if the provided location is inside this bounding box.
+     * The world of the location is ignored.
+     * @param l the location.
+     * @return true if its inside, false otherwise.
+     */
     default boolean isInside(Location l) {
         return isInside(l.toVector());
     }
+
+    /**
+     * Tells if the provided block is inside this bounding box.
+     * The world of the block is ignored.
+     * @param b the block.
+     * @return true if its inside, false otherwise.
+     */
     default boolean isInside(Block b) {
         return isInside(b.getLocation().add(.5, .5, .5));
     }
-    default boolean isInside(Entity p) {
-        return isInside(p.getLocation());
+
+    /**
+     * Tells if the provided entity is inside this bounding box.
+     * It calls {@link #isInside(Location)} using the returned value of {@link Entity#getLocation()}.
+     * The world of the entity is ignored.
+     * @param e the entity.
+     * @return true if its inside, false otherwise.
+     */
+    default boolean isInside(Entity e) {
+        return isInside(e.getLocation());
     }
 
 
 
 
+
+    /**
+     * Gets an iterator iterating through all the blocks of this block set.
+     * @param w the world of the blocks.
+     * @return a new iterator.
+     */
+    default Iterable<Block> asBlockIterable(World w) {
+        return () -> new Iterator<>() {
+            final Iterator<BlockVector> nested = BlockSet.this.iterator();
+            @Override
+            public boolean hasNext() {
+                return nested.hasNext();
+            }
+            @Override
+            public Block next() {
+                BlockVector bv = nested.next();
+                return w.getBlockAt(bv.getBlockX(), bv.getBlockY(), bv.getBlockZ());
+            }
+        };
+    }
+
+
+
+    /**
+     * Tests the two block set overlap each other.
+     * This method works on any implementation of this interface, but they should override the
+     * {@link #overlaps(BlockSet)} method to provide a more optimized code.
+     * @param bs1 the first block set.
+     * @param bs2 the second block set.
+     * @return true if the two block set overlap, false otherwise.
+     */
     static boolean overlap(BlockSet bs1, BlockSet bs2) {
         if (!bs1.getEnglobingAABB().overlaps(bs2.getEnglobingAABB()))
             return false;

pandalib-paper/src/main/java/fr/pandacube/lib/paper/gui/GUIHotBar.java

@@ -37,13 +37,21 @@ public class GUIHotBar implements Listener {
 	private final int defaultSlot;
 	
 	private final List<Player> currentPlayers = new ArrayList<>();
-	
+
+	/**
+	 * Set up a new gui hot  bar. You should not instantiate more than one hot bar.
+	 * @param defaultSlot the default slot (currently held item) when the player joins the hot bar.
+	 */
 	public GUIHotBar(int defaultSlot) {
 		this.defaultSlot = Math.max(0, Math.min(8, defaultSlot));
 		
 		BukkitEvent.register(this);
 	}
 
+	/**
+	 * Disables this hot bar.
+	 * @param clearPlayerMenuItems if the items of this hot bar should be removed from the players inventories.
+	 */
 	public void disable(boolean clearPlayerMenuItems) {
 		removeAllPlayers(clearPlayerMenuItems);
 
@@ -53,9 +61,10 @@ public class GUIHotBar implements Listener {
 	/**
 	 * Add the item to this hot bar menu. if there is already players hooked to this hot bar, the item will be directly added to
 	 * their inventories.
-	 * @param i the item stack
+	 * @param i the item stack.
 	 * @param setter code executed to put the item in the inventory. Additionally, check for permission before doing the addition.
 	 * @param run the Runnable to run when the user right-click on the item in the hot bar.
+	 * @return itself for daisy-chaining.
 	 */
 	public GUIHotBar addItem(ItemStack i, BiConsumer<PlayerInventory, ItemStack> setter, Consumer<Player> run) {
 		itemsAndSetters.put(i, setter);
@@ -69,8 +78,9 @@ public class GUIHotBar implements Listener {
 	
 	/**
 	 * Add the hot bar elements to this player, or update them if applicable.
-	 * 
+	 * <br>
 	 * The player is automatically removed when they quit. You can remove it before by calling {@link #removePlayer(Player, boolean)}.
+	 * @param p the player to add.
 	 */
 	public void addPlayer(Player p) {
 		if (!currentPlayers.contains(p))
@@ -85,6 +95,7 @@ public class GUIHotBar implements Listener {
 	
 	/**
 	 * Detach this player from this hot bar manager and removes the managed items from the players inventory.
+	 * @param p the player to remove.
 	 */
 	public void removePlayer(Player p) {
 		removePlayer(p, true);
@@ -92,6 +103,8 @@ public class GUIHotBar implements Listener {
 
 	/**
 	 * Detach this player from this hot bar manager and optionally removes the managed items from the players inventory.
+	 * @param p the player to remove.
+	 * @param clearMenuItems if the items from this hot bar should be removed from the player inventory.
 	 */
 	public void removePlayer(Player p, boolean clearMenuItems) {
 		if (!currentPlayers.contains(p))
@@ -106,18 +119,28 @@ public class GUIHotBar implements Listener {
 		currentPlayers.remove(p);
 
 	}
-	
-	
+
+	/**
+	 * Tells if the provided player is attached to this hot bar.
+	 * @param p the player to check.
+	 * @return true if the player is attached, false otherwise.
+	 */
 	public boolean containsPlayer(Player p) {
 		return currentPlayers.contains(p);
 	}
-	
-	
-	
+
+
+	/**
+	 * Detach all players from this hot bar.
+	 */
 	public void removeAllPlayers() {
 		removeAllPlayers(true);
 	}
 
+	/**
+	 * Detach all players from this hot bar.
+	 * @param clearMenuItems if the items from this hot bar should be removed from the player inventory.
+	 */
 	public void removeAllPlayers(boolean clearMenuItems) {
 		for (Player p : new ArrayList<>(currentPlayers))
 			removePlayer(p, clearMenuItems);
@@ -127,7 +150,7 @@ public class GUIHotBar implements Listener {
 	
 	
 	
-	public void addItemToPlayer(Player p, ItemStack is) {
+	private void addItemToPlayer(Player p, ItemStack is) {
 		if (!itemsAndSetters.containsKey(is))
 			throw new IllegalArgumentException("The provided ItemStack is not registered in this GUIHotBar");
 		if (!currentPlayers.contains(p))
@@ -135,7 +158,7 @@ public class GUIHotBar implements Listener {
 		itemsAndSetters.get(is).accept(p.getInventory(), is.clone());
 	}
 	
-	public void removeItemFromPlayer(Player p, ItemStack is) {
+	private void removeItemFromPlayer(Player p, ItemStack is) {
 		p.getInventory().remove(is);
 	}
 	
@@ -144,7 +167,7 @@ public class GUIHotBar implements Listener {
 	
 
 	@EventHandler
-	public void onPlayerDropItem(PlayerDropItemEvent event) {
+	void onPlayerDropItem(PlayerDropItemEvent event) {
 		if (!currentPlayers.contains(event.getPlayer()))
 			return;
 		
@@ -159,7 +182,7 @@ public class GUIHotBar implements Listener {
 	
 	
 	@EventHandler
-	public void onPlayerInteract(PlayerInteractEvent event) {
+	void onPlayerInteract(PlayerInteractEvent event) {
 		if (!currentPlayers.contains(event.getPlayer()))
 			return;
 		
@@ -188,7 +211,7 @@ public class GUIHotBar implements Listener {
 	
 	
 	@EventHandler
-	public void onInventoryClick(InventoryClickEvent event) {
+	void onInventoryClick(InventoryClickEvent event) {
 		if (event.getClickedInventory() == null || !(event.getClickedInventory() instanceof PlayerInventory inv))
 			return;
 
@@ -213,20 +236,20 @@ public class GUIHotBar implements Listener {
 
 	
 	@EventHandler
-	public void onPlayerQuit(PlayerQuitEvent event) {
+	void onPlayerQuit(PlayerQuitEvent event) {
 		removePlayer(event.getPlayer());
 	}
 	
 	
 	@EventHandler
-	public void onPlayerDeath(PlayerDeathEvent event) {
+	void onPlayerDeath(PlayerDeathEvent event) {
 		if (!currentPlayers.contains(event.getEntity()))
 			return;
 		event.getDrops().removeAll(itemsAndSetters.keySet());
 	}
 	
 	@EventHandler
-	public void onPlayerRespawn(PlayerRespawnEvent event) {
+	void onPlayerRespawn(PlayerRespawnEvent event) {
 		if (!currentPlayers.contains(event.getPlayer()))
 			return;
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/gui/GUIInventory.java

@@ -49,7 +49,11 @@ public class GUIInventory implements Listener {
 		Bukkit.getPluginManager().registerEvents(this, PandaLibPaper.getPlugin());
 
 	}
-	
+
+	/**
+	 * Sets the action when the player closes the inventory window.
+	 * @param closeEventAction the action to run.
+	 */
 	protected void setCloseEvent(Consumer<InventoryCloseEvent> closeEventAction) {
 		onCloseEvent = closeEventAction;
 	}
@@ -188,13 +192,13 @@ public class GUIInventory implements Listener {
 			onCloseEvent.accept(event);
 		isOpened = false;
 	}
-	
-	
 
-	
 
-	
-	
+	/**
+	 * Tells the number of inventory line needed to show the provided number of slot.
+	 * @param nb the number of slot.
+	 * @return the number of line.
+	 */
 	public static int nbLineForNbElements(int nb) {
 		return nb / 9 + ((nb % 9 == 0) ? 0 : 1);
 	}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/inventory/DummyPlayerInventory.java

@@ -0,0 +1,232 @@
+package fr.pandacube.lib.paper.inventory;
+
+import com.google.common.base.Preconditions;
+import org.bukkit.Material;
+import org.bukkit.entity.HumanEntity;
+import org.bukkit.inventory.EquipmentSlot;
+import org.bukkit.inventory.Inventory;
+import org.bukkit.inventory.ItemStack;
+import org.bukkit.inventory.PlayerInventory;
+import org.jetbrains.annotations.NotNull;
+import org.jetbrains.annotations.Nullable;
+
+import java.util.Arrays;
+import java.util.Objects;
+
+/**
+ * Dummy implementation of a player inventory.
+ */
+public class DummyPlayerInventory extends InventoryWrapper implements PlayerInventory {
+
+    /**
+     * Total number of item slots in the player inventory.
+     */
+    public static final int PLAYER_INVENTORY_SIZE = 43; // 36 base inventory + 4 armor slots + 1 off hand + 2 hidden slots (body and saddle)
+
+    private int heldItemSlot;
+
+    /**
+     * Creates a dummy player inventory.
+     * @param base the inventory itself.
+     * @param heldItemSlot the currently held item slot, from 0 to 8.
+     */
+    public DummyPlayerInventory(Inventory base, int heldItemSlot) {
+        super(base);
+        if (base.getSize() < PLAYER_INVENTORY_SIZE)
+            throw new IllegalArgumentException("base inventory should have a size of " + PLAYER_INVENTORY_SIZE + " (" + base.getSize() + " given).");
+        if (heldItemSlot < 0 || heldItemSlot > 8)
+            throw new IllegalArgumentException("heldItemSlot should be between 0 and 8 inclusive.");
+        this.heldItemSlot = heldItemSlot;
+    }
+
+    @Override
+    public @Nullable ItemStack @NotNull [] getStorageContents() {
+        return Arrays.copyOfRange(getContents(), 0, 36);
+    }
+
+    @Override
+    public @Nullable ItemStack @NotNull [] getArmorContents() {
+        return Arrays.copyOfRange(getContents(), 36, 40);
+    }
+
+    @Override
+    public void setArmorContents(@Nullable ItemStack[] items) {
+        this.setSlots(items, 36, 4);
+    }
+
+    @Override
+    public @Nullable ItemStack @NotNull [] getExtraContents() {
+        return Arrays.copyOfRange(getContents(), 40, getSize());
+    }
+
+    @Override
+    public void setExtraContents(@Nullable ItemStack[] items) {
+        this.setSlots(items, 40, getSize() - 40);
+    }
+
+    private void setSlots(ItemStack[] items, int baseSlot, int length) {
+        if (items == null) {
+            items = new ItemStack[length];
+        }
+        Preconditions.checkArgument(items.length <= length, "items.length must be < %s", length);
+
+        for (int i = 0; i < length; i++) {
+            if (i >= items.length) {
+                this.setItem(baseSlot + i, null);
+            } else {
+                this.setItem(baseSlot + i, items[i]);
+            }
+        }
+    }
+
+    @Override
+    public ItemStack getHelmet() {
+        return getItem(39);
+    }
+
+    @Override
+    public void setHelmet(@Nullable ItemStack helmet) {
+        setItem(39, helmet);
+    }
+
+    @Override
+    public ItemStack getChestplate() {
+        return getItem(38);
+    }
+
+    @Override
+    public void setChestplate(@Nullable ItemStack chestplate) {
+        setItem(38, chestplate);
+    }
+
+    @Override
+    public ItemStack getLeggings() {
+        return getItem(37);
+    }
+
+    @Override
+    public void setLeggings(@Nullable ItemStack leggings) {
+        setItem(37, leggings);
+    }
+
+    @Override
+    public ItemStack getBoots() {
+        return getItem(36);
+    }
+
+    @Override
+    public void setBoots(@Nullable ItemStack boots) {
+        setItem(36, boots);
+    }
+
+    /**
+     * Gets the item stack in the SADDLE {@link EquipmentSlot}.
+     * @return the SADDLE item stack.
+     */
+    public ItemStack getSaddle() {
+        return getItem(42);
+    }
+
+    /**
+     * Puts the provided item stack in the SADDLE {@link EquipmentSlot}.
+     * @param saddle the item.
+     */
+    public void setSaddle(@Nullable ItemStack saddle) {
+        setItem(42, saddle);
+    }
+
+    /**
+     * Gets the item stack in the BODY {@link EquipmentSlot}.
+     * @return the BODY item stack.
+     */
+    public ItemStack getBody() {
+        return getItem(41);
+    }
+
+    /**
+     * Puts the provided item stack in the BODY {@link EquipmentSlot}.
+     * @param body the item.
+     */
+    public void setBody(@Nullable ItemStack body) {
+        setItem(41, body);
+    }
+
+
+
+    @Override
+    public void setItem(EquipmentSlot slot, ItemStack item) {
+        Preconditions.checkArgument(slot != null, "slot must not be null");
+
+        switch (slot) {
+            case HAND -> this.setItemInMainHand(item);
+            case OFF_HAND -> this.setItemInOffHand(item);
+            case FEET -> this.setBoots(item);
+            case LEGS -> this.setLeggings(item);
+            case CHEST -> this.setChestplate(item);
+            case HEAD -> this.setHelmet(item);
+            case BODY -> this.setBody(item);
+            case SADDLE -> this.setSaddle(item);
+        }
+    }
+
+    @Override
+    public @NotNull ItemStack getItem(@NotNull EquipmentSlot slot) {
+        return switch (slot) {
+            case HAND -> this.getItemInMainHand();
+            case OFF_HAND -> this.getItemInOffHand();
+            case FEET -> Objects.requireNonNullElseGet(this.getBoots(), () -> new ItemStack(Material.AIR));
+            case LEGS -> Objects.requireNonNullElseGet(this.getLeggings(), () -> new ItemStack(Material.AIR));
+            case CHEST -> Objects.requireNonNullElseGet(this.getChestplate(), () -> new ItemStack(Material.AIR));
+            case HEAD -> Objects.requireNonNullElseGet(this.getHelmet(), () -> new ItemStack(Material.AIR));
+            case BODY -> Objects.requireNonNullElseGet(this.getBody(), () -> new ItemStack(Material.AIR)); // for horses/wolves armor
+            case SADDLE -> Objects.requireNonNullElseGet(this.getSaddle(), () -> new ItemStack(Material.AIR));
+        };
+    }
+
+    @Override
+    public @NotNull ItemStack getItemInMainHand() {
+        return Objects.requireNonNullElse(getItem(heldItemSlot), new ItemStack(Material.AIR));
+    }
+
+    @Override
+    public void setItemInMainHand(@Nullable ItemStack item) {
+        setItem(heldItemSlot, item);
+    }
+
+    @Override
+    public @NotNull ItemStack getItemInOffHand() {
+        return Objects.requireNonNullElse(getItem(40), new ItemStack(Material.AIR));
+    }
+
+    @Override
+    public void setItemInOffHand(@Nullable ItemStack item) {
+        setItem(40, item);
+    }
+
+    @Override
+    public @NotNull ItemStack getItemInHand() {
+        return getItemInMainHand();
+    }
+
+    @Override
+    public void setItemInHand(@Nullable ItemStack stack) {
+        setItemInMainHand(stack);
+    }
+
+    @Override
+    public int getHeldItemSlot() {
+        return heldItemSlot;
+    }
+
+    @Override
+    public void setHeldItemSlot(int slot) {
+        if (slot < 0 || slot > 8)
+            throw new IllegalArgumentException("Slot is not between 0 and 8 inclusive");
+        heldItemSlot = slot;
+    }
+
+    @Override
+    public @Nullable HumanEntity getHolder() {
+        return null;
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/inventory/InventoryWrapper.java

@@ -1,4 +1,4 @@
-package fr.pandacube.lib.paper.util;
+package fr.pandacube.lib.paper.inventory;
 
 import org.bukkit.Location;
 import org.bukkit.Material;
@@ -13,12 +13,22 @@ import org.jetbrains.annotations.Nullable;
 import java.util.HashMap;
 import java.util.List;
 import java.util.ListIterator;
+import java.util.Objects;
 
+/**
+ * Wrapper for an {@link Inventory}.
+ * Can be overridden to add specific behaviour to some methods.
+ */
 public class InventoryWrapper implements Inventory {
     private final Inventory base;
 
+    /**
+     * Creates a wrapper for the provided inventory.
+     * @param base the wrapped inventory. Cannot be null.
+     * @throws NullPointerException if the base inventory is null.
+     */
     public InventoryWrapper(Inventory base) {
-        this.base = base;
+        this.base = Objects.requireNonNull(base, "base inventory cannot be null.");
     }
 
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/inventory/ItemStackBuilder.java

@@ -0,0 +1,413 @@
+package fr.pandacube.lib.paper.inventory;
+
+import com.google.common.collect.Streams;
+import fr.pandacube.lib.chat.Chat;
+import io.papermc.paper.datacomponent.DataComponentType;
+import io.papermc.paper.datacomponent.DataComponentType.Valued;
+import io.papermc.paper.datacomponent.DataComponentTypes;
+import io.papermc.paper.datacomponent.item.ResolvableProfile;
+import net.kyori.adventure.text.Component;
+import net.kyori.adventure.text.ComponentLike;
+import org.bukkit.Material;
+import org.bukkit.NamespacedKey;
+import org.bukkit.enchantments.Enchantment;
+import org.bukkit.inventory.ItemFlag;
+import org.bukkit.inventory.ItemStack;
+import org.bukkit.inventory.meta.Damageable;
+import org.bukkit.inventory.meta.ItemMeta;
+
+import java.util.Arrays;
+import java.util.Collection;
+import java.util.Collections;
+import java.util.List;
+import java.util.function.Consumer;
+
+import static fr.pandacube.lib.chat.ChatStatic.chatComponent;
+
+/**
+ * A builder for {@link ItemStack}.
+ */
+public class ItemStackBuilder {
+
+	/**
+	 * Create a builder with a clone of the provided ItemStack.
+	 * <p>
+	 * The returned builder will not alter the provided ItemStack.
+	 * If you want to modify the ItemStack with the builder, please use {@link #wrap(ItemStack)}.
+	 * @param base the original ItemStack.
+	 * @return the builder
+	 */
+	public static ItemStackBuilder of(ItemStack base) {
+		return wrap(base.clone());
+	}
+
+	/**
+	 * Create a builder of a new ItemStack with the specified Material.
+	 * @param mat the material of the new built ItemStack
+	 * @return the builder
+	 */
+	public static ItemStackBuilder of(Material mat) {
+		return wrap(new ItemStack(mat));
+	}
+
+	/**
+	 * Create a builder that will alter the data of the provided ItemStack.
+	 * <p>
+	 * The {@link #build()} method of the returned builder will return the same instance
+	 * of ItemStack as the parameter of this method.
+	 * <p>
+	 * To create a builder that doesn't modify the provided ItemStack, use {@link #of(ItemStack)}.
+	 * @param stack the wrapped item stack.
+	 * @return the builder
+	 */
+	public static ItemStackBuilder wrap(ItemStack stack) {
+		return new ItemStackBuilder(stack);
+	}
+	
+	
+	
+	
+	
+	
+	
+	
+	
+	
+	
+	
+	private final ItemStack stack;
+	
+	private ItemStackBuilder(ItemStack base) {
+		stack = base;
+	}
+
+	/**
+	 * Runs the provided updater on the {@link ItemMeta} instance of the built stack.
+	 * @param metaUpdater the updater that will modify the meta.
+	 * @return itself.
+	 */
+	public ItemStackBuilder meta(Consumer<ItemMeta> metaUpdater) {
+		return meta(metaUpdater, ItemMeta.class);
+	}
+
+	/**
+	 * Runs the provided updater on the {@link ItemMeta} instance of the built stack.
+	 * @param metaUpdater the updater that will modify the meta.
+	 * @param metaType the type of the meta instance.
+	 * @param <T> the type of item meta.
+	 * @return itself.
+	 */
+	public <T extends ItemMeta> ItemStackBuilder meta(Consumer<T> metaUpdater, Class<T> metaType) {
+		stack.editMeta(metaType, metaUpdater);
+		return this;
+	}
+
+	/**
+	 * Sets the amount of the built stack.
+	 * @param a the new amount.
+	 * @return itself.
+	 */
+	public ItemStackBuilder amount(int a) {
+		stack.setAmount(a);
+		return this;
+	}
+
+	/**
+	 * Sets the display name of the item, directly passing to {@link ItemMeta#displayName(Component)}.
+	 * @param displayName the new display name. Can be null to unset.
+	 * @return itself.
+	 */
+	public ItemStackBuilder rawDisplayName(Component displayName) {
+		return meta(m -> m.displayName(displayName));
+	}
+
+	/**
+	 * Sets the display name of the item, filtering to make default italic to false.
+	 * @param displayName the new display name. Can be null to unset.
+	 * @return itself.
+	 */
+	public ItemStackBuilder displayName(ComponentLike displayName) {
+		return rawDisplayName(displayName != null
+				? Chat.italicFalseIfNotSet(chatComponent(displayName)).asComponent()
+				: null);
+	}
+
+	/**
+	 * Sets the lore of the item, directly passing to {@link ItemMeta#lore(List)}.
+	 * @param lore the new lore. Can be null to unset.
+	 * @return itself.
+	 */
+	public ItemStackBuilder rawLore(List<Component> lore) {
+		return meta(m -> m.lore(lore));
+	}
+
+
+	/**
+	 * Sets the lore of the item, filtering to make default italic to false.
+	 * @param lore the new lore. Can be null to unset.
+	 * @return itself.
+	 */
+	public ItemStackBuilder lore(List<? extends ComponentLike> lore) {
+		if (lore != null) {
+			return rawLore(lore.stream()
+					.map(line -> Chat.italicFalseIfNotSet(chatComponent(line)).get())
+					.toList());
+		}
+		else
+			return rawLore(Collections.emptyList());
+	}
+
+	/**
+	 * Adds new lore lines to the existing lore of the item.
+	 * @param lores the added lore lines.
+	 * @return itself.
+	 */
+	public ItemStackBuilder addLoreAfter(List<? extends ComponentLike> lores) {
+		if (lores != null) {
+			List<Component> baseLore = stack.getItemMeta().lore();
+			if (baseLore == null) baseLore = Collections.emptyList();
+			return rawLore(
+					Streams.concat(
+							baseLore.stream(),
+							lores.stream()
+							.map(line -> Chat.italicFalseIfNotSet(chatComponent(line)).get())
+					)
+					.toList());
+		}
+		else
+			return this;
+	}
+
+	/**
+	 * Adds new lore lines to the existing lore of the item.
+	 * @param lores the added lore lines.
+	 * @return itself.
+	 */
+	public ItemStackBuilder addLoreAfter(ComponentLike... lores) {
+		if (lores == null || lores.length == 0)
+			return this;
+		return addLoreAfter(Arrays.asList(lores));
+	}
+
+	/**
+	 * Enchant the item.
+	 * Supports unsafe enchants.
+	 * @param enchantment the enchantment.
+	 * @param level the enchant level.
+	 * @return itself.
+	 */
+	public ItemStackBuilder enchant(Enchantment enchantment, int level) {
+		return meta(m -> m.addEnchant(enchantment, level, true));
+	}
+
+	/**
+	 * Adds the provided flags to the item.
+	 * @param flags he flags to add.
+	 * @return itself.
+	 */
+	public ItemStackBuilder flags(ItemFlag... flags) {
+		return flags(true, flags);
+	}
+
+	/**
+	 * Adds or removes the provided flags to the item.
+	 * @param add true to add, false to remove.
+	 * @param flags he flags to add.
+	 * @return itself.
+	 */
+	public ItemStackBuilder flags(boolean add, ItemFlag... flags) {
+		return add ? meta(m -> m.addItemFlags(flags))
+				: meta(m -> m.removeItemFlags(flags));
+	}
+
+	/**
+	 * Hides the enchants from the tooltip of the item.
+	 * Will set the {@link ItemFlag#HIDE_ENCHANTS} flag of the item.
+	 * @return itself.
+	 */
+	public ItemStackBuilder hideEnchants() {
+		return hideEnchants(true);
+	}
+
+	/**
+	 * Sets or unsets the {@link ItemFlag#HIDE_ENCHANTS} flag of the item.
+	 * @param hide true to hide, false to show.
+	 * @return itself.
+	 */
+	public ItemStackBuilder hideEnchants(boolean hide) {
+		return flags(hide, ItemFlag.HIDE_ENCHANTS);
+	}
+
+	/**
+	 * Hides the attributes from the tooltip of the item.
+	 * Will set the {@link ItemFlag#HIDE_ATTRIBUTES} flag of the item.
+	 * @return itself.
+	 */
+	public ItemStackBuilder hideAttributes() {
+		return hideAttributes(true);
+	}
+
+	/**
+	 * Sets or unsets the {@link ItemFlag#HIDE_ATTRIBUTES} flag of the item.
+	 * @param hide true to hide, false to show.
+	 * @return itself.
+	 */
+	public ItemStackBuilder hideAttributes(boolean hide) {
+		return flags(hide, ItemFlag.HIDE_ATTRIBUTES);
+	}
+
+	/**
+	 * Apply the enchantment glint to the item, event if it's not enchant.
+	 * @return itself.
+	 */
+	public ItemStackBuilder fakeEnchant() {
+		return fakeEnchant(true);
+	}
+
+	/**
+	 * Sets the enchantment glint override to the item.
+	 * @param apply true to enforce the enchantment glint, false to set to default.
+	 * @return itself.
+	 */
+	public ItemStackBuilder fakeEnchant(boolean apply) {
+		return meta(m -> m.setEnchantmentGlintOverride(apply ? true : null));
+	}
+
+	/**
+	 * Sets this item as unbreakable.
+	 * @return itself.
+	 */
+	public ItemStackBuilder unbreakable() {
+		return unbreakable(true);
+	}
+
+	/**
+	 * Sets the unbreakable status of this item.
+	 * @param unbreakable the unbreakable status.
+	 * @return itself.
+	 */
+	public ItemStackBuilder unbreakable(boolean unbreakable) {
+		return meta(m -> m.setUnbreakable(unbreakable));
+	}
+
+	/**
+	 * Sets the damage value of this item.
+	 * @param d the new damage value.
+	 * @return itself.
+	 */
+	public ItemStackBuilder damage(int d) {
+		return meta(m -> m.setDamage(d), Damageable.class);
+	}
+
+
+	/**
+	 * Sets a value for a data component of this item.
+	 * @param dataType the data component type.
+	 * @param dataValue the data component value.
+	 * @return itself.
+	 * @param <T> the data component API type.
+	 */
+	public <T> ItemStackBuilder data(Valued<T> dataType, T dataValue) {
+		stack.setData(dataType, dataValue);
+		return this;
+	}
+
+	/**
+	 * Unset (set to empty) a value for a data component of this item.
+	 * @param dataType the data component type.
+	 * @return itself.
+	 */
+	public ItemStackBuilder unsetData(DataComponentType dataType) {
+		stack.unsetData(dataType);
+		return this;
+	}
+
+	/**
+	 * Reset (act as default) a value for a data component of this item.
+	 * @param dataType the data component type.
+	 * @return itself.
+	 */
+	public ItemStackBuilder resetData(DataComponentType dataType) {
+		stack.resetData(dataType);
+		return this;
+	}
+
+
+	/**
+	 * Sets the {@code can_break} data component to the provided list of {@link Material}.
+	 * @param canBreak a list of {@link Material}.
+	 * @return itself.
+	 */
+	public ItemStackBuilder canBreakMaterials(Collection<Material> canBreak) {
+		return canBreak(canBreak.stream().map(Material::getKey).toList());
+	}
+
+
+	/**
+	 * Sets the {@code can_break} data component to the provided list of {@link NamespacedKey}.
+	 * @param canBreak a list of block predicate. If empty, unsets the data component. If null, reset to default.
+	 * @return itself.
+	 */
+	@SuppressWarnings("removal")
+	public ItemStackBuilder canBreak(Collection<NamespacedKey> canBreak) {
+		@SuppressWarnings("unchecked")
+		Collection<com.destroystokyo.paper.Namespaced> nsCanBreak = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canBreak;
+		return meta(m -> m.setDestroyableKeys(nsCanBreak));
+
+		/*
+		if (canBreak == null)
+			return resetData(DataComponentTypes.CAN_BREAK);
+		else if (canBreak.isEmpty())
+			return unsetData(DataComponentTypes.CAN_BREAK);
+		else
+			return data(DataComponentTypes.CAN_BREAK, ItemAdventurePredicate.itemAdventurePredicate(canBreak));*/
+	}
+
+	/**
+	 * Sets the {@code can_place_on} data component to the provided list of {@link Material}.
+	 * @param canPlaceOn a list of {@link Material}.
+	 * @return itself.
+	 */
+	public ItemStackBuilder canPlaceOnMaterials(Collection<Material> canPlaceOn) {
+		return canPlaceOn(canPlaceOn.stream().map(Material::getKey).toList());
+	}
+
+	/**
+	 * Sets the {@code can_place_on} data component to the provided list of {@link NamespacedKey}.
+	 * @param canPlaceOn a list of block predicate. If empty, unsets the data component. If null, reset to default.
+	 * @return itself.
+	 */
+	@SuppressWarnings("removal")
+	public ItemStackBuilder canPlaceOn(Collection<NamespacedKey> canPlaceOn) {
+		@SuppressWarnings("unchecked")
+		Collection<com.destroystokyo.paper.Namespaced> nsCanPlaceOn = (Collection<com.destroystokyo.paper.Namespaced>) (Collection<?>) canPlaceOn;
+		return meta(m -> m.setPlaceableKeys(nsCanPlaceOn));
+
+		/* if (canPlaceOn == null)
+			return resetData(DataComponentTypes.CAN_PLACE_ON);
+		else if (canPlaceOn.isEmpty())
+			return unsetData(DataComponentTypes.CAN_PLACE_ON);
+		else
+			return data(DataComponentTypes.CAN_PLACE_ON, ItemAdventurePredicate.itemAdventurePredicate(canPlaceOn)); */
+	}
+
+	/**
+	 * Sets the {@code profile} data component to the provided profile.
+	 * @param profile the profile to use as the component value.
+	 * @return itself.
+	 */
+	public ItemStackBuilder profile(ResolvableProfile profile) {
+		return data(DataComponentTypes.PROFILE, profile);
+	}
+
+
+	/**
+	 * Build the {@link ItemStack}.
+	 * @return the build item stack.
+	 */
+	public ItemStack build() {
+		return stack;
+	}
+	
+
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/inventory/Skull.java

@@ -0,0 +1,126 @@
+package fr.pandacube.lib.paper.inventory;
+
+import com.destroystokyo.paper.profile.ProfileProperty;
+import io.papermc.paper.datacomponent.item.ResolvableProfile;
+import org.bukkit.Material;
+import org.bukkit.inventory.ItemStack;
+
+import java.util.Base64;
+import java.util.regex.Pattern;
+
+/**
+ * Represents some special mob heads, also support creating player skulls and custom skulls.
+ */
+public enum Skull {
+
+    /** Jungle wood arrow left. */
+    ARROW_LEFT("http://textures.minecraft.net/texture/3625902b389ed6c147574e422da8f8f361c8eb57e7631676a72777e7b1d"),
+    /** Jungle wood arrow right. */
+    ARROW_RIGHT("http://textures.minecraft.net/texture/d4be8aeec11849697adc6fd1f189b16642dff19f2955c05deaba68c9dff1be"),
+    /** Jungle wood arrow up. */
+    ARROW_UP("http://textures.minecraft.net/texture/88c0f37dec764d6e26b57aa8212572fbace5ee8f27f7b61c1fdaa47dd4c893"),
+    /** Jungle wood arrow down. */
+    ARROW_DOWN("http://textures.minecraft.net/texture/751ced2e647366f8f3ad2dfe415cca85651bfaf9739a95cd57b6f21cba053"),
+    /** Jungle wood question mark. */
+    QUESTION("http://textures.minecraft.net/texture/b4d7cc4dca986a53f1d6b52aaf376dc6acc73b8b287f42dc8fef5808bb5d76"),
+    /** Jungle wood exclamation mark. */
+    EXCLAMATION("http://textures.minecraft.net/texture/e869dc405a3155f281c16a3e8d9ff54afc1599153b4d9385c9b7bab88680f0");
+
+    private final String skinUrl;
+
+    Skull(String skinUrl) {
+        this.skinUrl = skinUrl;
+    }
+
+    /**
+     * Return the item based on this Skull enum.
+     * @return the item stack.
+     */
+    public ItemStack get() {
+        return getFromSkinURL(skinUrl);
+    }
+
+    /**
+     * Return an item stack builder already containing the skull.
+     * @return an item stack builder already containing the skull.
+     */
+    public ItemStackBuilder builder() {
+        return ItemStackBuilder.wrap(get());
+    }
+
+
+
+
+
+
+
+
+    /**
+     * Return a skull of a player based on their name.
+     *
+     * @param name player's name
+     * @return item stack
+     */
+    public static ItemStack getFromPlayerName(String name) {
+        return getFromProfile(ResolvableProfile.resolvableProfile().name(name).build());
+    }
+
+
+
+
+
+
+    /**
+     * Return a skull that has a custom texture specified by url.
+     * @param url skin url.
+     * @return item stack
+     */
+    public static ItemStack getFromSkinURL(String url) {
+        return getFromProfile(ResolvableProfile.resolvableProfile().addProperty(getTexturesProperty(url)).build());
+    }
+
+
+
+    private static ItemStack getFromProfile(ResolvableProfile profile) {
+        return ItemStackBuilder.of(Material.PLAYER_HEAD).profile(profile).build();
+    }
+
+
+    /**
+     * The URL prefix for all the player related textures (skin, cape)
+     */
+    public static final String TEXTURE_URL_PREFIX = "http://textures.minecraft.net/texture/";
+
+    private static final Pattern textureIdMatcher = Pattern.compile("^[0-9a-fA-F]+$");
+
+    /**
+     * Generate the base64 value of the "textures" profile property, based on the provided skin url!
+     * @param skinURL the URL of the skin. The "https" will be replaced by "http" because this is the protocol used in
+     *                the profile property url. If only the texture id part is provided, {@link #TEXTURE_URL_PREFIX} is
+     *                prepended.
+     * @return the base64 encoded texture data.
+     */
+    private static String encodeTextureBase64String(String skinURL) {
+        if (skinURL.startsWith("https://")) // secure url is not the url found in texture data (even if it actually works in the browser)
+            skinURL = "http://" + skinURL.substring("https://".length());
+        if (!skinURL.startsWith(TEXTURE_URL_PREFIX)) { // accept taking only the texture id part ()
+            if (textureIdMatcher.matcher(skinURL).matches())
+                skinURL = TEXTURE_URL_PREFIX + skinURL;
+            else
+                throw new IllegalArgumentException("Invalid skin URL. Must be from " + TEXTURE_URL_PREFIX + ".");
+        }
+        return Base64.getEncoder().encodeToString(String.format("{\"textures\":{\"SKIN\":{\"url\":\"%s\"}}}", skinURL).getBytes());
+    }
+
+
+    private static ProfileProperty getTexturesProperty(String skinURL) {
+        return new ProfileProperty("textures", encodeTextureBase64String(skinURL));
+    }
+    
+    
+    
+    
+    
+
+}
+ 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/json/ConfigurationSerializableAdapter.java

@@ -23,7 +23,7 @@ import java.util.Map;
 /**
  * Gson adapter for ConfigurationSerializable, an interface implemented by several classes in the Bukkit API to ease
  * serialization to YAML.
- *
+ * <p>
  * To not reinvent the wheel, this class uses the Bukkit’s Yaml API to convert the objects from/to json.
  */
 /* package */ class ConfigurationSerializableAdapter implements JsonSerializer<ConfigurationSerializable>, JsonDeserializer<ConfigurationSerializable> {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/json/ItemStackAdapter.java

@@ -9,10 +9,13 @@ import com.google.gson.JsonObject;
 import com.google.gson.JsonParseException;
 import com.google.gson.JsonSerializationContext;
 import com.google.gson.JsonSerializer;
+import com.google.gson.Strictness;
 import com.google.gson.TypeAdapterFactory;
 import com.google.gson.internal.bind.TreeTypeAdapter;
 import com.google.gson.reflect.TypeToken;
+import net.kyori.adventure.key.Key;
 import org.bukkit.Bukkit;
+import org.bukkit.Registry;
 import org.bukkit.configuration.serialization.ConfigurationSerializable;
 import org.bukkit.configuration.serialization.ConfigurationSerialization;
 import org.bukkit.inventory.ItemStack;
@@ -28,16 +31,25 @@ import java.util.Map;
     private static final TypeToken<Map<String, Object>> MAP_STR_OBJ_TYPE = new TypeToken<>() { };
 
     /** Gson instance with no custom type adapter */
-    private static final Gson vanillaGson = new GsonBuilder().setLenient().create();
+    private static final Gson vanillaGson = new GsonBuilder().setStrictness(Strictness.LENIENT).create();
 
     @Override
     public ItemStack deserialize(JsonElement json, Type typeOfT, JsonDeserializationContext context) throws JsonParseException {
         if (!(json instanceof JsonObject jsonObj))
             throw new JsonParseException("Unable to deserialize a ConfigurationSerializable from the provided json structure.");
+
+        // if it contains both old and new data, delete the old one introduced for compatibility
+        if (jsonObj.has("DataVersion") || jsonObj.has("id")) {
+            jsonObj.remove("v");
+            jsonObj.remove("type");
+        }
+
+        // format used when using ConfigurationSerialization
         if (jsonObj.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY))
             return context.deserialize(jsonObj, ConfigurationSerializable.class);
 
 
+
         if (jsonObj.has("meta")
                 && jsonObj.get("meta") instanceof JsonObject metaJson
                 && !metaJson.has(ConfigurationSerialization.SERIALIZED_TYPE_KEY)) {
@@ -47,6 +59,8 @@ import java.util.Map;
             Map<String, Object> map = context.deserialize(jsonObj, MAP_STR_OBJ_TYPE.getType());
             fixDeserializationVersion(map);
             map.remove("meta");
+
+
             ItemStack is = ItemStack.deserialize(map);
 
             Class<? extends ItemMeta> metaClass = is.getItemMeta().getClass();

pandalib-paper/src/main/java/fr/pandacube/lib/paper/json/PaperJson.java

@@ -14,4 +14,7 @@ public class PaperJson {
         Json.registerTypeAdapterFactory(ItemStackAdapter.FACTORY);
         Json.registerTypeAdapterFactory(ConfigurationSerializableAdapter.FACTORY);
     }
+
+
+    private PaperJson() {}
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/modules/PerformanceAnalysisManager.java

@@ -21,7 +21,7 @@ import net.kyori.adventure.bossbar.BossBar.Color;
 import net.kyori.adventure.bossbar.BossBar.Overlay;
 import net.kyori.adventure.text.format.NamedTextColor;
 import net.kyori.adventure.text.format.TextColor;
-import net.kyori.adventure.text.serializer.legacy.LegacyComponentSerializer;
+import org.apache.commons.lang3.tuple.Pair;
 import org.bukkit.Bukkit;
 import org.bukkit.command.CommandSender;
 import org.bukkit.command.ConsoleCommandSender;
@@ -37,6 +37,7 @@ import java.lang.management.ThreadMXBean;
 import java.util.ArrayList;
 import java.util.LinkedList;
 import java.util.List;
+import java.util.concurrent.atomic.AtomicInteger;
 
 import static fr.pandacube.lib.chat.ChatStatic.chat;
 import static fr.pandacube.lib.chat.ChatStatic.failureText;
@@ -44,10 +45,17 @@ import static fr.pandacube.lib.chat.ChatStatic.infoText;
 import static fr.pandacube.lib.chat.ChatStatic.successText;
 import static fr.pandacube.lib.chat.ChatStatic.text;
 
+/**
+ * Various tools to supervise the JVM RAM and the CPU usage of the main server thread.
+ */
 public class PerformanceAnalysisManager implements Listener {
 
 	private static PerformanceAnalysisManager instance;
 
+	/**
+	 * Gets the instance of {@link PerformanceAnalysisManager}.
+	 * @return the instance of {@link PerformanceAnalysisManager}.
+	 */
 	public static synchronized PerformanceAnalysisManager getInstance() {
 		if (instance == null)
 			instance = new PerformanceAnalysisManager();
@@ -76,14 +84,22 @@ public class PerformanceAnalysisManager implements Listener {
 	private final LinkedList<Long> interTPSDurations = new LinkedList<>();
 
 
-
-
+	/**
+	 * The boss bar that shows in real time the CPU performance of the main server thread.
+	 */
 	public final AutoUpdatedBossBar tpsBar;
+
+	/**
+	 * The boss bar that shows in real time the JVM RAM usage.
+	 */
 	public final AutoUpdatedBossBar memoryBar;
 	private final List<Player> barPlayers = new ArrayList<>();
 	private final List<BossBar> relatedBossBars = new ArrayList<>();
-	
-	
+
+
+	/**
+	 * The gradient of color covering the common range of TPS values.
+	 */
 	public final ChatColorGradient tps1sGradient = new ChatColorGradient()
 			.add(0, NamedTextColor.BLACK)
 			.add(1, NamedTextColor.DARK_RED)
@@ -94,23 +110,7 @@ public class PerformanceAnalysisManager implements Listener {
 			.add(21, PandaTheme.CHAT_GREEN_1_NORMAL)
 			.add(26, NamedTextColor.BLUE);
 
-
-	public final ChatColorGradient tps10sGradient = new ChatColorGradient()
-			.add(0, NamedTextColor.DARK_RED)
-			.add(5, NamedTextColor.RED)
-			.add(10, NamedTextColor.GOLD)
-			.add(14, NamedTextColor.YELLOW)
-			.add(19, PandaTheme.CHAT_GREEN_1_NORMAL);
-
-
-	public final ChatColorGradient tps1mGradient = new ChatColorGradient()
-			.add(0, NamedTextColor.DARK_RED)
-			.add(8, NamedTextColor.RED)
-			.add(14, NamedTextColor.GOLD)
-			.add(17, NamedTextColor.YELLOW)
-			.add(19, PandaTheme.CHAT_GREEN_1_NORMAL);
-
-	public final ChatColorGradient memoryUsageGradient = new ChatColorGradient()
+	private final ChatColorGradient memoryUsageGradient = new ChatColorGradient()
 			.add(.60f, PandaTheme.CHAT_GREEN_1_NORMAL)
 			.add(.70f, NamedTextColor.YELLOW)
 			.add(.80f, NamedTextColor.GOLD)
@@ -132,10 +132,19 @@ public class PerformanceAnalysisManager implements Listener {
 		
 	}
 
+	/**
+	 * Tells if the provided players is seeing the performance boss bars.
+	 * @param p the player to verify.
+	 * @return true if the provided players is seeing the performance boss bars, false otherwise.
+	 */
 	public boolean barsContainsPlayer(Player p) {
 		return barPlayers.contains(p);
 	}
-	
+
+	/**
+	 * Shows the performance boss bars to the provided player.
+	 * @param p the player.
+	 */
 	public synchronized void addPlayerToBars(Player p) {
 		barPlayers.add(p);
 		p.showBossBar(tpsBar.bar);
@@ -143,7 +152,11 @@ public class PerformanceAnalysisManager implements Listener {
 		for (BossBar bar : relatedBossBars)
 			p.showBossBar(bar);
 	}
-	
+
+	/**
+	 * Hides the performance boss bars from the provided player.
+	 * @param p the player.
+	 */
 	public synchronized void removePlayerToBars(Player p) {
 		p.hideBossBar(tpsBar.bar);
 		p.hideBossBar(memoryBar.bar);
@@ -151,7 +164,11 @@ public class PerformanceAnalysisManager implements Listener {
 			p.hideBossBar(bar);
 		barPlayers.remove(p);
 	}
-	
+
+	/**
+	 * Show an additional boss bar to the players currently seeing the performance ones.
+	 * @param bar the new bar to show.
+	 */
 	public synchronized void addBossBar(BossBar bar) {
 		if (relatedBossBars.contains(bar))
 			return;
@@ -159,7 +176,11 @@ public class PerformanceAnalysisManager implements Listener {
 		for (Player p : barPlayers)
 			p.showBossBar(bar);
 	}
-	
+
+	/**
+	 * Hides an additional boss bar from the players currently seeing the performance ones.
+	 * @param bar the additional bar to hide.
+	 */
 	public synchronized void removeBossBar(BossBar bar) {
 		if (!relatedBossBars.contains(bar))
 			return;
@@ -167,8 +188,11 @@ public class PerformanceAnalysisManager implements Listener {
 		for (Player p : barPlayers)
 			p.hideBossBar(bar);
 	}
-	
-	public synchronized void cancelInternalBossBar() {
+
+	/**
+	 * De-initialize the performance analyzer.
+	 */
+	public synchronized void deinit() {
 		tpsBar.cancel();
 		memoryBar.cancel();
 	}
@@ -178,7 +202,7 @@ public class PerformanceAnalysisManager implements Listener {
 	
 	
 	@EventHandler
-	public synchronized void onTickStart(ServerTickStartEvent event) {
+	synchronized void onTickStart(ServerTickStartEvent event) {
 		tickStartNanoTime = System.nanoTime();
 		tickStartCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
 		
@@ -186,7 +210,7 @@ public class PerformanceAnalysisManager implements Listener {
 	}
 	
 	@EventHandler
-	public synchronized void onTickEnd(ServerTickEndEvent event) {
+	synchronized void onTickEnd(ServerTickEndEvent event) {
 		tickEndNanoTime = System.nanoTime();
 		long tickEndCPUTime = threadMXBean.isThreadCpuTimeSupported() ? threadMXBean.getCurrentThreadCpuTime() : 0;
 		
@@ -213,7 +237,7 @@ public class PerformanceAnalysisManager implements Listener {
 
 	
 	@EventHandler
-	public void onPlayerJoin(PlayerJoinEvent event) {
+	void onPlayerJoin(PlayerJoinEvent event) {
 		plugin.getServer().getScheduler().runTaskAsynchronously(plugin, () -> {
 			@SuppressWarnings("unchecked")
 			AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer> playerManager = (AbstractPlayerManager<PaperOnlinePlayer, PaperOffPlayer>) AbstractPlayerManager.getInstance();
@@ -233,7 +257,7 @@ public class PerformanceAnalysisManager implements Listener {
 
 
 	@EventHandler
-	public void onPlayerQuit(PlayerQuitEvent event) {
+	void onPlayerQuit(PlayerQuitEvent event) {
 		removePlayerToBars(event.getPlayer());
 	}
 
@@ -295,22 +319,25 @@ public class PerformanceAnalysisManager implements Listener {
 					
 					
 					int[] tpsHistory = getTPSHistory();
-					
-					// keep the legacy text when generating the bar to save space when converting to component
-					StringBuilder s = new StringBuilder();
-					TextColor prevC = null;
+
+					List<Pair<TextColor, AtomicInteger>> barComponents = new ArrayList<>(60);
 					for (int i = 58; i >= 0; i--) {
 						int t = tpsHistory[i];
 						TextColor newC = tps1sGradient.pickColorAt(t);
-						if (!newC.equals(prevC)) {
-							s.append(text("|").color(newC).getLegacyText());
-							prevC = newC;
+						if (barComponents.isEmpty() || !newC.equals(barComponents.get(barComponents.size() - 1).getKey())) {
+							barComponents.add(Pair.of(newC, new AtomicInteger(1)));
 						}
 						else {
-							s.append("|");
+							barComponents.get(barComponents.size() - 1).getValue().incrementAndGet();
 						}
 					}
-					
+					Chat history = chat();
+					barComponents.forEach(p -> {
+						history.then(text("|".repeat(p.getValue().get()))
+								.color(p.getKey())
+						);
+					});
+
 					
 					
 					// tick time measurement
@@ -333,7 +360,7 @@ public class PerformanceAnalysisManager implements Listener {
 								: (avgTickCPUTime1s < 50) ? NamedTextColor.RED
 								: NamedTextColor.DARK_RED;
 						
-						float avgTickWaitingTime1s = avgTickDuration1s - avgTickCPUTime1s;
+						float avgTickWaitingTime1s = Math.max(0, avgTickDuration1s - avgTickCPUTime1s);
 						TextColor avgTickWaitingTime1sColor = (avgTickDuration1s < 46 || avgTickWaitingTime1s < 20) ? PandaTheme.CHAT_GREEN_1_NORMAL
 								: (avgTickWaitingTime1s < 30) ? NamedTextColor.YELLOW
 								: (avgTickWaitingTime1s < 40) ? NamedTextColor.GOLD
@@ -349,16 +376,16 @@ public class PerformanceAnalysisManager implements Listener {
 								: NamedTextColor.RED;
 						
 						timings = text("(R/W/S:")
-								.then(text(Math.round(avgTickCPUTime1s)).color(avgTickCPUTime1sColor))
+								.then(text("%02d".formatted(Math.round(avgTickCPUTime1s))).color(avgTickCPUTime1sColor))
 								.thenText("/")
-								.then(text(Math.round(avgTickWaitingTime1s)).color(avgTickWaitingTime1sColor))
+								.then(text("%02d".formatted(Math.round(avgTickWaitingTime1s))).color(avgTickWaitingTime1sColor))
 								.thenText("/")
-								.then(text(Math.round(avgInterTickDuration1s)).color(avgInterTickDuration1sColor))
+								.then(text("%02d".formatted(Math.round(avgInterTickDuration1s))).color(avgInterTickDuration1sColor))
 								.thenText("ms)");
 					}
 					
 					title = infoText("TPS [")
-							.thenLegacyText(s.toString())
+							.then(history)
 							.thenText("] ")
 							.then(text(tps1sDisplay + "/" + getTargetTickRate() + " ").color(tps1sGradient.pickColorAt(tps1s)))
 							.then(timings);
@@ -375,28 +402,34 @@ public class PerformanceAnalysisManager implements Listener {
 	}
 	
 	private Chat alteredTPSTitle = null;
-	
+
+	/**
+	 * Temporary change the title of the TPS boss bar.
+	 * @param title the title override. null to restore to the normal TPS title.
+	 */
 	public synchronized void setAlteredTPSTitle(Chat title) {
 		alteredTPSTitle = title;
 	}
-	
-	
-	
-	
-	
-	
-	
-	// special case where the getTPS method always returns a whole number when retrieving the TPS for 1 sec
+
+
+
+
+
+
+
+	/**
+	 * Gets the number of tick in the last second.
+	 * @return the number of tick in the last second.
+	 */
 	public int getTPS1s() {
 		return (int) getTPS(1_000);
 	}
 
 	/**
-	 * 
 	 * @param nbTicks number of ticks when the avg value is computed from history
 	 * @return the avg number of TPS in the interval
 	 */
-	public synchronized float getAvgNano(List<Long> data, int nbTicks) {
+	private synchronized float getAvgNano(List<Long> data, int nbTicks) {
 		if (data.isEmpty())
 			return 0;
 
@@ -410,7 +443,7 @@ public class PerformanceAnalysisManager implements Listener {
 	}
 
 	/**
-	 * 
+	 * Gets the average number of tick per second in the n last milliseconds.
 	 * @param nbMillis number of milliseconds when the avg TPS is computed from history
 	 * @return the avg number of TPS in the interval
 	 */
@@ -429,8 +462,12 @@ public class PerformanceAnalysisManager implements Listener {
 
 		return count * (1000 / (float) nbMillis);
 	}
-	
-	
+
+
+	/**
+	 * Gets the history of TPS performance.
+	 * @return an array of TPS values from the last minute. The value at 0 is in the last second (current second on the clock - 1), the value at index 1 is now - 2, ...
+	 */
 	public synchronized int[] getTPSHistory() {
 		int[] history = new int[60];
 
@@ -448,15 +485,22 @@ public class PerformanceAnalysisManager implements Listener {
 	}
 
 
-
+	/**
+	 * Gets the current server's target tick rate.
+	 * Usually 20 but the server can be configured to tick at a different rate.
+	 * @return the current server's target tick rate.
+	 */
 	public static int getTargetTickRate() {
 		return Math.round(Bukkit.getServerTickManager().getTickRate());
 	}
-	
-	
-	
-	
-	
+
+
+	/**
+	 * Runs the garbage collector on the server.
+	 * Depending on the server load and the used memory, this can freeze the server for a second.
+	 * @param sender the command sender that triggers the garbage collector. Can be null (the report will be sent to the
+	 *               console)
+	 */
 	public static void gc(CommandSender sender) {
 		long t1 = System.currentTimeMillis();
 		long alloc1 = Runtime.getRuntime().totalMemory();
@@ -478,7 +522,7 @@ public class PerformanceAnalysisManager implements Listener {
 			Log.info(finalMessage.getLegacyText());
 	}
 
-	public static String displayRound10(double val) {
+	private static String displayRound10(double val) {
 		long v = (long) Math.ceil(val * 10);
 		return "" + (v / 10f);
 	}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/players/PaperOffPlayer.java

@@ -1,11 +1,11 @@
 package fr.pandacube.lib.paper.players;
 
-import fr.pandacube.lib.paper.reflect.util.PrimaryWorlds;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
+import fr.pandacube.lib.paper.world.PrimaryWorlds;
 import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.NbtIo;
-import fr.pandacube.lib.paper.util.PlayerDataWrapper;
-import fr.pandacube.lib.paper.util.PlayerDataWrapper.PlayerDataLoadException;
+import fr.pandacube.lib.paper.players.PlayerDataWrapper.PlayerDataLoadException;
 import fr.pandacube.lib.paper.world.WorldUtil;
 import fr.pandacube.lib.players.standalone.AbstractOffPlayer;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
@@ -116,26 +116,31 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
      * Player config
      */
 
+    @SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
     @Override
     default String getConfig(String key) throws Exception {
         return PaperPlayerConfigStorage.get(getUniqueId(), key);
     }
 
+    @SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
     @Override
     default String getConfig(String key, String deflt) throws Exception {
         return PaperPlayerConfigStorage.get(getUniqueId(), key, deflt);
     }
 
+    @SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
     @Override
     default void setConfig(String key, String value) throws Exception {
         PaperPlayerConfigStorage.set(getUniqueId(), key, value);
     }
 
+    @SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
     @Override
     default void updateConfig(String key, String deflt, UnaryOperator<String> updater) throws Exception {
         PaperPlayerConfigStorage.update(getUniqueId(), key, deflt, updater);
     }
 
+    @SuppressWarnings("RedundantThrows") // may be thrown by concrete implementation
     @Override
     default void unsetConfig(String key) throws Exception {
         PaperPlayerConfigStorage.unset(getUniqueId(), key);
@@ -162,7 +167,7 @@ public interface PaperOffPlayer extends AbstractOffPlayer {
                     .getServer()
                     .getPlayerList()
                     .playerIo()
-                    .load(getName(), getUniqueId().toString()).orElse(null);
+                    .load(getName(), getUniqueId().toString(), ProblemReporter.DISCARDING()).orElse(null);
         } catch (Exception|LinkageError e) {
             throw new PlayerDataLoadException(getName(), getUniqueId(), e);
         }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/players/PaperOnlinePlayer.java

@@ -3,7 +3,7 @@ package fr.pandacube.lib.paper.players;
 import com.destroystokyo.paper.ClientOption;
 import com.destroystokyo.paper.ClientOption.ChatVisibility;
 import com.destroystokyo.paper.SkinParts;
-import fr.pandacube.lib.paper.players.PlayerNonPersistentConfig.Expiration;
+import fr.pandacube.lib.paper.players.PlayerNonPersistentConfig.ExpirationPolicy;
 import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftPlayer;
 import fr.pandacube.lib.players.standalone.AbstractOnlinePlayer;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
@@ -170,7 +170,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
         @Override
         public boolean isChatFullyVisible() {
             ChatVisibility v = getChatVisibility();
-            return v == ChatVisibility.FULL || v == ChatVisibility.UNKNOWN;
+            return v == ChatVisibility.FULL;
         }
 
         @Override
@@ -283,7 +283,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
      * @param relZ the relative z coordinate.
      */
     default void teleportRelatively(float relX, float relY, float relZ) {
-        getBukkitPlayer().teleport(getBukkitPlayer().getLocation().add(relX, relY, relZ), Relative.X, Relative.Y, Relative.Z, Relative.YAW, Relative.PITCH);
+        getBukkitPlayer().teleport(getBukkitPlayer().getLocation().add(relX, relY, relZ), Relative.VELOCITY_X, Relative.VELOCITY_Y, Relative.VELOCITY_Z, Relative.VELOCITY_ROTATION);
     }
 
     /**
@@ -291,7 +291,7 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
      * @param destination the destination.
      */
     default void teleportRelatively(Location destination) {
-        getBukkitPlayer().teleport(destination, Relative.X, Relative.Y, Relative.Z, Relative.YAW, Relative.PITCH);
+        getBukkitPlayer().teleport(destination, Relative.VELOCITY_X, Relative.VELOCITY_Y, Relative.VELOCITY_Z, Relative.VELOCITY_ROTATION);
     }
 
 
@@ -304,18 +304,39 @@ public interface PaperOnlinePlayer extends PaperOffPlayer, AbstractOnlinePlayer
      * Player config
      */
 
+    /**
+     * Gets the non-persistent value of the provided configuration key of this player.
+     * @param key the configuration key.
+     * @return the value of the configuration, or null if the configuration is not set.
+     */
     default String getNonPersistentConfig(String key) {
         return PlayerNonPersistentConfig.getData(getUniqueId(), key);
     }
 
+    /**
+     * Gets the non-persistent value of the provided configuration key of this player.
+     * @param key the configuration key.
+     * @param deflt the default value if the configuration is not set.
+     * @return the value of the configuration, or {@code deflt} if the configuration is not set.
+     */
     default String getNonPersistentConfig(String key, String deflt) {
         return PlayerNonPersistentConfig.getData(getUniqueId(), key);
     }
 
-    default void setNonPersistentConfig(String key, String value, Expiration expiration) {
-        PlayerNonPersistentConfig.setData(getUniqueId(), key, value, expiration);
+    /**
+     * Sets the non-persistent value of the provided configuration key for this player.
+     * @param key the configuration key to set.
+     * @param value the new value.
+     * @param expirationPolicy the expiration policy.
+     */
+    default void setNonPersistentConfig(String key, String value, ExpirationPolicy expirationPolicy) {
+        PlayerNonPersistentConfig.setData(getUniqueId(), key, value, expirationPolicy);
     }
 
+    /**
+     * Unsets the non-persistent value of the provided configuration key for this player.
+     * @param key the configuration key to update.
+     */
     default void unsetNonPersistentConfig(String key) {
         PlayerNonPersistentConfig.unsetData(getUniqueId(), key);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/players/PaperPlayerConfigStorage.java

@@ -16,6 +16,10 @@ import java.util.UUID;
 import java.util.function.UnaryOperator;
 import java.util.stream.Collectors;
 
+/**
+ * Provides rudimentary player data storage using a file in the plugin configuration.
+ * The file is loaded on the first access, and is auto-saved if needed every 30 seconds.
+ */
 public class PaperPlayerConfigStorage {
 
     static final File storageFile = new File(PandaLibPaper.getPlugin().getDataFolder(), "playerdata.yml");
@@ -77,6 +81,8 @@ public class PaperPlayerConfigStorage {
 
 
     private static synchronized void save() {
+        if (!changed)
+            return;
         YamlConfiguration config = new YamlConfiguration();
         for (UUID pId : playerSortedData.keySet()) {
             String pIdStr = pId.toString();
@@ -109,11 +115,17 @@ public class PaperPlayerConfigStorage {
     }
 
 
-    public static synchronized void set(UUID player, String key, String newValue) {
+    /**
+     * Sets the value of the provided configuration key for the player.
+     * @param player the player.
+     * @param key the configuration key to set.
+     * @param value the new value.
+     */
+    public static synchronized void set(UUID player, String key, String value) {
         initIfNeeded();
         ConfigKey cKey = new ConfigKey(player, key);
         ConfigEntry e = data.get(cKey);
-        if (e != null && newValue == null) { // delete
+        if (e != null && value == null) { // delete
             data.remove(cKey);
             if (playerSortedData.containsKey(player))
                 playerSortedData.get(player).remove(e);
@@ -121,50 +133,91 @@ public class PaperPlayerConfigStorage {
                 keySortedData.get(key).remove(e);
             changed = true;
         }
-        else if (e == null && newValue != null) { // create
-            create(player, key, newValue);
+        else if (e == null && value != null) { // create
+            create(player, key, value);
             changed = true;
         }
-        else if (e != null && !newValue.equals(e.value)) { // update
-            e.value = newValue;
+        else if (e != null && !value.equals(e.value)) { // update
+            e.value = value;
             changed = true;
         }
     }
 
+    /**
+     * Gets the value of the provided configuration key of the player.
+     * @param player the player.
+     * @param key the configuration key.
+     * @return the value of the configuration, or null if the configuration is not set.
+     */
     public static synchronized String get(UUID player, String key) {
         initIfNeeded();
         ConfigEntry e = data.get(new ConfigKey(player, key));
         return e != null ? e.value : null;
     }
 
-    public static String get(UUID p, String k, String deflt) {
-        String value = get(p, k);
+    /**
+     * Gets the value of the provided configuration key of the player.
+     * @param player the player.
+     * @param key the configuration key.
+     * @param deflt the default value if the configuration is not set.
+     * @return the value of the configuration, or {@code deflt} if the configuration is not set.
+     */
+    public static String get(UUID player, String key, String deflt) {
+        String value = get(player, key);
         return value == null ? deflt : value;
     }
 
-    public static synchronized void update(UUID p, String k, String deflt, UnaryOperator<String> updater) {
-        String oldValue = get(p, k, deflt);
-        set(p, k, updater.apply(oldValue));
+    /**
+     * Updates the value of the provided configuration key for the player, using the provided updater.
+     * @param player the player.
+     * @param key the configuration key to update.
+     * @param deflt the default value to use if the configuration is not already set.
+     * @param updater the unary operator to use to update th value. The old value is used as the parameter of the updater,
+     *                and it returns the new value of the configuration.
+     */
+    public static synchronized void update(UUID player, String key, String deflt, UnaryOperator<String> updater) {
+        String oldValue = get(player, key, deflt);
+        set(player, key, updater.apply(oldValue));
     }
 
-    public static void unset(UUID p, String k) {
-        set(p, k, null);
+    /**
+     * Unsets the value of the provided configuration key for the player.
+     * @param player the player.
+     * @param key the configuration key to update.
+     */
+    public static void unset(UUID player, String key) {
+        set(player, key, null);
     }
 
-
-    public static LinkedHashSet<ConfigEntry> getAllFromPlayer(UUID p) {
+    /**
+     * Gets all the config key-value pairs of the provided player.
+     * @param player the player.
+     * @return all the config key-value pairs of the provided player.
+     */
+    public static LinkedHashSet<ConfigEntry> getAllFromPlayer(UUID player) {
         initIfNeeded();
-        return new LinkedHashSet<>(playerSortedData.getOrDefault(p, new LinkedHashSet<>()));
+        return new LinkedHashSet<>(playerSortedData.getOrDefault(player, new LinkedHashSet<>()));
     }
 
+    /**
+     * Gets all the config key-value pairs of all players that have the provided key.
+     * @param key the key.
+     * @return all the config key-value pairs of all players that have the provided key.
+     */
     public static LinkedHashSet<ConfigEntry> getAllWithKeys(String key) {
         initIfNeeded();
         return new LinkedHashSet<>(keySortedData.getOrDefault(key, new LinkedHashSet<>()));
     }
 
-    public static LinkedHashSet<ConfigEntry> getAllWithKeyValue(String k, String v) {
+    /**
+     * Gets all the config key-value pairs of all players that have the provided key AND value.
+     * @param key the key.
+     * @param v the value.
+     * @return all the config key-value pairs of all players that have the provided key AND value.
+     */
+    public static LinkedHashSet<ConfigEntry> getAllWithKeyValue(String key, String v) {
         initIfNeeded();
-        return getAllWithKeys(k).stream()
+        return getAllWithKeys(key).stream()
                 .filter(c -> c.value.equals(v))
                 .collect(Collectors.toCollection(LinkedHashSet::new));
     }
@@ -173,25 +226,46 @@ public class PaperPlayerConfigStorage {
 
     private record ConfigKey(UUID playerId, String key) { }
 
+    /**
+     * Class holding the playerId-key-value triplet.
+     */
     public static class ConfigEntry {
         private final UUID playerId;
         private final String key;
         private String value;
 
+        /**
+         * Creates a new {@link ConfigEntry}.
+         * @param playerId the player id.
+         * @param key the key.
+         * @param value the value.
+         */
         private ConfigEntry(UUID playerId, String key, String value) {
             this.playerId = playerId;
             this.key = key;
             this.value = value;
         }
 
+        /**
+         * Gets the player id.
+         * @return the player id.
+         */
         public UUID getPlayerId() {
             return playerId;
         }
 
+        /**
+         * Gets the config key.
+         * @return the config key.
+         */
         public String getKey() {
             return key;
         }
 
+        /**
+         * Gets the config value.
+         * @return the config value.
+         */
         public String getValue() {
             return value;
         }
@@ -208,4 +282,7 @@ public class PaperPlayerConfigStorage {
                     && Objects.equals(key, o.key);
         }
     }
+
+
+    private PaperPlayerConfigStorage() {}
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/players/PlayerDataWrapper.java

@@ -0,0 +1,237 @@
+package fr.pandacube.lib.paper.players;
+
+import fr.pandacube.lib.paper.inventory.DummyPlayerInventory;
+import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftItemStack;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
+import fr.pandacube.lib.paper.util.ExperienceUtil;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import org.bukkit.Bukkit;
+import org.bukkit.event.inventory.InventoryType;
+import org.bukkit.inventory.Inventory;
+import org.bukkit.inventory.ItemStack;
+import org.bukkit.inventory.PlayerInventory;
+
+import java.util.Map;
+import java.util.Map.Entry;
+import java.util.Optional;
+import java.util.TreeMap;
+import java.util.UUID;
+import java.util.function.IntUnaryOperator;
+
+/**
+ * A wrapper to easily manipulate the player data file.
+ *
+ * @param data The NBT data structure as it is stored in the player file.
+ */
+public record PlayerDataWrapper(CompoundTag data) {
+
+    /**
+     * Creates a new wrapper for the provided player data.
+     * @param data the NBT data to wrap.
+     */
+    public PlayerDataWrapper(CompoundTag data) {
+        this.data = data == null ? new CompoundTag() : data;
+    }
+
+    /**
+     * Gets a snapshot of the inventory of this player.
+     * If the inventory is modified, the {@link #setInventory(PlayerInventory)} method should be called to update the
+     * data in this wrapper.
+     * @return the player inventory.
+     */
+    public PlayerInventory getInventory() {
+        return new DummyPlayerInventory(
+                getBukkitInventory("Inventory", InventoryType.PLAYER, this::fromNBTtoBukkitInventorySlot),
+                getHeldItemSlot());
+    }
+
+    private int fromNBTtoBukkitInventorySlot(int nbtSlot) {
+        // cat   nbEl    NBTSlot      bukkitSlot  NBT->Bukkit
+        // items   36                    0-35     ==
+        // armor    4  starts at 100    36-39     -100 + 36
+        // offhand  1  starts at 150      40      -150 + 40
+        if (nbtSlot >= 0 && nbtSlot < 36) { // regular inventory slots
+            return nbtSlot;
+        }
+        if (nbtSlot >= 100 && nbtSlot < 104) { // armor slots
+            return nbtSlot - 100 + 36;
+        }
+        if (nbtSlot == 150) { // second hand
+            return 40;
+        }
+        throw new IllegalArgumentException("Unrecognized NBT player inventory slot " + nbtSlot);
+    }
+
+    /**
+     * Sets the player inventory to the content of the provided one.
+     * The internal data of this wrapper will be updated.
+     * @param inv the inventory to store in this player data in place of the old one.
+     */
+    public void setInventory(PlayerInventory inv) {
+        setBukkitInventory("Inventory", inv, this::fromBukkitToNBTInventorySlot);
+        setHeldItemSlot(inv.getHeldItemSlot());
+    }
+
+    private int fromBukkitToNBTInventorySlot(int bukkitSlot) {
+        if (bukkitSlot >= 0 && bukkitSlot < 36) { // regular inventory slots
+            return bukkitSlot;
+        }
+        if (bukkitSlot >= 36 && bukkitSlot < 40) { // armor slots
+            return bukkitSlot + 100 - 36;
+        }
+        if (bukkitSlot == 40) { // second hand
+            return 150;
+        }
+        throw new IllegalArgumentException("Unrecognized Bukkit player inventory slot " + bukkitSlot);
+    }
+
+
+    /**
+     * Gets a snapshot of the enderchest of this player.
+     * If the enderchest is modified, the {@link #setEnderChest(Inventory)} method should be called to update the
+     * data in this wrapper.
+     * @return the player enderchest.
+     */
+    public Inventory getEnderChest() {
+        return getBukkitInventory("EnderItems", InventoryType.ENDER_CHEST, IntUnaryOperator.identity());
+    }
+
+    /**
+     * Sets the player enderchest to the content of the provided one.
+     * The internal data of this wrapper will be updated.
+     * @param inv the enderchest content to store in this player data in place of the old enderchest.
+     */
+    public void setEnderChest(Inventory inv) {
+        setBukkitInventory("EnderItems", inv, IntUnaryOperator.identity());
+    }
+
+
+    private Inventory getBukkitInventory(String nbtKey, InventoryType bukkitType, IntUnaryOperator nbtToBukkitSlotConverter) {
+        Map<Integer, ItemStack> stacks = getRawInventoryContent(nbtKey);
+        Inventory inv = Bukkit.createInventory(null, bukkitType);
+        if (stacks.isEmpty())
+            return inv;
+        for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
+            inv.setItem(nbtToBukkitSlotConverter.applyAsInt(is.getKey()), is.getValue());
+        }
+        return inv;
+    }
+
+    private Map<Integer, ItemStack> getRawInventoryContent(String key) {
+
+        ValueInput vi = TagValueInput.createGlobal(ProblemReporter.DISCARDING(), data);
+        Iterable<?> listNMSItemStackWithSlot = ReflectWrapper.unwrap(vi.listOrEmpty(key, ItemStackWithSlot.CODEC()));
+
+        Map<Integer, ItemStack> stacks = new TreeMap<>();
+
+        for (Object nmsISWS : listNMSItemStackWithSlot) {
+            ItemStackWithSlot isws = ReflectWrapper.wrap(nmsISWS, ItemStackWithSlot.class);
+
+            int nbtSlot = isws.slot() & 255;
+            Optional.of(isws.stack())
+                    .map(nms -> filterStack(CraftItemStack.asCraftMirror(nms)))
+                    .ifPresent(is -> stacks.put(nbtSlot, is));
+        }
+        return stacks;
+    }
+
+
+    private void setBukkitInventory(String nbtKey, Inventory inv, IntUnaryOperator bukkitToNBTSlotConverter) {
+        Map<Integer, ItemStack> stacks = new TreeMap<>();
+        if (inv == null) {
+            setRawInventoryContent(nbtKey, stacks);
+            return;
+        }
+        for (int bukkitSlot = 0; bukkitSlot < inv.getSize(); bukkitSlot++) {
+            ItemStack is = filterStack(inv.getItem(bukkitSlot));
+            if (is == null)
+                continue;
+            int nbtSlot = bukkitToNBTSlotConverter.applyAsInt(bukkitSlot);
+            stacks.put(nbtSlot, is);
+        }
+        setRawInventoryContent(nbtKey, stacks);
+    }
+
+    private void setRawInventoryContent(String key, Map<Integer, ItemStack> stacks) {
+
+        TagValueOutput vo = TagValueOutput.createWrappingGlobal(ProblemReporter.DISCARDING(), data);
+        ValueOutputTypedOutputList listNMSItemStackWithSlot = vo.list(key, ItemStackWithSlot.CODEC());
+
+        for (Entry<Integer, ItemStack> is : stacks.entrySet()) {
+            ItemStack stack = filterStack(is.getValue());
+            if (stack == null)
+                continue;
+
+            listNMSItemStackWithSlot.add(ReflectWrapper.unwrap(new ItemStackWithSlot(is.getKey(), CraftItemStack.asNMSCopy(is.getValue()))));
+        }
+    }
+
+
+    private ItemStack filterStack(ItemStack is) {
+        return is == null || is.isEmpty() || is.getAmount() <= 0 ? null : is;
+    }
+
+
+    private int getHeldItemSlot() {
+        return data.getInt("SelectedItemSlot").orElse(0);
+    }
+
+    private void setHeldItemSlot(int slot) {
+        data.putInt("SelectedItemSlot", slot);
+    }
+
+
+    /**
+     * Gets the score of the player, as stored in the data with the key {@code Score}.
+     * @return the value of Score.
+     */
+    public int getScore() {
+        return data.getInt("Score").orElse(0);
+
+    }
+
+    /**
+     * Sets the score of the player, as stored in the data with the key {@code Score}.
+     * @param score the value of Score to set.
+     */
+    public void setScore(int score) {
+        data.putInt("Score", score);
+    }
+
+
+    /**
+     * Gets the total experience of the player, as stored in the data with the key {@code XpTotal}.
+     * @return the value of XpTotal.
+     */
+    public int getTotalExperience() {
+        return data.getInt("XpTotal").orElse(0);
+    }
+
+    /**
+     * Sets the total experience of the player, as stored in the data with the key {@code XpTotal}.
+     * @param xp the value of XpTotal to set.
+     */
+    public void setTotalExperience(int xp) {
+        data.putInt("XpTotal", xp);
+        double levelAndExp = ExperienceUtil.getLevelFromExp(xp);
+        int level = (int) levelAndExp;
+        double expProgress = levelAndExp - level;
+        data.putInt("XpLevel", level);
+        data.putFloat("XpP", (float) expProgress);
+    }
+
+    /**
+     * Thrown to indicate that an error occurred while loading the data of the player from the file.
+     */
+    public static class PlayerDataLoadException extends RuntimeException {
+        /* package */ PlayerDataLoadException(String playerName,  UUID playerId, Throwable cause) {
+            super("Unable to load data of player " + playerName + " (" + playerId + ")", cause);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/players/PlayerNonPersistentConfig.java

@@ -12,6 +12,9 @@ import java.util.Map;
 import java.util.Objects;
 import java.util.UUID;
 
+/**
+ * Handles the player related configuration that is not persisted to disk.
+ */
 public class PlayerNonPersistentConfig {
     private static final Map<UUID, Map<String, ConfigEntry>> data = new HashMap<>();
 
@@ -22,34 +25,58 @@ public class PlayerNonPersistentConfig {
     }
 
 
-    public static void setData(UUID playerId, String key, String value, Expiration expiration) {
-        data.computeIfAbsent(Objects.requireNonNull(playerId, "playerId"), pp -> new HashMap<>())
+    /**
+     * Sets the value of the provided configuration key for the player.
+     * @param player the player.
+     * @param key the configuration key to set.
+     * @param value the new value.
+     * @param expirationPolicy the expiration policy for this config. If the config key already exists for this player. the expiration will be overridden.
+     */
+    public static void setData(UUID player, String key, String value, ExpirationPolicy expirationPolicy) {
+        data.computeIfAbsent(Objects.requireNonNull(player, "playerId"), pp -> new HashMap<>())
                 .put(Objects.requireNonNull(key, "key"),
                         new ConfigEntry(Objects.requireNonNull(value, "value"),
-                                Objects.requireNonNull(expiration, "expiration")
+                                Objects.requireNonNull(expirationPolicy, "expiration")
                         )
                 );
     }
 
-    public static void unsetData(UUID playerId, String key) {
-        data.getOrDefault(Objects.requireNonNull(playerId, "playerId"), new HashMap<>())
+    /**
+     * Unsets the value of the provided configuration key for the player.
+     * @param player the player.
+     * @param key the configuration key to update.
+     */
+    public static void unsetData(UUID player, String key) {
+        data.getOrDefault(Objects.requireNonNull(player, "playerId"), new HashMap<>())
                 .remove(Objects.requireNonNull(key, "key"));
     }
 
-    public static String getData(UUID playerId, String key) {
-        Map<String, ConfigEntry> playerData = data.getOrDefault(Objects.requireNonNull(playerId, "playerId"), new HashMap<>());
+    /**
+     * Gets the value of the provided configuration key of the player.
+     * @param player the player.
+     * @param key the configuration key.
+     * @return the value of the configuration, or {@code deflt} if the configuration is not set.
+     */
+    public static String getData(UUID player, String key) {
+        Map<String, ConfigEntry> playerData = data.getOrDefault(Objects.requireNonNull(player, "playerId"), new HashMap<>());
         ConfigEntry ce = playerData.get(Objects.requireNonNull(key, "key"));
         if (ce == null)
             return null;
-        if (!ce.expiration.valid(playerId, key)) {
+        if (!ce.expirationPolicy.valid(player, key)) {
             playerData.remove(key);
             return null;
         }
         return ce.value;
     }
 
-    public static boolean isDataSet(UUID playerId, String key) {
-        return getData(playerId, key) != null;
+    /**
+     * Tells if the provided config key is set for the player.
+     * @param player the player.
+     * @param key the configuration key.
+     * @return true if the value is set, false otherwise.
+     */
+    public static boolean isDataSet(UUID player, String key) {
+        return getData(player, key) != null;
     }
 
 
@@ -63,34 +90,76 @@ public class PlayerNonPersistentConfig {
 
 
 
-    private record ConfigEntry(String value, Expiration expiration) { }
+    private record ConfigEntry(String value, ExpirationPolicy expirationPolicy) { }
 
 
+    /**
+     * Super class for all expiration policies.
+     */
+    public static abstract class ExpirationPolicy {
+        /**
+         * Creates an expiration policy.
+         */
+        public ExpirationPolicy() {}
 
-
-    public static abstract class Expiration {
+        /**
+         * Tests if the associated configuration is still valid (not expired).
+         * @param player the player.
+         * @param key the configuration key.
+         * @return true if the associated configuration is still valid, false otherwise.
+         */
         abstract boolean valid(UUID player, String key);
     }
 
-    public static class ExpiresLogout extends Expiration {
+    /**
+     * Expiration policy for a config that expires when the player logs out.
+     */
+    public static class ExpiresLogout extends ExpirationPolicy {
+        /**
+         * Creates a logout expiration policy.
+         */
+        public ExpiresLogout() {
+            super();
+        }
+
+        @Override
         protected boolean valid(UUID player, String key) {
             return Bukkit.getPlayer(player) != null; // should not be call if player reconnects because it is removed on player quit
         }
     }
 
-    public static class ExpiresTick extends Expiration {
+    /**
+     * Expiration policy for a config that expires after a certain amount of game tick.
+     */
+    public static class ExpiresTick extends ExpirationPolicy {
         final long expirationTick;
 
+        /**
+         * Creates a delay expiration policy.
+         * @param expirationDelayTick the number of tick after which the config will expire. If 0, will expire immediately ; 1 to expire on the next tick.
+         */
         public ExpiresTick(long expirationDelayTick) {
             expirationTick = tick + expirationDelayTick;
         }
 
+        @Override
         protected boolean valid(UUID player, String key) {
             return tick < expirationTick;
         }
     }
 
-    public static class ExpiresServerStop extends Expiration {
+    /**
+     * Expiration policy for a config that expires when the server stops.
+     */
+    public static class ExpiresServerStop extends ExpirationPolicy {
+        /**
+         * Creates a server stop expiration policy.
+         */
+        public ExpiresServerStop() {
+            super();
+        }
+
+        @Override
         protected boolean valid(UUID player, String key) {
             return true;
         }
@@ -103,7 +172,7 @@ public class PlayerNonPersistentConfig {
 
 
     private static class ConfigListeners implements Listener {
-        public ConfigListeners() {
+        private ConfigListeners() {
             Bukkit.getPluginManager().registerEvents(this, PandaLibPaper.getPlugin());
         }
 
@@ -111,7 +180,7 @@ public class PlayerNonPersistentConfig {
         public void onPlayerQuit(PlayerQuitEvent event) {
             data.getOrDefault(event.getPlayer().getUniqueId(), new HashMap<>())
                     .entrySet()
-                    .removeIf(e -> e.getValue().expiration instanceof ExpiresLogout);
+                    .removeIf(e -> e.getValue().expirationPolicy instanceof ExpiresLogout);
         }
 
         @EventHandler
@@ -119,4 +188,9 @@ public class PlayerNonPersistentConfig {
             tick++;
         }
     }
+
+
+
+
+    private PlayerNonPersistentConfig() {}
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/OBCReflect.java

@@ -23,4 +23,6 @@ public class OBCReflect {
 		return Reflect.ofClass(CRAFTBUKKIT_PACKAGE + "." + obcClass);
 	}
 
+	private OBCReflect() { }
+
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/PandalibPaperReflect.java

@@ -14,9 +14,7 @@ import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.VanillaCommandWrapper;
 import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataConverter;
 import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCDataType;
 import fr.pandacube.lib.paper.reflect.wrapper.dataconverter.MCTypeRegistry;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.DetectedVersion;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.SharedConstants;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.WorldVersion;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.CommandSourceStack;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Commands;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.commands.Coordinates;
@@ -54,17 +52,25 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerGamePacketL
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerPlayer;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.Settings;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.AABB;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkPos;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ChunkStorage;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Entity;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStack;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ItemStackWithSlot;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Level;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.MapItemSavedData;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.PlayerDataStorage;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.RegionFileStorage;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.SavedData;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.TagValueOutput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueInputTypedInputList;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutput;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.ValueOutputTypedOutputList;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.VoxelShape;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.BambooStalkBlock;
@@ -72,13 +78,13 @@ import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.block.Block;
 import fr.pandacube.lib.paper.reflect.wrapper.netty.ByteBuf;
 import fr.pandacube.lib.paper.reflect.wrapper.netty.Unpooled;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.PaperAdventure;
-import fr.pandacube.lib.paper.reflect.wrapper.paper.QueuedChangesMapLong2Object;
+import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.BukkitCommandNode;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PaperBrigadier;
-import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.PluginCommandNode;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.ShadowBrigNode;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.FallbackValue_Int;
 import fr.pandacube.lib.paper.reflect.wrapper.paper.configuration.WorldConfiguration;
+import fr.pandacube.lib.paper.reflect.wrapper.spottedleaf.moonrise.ChunkSystemChunkStorage;
 import fr.pandacube.lib.reflect.ReflectionWrapperBypass;
 import fr.pandacube.lib.util.ThrowableAccumulator;
 
@@ -179,6 +185,7 @@ public class PandalibPaperReflect {
         thAcc.catchThrowable(() -> initWrapper(ServerPlayer.class, ServerPlayer.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Settings.class, Settings.REFLECT.get()));
         // minecraft.util
+        thAcc.catchThrowable(() -> initWrapper(ProblemReporter.class, ProblemReporter.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ProgressListener.class, ProgressListener.REFLECT.get()));
         // minecraft.world.block
         thAcc.catchThrowable(() -> initWrapper(Block.class, Block.REFLECT.get()));
@@ -187,28 +194,33 @@ public class PandalibPaperReflect {
         thAcc.catchThrowable(() -> initWrapper(AABB.class, AABB.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ChunkPos.class, ChunkPos.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ChunkStorage.class, ChunkStorage.REFLECT.get()));
-        thAcc.catchThrowable(() -> initWrapper(DataVersion.class, DataVersion.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Entity.class, Entity.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ItemStack.class, ItemStack.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ItemStackWithSlot.class, ItemStackWithSlot.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Level.class, Level.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(MapItemSavedData.class, MapItemSavedData.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(PlayerDataStorage.class, PlayerDataStorage.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(RegionFileStorage.class, RegionFileStorage.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(SavedData.class, SavedData.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(TagValueInput.class, TagValueInput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(TagValueOutput.class, TagValueOutput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueInput.class, ValueInput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueInputTypedInputList.class, ValueInputTypedInputList.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueOutput.class, ValueOutput.REFLECT.get()));
+        thAcc.catchThrowable(() -> initWrapper(ValueOutputTypedOutputList.class, ValueOutputTypedOutputList.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Vec3.class, Vec3.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(VoxelShape.class, VoxelShape.REFLECT.get()));
         // minecraft
-        thAcc.catchThrowable(() -> initWrapper(DetectedVersion.class, DetectedVersion.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(SharedConstants.class, SharedConstants.REFLECT.get()));
-        thAcc.catchThrowable(() -> initWrapper(WorldVersion.class, WorldVersion.REFLECT.get()));
 
         // netty
         thAcc.catchThrowable(() -> initWrapper(ByteBuf.class, ByteBuf.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(Unpooled.class, Unpooled.REFLECT.get()));
 
         // paper.commands
+        thAcc.catchThrowable(() -> initWrapper(APICommandMeta.class, APICommandMeta.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(BukkitCommandNode.class, BukkitCommandNode.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(PaperBrigadier.class, PaperBrigadier.REFLECT.get()));
-        thAcc.catchThrowable(() -> initWrapper(PluginCommandNode.class, PluginCommandNode.REFLECT.get()));
         thAcc.catchThrowable(() -> initWrapper(ShadowBrigNode.class, ShadowBrigNode.REFLECT.get()));
         // paper.configuration
         thAcc.catchThrowable(() -> initWrapper(FallbackValue_Int.class, FallbackValue_Int.REFLECT.get()));
@@ -216,10 +228,14 @@ public class PandalibPaperReflect {
         thAcc.catchThrowable(() -> initWrapper(WorldConfiguration.Chunks.class, WorldConfiguration.Chunks.REFLECT.get()));
         // paper
         thAcc.catchThrowable(() -> initWrapper(PaperAdventure.class, PaperAdventure.REFLECT.get()));
-        thAcc.catchThrowable(() -> initWrapper(QueuedChangesMapLong2Object.class, QueuedChangesMapLong2Object.REFLECT.get()));
+
+        // spottedleaf
+        thAcc.catchThrowable(() -> initWrapper(ChunkSystemChunkStorage.class, ChunkSystemChunkStorage.REFLECT.get()));
 
 
         thAcc.throwCaught();
 
     }
+
+    private PandalibPaperReflect() {}
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/util/BedrockBambooCollisionFixer.java

@@ -12,15 +12,29 @@ import org.bukkit.event.Listener;
 import org.bukkit.event.block.BlockPlaceEvent;
 import org.bukkit.util.BoundingBox;
 
-// simplified version of https://github.com/Camotoy/BambooCollisionFix/tree/c7d7d5327791cbb416d106de0b9eb0bf2461acbd/src/main/java/net/camotoy/bamboocollisionfix
-// we remove the bamboo bounding box due to bedrock clients not having the same placement for bamboos
+// simplified version of
+
+/**
+ * Disables the server-side bounding box of the bamboo stalk blocks.
+ * Bamboo stalks are the thin bamboo plants that are shifted differently, depending on the X and Z coordinate.
+ * This X/Z dependent shift is different between Java and Bedrock implementation.
+ * But since this block as a collision box and players cannot go through them, Bedrock players are often rolled back
+ * when they are walking around bamboo stalk due to the server being in Java Edition and thinking the player tries to
+ * move through the bamboo.
+ * To avoid this issue, we reduce to 0 the size of the bounding box on the server.
+ * <br>
+ * See <a href="https://github.com/Camotoy/BambooCollisionFix/tree/c7d7d5327791cbb416d106de0b9eb0bf2461acbd/src/main/java/net/camotoy/bamboocollisionfix">the original implementation</a>.
+ */
 public final class BedrockBambooCollisionFixer implements Listener {
     private final BoundingBox originalBambooBoundingBox = new BoundingBox(6.5D / 16D, 0.0D, 6.5D / 16.0D, 9.5D / 16.0D, 1D, 9.5D / 16.0D);
 
+    /**
+     * Creates a new {@link BedrockBambooCollisionFixer}. There is no need for multiple instances.
+     */
     public BedrockBambooCollisionFixer() {
         // Make the bamboo block have zero collision.
         try {
-            BambooStalkBlock.COLLISION_SHAPE(Block.box(8, 0, 8, 8, 0, 8));
+            BambooStalkBlock.SHAPE_COLLISION(Block.box(8, 0, 8, 8, 0, 8));
             Log.info("Bamboo block collision box removed successfully.");
         } catch (Exception e) {
             Log.severe("Unable to remove the collision box of the Bamboo block.", e);
@@ -34,7 +48,7 @@ public final class BedrockBambooCollisionFixer implements Listener {
      * our ability.
      */
     @EventHandler
-    public void onBlockPlace(BlockPlaceEvent event) {
+    void onBlockPlace(BlockPlaceEvent event) {
         if (event.getBlockPlaced().getBlockData().getMaterial().equals(Material.BAMBOO)) {
             BoundingBox currentBambooBoundingBox = originalBambooBoundingBox.clone().shift(event.getBlockPlaced().getLocation());
             for (LivingEntity e : event.getBlock().getLocation().getNearbyLivingEntities(5)) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/util/WorldSaveUtil.java

@@ -1,21 +1,24 @@
 package fr.pandacube.lib.paper.reflect.util;
 
-import org.bukkit.Bukkit;
-import org.bukkit.World;
-
 import fr.pandacube.lib.chat.Chat;
 import fr.pandacube.lib.chat.ChatConfig.PandaTheme;
 import fr.pandacube.lib.paper.modules.PerformanceAnalysisManager;
 import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftWorld;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ChunkMap;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.server.ServerLevel;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProgressListener;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import org.bukkit.Bukkit;
+import org.bukkit.World;
 
+/**
+ * Provides static methods to save worlds presumably in a better way than Bukkit provides (better flushing, more released RAM).
+ */
 public class WorldSaveUtil {
-	
-	private static ChunkMap getChunkMap(World w) {
-		return ReflectWrapper.wrapTyped(w, CraftWorld.class).getHandle().getChunkSource().chunkMap;
-	}
-	
+
+	/**
+	 * Save the provided world using the NMS {@link ServerLevel#save(ProgressListener, boolean, boolean)} method.
+	 * @param w the world to save.
+	 */
 	public static void nmsSaveFlush(World w) {
 		PerformanceAnalysisManager.getInstance().setAlteredTPSTitle(
 				Chat.text("Sauvegarde map ").color(PandaTheme.CHAT_BROWN_2_SAT).thenData(w.getName()).thenText(" ...")
@@ -27,9 +30,14 @@ public class WorldSaveUtil {
 			PerformanceAnalysisManager.getInstance().setAlteredTPSTitle(null);
 		}
 	}
-	
+
+	/**
+	 * Save all the loaded worlds, using {@link #nmsSaveFlush(World)}.
+	 */
 	public static void nmsSaveAllFlush() {
 		Bukkit.getWorlds().forEach(WorldSaveUtil::nmsSaveFlush);
 	}
+
+	private WorldSaveUtil() {}
 	
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/brigadier/CommandNode.java

@@ -1,6 +1,8 @@
 package fr.pandacube.lib.paper.reflect.wrapper.brigadier;
 
+import fr.pandacube.lib.paper.reflect.wrapper.paper.commands.APICommandMeta;
 import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectField;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -11,11 +13,20 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class CommandNode<S> extends ReflectWrapperTyped<com.mojang.brigadier.tree.CommandNode<S>> {
     public static final ReflectClass<?> REFLECT = Reflect.ofClass(com.mojang.brigadier.tree.CommandNode.class);
     private static final ReflectMethod<?> removeCommand = wrapEx(() -> REFLECT.method("removeCommand", String.class));
+    private static final ReflectField<?> apiCommandMeta = wrapEx(() -> REFLECT.field("apiCommandMeta"));
 
     public void removeCommand(String cmd) {
         wrapReflectEx(() -> removeCommand.invoke(__getRuntimeInstance(), cmd));
     }
 
+    public APICommandMeta apiCommandMeta() {
+        return wrap(wrapReflectEx(() -> apiCommandMeta.getValue(__getRuntimeInstance())), APICommandMeta.class);
+    }
+
+    public void apiCommandMeta(APICommandMeta meta) {
+        wrapReflectEx(() -> apiCommandMeta.setValue(__getRuntimeInstance(), unwrap(meta)));
+    }
+
     protected CommandNode(Object obj) {
         super(obj);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/craftbukkit/CraftVector.java

@@ -1,12 +1,10 @@
 package fr.pandacube.lib.paper.reflect.wrapper.craftbukkit;
 
 import fr.pandacube.lib.paper.reflect.OBCReflect;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.BlockPos;
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.Vec3;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
-
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
 import fr.pandacube.lib.util.ThrowableUtil;
 import org.bukkit.util.Vector;
 
@@ -16,26 +14,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class CraftVector extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("util.CraftVector"));
     public static final ReflectMethod<?> toBukkit_Vec3 = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", Vec3.REFLECT.get()));
-    public static final ReflectMethod<?> toBukkit_BlockPos = ThrowableUtil.wrapEx(() -> REFLECT.method("toBukkit", BlockPos.REFLECT.get()));
-    public static final ReflectMethod<?> toNMS = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
-    public static final ReflectMethod<?> toBlockPos = wrapEx(() -> REFLECT.method("toNMS", Vector.class));
 
     public static Vector toBukkit(Vec3 nms) {
         return (Vector) wrapReflectEx(() -> toBukkit_Vec3.invokeStatic(unwrap(nms)));
     }
 
-    public static Vector toBukkit(BlockPos blockPos) {
-        return (Vector) wrapReflectEx(() -> toBukkit_BlockPos.invokeStatic(unwrap(blockPos)));
-    }
-
-    public static Vec3 toNMS(Vector bukkit) {
-        return wrap(wrapReflectEx(() -> toNMS.invokeStatic(bukkit)), Vec3.class);
-    }
-
-    public static BlockPos toBlockPos(Vector bukkit) {
-        return wrap(wrapReflectEx(() -> toBlockPos.invokeStatic(bukkit)), BlockPos.class);
-    }
-
 
     protected CraftVector(Object obj) {
         super(obj);

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/craftbukkit/VanillaCommandWrapper.java

@@ -17,13 +17,9 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class VanillaCommandWrapper extends ReflectWrapperTyped<BukkitCommand> {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> OBCReflect.ofClass("command.VanillaCommandWrapper"));
-    public static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(Commands.REFLECT.get(), CommandNode.class));
     public static final ReflectField<?> vanillaCommand = wrapEx(() -> REFLECT.field("vanillaCommand"));
     public static final ReflectMethod<?> getListener = wrapEx(() -> REFLECT.method("getListener", CommandSender.class));
 
-    public VanillaCommandWrapper(Commands dispatcher, CommandNode<CommandSourceStack> vanillaCommand) {
-        this(wrapReflectEx(() -> CONSTRUCTOR.instantiate(unwrap(dispatcher), vanillaCommand)));
-    }
 
     @SuppressWarnings("unchecked")
     public CommandNode<CommandSourceStack> vanillaCommand() {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/DetectedVersion.java

@@ -1,15 +0,0 @@
-package fr.pandacube.lib.paper.reflect.wrapper.minecraft;
-
-import fr.pandacube.lib.reflect.Reflect;
-import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-
-import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-
-public class DetectedVersion extends ReflectWrapper implements WorldVersion {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.DetectedVersion"));
-
-    protected DetectedVersion(Object obj) {
-        super(obj);
-    }
-}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/SharedConstants.java

@@ -10,15 +10,10 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class SharedConstants extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.SharedConstants"));
-    private static final ReflectMethod<?> getCurrentVersion = wrapEx(() -> REFLECT.method("getCurrentVersion"));
     private static final ReflectMethod<?> getProtocolVersion = wrapEx(() -> REFLECT.method("getProtocolVersion"));
 
 
 
-    public static WorldVersion getCurrentVersion() {
-        return wrap(wrapReflectEx(() -> getCurrentVersion.invokeStatic()), WorldVersion.class);
-    }
-
     public static int getProtocolVersion() {
         return (int) wrapReflectEx(() -> getProtocolVersion.invokeStatic());
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/commands/Coordinates.java

@@ -14,7 +14,7 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 @ConcreteWrapper(Coordinates.__concrete.class)
 public interface Coordinates extends ReflectWrapperI {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates"));
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.commands.arguments.coordinates.Coordinates"));
     ReflectMethod<?> getPosition = wrapEx(() -> REFLECT.method("getPosition", CommandSourceStack.REFLECT.get()));
 
     default Vec3 getPosition(io.papermc.paper.command.brigadier.CommandSourceStack source) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/nbt/CompoundTag.java

@@ -6,10 +6,9 @@ import fr.pandacube.lib.reflect.ReflectConstructor;
 import fr.pandacube.lib.reflect.ReflectMethod;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
 
-import java.util.List;
 import java.util.Map;
+import java.util.Optional;
 import java.util.Set;
-import java.util.UUID;
 
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
@@ -20,21 +19,16 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	private static final ReflectMethod<?> putBoolean = wrapEx(() -> REFLECT.method("putBoolean", String.class, boolean.class));
 	private static final ReflectMethod<?> putByte = wrapEx(() -> REFLECT.method("putByte", String.class, byte.class));
 	private static final ReflectMethod<?> putByteArray = wrapEx(() -> REFLECT.method("putByteArray", String.class, byte[].class));
-	private static final ReflectMethod<?> putByteArray_List = wrapEx(() -> REFLECT.method("putByteArray", String.class, List.class));
 	private static final ReflectMethod<?> putDouble = wrapEx(() -> REFLECT.method("putDouble", String.class, double.class));
 	private static final ReflectMethod<?> putFloat = wrapEx(() -> REFLECT.method("putFloat", String.class, float.class));
 	private static final ReflectMethod<?> putInt = wrapEx(() -> REFLECT.method("putInt", String.class, int.class));
 	private static final ReflectMethod<?> putIntArray = wrapEx(() -> REFLECT.method("putIntArray", String.class, int[].class));
-	private static final ReflectMethod<?> putIntArray_List = wrapEx(() -> REFLECT.method("putIntArray", String.class, List.class));
 	private static final ReflectMethod<?> putString = wrapEx(() -> REFLECT.method("putString", String.class, String.class));
-	private static final ReflectMethod<?> putUUID = wrapEx(() -> REFLECT.method("putUUID", String.class, UUID.class));
 	private static final ReflectMethod<?> putLong = wrapEx(() -> REFLECT.method("putLong", String.class, long.class));
 	private static final ReflectMethod<?> putLongArray = wrapEx(() -> REFLECT.method("putLongArray", String.class, long[].class));
-	private static final ReflectMethod<?> putLongArray_List = wrapEx(() -> REFLECT.method("putLongArray", String.class, List.class));
 	private static final ReflectMethod<?> putShort = wrapEx(() -> REFLECT.method("putShort", String.class, short.class));
 	private static final ReflectMethod<?> put = wrapEx(() -> REFLECT.method("put", String.class, Tag.REFLECT.get()));
 
-	private static final ReflectMethod<?> getTagType = wrapEx(() -> REFLECT.method("getTagType", String.class));
 	private static final ReflectMethod<?> getByte = wrapEx(() -> REFLECT.method("getByte", String.class));
 	private static final ReflectMethod<?> getShort = wrapEx(() -> REFLECT.method("getShort", String.class));
 	private static final ReflectMethod<?> getInt = wrapEx(() -> REFLECT.method("getInt", String.class));
@@ -47,14 +41,13 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	private static final ReflectMethod<?> getLongArray = wrapEx(() -> REFLECT.method("getLongArray", String.class));
 	private static final ReflectMethod<?> getCompound = wrapEx(() -> REFLECT.method("getCompound", String.class));
 	private static final ReflectMethod<?> getBoolean = wrapEx(() -> REFLECT.method("getBoolean", String.class));
-	private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class, int.class));
+	private static final ReflectMethod<?> getList = wrapEx(() -> REFLECT.method("getList", String.class));
 
 	private static final ReflectMethod<?> get = wrapEx(() -> REFLECT.method("get", String.class));
-	private static final ReflectMethod<?> getAllKeys = wrapEx(() -> REFLECT.method("getAllKeys"));
+	private static final ReflectMethod<?> keySet = wrapEx(() -> REFLECT.method("keySet"));
 	private static final ReflectMethod<?> entrySet = wrapEx(() -> REFLECT.method("entrySet"));
 	private static final ReflectMethod<?> size = wrapEx(() -> REFLECT.method("size"));
 	private static final ReflectMethod<?> contains = wrapEx(() -> REFLECT.method("contains", String.class));
-	private static final ReflectMethod<?> containsStringInt = wrapEx(() -> REFLECT.method("contains", String.class, int.class));
 
 	public CompoundTag() {
 		this(wrapReflectEx(() -> CONSTRUCTOR.instantiate()));
@@ -73,9 +66,6 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	public void putByteArray(String key, byte[] value) {
 		wrapReflectEx(() -> putByteArray.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putByteArray(String key, List<Byte> value) {
-		wrapReflectEx(() -> putByteArray_List.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putDouble(String key, double value) {
 		wrapReflectEx(() -> putDouble.invoke(__getRuntimeInstance(), key, value));
 	}
@@ -88,78 +78,79 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	public void putIntArray(String key, int[] value) {
 		wrapReflectEx(() -> putIntArray.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putIntArray(String key, List<Integer> value) {
-		wrapReflectEx(() -> putIntArray_List.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putString(String key, String value) {
 		wrapReflectEx(() -> putString.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putUUID(String key, UUID value) {
-		wrapReflectEx(() -> putUUID.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putLong(String key, long value) {
 		wrapReflectEx(() -> putLong.invoke(__getRuntimeInstance(), key, value));
 	}
 	public void putLongArray(String key, long[] value) {
 		wrapReflectEx(() -> putLongArray.invoke(__getRuntimeInstance(), key, value));
 	}
-	public void putLongArray(String key, List<Long> value) {
-		wrapReflectEx(() -> putLongArray_List.invoke(__getRuntimeInstance(), key, value));
-	}
 	public void putShort(String key, short value) {
 		wrapReflectEx(() -> putShort.invoke(__getRuntimeInstance(), key, value));
 	}
 	public void put(String key, Tag value) {
 		wrapReflectEx(() -> put.invoke(__getRuntimeInstance(), key, unwrap(value)));
 	}
-	public byte getTagType(String key) {
-		return (byte) wrapReflectEx(() -> getTagType.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Byte> getByte(String key) {
+		return (Optional<Byte>) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key));
 	}
-	public byte getByte(String key) {
-		return (byte) wrapReflectEx(() -> getByte.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Short> getShort(String key) {
+		return (Optional<Short>) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key));
 	}
-	public short getShort(String key) {
-		return (short) wrapReflectEx(() -> getShort.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Integer> getInt(String key) {
+		return (Optional<Integer>) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key));
 	}
-	public int getInt(String key) {
-		return (int) wrapReflectEx(() -> getInt.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Long> getLong(String key) {
+		return (Optional<Long>) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key));
 	}
-	public long getLong(String key) {
-		return (long) wrapReflectEx(() -> getLong.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Float> getFloat(String key) {
+		return (Optional<Float>) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key));
 	}
-	public float getFloat(String key) {
-		return (float) wrapReflectEx(() -> getFloat.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<Double> getDouble(String key) {
+		return (Optional<Double>) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key));
 	}
-	public double getDouble(String key) {
-		return (double) wrapReflectEx(() -> getDouble.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<String> getString(String key) {
+		return (Optional<String>) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key));
 	}
-	public String getString(String key) {
-		return (String) wrapReflectEx(() -> getString.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<byte[]> getByteArray(String key) {
+		return (Optional<byte[]>) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key));
 	}
-	public byte[] getByteArray(String key) {
-		return (byte[]) wrapReflectEx(() -> getByteArray.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<int[]> getIntArray(String key) {
+		return (Optional<int[]>) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key));
 	}
-	public int[] getIntArray(String key) {
-		return (int[]) wrapReflectEx(() -> getIntArray.invoke(__getRuntimeInstance(), key));
+	@SuppressWarnings("unchecked")
+	public Optional<long[]> getLongArray(String key) {
+		return (Optional<long[]>) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key));
 	}
-	public long[] getLongArray(String key) {
-		return (long[]) wrapReflectEx(() -> getLongArray.invoke(__getRuntimeInstance(), key));
+	public Optional<CompoundTag> getCompound(String key) {
+		return ((Optional<?>) wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)))
+				.map(u -> wrap(u, CompoundTag.class));
 	}
-	public CompoundTag getCompound(String key) {
-		return wrap(wrapReflectEx(() -> getCompound.invoke(__getRuntimeInstance(), key)), CompoundTag.class);
+	@SuppressWarnings("unchecked")
+	public Optional<Boolean> getBoolean(String key) {
+		return (Optional<Boolean>) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key));
 	}
-	public boolean getBoolean(String key) {
-		return (boolean) wrapReflectEx(() -> getBoolean.invoke(__getRuntimeInstance(), key));
-	}
-	public ListTag getList(String key, int type) {
-		return wrap(wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key, type)), ListTag.class);
+	public Optional<ListTag> getList(String key) {
+		return ((Optional<?>) wrapReflectEx(() -> getList.invoke(__getRuntimeInstance(), key)))
+				.map(u -> wrap(u, ListTag.class));
 	}
 	public Tag get(String key) {
 		return wrap(wrapReflectEx(() -> get.invoke(__getRuntimeInstance(), key)), Tag.class);
 	}
 	@SuppressWarnings("unchecked")
-	public Set<String> getAllKeys() {
-		return (Set<String>) wrapReflectEx(() -> getAllKeys.invoke(__getRuntimeInstance()));
+	public Set<String> keySet() {
+		return (Set<String>) wrapReflectEx(() -> keySet.invoke(__getRuntimeInstance()));
 	}
 
 	/**
@@ -176,8 +167,5 @@ public class CompoundTag extends ReflectWrapper implements Tag {
 	public boolean contains(String key) {
 		return (boolean) wrapReflectEx(() -> contains.invoke(__getRuntimeInstance(), key));
 	}
-	public boolean contains(String key, int type) {
-		return (boolean) wrapReflectEx(() -> containsStringInt.invoke(__getRuntimeInstance(), key, type));
-	}
 
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/nbt/Tag.java

@@ -8,20 +8,22 @@ import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
 
+import java.util.Optional;
+
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 @ConcreteWrapper(Tag.__concrete.class)
 public interface Tag extends ReflectWrapperI {
 	ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.nbt.Tag"));
-	ReflectMethod<?> getAsString = wrapEx(() -> REFLECT.method("getAsString"));
+	ReflectMethod<?> asString = wrapEx(() -> REFLECT.method("asString"));
 	ReflectField<?> TAG_LIST = wrapEx(() -> REFLECT.field("TAG_LIST"));
 	ReflectField<?> TAG_COMPOUND = wrapEx(() -> REFLECT.field("TAG_COMPOUND"));
-	ReflectField<?> TAG_ANY_NUMERIC = wrapEx(() -> REFLECT.field("TAG_ANY_NUMERIC"));
 
 	
-	default String getAsString() {
-		return wrapReflectEx(() -> (String) getAsString.invoke(__getRuntimeInstance()));
+	@SuppressWarnings("unchecked")
+	default Optional<String> asString() {
+		return wrapReflectEx(() -> (Optional<String>) asString.invoke(__getRuntimeInstance()));
 	}
 
 	static byte TAG_LIST() {
@@ -32,10 +34,6 @@ public interface Tag extends ReflectWrapperI {
 		return wrapReflectEx(() -> (byte) TAG_COMPOUND.getStaticValue());
 	}
 
-	static byte TAG_ANY_NUMERIC() {
-		return wrapReflectEx(() -> (byte) TAG_ANY_NUMERIC.getStaticValue());
-	}
-
 	
 	class __concrete extends ReflectWrapper implements Tag {
 		private __concrete(Object obj) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/util/ProblemReporter.java

@@ -0,0 +1,31 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.util;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectField;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
+
+import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+@ConcreteWrapper(ProblemReporter.__concrete.class)
+public interface ProblemReporter extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.util.ProblemReporter"));
+    ReflectField<?> DISCARDING = wrapEx(() -> REFLECT.field("DISCARDING"));
+
+    static ProblemReporter DISCARDING() {
+        return wrap(wrapReflectEx(DISCARDING::getStaticValue), ProblemReporter.class);
+    }
+
+
+
+
+    class __concrete extends ReflectWrapper implements ProblemReporter {
+        protected __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ChunkStorage.java

@@ -1,6 +1,7 @@
 package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.spottedleaf.moonrise.ChunkSystemChunkStorage;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -12,17 +13,13 @@ import java.util.concurrent.CompletableFuture;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
-public class ChunkStorage extends ReflectWrapper {
+public class ChunkStorage extends ReflectWrapper implements ChunkSystemChunkStorage {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.chunk.storage.ChunkStorage"));
-    private static final ReflectMethod<?> readSync = wrapEx(() -> REFLECT.method("readSync", ChunkPos.REFLECT.get())); // spigot/paper method
-
-    public CompoundTag readSync(ChunkPos pos) {
-        return wrap(wrapReflectEx(() -> readSync.invoke(__getRuntimeInstance(), unwrap(pos))), CompoundTag.class);
-    }
+    private static final ReflectMethod<?> read = wrapEx(() -> REFLECT.method("read", ChunkPos.REFLECT.get())); // spigot/paper method
 
     public CompletableFuture<Optional<CompoundTag>> read(ChunkPos pos) {
         @SuppressWarnings("unchecked")
-        CompletableFuture<Optional<?>> nmsFuture = (CompletableFuture<Optional<?>>) wrapReflectEx(() -> readSync.invoke(__getRuntimeInstance(), unwrap(pos)));
+        CompletableFuture<Optional<?>> nmsFuture = ((CompletableFuture<Optional<?>>) wrapReflectEx(() -> read.invoke(__getRuntimeInstance(), unwrap(pos))));
         return nmsFuture.thenApply(o -> o.map(c -> wrap(c, CompoundTag.class)));
     }
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/DataVersion.java

@@ -1,32 +0,0 @@
-package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
-
-import fr.pandacube.lib.reflect.Reflect;
-import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.ReflectMethod;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-
-import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
-
-public class DataVersion extends ReflectWrapper {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.DataVersion"));
-    private static final ReflectMethod<?> getVersion = wrapEx(() -> REFLECT.method("getVersion"));
-    private static final ReflectMethod<?> getSeries = wrapEx(() -> REFLECT.method("getSeries"));
-
-
-
-    public int getVersion() {
-        return (int) wrapReflectEx(() -> getVersion.invoke(__getRuntimeInstance()));
-    }
-
-    public String getSeries() {
-        return (String) wrapReflectEx(() -> getSeries.invoke(__getRuntimeInstance()));
-    }
-
-
-
-
-    protected DataVersion(Object obj) {
-        super(obj);
-    }
-}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/Entity.java

@@ -1,6 +1,5 @@
 package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -12,16 +11,11 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class Entity extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.entity.Entity"));
     public static final ReflectMethod<?> getBukkitEntity = wrapEx(() -> REFLECT.method("getBukkitEntity")); // spigot method
-    public static final ReflectMethod<?> serializeEntity = wrapEx(() -> REFLECT.method("serializeEntity", CompoundTag.REFLECT.get())); // paper method
 
     public org.bukkit.entity.Entity getBukkitEntity() {
         return (org.bukkit.entity.Entity) wrapReflectEx(() -> getBukkitEntity.invoke(__getRuntimeInstance()));
     }
 
-    public boolean serializeEntity(CompoundTag nbt) {
-        return wrapReflectEx(() -> (Boolean) serializeEntity.invoke(__getRuntimeInstance(), unwrap(nbt)));
-    }
-
     protected Entity(Object obj) {
         super(obj);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ItemStack.java

@@ -1,63 +1,15 @@
 package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
-import fr.pandacube.lib.paper.reflect.wrapper.craftbukkit.CraftServer;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.HolderLookupProvider;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.core.RegistryAccess;
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.Tag;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.ReflectMethod;
 import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-import org.bukkit.Bukkit;
-
-import java.util.Optional;
 
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class ItemStack extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.item.ItemStack"));
-    private static final ReflectMethod<?> parse = wrapEx(() -> REFLECT.method("parse", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
-    private static final ReflectMethod<?> saveWithPrefix = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get(), Tag.REFLECT.get()));
-    private static final ReflectMethod<?> save = wrapEx(() -> REFLECT.method("save", HolderLookupProvider.REFLECT.get()));
-
-    @SuppressWarnings("unchecked")
-    public static Optional<ItemStack> parse(HolderLookupProvider registries, Tag nbt) {
-        return ((Optional<Object>) wrapReflectEx(() -> parse.invokeStatic(unwrap(registries), unwrap(nbt))))
-                .map(o -> wrap(o, ItemStack.class));
-    }
-
-    
-    public static Optional<ItemStack> parse(Tag nbt) {
-        return parse(getRegistries(), nbt);
-    }
-
 
     protected ItemStack(Object obj) {
         super(obj);
     }
-
-
-    public Tag save(HolderLookupProvider registries, Tag prefix) {
-        return wrap(wrapReflectEx(() -> saveWithPrefix.invoke(__getRuntimeInstance(), unwrap(registries), unwrap(prefix))), Tag.class);
-    }
-
-
-    public Tag save(HolderLookupProvider registries) {
-        return wrap(wrapReflectEx(() -> save.invoke(__getRuntimeInstance(), unwrap(registries))), Tag.class);
-    }
-
-
-    public Tag save(Tag prefix) {
-        return save(getRegistries(), prefix);
-    }
-
-
-    public Tag save() {
-        return save(getRegistries());
-    }
-
-    private static RegistryAccess getRegistries() {
-        return wrap(Bukkit.getServer(), CraftServer.class).getServer().registryAccess();
-    }
 }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ItemStackWithSlot.java

@@ -0,0 +1,44 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import com.mojang.serialization.Codec;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectConstructor;
+import fr.pandacube.lib.reflect.ReflectField;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class ItemStackWithSlot extends ReflectWrapper {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.ItemStackWithSlot"));
+    private static final ReflectConstructor<?> CONSTRUCTOR = wrapEx(() -> REFLECT.constructor(int.class, ItemStack.REFLECT.get()));
+    private static final ReflectField<?> CODEC = wrapEx(() -> REFLECT.field("CODEC"));
+    private static final ReflectMethod<?> slot = wrapEx(() -> REFLECT.method("slot"));
+    private static final ReflectMethod<?> stack = wrapEx(() -> REFLECT.method("stack"));
+
+    public static Codec<?> CODEC() {
+        return (Codec<?>) wrapReflectEx(CODEC::getStaticValue);
+    }
+
+
+
+    protected ItemStackWithSlot(Object obj) {
+        super(obj);
+    }
+
+    public ItemStackWithSlot(int slot, ItemStack stack) {
+        super(wrapReflectEx(() -> CONSTRUCTOR.instantiate(slot, unwrap(stack))));
+    }
+
+
+    public int slot() {
+        return (int) wrapReflectEx(() -> slot.invoke(__getRuntimeInstance()));
+    }
+
+    public ItemStack stack() {
+        return wrap(wrapReflectEx(() -> stack.invoke(__getRuntimeInstance())), ItemStack.class);
+    }
+
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/Level.java

@@ -12,17 +12,12 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 public class Level extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.Level"));
     public static final ReflectMethod<?> getGameTime = wrapEx(() -> REFLECT.method("getGameTime"));
-    public static final ReflectMethod<?> getFreeMapId = wrapEx(() -> REFLECT.method("getFreeMapId"));
     public static final ReflectMethod<?> paperConfig = wrapEx(() -> REFLECT.method("paperConfig")); // paper method
 
     public long getGameTime() {
         return (long) wrapReflectEx(() -> getGameTime.invoke(__getRuntimeInstance()));
     }
 
-    public int getFreeMapId() {
-        return (int) wrapReflectEx(() -> getFreeMapId.invoke(__getRuntimeInstance()));
-    }
-
     public WorldConfiguration paperConfig() {
         return wrap(wrapReflectEx(() -> paperConfig.invoke(__getRuntimeInstance())), WorldConfiguration.class);
     }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/PlayerDataStorage.java

@@ -1,6 +1,7 @@
 package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
 import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -13,15 +14,15 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class PlayerDataStorage extends ReflectWrapper {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.PlayerDataStorage"));
-    public static final ReflectMethod<?> load = wrapEx(() -> REFLECT.method("load", String.class, String.class));
+    public static final ReflectMethod<?> load = wrapEx(() -> REFLECT.method("load", String.class, String.class, ProblemReporter.REFLECT.get()));
 
     /**
      * @param playerName the name of the player: used for loading error message and for offline UUID generation.
      * @param playerId UUID of a player as it is used to name the player data file (UUID.toString()).
      */
     @SuppressWarnings("unchecked")
-    public Optional<CompoundTag> load(String playerName, String playerId) {
-        return wrapOptional((Optional<Object>) wrapReflectEx(() -> load.invoke(__getRuntimeInstance(), playerName, playerId)), CompoundTag.class);
+    public Optional<CompoundTag> load(String playerName, String playerId, ProblemReporter problemReporter) {
+        return wrapOptional((Optional<Object>) wrapReflectEx(() -> load.invoke(__getRuntimeInstance(), playerName, playerId, unwrap(problemReporter))), CompoundTag.class);
     }
 
 

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/RegionFileStorage.java

@@ -0,0 +1,23 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class RegionFileStorage extends ReflectWrapper {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.chunk.storage.RegionFileStorage"));
+    private static final ReflectMethod<?> read = wrapEx(() -> REFLECT.method("read", ChunkPos.REFLECT.get())); // spigot/paper method
+
+    public CompoundTag read(ChunkPos pos) {
+        return wrap(wrapReflectEx(() -> read.invoke(__getRuntimeInstance(), unwrap(pos))), CompoundTag.class);
+    }
+
+    protected RegionFileStorage(Object obj) {
+        super(obj);
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/TagValueInput.java

@@ -0,0 +1,25 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class TagValueInput extends ReflectWrapper implements ValueInput {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.TagValueInput"));
+    private static final ReflectMethod<?> createGlobal = wrapEx(() -> REFLECT.method("createGlobal", ProblemReporter.REFLECT.get(), CompoundTag.REFLECT.get()));
+
+    public static ValueInput createGlobal(ProblemReporter problemReporter, CompoundTag nbt) {
+        return wrap(wrapReflectEx(() -> createGlobal.invokeStatic(unwrap(problemReporter), unwrap(nbt))), ValueInput.class);
+    }
+
+    protected TagValueInput(Object obj) {
+        super(obj);
+    }
+
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/TagValueOutput.java

@@ -0,0 +1,25 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.nbt.CompoundTag;
+import fr.pandacube.lib.paper.reflect.wrapper.minecraft.util.ProblemReporter;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class TagValueOutput extends ReflectWrapper implements ValueOutput {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.TagValueOutput"));
+    private static final ReflectMethod<?> createWrappingGlobal = wrapEx(() -> REFLECT.method("createWrappingGlobal", ProblemReporter.REFLECT.get(), CompoundTag.REFLECT.get()));
+
+    public static TagValueOutput createWrappingGlobal(ProblemReporter problemReporter, CompoundTag nbt) {
+        return wrap(wrapReflectEx(() -> createWrappingGlobal.invokeStatic(unwrap(problemReporter), unwrap(nbt))), TagValueOutput.class);
+    }
+
+    protected TagValueOutput(Object obj) {
+        super(obj);
+    }
+
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueInput.java

@@ -0,0 +1,31 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import com.mojang.serialization.Codec;
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
+
+import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+@ConcreteWrapper(ValueInput.__concrete.class)
+public interface ValueInput extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueInput"));
+    ReflectMethod<?> listOrEmpty = wrapEx(() -> REFLECT.method("listOrEmpty", String.class, Codec.class));
+
+
+
+    default ValueInputTypedInputList listOrEmpty(String key, Codec<?> elementCodec) {
+        return wrap(wrapReflectEx(() -> listOrEmpty.invoke(__getRuntimeInstance(), key, elementCodec)), ValueInputTypedInputList.class);
+    }
+
+    class __concrete extends ReflectWrapper implements ValueInput {
+        private __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueInputTypedInputList.java

@@ -0,0 +1,21 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTyped;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperTypedI;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+
+@ConcreteWrapper(ValueInputTypedInputList.__concrete.class)
+public interface ValueInputTypedInputList extends ReflectWrapperTypedI<Iterable<?>> {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueInput$TypedInputList"));
+
+
+    class __concrete extends ReflectWrapperTyped<Iterable<?>> implements ValueInputTypedInputList {
+        private __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueOutput.java

@@ -1,6 +1,6 @@
-package fr.pandacube.lib.paper.reflect.wrapper.minecraft;
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
 
-import fr.pandacube.lib.paper.reflect.wrapper.minecraft.world.DataVersion;
+import com.mojang.serialization.Codec;
 import fr.pandacube.lib.reflect.Reflect;
 import fr.pandacube.lib.reflect.ReflectClass;
 import fr.pandacube.lib.reflect.ReflectMethod;
@@ -12,18 +12,18 @@ import static fr.pandacube.lib.reflect.wrapper.ReflectWrapper.wrap;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
 import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
-@ConcreteWrapper(WorldVersion.__concrete.class)
-public interface WorldVersion extends ReflectWrapperI {
-    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.WorldVersion"));
-    ReflectMethod<?> getDataVersion = wrapEx(() -> REFLECT.method("getDataVersion"));
+@ConcreteWrapper(ValueOutput.__concrete.class)
+public interface ValueOutput extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueOutput"));
+    ReflectMethod<?> list = wrapEx(() -> REFLECT.method("list", String.class, Codec.class));
 
-    default DataVersion getDataVersion() {
-        return wrap(wrapReflectEx(() -> getDataVersion.invoke(__getRuntimeInstance())), DataVersion.class);
+
+
+    default ValueOutputTypedOutputList list(String key, Codec<?> elementCodec) {
+        return wrap(wrapReflectEx(() -> list.invoke(__getRuntimeInstance(), key, elementCodec)), ValueOutputTypedOutputList.class);
     }
 
-
-
-    class __concrete extends ReflectWrapper implements WorldVersion {
+    class __concrete extends ReflectWrapper implements ValueOutput {
         private __concrete(Object obj) {
             super(obj);
         }

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/ValueOutputTypedOutputList.java

@@ -0,0 +1,28 @@
+package fr.pandacube.lib.paper.reflect.wrapper.minecraft.world;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ConcreteWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapperI;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+@ConcreteWrapper(ValueOutputTypedOutputList.__concrete.class)
+public interface ValueOutputTypedOutputList extends ReflectWrapperI {
+    ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.storage.ValueOutput$TypedOutputList"));
+    ReflectMethod<?> add = wrapEx(() -> REFLECT.method("add", Object.class));
+
+    default void add(Object rawElement) {
+        wrapReflectEx(() -> add.invoke(__getRuntimeInstance(), rawElement));
+    }
+
+
+    class __concrete extends ReflectWrapper implements ValueOutputTypedOutputList {
+        private __concrete(Object obj) {
+            super(obj);
+        }
+    }
+}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/minecraft/world/block/BambooStalkBlock.java

@@ -10,14 +10,14 @@ import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
 
 public class BambooStalkBlock extends Block {
     public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("net.minecraft.world.level.block.BambooStalkBlock"));
-    public static final ReflectField<?> COLLISION_SHAPE = wrapEx(() -> REFLECT.field("COLLISION_SHAPE"));
+    public static final ReflectField<?> SHAPE_COLLISION = wrapEx(() -> REFLECT.field("SHAPE_COLLISION"));
 
-    public static VoxelShape COLLISION_SHAPE() {
-        return wrap(wrapReflectEx(COLLISION_SHAPE::getStaticValue), VoxelShape.class);
+    public static VoxelShape SHAPE_COLLISION() {
+        return wrap(wrapReflectEx(SHAPE_COLLISION::getStaticValue), VoxelShape.class);
     }
 
-    public static void COLLISION_SHAPE(VoxelShape shape) {
-        wrapReflectEx(() -> COLLISION_SHAPE.setStaticValue(unwrap(shape)));
+    public static void SHAPE_COLLISION(VoxelShape shape) {
+        wrapReflectEx(() -> SHAPE_COLLISION.setStaticValue(unwrap(shape)));
     }
 
     protected BambooStalkBlock(Object obj) {

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/paper/QueuedChangesMapLong2Object.java

@@ -1,25 +0,0 @@
-package fr.pandacube.lib.paper.reflect.wrapper.paper;
-
-import fr.pandacube.lib.reflect.Reflect;
-import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
-import fr.pandacube.lib.reflect.ReflectClass;
-import fr.pandacube.lib.reflect.ReflectMethod;
-
-import it.unimi.dsi.fastutil.longs.Long2ObjectLinkedOpenHashMap;
-
-import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
-import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
-
-public class QueuedChangesMapLong2Object extends ReflectWrapper {
-    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("com.destroystokyo.paper.util.map.QueuedChangesMapLong2Object"));
-    public static final ReflectMethod<?> getVisibleMap = wrapEx(() -> REFLECT.method("getVisibleMap"));
-
-    /** The entries in the returned value are not mapped */
-    public Long2ObjectLinkedOpenHashMap<?> getVisibleMap() {
-        return (Long2ObjectLinkedOpenHashMap<?>) wrapReflectEx(() -> getVisibleMap.invoke(__getRuntimeInstance()));
-    }
-
-    protected QueuedChangesMapLong2Object(Object obj) {
-        super(obj);
-    }
-}

pandalib-paper/src/main/java/fr/pandacube/lib/paper/reflect/wrapper/paper/commands/APICommandMeta.java

@@ -0,0 +1,39 @@
+package fr.pandacube.lib.paper.reflect.wrapper.paper.commands;
+
+import fr.pandacube.lib.reflect.Reflect;
+import fr.pandacube.lib.reflect.ReflectClass;
+import fr.pandacube.lib.reflect.ReflectMethod;
+import fr.pandacube.lib.reflect.wrapper.ReflectWrapper;
+import org.bukkit.plugin.Plugin;
+
+import java.util.List;
+
+import static fr.pandacube.lib.util.ThrowableUtil.wrapEx;
+import static fr.pandacube.lib.util.ThrowableUtil.wrapReflectEx;
+
+public class APICommandMeta extends ReflectWrapper {
+    public static final ReflectClass<?> REFLECT = wrapEx(() -> Reflect.ofClass("io.papermc.paper.command.brigadier.APICommandMeta"));
+    private static final ReflectMethod<?> plugin = wrapEx(() -> REFLECT.method("plugin"));
+    private static final ReflectMethod<?> description = wrapEx(() -> REFLECT.method("description"));
+    private static final ReflectMethod<?> aliases = wrapEx(() -> REFLECT.method("aliases"));
+
+
+    public Plugin plugin() {
+        return (Plugin) wrapReflectEx(() -> plugin.invoke(__getRuntimeInstance()));
+    }
+
+    public String description() {
+        return (String) wrapReflectEx(() -> description.invoke(__getRuntimeInstance()));
+    }
+
+    @SuppressWarnings("unchecked")
+    public List<String> aliases() {
+        return (List<String>) wrapReflectEx(() -> aliases.invoke(__getRuntimeInstance()));
+    }
+
+
+
+    protected APICommandMeta(Object obj) {
+        super(obj);
+    }
+}